{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8a67412b-21a1-4b40-b848-99088cd305d2", "code": "6358-30-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6358-30-1", "code_system": "CAS", "references": [ "f5d130b2-a56a-4192-bc7a-5358e03c8e7b", "4fc7273c-ea91-4a31-b222-d0a54ef3520d" ] }, { "uuid": "43510698-0461-4c1b-a40c-17376dd29711", "code": "228-767-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.152", "code_system": "ECHA (EC/EINECS)", "references": [ "f5d130b2-a56a-4192-bc7a-5358e03c8e7b" ] }, { "uuid": "bc6e4c1c-2615-4f16-9f02-4dec4984b903", "code": "61387", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61387", "code_system": "PUBCHEM", "references": [ "f5d130b2-a56a-4192-bc7a-5358e03c8e7b" ] }, { "uuid": "b7bed278-1ebf-dd81-586a-befc4f29cf5c", "code": "DTXSID2036293", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2036293", "code_system": "EPA CompTox", "references": [ "dec34f15-06e7-da71-de99-85c595716f4a" ] }, { "uuid": "5731907a-d0b0-31d0-a828-dc256dff116d", "code": "2397126", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2397126/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "47cfe8bf-5be7-49d8-2e31-e2ff831eeb58" ] }, { "uuid": "2fefb3a8-baf7-4854-84a6-ad24269335ee", "code": "8U8Z6628KF", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "7f809b3c-ac52-1a72-b764-c537e90a189c", "code": "8U8Z6628KF", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8U8Z6628KF", "code_system": "DAILYMED", "references": [ "7851a057-22d6-8e5b-75dd-2988eb4ea5b4" ] } ], "substance_class": "chemical", "names": [ { "uuid": "e22dd2eb-2067-4e10-ac15-c9b81b21180b", "name": "C.I. PIGMENT VIOLET 23", "stdName": "C.I. PIGMENT VIOLET 23", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e99c7066-4d72-41d7-a212-5e13d7d19192", "538720d4-62f4-4cac-9437-b35dc2250328" ], "display_name": false }, { "uuid": "23b5cfd1-8530-4c01-8ccb-988441149838", "name": "CARBAZOLE VIOLET", "stdName": "CARBAZOLE VIOLET", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "959f7f11-d9a5-43e2-854e-fb01707dd097", "3e62d03e-5820-4c4c-9ce6-d9747debc79c", "e99c7066-4d72-41d7-a212-5e13d7d19192", "538720d4-62f4-4cac-9437-b35dc2250328" ], "display_name": false }, { "uuid": "ea8b6420-60d0-45bb-872a-73e712e2e93c", "name": "CARBAZOLE VIOLET [MART.]", "stdName": "CARBAZOLE VIOLET [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3e62d03e-5820-4c4c-9ce6-d9747debc79c" ], "display_name": false }, { "uuid": "e99a84a8-92b1-40f6-9dcd-eb2ed387012f", "name": "CI 51319", "stdName": "CI 51319", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "85eb3d90-f7a3-4093-97b7-44c1fbeeeb03", "538720d4-62f4-4cac-9437-b35dc2250328", "ea361098-ee65-4028-a532-0ef709a4670d" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "9411e2c0-5a0e-4b28-aef4-5d1ccede632a", "name_org": "INCI" } ] }, { "uuid": "0498a454-5b4b-44e2-928a-268fd27514d8", "name": "DIINDOLO(3,2-B:3',2'-M)TRIPHENODIOXAZINE, 8,18-DICHLORO-5,15-DIETHYL-5,15-DIHYDRO-", "stdName": "DIINDOLO(3,2-B:3',2'-M)TRIPHENODIOXAZINE, 8,18-DICHLORO-5,15-DIETHYL-5,15-DIHYDRO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3b9f4050-0897-433b-8995-a5e5a4f502b0", "538720d4-62f4-4cac-9437-b35dc2250328" ], "display_name": false }, { "uuid": "8c330279-ff0b-4ca2-9131-86395d232c4c", "name": "DIOXAZINE VIOLET", "stdName": "DIOXAZINE VIOLET", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e99c7066-4d72-41d7-a212-5e13d7d19192", "538720d4-62f4-4cac-9437-b35dc2250328" ], "display_name": false }, { "uuid": "8ad64705-8399-471b-bacd-dda2c4373573", "name": "FAST VIOLET RL", "stdName": "FAST VIOLET RL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "538720d4-62f4-4cac-9437-b35dc2250328", "3eb17499-7af8-4bbe-b9cc-7e0e4dc69240" ], "display_name": false }, { "uuid": "a1b33873-1b02-4192-b003-0191e67a7b69", "name": "PIGMENT VIOLET 23", "stdName": "PIGMENT VIOLET 23", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "3b9f4050-0897-433b-8995-a5e5a4f502b0", "538720d4-62f4-4cac-9437-b35dc2250328", "abe736ef-ee58-4ac8-976a-c1f8373fd689", "758da534-e7e1-4fd2-b852-4185c86d4bfe" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "ccdd6a6c-d21b-44fa-a4ac-70d769c7109e", "name_org": "INCI" } ] } ], "references": [ { "uuid": "3b9f4050-0897-433b-8995-a5e5a4f502b0", "citation": "chemid", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "538720d4-62f4-4cac-9437-b35dc2250328", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3eb17499-7af8-4bbe-b9cc-7e0e4dc69240", "citation": "Plastics Additives Database", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e99c7066-4d72-41d7-a212-5e13d7d19192", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3e62d03e-5820-4c4c-9ce6-d9747debc79c", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "758da534-e7e1-4fd2-b852-4185c86d4bfe", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "85eb3d90-f7a3-4093-97b7-44c1fbeeeb03", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f5d130b2-a56a-4192-bc7a-5358e03c8e7b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390818000, "tags": [ "NOMEN" ] }, { "uuid": "bd3ee250-fabc-4557-9165-bb56b4a678ce", "citation": "SRS import [8U8Z6628KF]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8U8Z6628KF", "doc_type": "SRS", "public_domain": true, "document_date": 1493390818000, "tags": [ "NOMEN" ] }, { "uuid": "3f7ddbee-e044-4ccd-8150-5cecd558e985", "citation": "ChemID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "959f7f11-d9a5-43e2-854e-fb01707dd097", "citation": "CARBAZOLE VIOLET [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "abe736ef-ee58-4ac8-976a-c1f8373fd689", "citation": "PIGMENT VIOLET 23 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ea361098-ee65-4028-a532-0ef709a4670d", "citation": "CI 51319 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "dec34f15-06e7-da71-de99-85c595716f4a", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6358-30-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "47cfe8bf-5be7-49d8-2e31-e2ff831eeb58", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "4fc7273c-ea91-4a31-b222-d0a54ef3520d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "7851a057-22d6-8e5b-75dd-2988eb4ea5b4", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "74dcd3e1-d175-4d50-8c4e-1375e85122be", "id": "74dcd3e1-d175-4d50-8c4e-1375e85122be", "molfile": "\n Marvin 01132106042D \n\n 42 50 0 0 0 0 999 V2000\n -1.0413 -5.0517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3370 -4.6494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3370 -3.8402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0496 -3.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7535 -3.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4538 -3.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4485 -2.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7535 -2.2143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0490 -2.6124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3718 -2.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0716 -2.1979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7844 -2.