{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "01a9a463-6bdf-4a53-90d2-5ba09da37c75",
          "code": "135397-30-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=135397-30-7",
          "code_system": "CAS",
          "references": [
            "093c5b74-feb2-4d8b-bfc3-1a88a08f9ecf",
            "2a35ff62-731c-42ad-86c5-fac9a84d10ff"
          ]
        },
        {
          "uuid": "82b25ed6-b4ba-4f3d-a285-07b04eb7a274",
          "code": "86414",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86414",
          "code_system": "PUBCHEM",
          "references": [
            "093c5b74-feb2-4d8b-bfc3-1a88a08f9ecf"
          ]
        },
        {
          "uuid": "ab3c3a52-8611-e818-f96a-cacb7a6f7329",
          "code": "DTXSID3074947",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3074947",
          "code_system": "EPA CompTox",
          "references": [
            "229920fb-7511-cbd4-1641-f6e2870ef1fe"
          ]
        },
        {
          "uuid": "2d631677-da70-4b9b-a4d4-8b067a3b574c",
          "code": "8WU8U5S0UR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4850a320-8e43-9c7e-6d6a-6c7d490365c5",
          "code": "halosulfuron",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/halosulfuron.html",
          "code_system": "ALANWOOD",
          "references": [
            "ea19a293-85fa-e4ca-a83b-641c513223c2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f61c0b75-8da2-4ec2-95ec-f170cf785b98",
          "name": "3-CHLORO-5-(((((4,6-DIMETHOXY-2-PYRIMIDINYL)AMINO)CARBONYL)AMINO)SULFONYL)-1-METHYL-1H-PYRAZOLE-4-CARBOXYLIC ACID",
          "stdName": "3-CHLORO-5-(((((4,6-DIMETHOXY-2-PYRIMIDINYL)AMINO)CARBONYL)AMINO)SULFONYL)-1-METHYL-1H-PYRAZOLE-4-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78273d39-bbfb-4b4f-af65-0613c3da04a1",
            "35a27694-ef0e-4016-8535-e0915ecd35e2"
          ],
          "display_name": false
        },
        {
          "uuid": "77e653db-cf7c-4ee0-a5f2-54ee1861d6b3",
          "name": "3-CHLORO-5-(4,6-DIMETHOXYPYRIMIDIN-2-YLCARBAMOYLSULFAMOYL)-1-METHYLPYRAZOLE-4-CARBOXYLIC ACID",
          "stdName": "3-CHLORO-5-(4,6-DIMETHOXYPYRIMIDIN-2-YLCARBAMOYLSULFAMOYL)-1-METHYLPYRAZOLE-4-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78273d39-bbfb-4b4f-af65-0613c3da04a1",
            "424d2cd8-cce5-41b0-9903-10faaf16141e"
          ],
          "display_name": false
        },
        {
          "uuid": "66c590f7-1cbb-4f63-ae26-fa10071e8cdb",
          "name": "HALOSULFURON",
          "stdName": "HALOSULFURON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de7c82b8-b9c3-4b6b-9f1d-283b36c04ec9",
            "9688c009-77e5-4db1-914a-81b8a73a4095",
            "bf4fb9e4-77f1-4533-ace5-4f790d42cc1b",
            "aa1623c7-27f2-4884-926e-7c9b39509709"
          ],
          "display_name": true
        },
        {
          "uuid": "8befa26f-b498-453d-aa61-6e6c30f1f974",
          "name": "HALOSULFURON [ISO]",
          "stdName": "HALOSULFURON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de7c82b8-b9c3-4b6b-9f1d-283b36c04ec9",
            "aa1623c7-27f2-4884-926e-7c9b39509709"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9688c009-77e5-4db1-914a-81b8a73a4095",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "78273d39-bbfb-4b4f-af65-0613c3da04a1",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "424d2cd8-cce5-41b0-9903-10faaf16141e",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35a27694-ef0e-4016-8535-e0915ecd35e2",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa1623c7-27f2-4884-926e-7c9b39509709",
          "citation": "http://www.alanwood.net/pesticides/halosulfuron.html",
          "url": "http://www.alanwood.net/pesticides/halosulfuron.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de7c82b8-b9c3-4b6b-9f1d-283b36c04ec9",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "093c5b74-feb2-4d8b-bfc3-1a88a08f9ecf",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390932000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "222fe1f2-f147-45f3-aa30-0dc93a58788d",
          "citation": "SRS import [8WU8U5S0UR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8WU8U5S0UR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390932000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b5d51f4-9247-4930-9b94-3a2286d0f0d8",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf4fb9e4-77f1-4533-ace5-4f790d42cc1b",
          "citation": "HALOSULFURON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "229920fb-7511-cbd4-1641-f6e2870ef1fe",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=135397-30-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ea19a293-85fa-e4ca-a83b-641c513223c2",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "2a35ff62-731c-42ad-86c5-fac9a84d10ff",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bd73079d-59a2-45e2-84f4-90f760af3dca",
          "id": "bd73079d-59a2-45e2-84f4-90f760af3dca",
