{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a010961f-02fb-4253-a07f-d64b76e6b766",
          "code": "3081-14-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3081-14-9",
          "code_system": "CAS",
          "references": [
            "aa2420e4-afad-441a-bc16-95b6889c6fdd",
            "f49ec8b1-fd2f-457c-984d-a3da16d882ba"
          ]
        },
        {
          "uuid": "91ece750-848b-481d-bff9-3e4800cd2c49",
          "code": "221-375-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.019.433",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "aa2420e4-afad-441a-bc16-95b6889c6fdd"
          ]
        },
        {
          "uuid": "ec2029be-85a1-4ff7-b4f6-5d46773406af",
          "code": "18320",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18320",
          "code_system": "PUBCHEM",
          "references": [
            "aa2420e4-afad-441a-bc16-95b6889c6fdd"
          ]
        },
        {
          "uuid": "7cad5fc8-e863-3a76-b043-e3b799ff2067",
          "code": "DTXSID2024618",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2024618",
          "code_system": "EPA CompTox",
          "references": [
            "e072f70e-df9a-95d9-ee16-7586badd6c85"
          ]
        },
        {
          "uuid": "e0b9d796-6a1d-4f35-b62a-06ddde8f624f",
          "code": "8VAF71SNQ5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "07d81f16-cbc1-42a8-b1a8-f48c9faa0d82",
          "name": "1,4-BENZENEDIAMINE, N,N'-BIS(1,4-DIMETHYLPENTYL)-",
          "stdName": "1,4-BENZENEDIAMINE, N,N'-BIS(1,4-DIMETHYLPENTYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46054a0e-952a-4498-bf14-cc6ffed83c43"
          ],
          "display_name": false
        },
        {
          "uuid": "240bf409-4a93-4c97-82c9-3da9fdb2811a",
          "name": "1,4-BENZENEDIAMINE, N1,N4-BIS(1,4-DIMETHYLPENTYL)-",
          "stdName": "1,4-BENZENEDIAMINE, N1,N4-BIS(1,4-DIMETHYLPENTYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46054a0e-952a-4498-bf14-cc6ffed83c43"
          ],
          "display_name": false
        },
        {
          "uuid": "2779afa3-cb17-46cf-b7db-e52a288453ac",
          "name": "N,N'-BIS(1,4-DIMETHYLPENTYL)-1,4-BENZENEDIAMINE",
          "stdName": "N,N'-BIS(1,4-DIMETHYLPENTYL)-1,4-BENZENEDIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46054a0e-952a-4498-bf14-cc6ffed83c43"
          ],
          "display_name": false
        },
        {
          "uuid": "61c149b8-187d-47f8-ab72-8540398c1960",
          "name": "N,N'-BIS(1,4-DIMETHYLPENTYL)-1,4-PHENYLENEDIAMINE",
          "stdName": "N,N'-BIS(1,4-DIMETHYLPENTYL)-1,4-PHENYLENEDIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46054a0e-952a-4498-bf14-cc6ffed83c43"
          ],
          "display_name": false
        },
        {
          "uuid": "e9ebf343-d93e-40ff-8ffa-585b24804e1d",
          "name": "N,N'-BIS(1,4-DIMETHYLPENTYL)-4-PHENYLENEDIAMINE",
          "stdName": "N,N'-BIS(1,4-DIMETHYLPENTYL)-4-PHENYLENEDIAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c39097f-5d04-4783-a419-959a3695185d"
          ],
          "display_name": false
        },
        {
          "uuid": "9091bd45-c648-499b-8b03-d7d9a1f8b7b1",
          "name": "N,N'-BIS(1,4-DIMETHYLPENTYL)-P-PHENYLENEDIAMINE",
          "stdName": "N,N'-BIS(1,4-DIMETHYLPENTYL)-P-PHENYLENEDIAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46054a0e-952a-4498-bf14-cc6ffed83c43"
          ],
          "display_name": true
        },
        {
          "uuid": "1afe5547-91af-41e2-ad62-b36973270ff9",
          "name": "N,N'-BIS(2-(5-METHYLHEXYL))-P-PHENYLENEDIAMINE",
          "stdName": "N,N'-BIS(2-(5-METHYLHEXYL))-P-PHENYLENEDIAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46054a0e-952a-4498-bf14-cc6ffed83c43"
          ],
          "display_name": false
        },
        {
          "uuid": "20e544b3-dbbf-4e1b-91dc-501207abad6b",
          "name": "N,N'-DI(1,4-DIMETHYLPENTYL)-P-PHENYLENEDIAMINE",
          "stdName": "N,N'-DI(1,4-DIMETHYLPENTYL)-P-PHENYLENEDIAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46054a0e-952a-4498-bf14-cc6ffed83c43"
          ],
          "display_name": false
        },
        {
          "uuid": "c6b22b76-ceea-457f-8746-80a382bdd13c",
          "name": "P-PHENYLENEDIAMINE, N,N'-BIS(1,4-DIMETHYLPENTYL)-",
          "stdName": "P-PHENYLENEDIAMINE, N,N'-BIS(1,4-DIMETHYLPENTYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46054a0e-952a-4498-bf14-cc6ffed83c43"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9c39097f-5d04-4783-a419-959a3695185d",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "46054a0e-952a-4498-bf14-cc6ffed83c43",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa2420e4-afad-441a-bc16-95b6889c6fdd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392313000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0790ac8c-c8fe-4d25-a93f-47243b2e8784",
          "citation": "SRS import [8VAF71SNQ5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8VAF71SNQ5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392313000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e072f70e-df9a-95d9-ee16-7586badd6c85",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3081-14-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f49ec8b1-fd2f-457c-984d-a3da16d882ba",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ab037ac0-dad8-46c7-898d-ed32bee9c4d2",
          "id": "ab037ac0-dad8-46c7-898d-ed32bee9c4d2",
          "molfile": "\n  Marvin  01132108522D          \n\n 22 22  0  0  0  0            999 V2000\n    0.7100   -3.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7100   -2.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4301   -2.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1402   -2.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8602   -2.0601    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.8602   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5703   -2.4802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2904   -2.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0004   -2.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7105   -2.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7105   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4306   -0.8301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1406   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.1406   -2.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8606   -0.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5708   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2908   -0.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2908    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0008   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0004   -0.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2904   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 22  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 21  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCC(C)Nc1ccc(cc1)NC(C)CCC(C)C",
          "formula": "C20H36N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d2074f67-4e8c-4a6e-923c-81bce69aeb8f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "304.514",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1ce4ef0a-bd4d-4c11-bc47-6fda5c39dc24",
      "version": "3",
      "structure": {
        "id": "1f2a3d47-ff4f-48ae-b328-b0d871be2605",
        "molfile": "\n  Marvin  01132101472D          \n\n 22 22  0  0  0  0            999 V2000\n    6.4306   -0.8301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7105   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7105   -2.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0004   -2.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2904   -2.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5703   -2.4802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8602   -2.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1402   -2.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4301   -2.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7100   -2.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7100   -3.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8602   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2904   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0004   -0.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1406   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8606   -0.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5708   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2908   -0.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2908    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0008   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1406   -2.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 16  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2 15  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5 14  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 13  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 22  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCC(C)Nc1ccc(cc1)NC(C)CCC(C)C",
        "formula": "C20H36N2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "304.514",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "9c39097f-5d04-4783-a419-959a3695185d",
          "0790ac8c-c8fe-4d25-a93f-47243b2e8784"
        ],
        "stereo_centers": 2
      },
      "unii": "8VAF71SNQ5"
    }
  ]
}