{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a0f095e2-1cb7-4555-91ea-c7c29777b439", "code": "84-26-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=84-26-4", "code_system": "CAS", "references": [ "6edafe8c-1c5a-4c25-bca6-2b54f78e2a50", "bdc2f821-7b8b-44bc-be21-c2bdce0cdbf0" ] }, { "uuid": "095ccc99-2c07-4ad8-bbc9-e1f64fc4325a", "code": "C028632", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67028632", "code_system": "MESH", "references": [ "6edafe8c-1c5a-4c25-bca6-2b54f78e2a50" ] }, { "uuid": "bd083457-efd7-4e6f-ab94-8b7e7b06f0da", "code": "m9702", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m9702?q=authorize", "code_system": "MERCK INDEX", "references": [ "6edafe8c-1c5a-4c25-bca6-2b54f78e2a50" ] }, { "uuid": "9394eebe-57a8-408d-b5bf-c153415052a7", "code": "65752", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/65752", "code_system": "PUBCHEM", "references": [ "6edafe8c-1c5a-4c25-bca6-2b54f78e2a50" ] }, { "uuid": "98325cfd-875d-6971-5349-1d6be10d307c", "code": "DTXSID00232884", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00232884", "code_system": "EPA CompTox", "references": [ "2f1e3382-4915-fb1f-051b-cca91cb1adb3" ] }, { "uuid": "c4885dd3-420a-4930-91b7-4c5fdcdc03a8", "code": "8XZV289PRY", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "56c587a4-8fba-d108-9993-c127ab08671a", "code": "1394 (Number of products:104)", "comments": "Dietary Supplement Label Database|Botanical|Flavonoid", "type": "PRIMARY", "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1394&item=Flavonoid", "code_system": "DSLD", "references": [ "13a3b565-019c-7d81-f1a8-a421f888f3b8" ] }, { "uuid": "824f877c-75ee-53fd-d0f2-cda00e8b36d5", "code": "Rutecarpine", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Rutecarpine", "code_system": "WIKIPEDIA", "references": [ "713101d9-29f7-e814-34ad-d156bd0e844b" ] }, { "uuid": "ec9c16f3-0336-c679-5948-8c2ff4f25375", "code": "258317", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=258317", "code_system": "NSC", "references": [ "809d522f-d2e2-1108-f3f0-c9b327afd5d5" ] } ], "substance_class": "chemical", "names": [ { "uuid": "0ddaf3a8-088b-43c4-aca4-987d3044b86e", "name": "8,13-DIHYDROINDOLO(2',3':3,4)PYRIDO(2,1-B)QUINAZOLIN-5(7H)-ONE", "stdName": "8,13-DIHYDROINDOLO(2',3':3,4)PYRIDO(2,1-B)QUINAZOLIN-5(7H)-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "96811364-7482-46c6-aae7-7b88acb03047", "de0c0341-2905-43d2-a221-2f692a3c0766" ], "display_name": false }, { "uuid": "f1bde282-5ea6-4710-8c2b-91be02d9c796", "name": "NSC-258317", "stdName": "NSC-258317", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "6f0f485a-b510-4323-90e9-1ad37a49f8a7", "de0c0341-2905-43d2-a221-2f692a3c0766" ], "display_name": false }, { "uuid": "8969cb6c-68df-f362-f311-e782bcc71821", "name": "RUTAECARPINE", "stdName": "RUTAECARPINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a8d9b95b-aded-dc3a-6b57-b4c40d5a7bc9" ], "display_name": false }, { "uuid": "81f13d4b-30ed-41f8-8198-e533ccc68583", "name": "RUTECARPINE", "stdName": "RUTECARPINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6c31aa8a-ed26-4dcb-8a21-a374ac51d751", "d5d2eede-5ab6-4767-909e-b6b9b56412ed", "35122787-188e-4dd1-8f30-0171368520a2", "40a5f6c7-4e77-44fa-87e3-28b1f3447623", "de0c0341-2905-43d2-a221-2f692a3c0766" ], "display_name": true }, { "uuid": "a9f5474d-30ee-460e-8a12-c6715b50b4cc", "name": "RUTECARPINE [MI]", "stdName": "RUTECARPINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6c31aa8a-ed26-4dcb-8a21-a374ac51d751", "de0c0341-2905-43d2-a221-2f692a3c0766" ], "display_name": false } ], "references": [ { "uuid": "35122787-188e-4dd1-8f30-0171368520a2", "citation": "CHEMID 2011 Drugportal", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d5d2eede-5ab6-4767-909e-b6b9b56412ed", "citation": "DRUGPORTAL 2011", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6c31aa8a-ed26-4dcb-8a21-a374ac51d751", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "de0c0341-2905-43d2-a221-2f692a3c0766", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "96811364-7482-46c6-aae7-7b88acb03047", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6f0f485a-b510-4323-90e9-1ad37a49f8a7", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6edafe8c-1c5a-4c25-bca6-2b54f78e2a50", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391214000, "tags": [ "NOMEN" ] }, { "uuid": "7bf5c3b8-0ae2-4db1-a080-7a8d66cfa018", "citation": "SRS import [8XZV289PRY]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8XZV289PRY", "doc_type": "SRS", "public_domain": true, "document_date": 1493391214000, "tags": [ "NOMEN" ] }, { "uuid": "662eeb11-5d32-4089-9881-8595f25dddf0", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "40a5f6c7-4e77-44fa-87e3-28b1f3447623", "citation": "RUTECARPINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2f1e3382-4915-fb1f-051b-cca91cb1adb3", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=84-26-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "713101d9-29f7-e814-34ad-d156bd0e844b", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "13a3b565-019c-7d81-f1a8-a421f888f3b8", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "a8d9b95b-aded-dc3a-6b57-b4c40d5a7bc9", "citation": "https://dsld.od.nih.gov/dsld/index.jsp", "url": "https://dsld.od.nih.gov/dsld/index.jsp", "doc_type": "WEB