{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "116a3197-6210-4d1b-8a44-97f6b77d1e97",
          "code": "122628-50-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=122628-50-6",
          "code_system": "CAS",
          "references": [
            "04ce8e6a-f7fb-4db7-8848-5b5d44f915e8",
            "faa4f6a5-c7ae-4ea2-a503-9500ceb7e406"
          ]
        },
        {
          "uuid": "07f5eabb-c0ca-9fa6-a759-ac1816798703",
          "code": "3078772",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3078772",
          "code_system": "PUBCHEM",
          "references": [
            "0833d004-e7c6-d6c5-7f5e-a61c10b9c8ed"
          ]
        },
        {
          "uuid": "7459896c-9e49-41e1-aee1-1c27d3dddcd5",
          "code": "8WX58ADB2E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4adf925d-6243-71f2-0cd4-e4f20a5fc44e",
          "code": "DTXSID10924223",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10924223",
          "code_system": "EPA CompTox",
          "references": [
            "7bd63ff6-54ff-1547-42e8-28f18c3e362f"
          ]
        },
        {
          "uuid": "7265a0db-03e7-10c3-a220-fa479e4c18e7",
          "code": "701",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=701",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "7bd63ff6-54ff-1547-42e8-28f18c3e362f"
          ]
        },
        {
          "uuid": "7c2555e7-1356-5148-2666-f26b45ccf02c",
          "code": "625",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=625",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "7bd63ff6-54ff-1547-42e8-28f18c3e362f"
          ]
        },
        {
          "uuid": "69f23daf-55c9-3c8e-98f4-da53064a81ec",
          "code": "694",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=694",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "7bd63ff6-54ff-1547-42e8-28f18c3e362f"
          ]
        },
        {
          "uuid": "5b7c3821-5ed0-cb89-b4c8-c3e9b657c59c",
          "code": "709",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=709",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "7bd63ff6-54ff-1547-42e8-28f18c3e362f"
          ]
        },
        {
          "uuid": "eaa6c596-0276-506d-2a44-6f7f0f2b56db",
          "code": "641",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=641",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "7bd63ff6-54ff-1547-42e8-28f18c3e362f"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "c4c9595b-afd8-46a5-9ef6-dd22ac3daf4d",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cdb04bf7-3504-417e-ad87-b556d2a70769",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f050ac7a-29a8-4e2c-ac79-c382ebc0dee9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ec731c3-41dc-4525-8781-29f855bd3679",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04ce8e6a-f7fb-4db7-8848-5b5d44f915e8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391652000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5251601b-a6b7-4277-bda3-85a0d3b67e3e",
          "citation": "SRS import [8WX58ADB2E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8WX58ADB2E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391652000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "319fd175-d42f-47b8-8449-c97166c5d422",
          "citation": "DISODIUM PYRROLOQUINOLINEDIONE TRICARBOXYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0833d004-e7c6-d6c5-7f5e-a61c10b9c8ed",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "faa4f6a5-c7ae-4ea2-a503-9500ceb7e406",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7bd63ff6-54ff-1547-42e8-28f18c3e362f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5c13f5a8-4d37-4a06-ba3d-43de4ca6d48f",
          "citation": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&sort=GRN_No&order=DESC&startrow=1&type=basic&search=",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&sort=GRN_No&order=DESC&startrow=1&type=basic&search=",
          "doc_type": "CFSAN",
          "public_domain": true
        },
        {
          "uuid": "29f0ef22-6686-4e64-a695-767667643077",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0d1a4794-a092-4da3-a9fe-9766dffc2960",
          "id": "0d1a4794-a092-4da3-a9fe-9766dffc2960",
          "molfile": "\n  Marvin  01132100552D          \n\n  1  0  0  0  0  0            999 V2000\n    4.4698   -9.5062    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "673f85ce-138c-41d4-a1ac-abd57087e5b8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "68d5ac8d-d652-4e38-b588-e44cdc23fbef",
          "id": "68d5ac8d-d652-4e38-b588-e44cdc23fbef",
