{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b8f29322-9c53-43f3-ae93-8edb38bbb315",
          "code": "27750-10-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=27750-10-3",
          "code_system": "CAS",
          "references": [
            "7e67b28d-32ae-42ae-a171-c30b384cf77c",
            "a130a55e-5905-464a-b971-00cf6f993323"
          ]
        },
        {
          "uuid": "073e2cd1-4e40-486c-9e07-c270536dedd1",
          "code": "C007999",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67007999",
          "code_system": "MESH",
          "references": [
            "7e67b28d-32ae-42ae-a171-c30b384cf77c"
          ]
        },
        {
          "uuid": "32f2f804-aa30-4aa1-883e-47de713dec35",
          "code": "HYDROXYCITRIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Hydroxycitric_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "7e67b28d-32ae-42ae-a171-c30b384cf77c"
          ]
        },
        {
          "uuid": "98249fa4-7414-43d7-8d1d-ef5614dad466",
          "code": "6205-14-7",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6205-14-7",
          "code_system": "CAS",
          "references": [
            "7e67b28d-32ae-42ae-a171-c30b384cf77c",
            "62741865-5dbc-44a3-a881-ab1144770586"
          ]
        },
        {
          "uuid": "43611503-2caa-4cd4-aecd-2aa4630657f4",
          "code": "1312602",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1312602/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7e67b28d-32ae-42ae-a171-c30b384cf77c"
          ]
        },
        {
          "uuid": "582b716f-193c-4102-a6e5-58b3fca16d15",
          "code": "m6131",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6131?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7e67b28d-32ae-42ae-a171-c30b384cf77c"
          ]
        },
        {
          "uuid": "79fa7d40-d1f1-4119-8141-b730178cb0c9",
          "code": "SUB33094",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7e67b28d-32ae-42ae-a171-c30b384cf77c"
          ]
        },
        {
          "uuid": "36de1195-d698-44bf-a39a-ddd1bacdd38b",
          "code": "185620",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/185620",
          "code_system": "PUBCHEM",
          "references": [
            "7e67b28d-32ae-42ae-a171-c30b384cf77c"
          ]
        },
        {
          "uuid": "bd13f49b-b6a4-9f20-1cf7-891f2b6ad082",
          "code": "DTXSID601045116",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601045116",
          "code_system": "EPA CompTox",
          "references": [
            "95afda56-83dc-a727-2dc3-ed614ad64065"
          ]
        },
        {
          "uuid": "0fa929bf-723b-f6c4-32e9-4dede3cf8def",
          "code": "2324 (Number of products:70)",
          "comments": "Dietary Supplement Label Database|chemical|Hydroxycitric Acid",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2324&item=Hydroxycitric Acid",
          "code_system": "DSLD",
          "references": [
            "6a15e157-62b7-7f2d-7e8c-95aef50811b6"
          ]
        },
        {
          "uuid": "977bfeae-8c9f-4df0-af0b-56fd6c676bb7",
          "code": "8W94T9026R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5b312112-a15d-1dad-1f6f-428871fa3107",
          "code": "100000125898",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8277e827-181b-d2b7-cd16-e2e00f3dbdc1"
          ]
        },
        {
          "uuid": "7fd9af1a-cf08-eb0b-07ea-a659268de5b4",
          "code": "8W94T9026R",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8W94T9026R",
          "code_system": "DAILYMED",
          "references": [
            "82770a59-81a0-146c-2abe-2ae11828ef9b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "baca35f8-b52b-43c3-867b-716ecd364c19",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d3def267-949b-455c-9772-a7bc917bc664",
            "refuuid": "27d77c39-4419-496a-a108-6632a25ff9a4",
            "name": "HYDROXYCITRIC ACID",
            "unii": "8W94T9026R",
            "linking_id": "8W94T9026R",
            "ref_pname": "HYDROXYCITRIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a95f0f88-a5d5-4fc6-840a-dad899e0e153",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "339fbfce-0380-43e2-8111-2a868c179f63",
            "refuuid": "157a00c8-66b9-4ac5-a4e4-eb0c6626b327",
            "name": "POTASSIUM HYDROXYCITRATE",
            "unii": "4586270U1R",
            "linking_id": "4586270U1R",
            "ref_pname": "POTASSIUM HYDROXYCITRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "99a88752-cade-4f13-8ac4-eacc41fea170",
          "amount": {
            "uuid": "a6aedd8f-579d-4b90-86ef-c8a072d6804b",
            "average": 8000,
            "units": "NANOMOLAR"
          },
          "qualification": "Ki",
          "type": "TARGET->INHIBITOR",
          "references": [
            "9952a2d0-b377-4068-a6cf-b2ef59d737f6"
          ],
