{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ba56ab76-1cd2-4953-af93-92985d57bf2a",
          "code": "128-66-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=128-66-5",
          "code_system": "CAS",
          "references": [
            "98231d65-e9e1-455f-8e82-330c8d581cdf",
            "814e6f34-c6fc-411f-8412-25cfdcca8b39"
          ]
        },
        {
          "uuid": "f4429237-bb3e-4224-8b52-b01c75d5b965",
          "code": "31412",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/31412",
          "code_system": "PUBCHEM",
          "references": [
            "98231d65-e9e1-455f-8e82-330c8d581cdf"
          ]
        },
        {
          "uuid": "d10cc3ec-1f27-40f2-9ce4-a004bdc4779a",
          "code": "204-903-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.459",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "98231d65-e9e1-455f-8e82-330c8d581cdf"
          ]
        },
        {
          "uuid": "72e168f7-7616-7fc7-e1fa-ddc9ff3734b7",
          "code": "4090",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4090",
          "code_system": "HSDB",
          "references": [
            "aeccf224-91f2-745a-470b-732fa419a24b"
          ]
        },
        {
          "uuid": "77489784-e8bd-a815-c421-74f8bab9e3cf",
          "code": "DTXSID6021454",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6021454",
          "code_system": "EPA CompTox",
          "references": [
            "43d2c2b7-f58a-cb4e-8d1b-3ff3bc7f19e1"
          ]
        },
        {
          "uuid": "414dd439-a178-e187-efac-be9842a91844",
          "code": "Dibenzpyrenequinone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dibenzpyrenequinone",
          "code_system": "WIKIPEDIA",
          "references": [
            "691d148b-04a5-09da-814a-fe55ee21b57c"
          ]
        },
        {
          "uuid": "e6d90095-d587-4856-a46b-c30e074054fc",
          "code": "8XO6A4G496",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0d6ad767-37f6-25ef-6468-b58bfce40961",
          "code": "2621121",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2621121/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "21d13940-8239-8f7c-5d54-ffcd15550498"
          ]
        },
        {
          "uuid": "38766085-5229-6a38-1590-7816ef1e1ce4",
          "code": "30987",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=30987",
          "code_system": "NSC",
          "references": [
            "c884fddd-f40c-3904-f29f-d16952510fe7"
          ]
        },
        {
          "uuid": "a7e18277-4ea3-44f0-9e15-a43434d20a93",
          "code": "8XO6A4G496",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(8XO6A4G496)",
          "code_system": "DAILYMED",
          "references": [
            "38b2610f-a0fd-0be4-c31c-5eeece053aae"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "39a4daf7-7fd7-4138-b08f-35057b2aa3a6",
          "name": "1,2,6,7-DIBENPYRENE-7,14-QUINONE",
          "stdName": "1,2,6,7-DIBENPYRENE-7,14-QUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66a6325f-356d-4ce6-89a7-4cc46915ee39",
            "1957c58a-154c-404e-9e4c-b4a1564fdf7b"
          ],
          "display_name": false
        },
        {
          "uuid": "f37f28ec-9588-4a30-b97b-66dd8158889a",
          "name": "2,3,7,8-DIBENZPYRENE-1,6-QUINONE",
          "stdName": "2,3,7,8-DIBENZPYRENE-1,6-QUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66a6325f-356d-4ce6-89a7-4cc46915ee39",
            "5b21a997-0d32-4e6c-a2f8-0f222ee2aff5"
          ],
          "display_name": false
        },
        {
          "uuid": "8fcf4e08-f781-49d0-bcf0-8bb790f8d03f",
          "name": "3,4:8,9-DIBENZOPYRENE-5,10-DIONE",
          "stdName": "3,4:8,9-DIBENZOPYRENE-5,10-DIONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66a6325f-356d-4ce6-89a7-4cc46915ee39",
            "5b21a997-0d32-4e6c-a2f8-0f222ee2aff5"
          ],
          "display_name": false
        },
        {
          "uuid": "39624a02-0ac8-4532-bef5-cc10010bbe3c",
          "name": "AHCOVAT PRINTING GOLDEN YELLOW GK",
          "stdName": "AHCOVAT PRINTING GOLDEN YELLOW GK",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66a6325f-356d-4ce6-89a7-4cc46915ee39",
            "5b21a997-0d32-4e6c-a2f8-0f222ee2aff5"
          ],
          "display_name": false
        },
        {
          "uuid": "1553b8a4-1d52-4baa-ae2a-b607263a62a2",
          "name": "C.I. SOLUBILISED VAT YELLOW 4",
          "stdName": "C.I. SOLUBILISED VAT YELLOW 4",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66a6325f-356d-4ce6-89a7-4cc46915ee39",
            "5b21a997-0d32-4e6c-a2f8-0f222ee2aff5"
          ],
          "display_name": false
        },
        {
          "uuid": "65dcb80d-91f3-4362-9f2a-4ba92d92fd8f",
          "name": "C.I. VAT YELLOW 4",
          "stdName": "C.I. VAT YELLOW 4",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa5f67ea-f162-498c-84d3-a11815d72954",
            "66a6325f-356d-4ce6-89a7-4cc46915ee39",
