{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2b9facf7-80c5-48fe-bcdd-9d2c3bb4ad2e",
          "code": "484-33-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=484-33-3",
          "code_system": "CAS",
          "references": [
            "4597a7ef-d773-4514-974b-eb6f98e43cae",
            "4fb06337-ef87-41e0-aff5-99d510e6ab7c"
          ]
        },
        {
          "uuid": "e61b2c70-512c-4e45-9db6-8725ef4f4d16",
          "code": "C533419",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67533419",
          "code_system": "MESH",
          "references": [
            "4597a7ef-d773-4514-974b-eb6f98e43cae"
          ]
        },
        {
          "uuid": "d4cc7754-20fb-4840-b2af-86a24a236203",
          "code": "1426400",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426400/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4597a7ef-d773-4514-974b-eb6f98e43cae"
          ]
        },
        {
          "uuid": "31943773-e0e8-40e9-bbc2-462883b9e2ea",
          "code": "689051",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/689051",
          "code_system": "PUBCHEM",
          "references": [
            "4597a7ef-d773-4514-974b-eb6f98e43cae"
          ]
        },
        {
          "uuid": "a4722933-a659-96c3-d886-ffc3898245c3",
          "code": "DTXSID50351019",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50351019",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "1b3de3dc-1305-4492-94d0-898cb619da6e",
          "code": "8Y19QCY6I4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8477fdac-2eb5-1aa3-f6fa-d04dda23f8ed",
          "code": "8Y19QCY6I4",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8Y19QCY6I4",
          "code_system": "DAILYMED",
          "references": [
            "c5229509-4789-4fc6-2843-7b8d2eaabbf3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2719eed0-5cb1-4690-80f0-e76488863ec7",
          "name": "1,3-PROPANEDIONE, 1-(4-METHOXY-5-BENZOFURANYL)-3-PHENYL-",
          "stdName": "1,3-PROPANEDIONE, 1-(4-METHOXY-5-BENZOFURANYL)-3-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2254e36a-882f-49c9-9b87-ff713788be2e",
            "f0a69bab-3b3b-4289-90ae-1bd81e7b554a"
          ],
          "display_name": false
        },
        {
          "uuid": "14a3cb88-06a1-4488-b519-bc2cd39b8e4e",
          "name": "LANCEOLATIN C",
          "stdName": "LANCEOLATIN C",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2254e36a-882f-49c9-9b87-ff713788be2e",
            "f0a69bab-3b3b-4289-90ae-1bd81e7b554a"
          ],
          "display_name": false
        },
        {
          "uuid": "1e5cc678-5b3d-48d2-9c3d-cf2d344dc1b1",
          "name": "PONGAMOL",
          "stdName": "PONGAMOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee16f72e-c2e1-4fdc-bfcd-2cc97ac773fd",
            "024dc9d1-33cb-4d71-ad9c-3bd42a219162",
            "f0a69bab-3b3b-4289-90ae-1bd81e7b554a",
            "ecb04cd2-51ce-445b-8a3f-36d80371bb84"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "637a76d3-1224-4609-8046-c6bda3fc905e",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "ecb04cd2-51ce-445b-8a3f-36d80371bb84",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ee16f72e-c2e1-4fdc-bfcd-2cc97ac773fd",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0a69bab-3b3b-4289-90ae-1bd81e7b554a",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2254e36a-882f-49c9-9b87-ff713788be2e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4597a7ef-d773-4514-974b-eb6f98e43cae",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390948000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69ac22cc-15f9-4d44-8a6d-f27fc9b446ac",
          "citation": "SRS import [8Y19QCY6I4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8Y19QCY6I4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390948000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98e608e5-7900-446c-892a-3fd33b4b7750",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "024dc9d1-33cb-4d71-ad9c-3bd42a219162",
          "citation": "PONGAMOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4fb06337-ef87-41e0-aff5-99d510e6ab7c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c5229509-4789-4fc6-2843-7b8d2eaabbf3",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "47f1ab49-7cf6-47e3-90b4-4982fe2179f4",
          "id": "47f1ab49-7cf6-47e3-90b4-4982fe2179f4",
          "molfile": "\n  Marvin  01132103462D          \n\n 22 24  0  0  0  0            999 V2000\n    6.3070   -0.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5322   -1.4171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5322   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8174   -2.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8174   -3.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5322   -3.8899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2470   -3.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0301   -3.7308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5095   -3.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0301   -2.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2470   -2.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1026   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1026   -1.4182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3878   -2.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6730   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6730   -1.4182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9629   -2.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2481   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5333   -2.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5333   -3.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2481   -3.8899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9629   -3.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n 11  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n 12  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 11  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 22  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "COc1c(ccc2c1cco2)C(=O)CC(=O)c3ccccc3",
          "formula": "C18H14O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "18d34dba-489a-4629-a797-6c50a62ff288"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "294.302",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f5a892c9-c2a7-4385-823c-cead5cd00a99",
      "version": "5",
      "structure": {
        "id": "6bee06de-0807-4bc7-91b9-bd6790d785c7",
        "molfile": "\n  Marvin  01132105362D          \n\n 22 24  0  0  0  0            999 V2000\n    2.6730   -1.4182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6730   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3878   -2.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1026   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1026   -1.4182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8174   -2.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8174   -3.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5322   -3.8899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2470   -3.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0301   -3.7308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5095   -3.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0301   -2.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2470   -2.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5322   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5322   -1.4171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3070   -0.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9629   -2.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2481   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5333   -2.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5333   -3.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2481   -3.8899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9629   -3.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n  9 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n  6 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  2 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 17 22  1  0  0  0  0\nM  END",
        "smiles": "COc1c(ccc2c1cco2)C(=O)CC(=O)c3ccccc3",
        "formula": "C18H14O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "294.302",
        "optical_activity": "NONE",
        "references": [
          "98e608e5-7900-446c-892a-3fd33b4b7750",
          "69ac22cc-15f9-4d44-8a6d-f27fc9b446ac"
        ],
        "stereo_centers": 0
      },
      "unii": "8Y19QCY6I4"
    }
  ]
}