          "related_substance": {
            "uuid": "2d7a20ac-7d2c-4b34-9611-3a14e65b280b",
            "refuuid": "ce7e6646-9c79-42c8-9bad-955d866d196b",
            "name": "ATP-CITRATE SYNTHASE",
            "unii": "YY45HG905G",
            "linking_id": "YY45HG905G",
            "ref_pname": "ATP-CITRATE SYNTHASE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "dcd3a899-c283-4549-afab-d5d468cae12b",
          "name": "(-)-HYDROXYCITRIC ACID",
          "stdName": "(-)-HYDROXYCITRIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd6c6c8c-1f7f-4ab2-a7aa-25e601064836",
            "cd317212-7f13-41f7-8514-b3cf39236f01"
          ],
          "display_name": false
        },
        {
          "uuid": "85ea764f-8726-4a2e-9969-d5fc595d8354",
          "name": "(-)-HYDROXYCITRIC ACID (CONSTITUENT OF GARCINIA CAMBOGIA AND GARCINIA INDICA) [DSC]",
          "stdName": "(-)-HYDROXYCITRIC ACID (CONSTITUENT OF GARCINIA CAMBOGIA AND GARCINIA INDICA) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd317212-7f13-41f7-8514-b3cf39236f01",
            "79c1bb9c-887e-4407-a38a-8f47cd294ec3"
          ],
          "display_name": false
        },
        {
          "uuid": "332f8478-fbfb-4d0b-ac8a-6403d029fb11",
          "name": "(1S,2S)-1,2-DIHYDROXY-1,2,3-PROPANETRICARBOXYLIC ACID",
          "stdName": "(1S,2S)-1,2-DIHYDROXY-1,2,3-PROPANETRICARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd6c6c8c-1f7f-4ab2-a7aa-25e601064836",
            "cd317212-7f13-41f7-8514-b3cf39236f01"
          ],
          "display_name": false
        },
        {
          "uuid": "3a6d7c97-7c0a-4870-a1ef-c12672d4781c",
          "name": "GARCINIA ACID",
          "stdName": "GARCINIA ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd6c6c8c-1f7f-4ab2-a7aa-25e601064836",
            "cd317212-7f13-41f7-8514-b3cf39236f01"
          ],
          "display_name": false
        },
        {
          "uuid": "3dd46b76-f930-411d-a36e-ddc9b45cb4f0",
          "name": "HYDROXYCITRATE, L-",
          "stdName": "HYDROXYCITRATE, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd6c6c8c-1f7f-4ab2-a7aa-25e601064836"
          ],
          "display_name": false
        },
        {
          "uuid": "e13ec662-1413-4e29-aae1-5c7a06414e2d",
          "name": "HYDROXYCITRIC ACID",
          "stdName": "HYDROXYCITRIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd6c6c8c-1f7f-4ab2-a7aa-25e601064836",
            "22c2fad2-31eb-43b9-a265-276f37d8b2d5",
            "cd317212-7f13-41f7-8514-b3cf39236f01",
            "a3de6c19-2b01-450e-b93e-c23d1a0b4ed6",
            "17e6b2de-e045-4ac4-bb1b-3118686f1986",
            "401a1999-6378-4bfa-beef-3adba248c561"
          ],
          "display_name": true
        },
        {
          "uuid": "9f05eca9-907a-46d7-b93f-1ecd286006cf",
          "name": "HYDROXYCITRIC ACID [MI]",
          "stdName": "HYDROXYCITRIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3de6c19-2b01-450e-b93e-c23d1a0b4ed6",
            "cd317212-7f13-41f7-8514-b3cf39236f01"
          ],
          "display_name": false
        },
        {
          "uuid": "f1e9d33b-9e6c-4413-9a98-41dedd0dcee4",
          "name": "HYDROXYCITRIC ACID, (-)-",
          "stdName": "HYDROXYCITRIC ACID, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd317212-7f13-41f7-8514-b3cf39236f01",
            "fa660b72-1b51-43bc-a7a4-3b24e765afe8"
          ],
          "display_name": false
        },
        {
          "uuid": "9ac0a458-1c87-a0b0-f0cf-b51da6d4f890",
          "name": "Hydroxycitric acid [WHO-DD]",
          "stdName": "HYDROXYCITRIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be5da64f-1266-da53-88de-5e5138e4db99"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bd6c6c8c-1f7f-4ab2-a7aa-25e601064836",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cd317212-7f13-41f7-8514-b3cf39236f01",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3de6c19-2b01-450e-b93e-c23d1a0b4ed6",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79c1bb9c-887e-4407-a38a-8f47cd294ec3",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa660b72-1b51-43bc-a7a4-3b24e765afe8",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "17e6b2de-e045-4ac4-bb1b-3118686f1986",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e67b28d-32ae-42ae-a171-c30b384cf77c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390878000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6514237d-0a4e-4029-8fa8-0a83242701b6",
          "citation": "USP-DSC",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "295bb64c-7ed0-4f8f-b2f6-5d9e758e347d",
          "citation": "SRS import [8W94T9026R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8W94T9026R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390878000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22c2fad2-31eb-43b9-a265-276f37d8b2d5",
          "citation": "HYDROXYCITRIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "401a1999-6378-4bfa-beef-3adba248c561",