            "66acbd53-3c06-40c8-a4d9-be9a1452fd73",
            "ff29ff7c-7d44-426b-b7db-e77451da2602"
          ],
          "display_name": false
        },
        {
          "uuid": "e0ef3e26-b039-4f6f-99c8-f63e34a1069f",
          "name": "C.I. VAT YELLOW 4 [HSDB]",
          "stdName": "C.I. VAT YELLOW 4 [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66a6325f-356d-4ce6-89a7-4cc46915ee39",
            "ff29ff7c-7d44-426b-b7db-e77451da2602"
          ],
          "display_name": false
        },
        {
          "uuid": "3c5b0149-3a39-4cf7-9e8b-abcb8775174a",
          "name": "CI 59100",
          "stdName": "CI 59100",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66a6325f-356d-4ce6-89a7-4cc46915ee39",
            "5b21a997-0d32-4e6c-a2f8-0f222ee2aff5"
          ],
          "display_name": false
        },
        {
          "uuid": "63850b1f-1122-49e4-9295-30a185cc8afd",
          "name": "DIBENZO(A,B)PYRENE-7,14-DIONE",
          "stdName": "DIBENZO(A,B)PYRENE-7,14-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66a6325f-356d-4ce6-89a7-4cc46915ee39",
            "1957c58a-154c-404e-9e4c-b4a1564fdf7b"
          ],
          "display_name": false
        },
        {
          "uuid": "03b493a0-9084-4c81-94c7-74ba20441806",
          "name": "DIBENZO(B,DEF)CHRYSENE-7,14-DIONE",
          "stdName": "DIBENZO(B,DEF)CHRYSENE-7,14-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66a6325f-356d-4ce6-89a7-4cc46915ee39",
            "5b21a997-0d32-4e6c-a2f8-0f222ee2aff5"
          ],
          "display_name": false
        },
        {
          "uuid": "6524b5c0-4dd6-4d87-a78a-23d04b083c65",
          "name": "NSC-30987",
          "stdName": "NSC-30987",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66a6325f-356d-4ce6-89a7-4cc46915ee39",
            "1957c58a-154c-404e-9e4c-b4a1564fdf7b"
          ],
          "display_name": false
        },
        {
          "uuid": "24f7daf7-5145-4422-9ff4-3621fc9c562e",
          "name": "TYRIAN YELLOW I-GOK",
          "stdName": "TYRIAN YELLOW I-GOK",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66a6325f-356d-4ce6-89a7-4cc46915ee39",
            "5b21a997-0d32-4e6c-a2f8-0f222ee2aff5"
          ],
          "display_name": false
        },
        {
          "uuid": "7077a8b6-eea4-486a-80de-11555b993f7f",
          "name": "VAT YELLOW 4",
          "stdName": "VAT YELLOW 4",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66a6325f-356d-4ce6-89a7-4cc46915ee39",
            "5b21a997-0d32-4e6c-a2f8-0f222ee2aff5"
          ],
          "display_name": true
        },
        {
          "uuid": "a2488e3f-4949-97f3-f8a9-d98fa3e338d7",
          "name": "VAT YELLOW 4 [IARC]",
          "stdName": "VAT YELLOW 4 [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4342fc87-b60b-abb3-573e-7b03de77b39f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fa5f67ea-f162-498c-84d3-a11815d72954",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ff29ff7c-7d44-426b-b7db-e77451da2602",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66a6325f-356d-4ce6-89a7-4cc46915ee39",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b21a997-0d32-4e6c-a2f8-0f222ee2aff5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1957c58a-154c-404e-9e4c-b4a1564fdf7b",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98231d65-e9e1-455f-8e82-330c8d581cdf",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390888000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aab93ab6-725a-41e0-b6c4-a7a20399cab1",
          "citation": "SRS import [8XO6A4G496]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8XO6A4G496",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390888000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03542eb8-4e18-49a7-9858-6a310f113152",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66acbd53-3c06-40c8-a4d9-be9a1452fd73",
          "citation": "C.I. VAT YELLOW 4 [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aeccf224-91f2-745a-470b-732fa419a24b",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+128-66-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "43d2c2b7-f58a-cb4e-8d1b-3ff3bc7f19e1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=128-66-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "21d13940-8239-8f7c-5d54-ffcd15550498",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "4342fc87-b60b-abb3-573e-7b03de77b39f",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "691d148b-04a5-09da-814a-fe55ee21b57c",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "814e6f34-c6fc-411f-8412-25cfdcca8b39",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "38b2610f-a0fd-0be4-c31c-5eeece053aae",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c884fddd-f40c-3904-f29f-d16952510fe7",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "53e66579-8693-4138-8c69-9328484817f4",
          "id": "53e66579-8693-4138-8c69-9328484817f4",
