{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6288702f-a937-42e7-8cab-bf32198d7a2a",
          "code": "26537-19-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=26537-19-9",
          "code_system": "CAS",
          "references": [
            "d915546a-f73f-4a6f-acd4-bd1bd47d7c73",
            "2684d6ee-91b7-4245-aa4c-44c2df5d19b3"
          ]
        },
        {
          "uuid": "00b61eb8-262d-4daa-b872-cec445511676",
          "code": "247-768-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.410",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d915546a-f73f-4a6f-acd4-bd1bd47d7c73"
          ]
        },
        {
          "uuid": "2a92e110-76d7-430e-90eb-d887c93d4602",
          "code": "97433",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/97433",
          "code_system": "PUBCHEM",
          "references": [
            "d915546a-f73f-4a6f-acd4-bd1bd47d7c73"
          ]
        },
        {
          "uuid": "cc2c387a-a939-44a1-89ed-b5bdc2486778",
          "code": "8VK4O27JMT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "89225c08-bfcf-f933-40fc-792902cd745a",
          "code": "DTXSID10885360",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10885360",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "6aee5f67-4635-1b00-2c27-2d7c5db03511",
          "code": "122690",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=122690",
          "code_system": "NSC",
          "references": [
            "f851c225-89c8-f02b-56db-afd3e06867e9"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "71133d83-d411-4df4-bd78-8c03290080b4",
          "name": "4-(1,1-DIMETHYLETHYL)BENZOIC ACID METHYL ESTER",
          "stdName": "4-(1,1-DIMETHYLETHYL)BENZOIC ACID METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "959ee171-bb23-4b44-9d0f-844d46d3d782",
            "613788a7-eda0-4c79-92eb-2a735da785f2"
          ],
          "display_name": false
        },
        {
          "uuid": "1e99d301-b0ad-4f12-89e1-338b170fa16f",
          "name": "BENZOIC ACID, 4-(1,1-DIMETHYLETHYL)-, METHYL ESTER",
          "stdName": "BENZOIC ACID, 4-(1,1-DIMETHYLETHYL)-, METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "959ee171-bb23-4b44-9d0f-844d46d3d782",
            "613788a7-eda0-4c79-92eb-2a735da785f2"
          ],
          "display_name": false
        },
        {
          "uuid": "dde9dfb3-fd83-444b-9b9a-e4a56bd485cd",
          "name": "BENZOIC ACID, P-TERT-BUTYL-, METHYL ESTER",
          "stdName": "BENZOIC ACID, P-TERT-BUTYL-, METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "959ee171-bb23-4b44-9d0f-844d46d3d782",
            "613788a7-eda0-4c79-92eb-2a735da785f2"
          ],
          "display_name": false
        },
        {
          "uuid": "f44186a7-28d0-4d7f-937d-ef8f23fb4b47",
          "name": "MBB",
          "stdName": "MBB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "959ee171-bb23-4b44-9d0f-844d46d3d782",
            "00b612b4-420d-4b35-bb6e-1c30bd89dd09"
          ],
          "display_name": false
        },
        {
          "uuid": "b3170b8d-46c9-4a08-b85d-8c4e7ccec43e",
          "name": "METHYL 4-(1,1-DIMETHYLETHYL)BENZOATE",
          "stdName": "METHYL 4-(1,1-DIMETHYLETHYL)BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "959ee171-bb23-4b44-9d0f-844d46d3d782",
            "613788a7-eda0-4c79-92eb-2a735da785f2"
          ],
          "display_name": false
        },
        {
          "uuid": "0e6a6174-1c48-4f11-89d0-d9f34e03cdea",
          "name": "METHYL 4-T-BUTYLBENZOATE",
          "stdName": "METHYL 4-T-BUTYLBENZOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "14021a42-5030-43fd-b950-2567dd0767bd",
            "959ee171-bb23-4b44-9d0f-844d46d3d782",
            "00b612b4-420d-4b35-bb6e-1c30bd89dd09"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6dfa4915-d722-4904-bab3-c01536faa355",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "23c0dfca-dd85-455d-bc31-e879ee22cc84",
          "name": "METHYL 4-TERT-BUTYLBENZOATE",
          "stdName": "METHYL 4-TERT-BUTYLBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "959ee171-bb23-4b44-9d0f-844d46d3d782",
            "613788a7-eda0-4c79-92eb-2a735da785f2"
          ],
          "display_name": false
        },
        {
          "uuid": "972c37c6-ba26-4660-84b2-342786b0eb76",
          "name": "METHYL P-TERT-BUTYLBENZOATE",
          "stdName": "METHYL P-TERT-BUTYLBENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "959ee171-bb23-4b44-9d0f-844d46d3d782",
            "613788a7-eda0-4c79-92eb-2a735da785f2"
          ],
          "display_name": true
        },
        {
          "uuid": "4bbb7621-8517-4a35-810e-d08050bcb474",
          "name": "NSC-122690",
