{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4da9e9d7-1ab5-4ab4-ba5b-4ea82bd0665e",
          "code": "88-27-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=88-27-7",
          "code_system": "CAS",
          "references": [
            "67c88e24-64bf-4fdb-a11e-19ae69519f57",
            "b8df9b32-819e-49a2-b491-02bf3b63e6bc"
          ]
        },
        {
          "uuid": "8fdf02c7-5ea2-4d41-b6f9-5c2d6ea34889",
          "code": "201-816-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.651",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "67c88e24-64bf-4fdb-a11e-19ae69519f57"
          ]
        },
        {
          "uuid": "60a5c10b-cc86-405a-b5c9-8e725c482371",
          "code": "66609",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66609",
          "code_system": "PUBCHEM",
          "references": [
            "67c88e24-64bf-4fdb-a11e-19ae69519f57"
          ]
        },
        {
          "uuid": "f75d5b6d-7af6-436e-141e-7be6c5543b8d",
          "code": "DTXSID0044997",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0044997",
          "code_system": "EPA CompTox",
          "references": [
            "bd3ae411-0edb-851c-aead-3e78b2669038"
          ]
        },
        {
          "uuid": "4e069d0c-4d82-4a56-bc76-88baa72bb62f",
          "code": "8TK6VR2KYX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "03c94969-753c-7193-1a3b-84cbc20af16b",
          "code": "27823",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=27823",
          "code_system": "NSC",
          "references": [
            "4a5b003d-fd43-72de-e1cc-83f4ab3cd125"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3979c01e-c9e8-4797-a8ce-5ff6d8dfb61c",
          "name": "2,6-DI-TERT-BUTYL-4-((DIMETHYLAMINO)METHYL)PHENOL",
          "stdName": "2,6-DI-TERT-BUTYL-4-((DIMETHYLAMINO)METHYL)PHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ada4bd89-7e5e-4329-9e7b-681daa1b9990",
            "e6ed3147-2c8f-44bb-b746-36fd7d9c99cd"
          ],
          "display_name": false
        },
        {
          "uuid": "efd935c4-a35e-4391-94c4-21f0b92106ee",
          "name": "2,6-DI-TERT-BUTYL-4-(DIMETHYLAMINO)METHYLPHENOL",
          "stdName": "2,6-DI-TERT-BUTYL-4-(DIMETHYLAMINO)METHYLPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6ed3147-2c8f-44bb-b746-36fd7d9c99cd",
            "52b5153c-646e-44dc-b726-488431ac457b"
          ],
          "display_name": true
        },
        {
          "uuid": "5c7aa289-ce20-4d1c-be7d-608461325718",
          "name": "2,6-DI-TERT-BUTYL-4-(DIMETHYLAMINOMETHYL)PHENOL",
          "stdName": "2,6-DI-TERT-BUTYL-4-(DIMETHYLAMINOMETHYL)PHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6ed3147-2c8f-44bb-b746-36fd7d9c99cd",
            "0bfde03a-9ebd-4ebd-ba46-8ea141678388"
          ],
          "display_name": false
        },
        {
          "uuid": "9081d7fd-2455-4c1c-8fb1-a14792ed75cb",
          "name": "ETHYL 703",
          "stdName": "ETHYL 703",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6ed3147-2c8f-44bb-b746-36fd7d9c99cd",
            "d4354a9f-5f9c-481b-9d5e-16dc2494d8f1"
          ],
          "display_name": false
        },
        {
          "uuid": "314654fe-c27c-47ae-8c54-00e7261ba1fe",
          "name": "IONOL 103",
          "stdName": "IONOL 103",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6ed3147-2c8f-44bb-b746-36fd7d9c99cd",
            "0bfde03a-9ebd-4ebd-ba46-8ea141678388"
          ],
          "display_name": false
        },
        {
          "uuid": "dba7edb0-1911-4abc-a769-c3b1f9e77332",
          "name": "NSC-27823",
          "stdName": "NSC-27823",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6ed3147-2c8f-44bb-b746-36fd7d9c99cd",
            "d4354a9f-5f9c-481b-9d5e-16dc2494d8f1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d4354a9f-5f9c-481b-9d5e-16dc2494d8f1",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e6ed3147-2c8f-44bb-b746-36fd7d9c99cd",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52b5153c-646e-44dc-b726-488431ac457b",
          "citation": "http://www.chemblink.com/products/88-27-7.htm",
          "url": "http://www.chemblink.com/products/88-27-7.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bfde03a-9ebd-4ebd-ba46-8ea141678388",
          "citation": "http://www.chemexper.com/chemicals/supplier/cas/88-27-7.html",
          "url": "http://www.chemexper.com/chemicals/supplier/cas/88-27-7.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ada4bd89-7e5e-4329-9e7b-681daa1b9990",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67c88e24-64bf-4fdb-a11e-19ae69519f57",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391630000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "181305de-7f5c-47a7-85d7-06267f6ae079",
          "citation": "SRS import [8TK6VR2KYX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8TK6VR2KYX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391630000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c6eb2af-cac0-4463-96b1-28023cbe7d6c",
          "citation": "CHEMID RECORD 88-27-7",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd3ae411-0edb-851c-aead-3e78b2669038",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=88-27-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b8df9b32-819e-49a2-b491-02bf3b63e6bc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4a5b003d-fd43-72de-e1cc-83f4ab3cd125",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8edb3fd2-5e8b-45e1-a706-47780eaa79ad",
          "id": "8edb3fd2-5e8b-45e1-a706-47780eaa79ad",
          "molfile": "\n  Marvin  01132107242D          \n\n 19 19  0  0  0  0            999 V2000\n    0.9042   -3.7037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6170   -3.2960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3320   -3.7102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6185   -2.4675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3311   -2.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0411   -2.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7611   -2.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7611   -1.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4724   -0.8180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0411   -0.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3311   -1.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0386    0.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2303    0.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8303    0.4670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0403    0.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4724   -2.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0942   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4716   -3.2186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1879   -2.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 11  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7 16  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1cc(cc(c1O)C(C)(C)C)CN(C)C",
          "formula": "C17H29NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3a94ce24-909a-40e1-a093-e2bef15d8f59"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "263.4189",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2faae792-d2e8-43f1-a6e3-3e261412a5af",
      "version": "4",
      "structure": {
        "id": "93d37eb6-8c61-4872-814e-64ea8e9e8e69",
        "molfile": "\n  Marvin  01132107402D          \n\n 19 19  0  0  0  0            999 V2000\n    4.4724   -0.8180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7611   -1.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0411   -0.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3311   -1.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3311   -2.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0411   -2.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7611   -2.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4724   -2.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0942   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4716   -3.2186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1879   -2.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6185   -2.4675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6170   -3.2960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9042   -3.7037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3320   -3.7102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0386    0.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2303    0.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8303    0.4670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0403    0.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n  5 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n  3 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1cc(cc(c1O)C(C)(C)C)CN(C)C",
        "formula": "C17H29NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "263.4189",
        "optical_activity": "NONE",
        "references": [
          "181305de-7f5c-47a7-85d7-06267f6ae079",
          "3c6eb2af-cac0-4463-96b1-28023cbe7d6c"
        ],
        "stereo_centers": 0
      },
      "unii": "8TK6VR2KYX"
    }
  ]
}