          "molfile": "\n  Marvin  01132105272D          \n\n 24 26  0  0  0  0            999 V2000\n    8.7489   -9.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4483   -9.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4483   -8.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7489   -8.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7489   -7.3437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0291   -8.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0291   -9.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3143   -9.8159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3143  -10.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5946  -11.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5946  -11.8838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8824  -10.6400    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.0291  -11.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7489  -10.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4483  -11.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1630  -10.6400    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.4483  -11.8838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3143   -8.1754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2367   -8.3356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7226   -9.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2367   -9.6557    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5467   -9.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9638   -8.2848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9638   -9.7015    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  2  0  0  0  0\n  1 14  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2 21  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 19  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 18  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 13  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 19 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 22 24  1  0  0  0  0\nM  CHG  3  12  -1  16  -1  24  -1\nM  END",
          "smiles": "c1c(c2-c3c(cc(C(=O)[O-])[nH]3)C(=O)C(=O)c2nc1C(=O)[O-])C(=O)[O-]",
          "formula": "C14H3N2O8",
          "atropisomerism": "No",
          "charge": -3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "036d468d-09a8-4bf0-b2d6-e40ddbf6001c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "327.1828",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b0b07b72-146b-4487-a3d0-a077a769c59c",
          "id": "b0b07b72-146b-4487-a3d0-a077a769c59c",
          "molfile": "\n  Marvin  01132109102D          \n\n  1  0  0  0  0  0            999 V2000\n    6.2731   -5.9509    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "formula": "H",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "147d89ad-9736-454f-9861-a65dff3bd2d2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "1.0079",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "60f36e84-de0f-4403-aa01-c96acc52a34a",
      "version": "12",
      "structure": {
        "id": "5bfbdbe8-35e4-4fdb-9a92-59ea80d73fa7",
        "molfile": "\n  Marvin  01132104462D          \n\n 27 26  0  0  0  0            999 V2000\n    4.4698   -9.5062    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    8.7489   -9.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4483   -9.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4483   -8.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7489   -8.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7489   -7.3437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0291   -8.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0291   -9.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3143   -9.8159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3143  -10.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5946  -11.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5946  -11.8838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8824  -10.6400    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.0291  -11.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7489  -10.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4483  -11.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1630  -10.6400    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.4483  -11.8838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3143   -8.1754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2367   -8.3356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7226   -9.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2367   -9.6557    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5467   -9.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9638   -8.2848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9638   -9.7015    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.2731   -5.9509    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\n    4.4698   -9.5062    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  2  8  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 10  1  0  0  0  0\n  2 15  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n  7 19  2  0  0  0  0\n  4 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n  3 22  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 23 25  1  0  0  0  0\nM  CHG  6   1   1  13  -1  17  -1  25  -1  26   1  27   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2   1  27\nM  SPA   1  1   1\nM  SDI   1  4    4.0498   -9.9262    4.0498   -9.0862\nM  SDI   1  4    4.8898   -9.0862    4.8898   -9.9262\nM  SMT   1 2\nM  END",