PAGE", "public_domain": true }, { "uuid": "bdc2f821-7b8b-44bc-be21-c2bdce0cdbf0", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "809d522f-d2e2-1108-f3f0-c9b327afd5d5", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3da95de0-a679-4d30-ab89-be39d22dfe4c", "id": "3da95de0-a679-4d30-ab89-be39d22dfe4c", "molfile": "\n Marvin 01132103162D \n\n 22 26 0 0 0 0 999 V2000\n 6.5246 -4.0291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8063 -4.4366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0953 -4.0221 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0988 -3.1949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3835 -2.7759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6693 -3.1888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6658 -4.0161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9487 -4.4295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2352 -4.0161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5221 -4.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8064 -4.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8076 -3.1906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5202 -2.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2363 -3.1868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3769 -4.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3696 -5.2490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0813 -5.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0734 -6.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7806 -6.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4974 -6.4959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5018 -5.6775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7972 -5.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 22 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 15 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 14 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 15 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 14 9 2 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 22 17 2 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)c3CCn4c(-c3[nH]2)nc5ccccc5c4=O", "formula": "C18H13N3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "25731d7f-8cc2-4e45-a9fe-792bd614a421" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "287.316", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "f246bdd4-24be-472c-99b6-7e18a300cfde", "version": "7", "structure": { "id": "41c80bbe-358b-4ae5-a301-548b375f50f0", "molfile": "\n Marvin 01132103282D \n\n 22 26 0 0 0 0 999 V2000\n 0.8076 -3.1906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8064 -4.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5221 -4.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5202 -2.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2363 -3.1868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2352 -4.0161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9487 -4.4295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6693 -3.1888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6658 -4.0161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0988 -3.1949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3835 -2.7759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0953 -4.0221 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3769 -4.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3696 -5.2490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8063 -4.4366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7972 -5.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0813 -5.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0734 -6.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7806 -6.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4974 -6.4959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5018 -5.6775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5246 -4.0291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9 13 1 0 0 0 0\n 12 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 12 15 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 17 1 0 0 0 0\n 16 15 1 0 0 0 0\n 7 9 1 0 0 0 0\n 8 9 2 0 0 0 0\n 16 17 2 0 0 0 0\n 1 2 2 0 0 0 0\n 17 18 1 0 0 0 0\n 5 4 2 0 0 0 0\n 18 19 2 0 0 0 0\n 4 1 1 0 0 0 0\n 19 20 1 0 0 0 0\n 5 6 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 16 1 0 0 0 0\n 5 8 1 0 0 0 0\n 8 11 1 0 0 0 0\n 15 22 2 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)c3CCn4c(-c3[nH]2)nc5ccccc5c4=O", "formula": "C18H13N3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "287.316", "optical_activity": "NONE", "references": [ "662eeb11-5d32-4089-9881-8595f25dddf0", "7bf5c3b8-0ae2-4db1-a080-7a8d66cfa018" ], "stereo_centers": 0 }, "unii": "8XZV289PRY" } ] }