          "molfile": "\n  Marvin  01132109482D          \n\n 27 28  0  0  0  0            999 V2000\n    3.7512   -2.3323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7512   -3.1621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4684   -3.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4684   -4.3935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1782   -4.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1782   -5.6311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4621   -6.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8992   -4.3935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8992   -3.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6103   -3.1596    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3274   -3.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0384   -3.1606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3274   -4.3916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0410   -4.8078    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6293   -5.5202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4525   -4.0908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9014   -5.2989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9883   -6.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2548   -6.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4658   -6.5330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4243   -7.5881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7992   -6.2930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1414   -7.0414    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.2058   -5.5753    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6616   -4.9591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8326   -4.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1782   -3.1606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 27  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5  8  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 27  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  2  0  0  0  0\n 17 14  1  0  0  0  0\n 17 18  2  0  0  0  0\n 25 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 22  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
          "smiles": "Cn1c(c(c(Cl)n1)C(=O)O)S(=O)(=O)NC(=O)Nc2nc(cc(n2)OC)OC",
          "formula": "C12H13ClN6O7S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2e2a75dd-d6cd-499b-8b5a-4e4c11477747"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "420.7871",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "25a6682b-543c-49bb-abf7-a0c600a03eb4",
      "version": "4",
      "structure": {
        "id": "d370999e-51b4-471d-8eed-2dfd08db6c6a",
        "molfile": "\n  Marvin  01132110562D          \n\n 27 28  0  0  0  0            999 V2000\n    7.4658   -6.5330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2548   -6.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4243   -7.5881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9883   -6.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7992   -6.2930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1414   -7.0414    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.2058   -5.5753    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6616   -4.9591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8326   -4.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9014   -5.2989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0410   -4.8078    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6293   -5.5202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4525   -4.0908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3274   -4.3916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3274   -3.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0384   -3.1606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6103   -3.1596    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8992   -3.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1782   -3.1606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4684   -3.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7512   -3.1621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7512   -2.3323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4684   -4.3935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1782   -4.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1782   -5.6311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4621   -6.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8992   -4.3935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10  4  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 20 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 24 27  1  0  0  0  0\n 27 18  2  0  0  0  0\nM  END",
        "smiles": "Cn1c(c(c(Cl)n1)C(=O)O)S(=O)(=O)NC(=O)Nc2nc(cc(n2)OC)OC",
        "formula": "C12H13ClN6O7S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "420.7871",
        "optical_activity": "NONE",
        "references": [
          "222fe1f2-f147-45f3-aa30-0dc93a58788d",
          "1b5d51f4-9247-4930-9b94-3a2286d0f0d8"
        ],
        "stereo_centers": 0
      },
      "unii": "8WU8U5S0UR"
    }
  ]
}