        "smiles": "c1c(c2-c3c(cc(C(=O)[O-])[nH]3)C(=O)C(=O)c2nc1C(=O)[O-])C(=O)[O-].[Na+].[Na+].[H+]",
        "formula": "C14H3N2O8.2Na.H",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "374.1702",
        "optical_activity": "NONE",
        "references": [
          "5251601b-a6b7-4277-bda3-85a0d3b67e3e",
          "f050ac7a-29a8-4e2c-ac79-c382ebc0dee9"
        ],
        "stereo_centers": 0
      },
      "unii": "8WX58ADB2E",
      "relationships": [
        {
          "uuid": "bc7af430-eefc-4ba6-9de3-6450819ee9a2",
          "amount": {
            "uuid": "e4aa5352-a1f4-4eb4-b336-4b06dc677d31"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "f7d0fd4d-8e44-4b02-aa05-de02874d5e0f",
            "refuuid": "5a92cd89-beb3-4148-a01d-68f99fa85597",
            "name": "PYRROLOQUINOLINEDIONE TRICARBOXYLIC ACID",
            "unii": "47819QGH5L",
            "linking_id": "47819QGH5L",
            "ref_pname": "PYRROLOQUINOLINEDIONE TRICARBOXYLIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "66e7e400-57e0-4627-a7f4-bcf836955093",
          "name": "1H-PYRROLO(2,3-F)QUINOLINE-2,7,9-TRICARBOXYLIC ACID, 4,5-DIHYDRO-4,5-DIOXO-, DISODIUM SALT",
          "stdName": "1H-PYRROLO(2,3-F)QUINOLINE-2,7,9-TRICARBOXYLIC ACID, 4,5-DIHYDRO-4,5-DIOXO-, DISODIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f050ac7a-29a8-4e2c-ac79-c382ebc0dee9"
          ],
          "display_name": false
        },
        {
          "uuid": "dd87416d-8619-40d8-8d4e-30bcb914f070",
          "name": "1H-PYRROLO(2,3-F)QUINOLINE-2,7,9-TRICARBOXYLIC ACID, 4,5-DIHYDRO-4,5-DIOXO-, SODIUM SALT (1:2)",
          "stdName": "1H-PYRROLO(2,3-F)QUINOLINE-2,7,9-TRICARBOXYLIC ACID, 4,5-DIHYDRO-4,5-DIOXO-, SODIUM SALT (1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f050ac7a-29a8-4e2c-ac79-c382ebc0dee9"
          ],
          "display_name": false
        },
        {
          "uuid": "7816a4b4-f9c4-49b2-8cdf-bc57d99203cb",
          "name": "DISODIUM PYRROLOQUINOLINE QUINONE",
          "stdName": "DISODIUM PYRROLOQUINOLINE QUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ec731c3-41dc-4525-8781-29f855bd3679"
          ],
          "display_name": false
        },
        {
          "uuid": "466e69f6-61d9-488b-9591-404621a4297e",
          "name": "DISODIUM PYRROLOQUINOLINEDIONE TRICARBOXYLATE",
          "stdName": "DISODIUM PYRROLOQUINOLINEDIONE TRICARBOXYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "319fd175-d42f-47b8-8449-c97166c5d422",
            "cdb04bf7-3504-417e-ad87-b556d2a70769"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "9468a31f-eedd-457d-8036-0a2b256c7431",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "66f33084-c9f3-40de-a121-1022ddcd65db",
          "name": "METHOXATIN DISODIUM",
          "stdName": "METHOXATIN DISODIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ec731c3-41dc-4525-8781-29f855bd3679"
          ],
          "display_name": false
        },
        {
          "uuid": "d5f79c5b-5fff-4a15-864b-5eddb682ac10",
          "name": "METHOXATIN DISODIUM SALT",
          "stdName": "METHOXATIN DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4c9595b-afd8-46a5-9ef6-dd22ac3daf4d"
          ],
          "display_name": false
        },
        {
          "uuid": "4fab8e1c-a51b-4f97-9622-36966ea3fd6c",
          "name": "METHOXATIN, DISODIUM SALT",
          "stdName": "METHOXATIN, DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4c9595b-afd8-46a5-9ef6-dd22ac3daf4d"
          ],
          "display_name": false
        },
        {
          "uuid": "5328a8fb-a40c-49d8-9a70-894733ae325a",
          "name": "PQQ DISODIUM SALT",
          "stdName": "PQQ DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ec731c3-41dc-4525-8781-29f855bd3679"
          ],
          "display_name": false
        },
        {
          "uuid": "684d2f78-1e73-4703-9130-6d83f3bf1d17",
          "name": "PYRROLOQUINOLINE QUINONE DISODIUM SALT",
          "stdName": "PYRROLOQUINOLINE QUINONE DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c13f5a8-4d37-4a06-ba3d-43de4ca6d48f"
          ],
          "display_name": false
        },
        {
          "uuid": "e5886cd0-73fa-46a0-909f-1d5ac1b5bc66",
          "name": "PYRROLOQUINOLINEQUINONE DISODIUM SALT",
          "stdName": "PYRROLOQUINOLINEQUINONE DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f050ac7a-29a8-4e2c-ac79-c382ebc0dee9"
          ],
          "display_name": false
        },
        {
          "uuid": "d01d2922-d380-407e-b3be-c6b7bbf3a58a",
          "name": "Pyrroloquinoline quinone disodium [WHO-DD]",
          "stdName": "PYRROLOQUINOLINE QUINONE DISODIUM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29f0ef22-6686-4e64-a695-767667643077"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "161373c8-7582-4973-b319-de5a544e2ba5"
      }
    }
  ]
}