{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "adfd44cc-5ff4-41ee-9602-a86bb2495353",
          "code": "18600-59-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=18600-59-4",
          "code_system": "CAS",
          "references": [
            "5c0d6d7c-7197-4024-8f56-a1ae2ff0d434",
            "812ae79e-753c-48fd-99c8-1773151da0f2"
          ]
        },
        {
          "uuid": "c5240a3b-15ab-4adb-adaf-164680450335",
          "code": "FCN NO. 935",
          "comments": "FCN|UV LIGHT STABILIZER|PET",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=935",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "5c0d6d7c-7197-4024-8f56-a1ae2ff0d434"
          ]
        },
        {
          "uuid": "2ced674d-e06e-40cf-a40c-4f99e254e203",
          "code": "FCN NO. 537",
          "comments": "FCN|UV LIGHT STABILIZER|POLYMERS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=537",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "5c0d6d7c-7197-4024-8f56-a1ae2ff0d434"
          ]
        },
        {
          "uuid": "09551e5d-f7df-4307-b31d-5b062cd270b1",
          "code": "FCN NO. 428",
          "type": "ALTERNATIVE",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=428",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "5c0d6d7c-7197-4024-8f56-a1ae2ff0d434"
          ]
        },
        {
          "uuid": "33f4336a-2863-4443-8eae-a5713e468c59",
          "code": "FCN NO. 493",
          "type": "ALTERNATIVE",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=493",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "5c0d6d7c-7197-4024-8f56-a1ae2ff0d434"
          ]
        },
        {
          "uuid": "8f98043f-9b67-401e-8a1b-0ab6fed9251d",
          "code": "3098422",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3098422",
          "code_system": "PUBCHEM",
          "references": [
            "5c0d6d7c-7197-4024-8f56-a1ae2ff0d434"
          ]
        },
        {
          "uuid": "286de60d-e720-44ab-9d98-18df9c5693db",
          "code": "8V348NL4QK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8f2e4bee-c187-ea0d-5bff-fd1e9f93fadb",
          "code": "DTXSID40864845",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40864845",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d782ebb9-a749-4f2f-bd0a-56379ceddfbc",
          "name": "2,2'-(1,4-PHENYLENE)BIS(3,1-BENZOXAZIN-4-ONE)",
          "stdName": "2,2'-(1,4-PHENYLENE)BIS(3,1-BENZOXAZIN-4-ONE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "309043dc-8662-4cd0-a5b2-7104a1decb85"
          ],
          "display_name": true
        },
        {
          "uuid": "83d54e21-1b12-4743-afd2-5c99d35a4f19",
          "name": "2,2'-(1,4-PHENYLENE)BIS(4H-3,1-BENZOXAZIN-4-ONE)",
          "stdName": "2,2'-(1,4-PHENYLENE)BIS(4H-3,1-BENZOXAZIN-4-ONE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fcd17b48-9c0f-4ff8-9238-8e9a691b6501"
          ],
          "display_name": false
        },
        {
          "uuid": "5c504751-7f90-4a2c-96ea-3b5b163df18d",
          "name": "4H-3,1-BENZOXAZIN-4-ONE, 2,2'-(1,4-PHENYLENE)BIS-",
          "stdName": "4H-3,1-BENZOXAZIN-4-ONE, 2,2'-(1,4-PHENYLENE)BIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60ea9dc0-9297-43dd-b72a-06dbbdd2a295"
          ],
          "display_name": false
        },
        {
          "uuid": "6d84ac6f-ff34-444c-9e19-ed556a570dfa",
          "name": "4H-3,1-BENZOXAZIN-4-ONE, 2,2'-P-PHENYLENEBIS-",
          "stdName": "4H-3,1-BENZOXAZIN-4-ONE, 2,2'-P-PHENYLENEBIS-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "309043dc-8662-4cd0-a5b2-7104a1decb85"
          ],
          "display_name": false
        },
        {
          "uuid": "c9881a26-68d6-4cd5-bbd2-c750c19a4b98",
          "name": "CYASORB UV 3638",
          "stdName": "CYASORB UV 3638",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "309043dc-8662-4cd0-a5b2-7104a1decb85"
          ],
          "display_name": false
        },
        {
          "uuid": "9069ab0a-9fa1-4349-8813-a17f4220c026",
          "name": "PIONIN ZA 101",
          "stdName": "PIONIN ZA 101",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "309043dc-8662-4cd0-a5b2-7104a1decb85"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "aeb04993-016d-4ff5-81e0-33cc74e44812",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fcd17b48-9c0f-4ff8-9238-8e9a691b6501",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60ea9dc0-9297-43dd-b72a-06dbbdd2a295",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "309043dc-8662-4cd0-a5b2-7104a1decb85",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c0d6d7c-7197-4024-8f56-a1ae2ff0d434",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390930000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "caf16e80-1cd1-4b70-8036-b291fc418275",
          "citation": "SRS import [8V348NL4QK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8V348NL4QK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390930000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1f97ed1-c220-473a-871b-af6df7074e4f",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6f4cf4b-415c-4b82-88bc-5b44b4934287",
          "citation": "2,2'-(1,4-PHENYLENE)BIS[4H-3,1-BENZOXAZIN-4-ONE]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "812ae79e-753c-48fd-99c8-1773151da0f2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6f488ad6-f21a-4849-ba8d-3d526deadce6",
          "id": "6f488ad6-f21a-4849-ba8d-3d526deadce6",