          "citation": "HYDROXYCITRIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8277e827-181b-d2b7-cd16-e2e00f3dbdc1",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "39bf7288-86a9-723b-66c1-0efcd47db58a",
          "url": "https://www.liebertpub.com/doi/full/10.1089/jmf.2010.1555?url_ver=Z39.88-2003&rfr_id=ori:rid:crossref.org&rfr_dat=cr_pub%3dpubmed",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a130a55e-5905-464a-b971-00cf6f993323",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "62741865-5dbc-44a3-a881-ab1144770586",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6a15e157-62b7-7f2d-7e8c-95aef50811b6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b9c7e219-977b-49fc-a0d3-740112c96b35",
          "url": "https://www.liebertpub.com/doi/full/10.1089/jmf.2010.1555?url_ver=Z39.88-2003&rfr_id=ori:rid:crossref.org&rfr_dat=cr_pub%3dpubmed",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "be5da64f-1266-da53-88de-5e5138e4db99",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "82770a59-81a0-146c-2abe-2ae11828ef9b",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "95afda56-83dc-a727-2dc3-ed614ad64065",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "9952a2d0-b377-4068-a6cf-b2ef59d737f6",
          "url": "https://www.liebertpub.com/doi/full/10.1089/jmf.2010.1555?url_ver=Z39.88-2003&rfr_id=ori:rid:crossref.org&rfr_dat=cr_pub%3dpubmed",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "af40a48b-f15b-436c-a228-0a34055d03da",
          "id": "af40a48b-f15b-436c-a228-0a34055d03da",
          "molfile": "\n  Marvin  01132109052D          \n\n 14 13  0  0  1  0            999 V2000\n    2.7385   -2.1054    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.7769   -3.0673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0569   -1.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0518   -0.8553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3039   -2.1054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4507   -1.6904    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.9528   -2.9893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1834   -2.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9058   -1.6340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8700   -0.6656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7514   -2.0492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4251   -0.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7077   -0.4147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2449   -0.3532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  6  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  7  1  1  0  0  0\n  6  8  1  0  0  0  0\n  6 12  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\nM  END",
          "smiles": "C(C(=O)O)[C@]([C@@H](C(=O)O)O)(C(=O)O)O",
          "formula": "C6H8O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "258fd7e9-692c-4377-a9b1-6ef102a88e86"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "208.1232",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "27d77c39-4419-496a-a108-6632a25ff9a4",
      "version": "15",
      "structure": {
        "id": "bc14657d-f353-46de-90bc-4385940d2390",
        "molfile": "\n  Marvin  01132109442D          \n\n 14 13  0  0  1  0            999 V2000\n    2.7769   -3.0673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7385   -2.1054    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.4507   -1.6904    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.1834   -2.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9058   -1.6340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8700   -0.6656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7514   -2.0492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4251   -0.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7077   -0.4147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2449   -0.3532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9528   -2.9893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0569   -1.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0518   -0.8553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3039   -2.1054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  6  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  5  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n  3 11  1  1  0  0  0\n 12  2  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 12  1  0  0  0  0\nM  END",
        "smiles": "C(C(=O)O)[C@]([C@@H](C(=O)O)O)(C(=O)O)O",
        "formula": "C6H8O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "208.1232",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bd6c6c8c-1f7f-4ab2-a7aa-25e601064836",
          "295bb64c-7ed0-4f8f-b2f6-5d9e758e347d"
        ],
        "stereo_centers": 2
      },
      "unii": "8W94T9026R"
    }
  ]
}