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4882 -2.1902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2091 -2.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9211 -2.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9172 -1.3689 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6422 -2.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3544 -2.1780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0705 -2.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7873 -2.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4994 -2.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2157 -2.1739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2157 -1.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9161 -0.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9400 -2.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6609 -2.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3813 -2.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3813 -3.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6609 -3.8525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9407 -3.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4994 -3.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7873 -3.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0705 -3.4256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3544 -3.8402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6381 -3.4256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9253 -3.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9253 -4.6494 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2132 -3.4256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4964 -3.8402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7844 -3.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0756 -3.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3718 -3.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 42 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 9 4 2 0 0 0 0\n 5 6 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 42 10 2 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 40 12 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 38 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 15 2 0 0 0 0\n 18 17 1 0 0 0 0\n 35 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 2 0 0 0 0\n 33 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 31 21 2 0 0 0 0\n 22 23 1 0 0 0 0\n 22 25 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 30 25 2 0 0 0 0\n 26 27 2 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 2 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 2 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 36 38 2 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 2 0 0 0 0\n 41 42 1 0 0 0 0\nM END", "smiles": "CCn1c2ccccc2c3cc4c(cc31)Oc5c(c6=Nc7cc8c9ccccc9n(CC)c8cc7Oc6c(c5=N4)Cl)Cl", "formula": "C34H22Cl2N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f08da3f9-23ce-4c40-bdc0-0e9601ef5893" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "589.4712", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "13ec162d-5871-499c-a6e9-ff4c4cc63187", "version": "8", "structure": { "id": "92a14f91-db76-4a05-9e71-1a13633fc15d", "molfile": "\n Marvin 01132107362D \n\n 42 50 0 0 0 0 999 V2000\n -2.4538 -3.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4485 -2.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7535 -2.2143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0490 -2.6124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0496 -3.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7535 -3.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3370 -3.8402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3370 -4.6494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0413 -5.0517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3718 -3.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3718 -2.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0716 -2.1979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7844 -2.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7844 -3.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0756 -3.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4964 -3.8402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2132 -3.4256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2091 -2.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4882 -2.1902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9211 -2.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9172 -1.3689 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6422 -2.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6381 -3.4256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9253 -3.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9253 -4.6494 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3544 -3.8402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0705 -3.4256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0705 -2.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3544 -2.1780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7873 -2.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4994 -2.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2157 -2.1739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9400 -2.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6609 -2.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3813 -2.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3813 -3.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6609 -3.8525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9407 -3.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4994 -3.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7873 -3.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2157 -1.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9161 -0.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 1 1 0 0 0 0\n 7 5 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 7 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 4 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 10 1 0 0 0 0\n 16 14 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 13 1 0 0 0 0\n 20 18 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 20 2 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 17 2 0 0 0 0\n 26 23 2 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 22 1 0 0 0 0\n 30 28 1 0 0 0 0\n 31 30 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 2 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 2 0 0 0 0\n 38 37 1 0 0 0 0\n 38 33 2 0 0 0 0\n 39 38 1 0 0 0 0\n 39 40 2 0 0 0 0\n 40 27 1 0 0 0 0\n 39 31 1 0 0 0 0\n 32 41 1 0 0 0 0\n 41 42 1 0 0 0 0\nM END", "smiles": "CCn1c2ccccc2c3cc4c(cc31)Oc5c(c6=Nc7cc8c9ccccc9n(CC)c8cc7Oc6c(c5=N4)Cl)Cl", "formula": "C34H22Cl2N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "589.4712", "optical_activity": "NONE", "references": [ "bd3ee250-fabc-4557-9165-bb56b4a678ce", "3f7ddbee-e044-4ccd-8150-5cecd558e985" ], "stereo_centers": 0 }, "unii": "8U8Z6628KF" } ] }