          "molfile": "\n  Marvin  01132105472D          \n\n 28 32  0  0  0  0            999 V2000\n   10.6503   -4.9898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0344   -5.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2533   -5.2853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6375   -5.8383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8075   -6.6437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5932   -6.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7629   -7.7109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5487   -7.9682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1645   -7.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9945   -6.6052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2089   -6.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0380   -5.4611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2960   -5.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6132   -5.3650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6721   -4.5421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4057   -4.1775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0946   -4.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9877   -4.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2429   -4.4460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5586   -3.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8182   -4.3498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1339   -3.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1899   -3.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9301   -2.7039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6145   -3.1635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3548   -2.8002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4107   -1.9726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0437   -3.2598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  2 11  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n 12  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 11  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 17  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 15 18  1  0  0  0  0\n 17 16  1  0  0  0  0\n 19 18  2  0  0  0  0\n 18 28  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 25 20  2  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  2  0  0  0  0\n 28 26  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c(=O)oc(-c3ccc(cc3)-c4nc5ccccc5c(=O)o4)n2",
          "formula": "C22H12N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e7e34924-c3ad-49b5-a529-4c71d7263032"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "368.3425",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a9e29eab-f007-4371-b5b6-5fee7947a883",
      "version": "6",
      "structure": {
        "id": "7fe4258c-89b0-4ef6-bb65-20644c95f857",
        "molfile": "\n  Marvin  01132106382D          \n\n 28 32  0  0  0  0            999 V2000\n    8.8075   -6.6437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5932   -6.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2089   -6.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0344   -5.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6503   -4.9898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2533   -5.2853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6375   -5.8383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0380   -5.4611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2960   -5.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6132   -5.3650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6721   -4.5421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9877   -4.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2429   -4.4460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5586   -3.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6145   -3.1635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3548   -2.8002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0437   -3.2598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4107   -1.9726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9301   -2.7039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1899   -3.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1339   -3.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8182   -4.3498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4057   -4.1775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0946   -4.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9945   -6.6052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1645   -7.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5487   -7.9682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7629   -7.7109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  1  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 12 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n 15 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 14 22  2  0  0  0  0\n 23 11  1  0  0  0  0\n 24 23  2  0  0  0  0\n  8 24  1  0  0  0  0\n  3 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\n  2 28  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)c(=O)oc(-c3ccc(cc3)-c4nc5ccccc5c(=O)o4)n2",
        "formula": "C22H12N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "368.3425",
        "optical_activity": "NONE",
        "references": [
          "caf16e80-1cd1-4b70-8036-b291fc418275",
          "d1f97ed1-c220-473a-871b-af6df7074e4f"
        ],
        "stereo_centers": 0
      },
      "unii": "8V348NL4QK"
    }
  ]
}