          "molfile": "\n  Marvin  01132104222D          \n\n 26 31  0  0  0  0            999 V2000\n    8.8018   -3.5186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3893   -4.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8018   -4.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6268   -4.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0392   -5.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6268   -6.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8018   -6.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3893   -5.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5642   -5.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1517   -6.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3268   -6.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9143   -5.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3268   -4.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9143   -4.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3268   -3.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1517   -3.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5642   -4.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1517   -4.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0893   -4.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6767   -3.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8518   -3.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4393   -4.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8518   -4.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6767   -4.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0893   -5.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6767   -6.3765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  2 17  1  0  0  0  0\n  4  3  1  0  0  0  0\n  8  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 18  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 25 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 18 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 14 19  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 20  1  0  0  0  0\n 24 19  2  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  2  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)-c3ccc4c5c(ccc(c35)C2=O)-c6ccccc6C4=O",
          "formula": "C24H12O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "de7a36ee-2794-4fa2-a09f-15453a5bd5ba"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "332.3518",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "61181138-0318-4afc-b694-afe7d518fb10",
      "version": "10",
      "structure": {
        "id": "2368115a-5b09-4148-9439-f6b9c9b0749e",
        "molfile": "\n  Marvin  01132101592D          \n\n 26 31  0  0  0  0            999 V2000\n    9.6268   -6.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0392   -5.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6268   -4.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8018   -4.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3893   -5.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8018   -6.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5642   -5.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1517   -4.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5642   -4.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3893   -4.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8018   -3.5186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1517   -3.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3268   -3.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9143   -4.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3268   -4.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9143   -5.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3268   -6.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1517   -6.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0893   -5.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6767   -4.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0893   -4.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6767   -3.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8518   -3.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4393   -4.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8518   -4.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6767   -6.3765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n  9 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n  8 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18  7  2  0  0  0  0\n 19 16  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 14 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 20  1  0  0  0  0\n 19 26  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)-c3ccc4c5c(ccc(c35)C2=O)-c6ccccc6C4=O",
        "formula": "C24H12O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "332.3518",
        "optical_activity": "NONE",
        "references": [
          "03542eb8-4e18-49a7-9858-6a310f113152",
          "aab93ab6-725a-41e0-b6c4-a7a20399cab1"
        ],
        "stereo_centers": 0
      },
      "unii": "8XO6A4G496"
    }
  ]
}