          "stdName": "NSC-122690",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "959ee171-bb23-4b44-9d0f-844d46d3d782",
            "613788a7-eda0-4c79-92eb-2a735da785f2"
          ],
          "display_name": false
        },
        {
          "uuid": "29554cac-a2fb-40aa-8114-2a0d5b1c8992",
          "name": "P-TERT-BUTYLBENZOIC ACID METHYL ESTER",
          "stdName": "P-TERT-BUTYLBENZOIC ACID METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "959ee171-bb23-4b44-9d0f-844d46d3d782",
            "613788a7-eda0-4c79-92eb-2a735da785f2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "613788a7-eda0-4c79-92eb-2a735da785f2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "959ee171-bb23-4b44-9d0f-844d46d3d782",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00b612b4-420d-4b35-bb6e-1c30bd89dd09",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d915546a-f73f-4a6f-acd4-bd1bd47d7c73",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391527000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9314b142-0af1-41c2-8f3b-53142f31f02e",
          "citation": "SRS import [8VK4O27JMT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8VK4O27JMT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391527000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14021a42-5030-43fd-b950-2567dd0767bd",
          "citation": "METHYL 4-T-BUTYLBENZOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2684d6ee-91b7-4245-aa4c-44c2df5d19b3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f851c225-89c8-f02b-56db-afd3e06867e9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4db10081-b7cc-4a30-8ba4-d57c04905463",
          "id": "4db10081-b7cc-4a30-8ba4-d57c04905463",
          "molfile": "\n  Marvin  01132104032D          \n\n 14 14  0  0  0  0            999 V2000\n   11.6416   -4.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8076   -4.2879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3519   -4.9629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7108   -5.7088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5243   -4.9156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1589   -4.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3421   -4.1160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8799   -4.8038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2411   -5.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0622   -5.5906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0524   -4.7436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8976   -3.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2248   -4.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0524   -5.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n 10  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 11  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1ccc(cc1)C(=O)OC",
          "formula": "C12H16O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c2746b00-f619-4261-a509-8c53cd7872b5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "192.2547",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3933a68a-f0de-4bbc-ab8a-5c99e94ca530",
      "version": "5",
      "structure": {
        "id": "713ee6f7-1acc-466c-9947-8cd26a42eb0c",
        "molfile": "\n  Marvin  01132105522D          \n\n 14 14  0  0  0  0            999 V2000\n    7.8799   -4.8038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0524   -4.7436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8976   -3.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2248   -4.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0524   -5.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3421   -4.1160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1589   -4.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5243   -4.9156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3519   -4.9629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8076   -4.2879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6416   -4.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7108   -5.7088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0622   -5.5906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2411   -5.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  9 12  2  0  0  0  0\n 13  8  2  0  0  0  0\n  1 14  2  0  0  0  0\n 14 13  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1ccc(cc1)C(=O)OC",
        "formula": "C12H16O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "192.2547",
        "optical_activity": "NONE",
        "references": [
          "613788a7-eda0-4c79-92eb-2a735da785f2",
          "9314b142-0af1-41c2-8f3b-53142f31f02e"
        ],
        "stereo_centers": 0
      },
      "unii": "8VK4O27JMT"
    }
  ]
}