{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0a0b2aa1-ff27-48bc-a21c-a5d84298ee52",
          "code": "74639-14-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=74639-14-8",
          "code_system": "CAS",
          "references": [
            "aeb3968f-df84-4ed6-affe-65e34c17cb0d",
            "0322d2dd-33d3-44f6-bd42-06a0d1d2c390"
          ]
        },
        {
          "uuid": "5b97ab63-4e3f-4850-843c-807d22666db7",
          "code": "10076238",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10076238",
          "code_system": "PUBCHEM",
          "references": [
            "aeb3968f-df84-4ed6-affe-65e34c17cb0d"
          ]
        },
        {
          "uuid": "999722f5-159c-4cab-8410-760ed0e7d8ea",
          "code": "8T57TH2CCD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b1e14e8a-e6e0-b579-e5e7-53a3cba6c7ec",
          "code": "DTXSID20904894",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20904894",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "5e8ea9d6-df9b-47b9-b77e-e1d049e4fe1a",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "52b2630c-5da7-4a36-9e91-d0c1c2fb286b"
          ],
          "related_substance": {
            "uuid": "138c2660-350e-46db-a112-559c8bd5a5e4",
            "refuuid": "74d8e55b-83f8-43f6-97e7-98b3a53ad5aa",
            "name": "GLYCYRRHIZA URALENSIS ROOT",
            "unii": "42B5YD8F0K",
            "linking_id": "42B5YD8F0K",
            "ref_pname": "GLYCYRRHIZA URALENSIS ROOT",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0e05b00b-f3d6-4895-be77-3ef5d74f4096",
          "name": "4H-1-BENZOPYRAN-4-ONE, 2-(4-((2-O-D-APIO-.BETA.-D-FURANOSYL-.BETA.-D-GLUCOPYRANOSYL)OXY)PHENYL)-2,3-DIHYDRO-7-HYDROXY-, (2S)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 2-(4-((2-O-D-APIO-.BETA.-D-FURANOSYL-.BETA.-D-GLUCOPYRANOSYL)OXY)PHENYL)-2,3-DIHYDRO-7-HYDROXY-, (2S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e840ac1c-1308-49f4-b2e8-64edd020eef2",
            "5113d9aa-a279-4fc7-855c-1471ffd61887"
          ],
          "display_name": false
        },
        {
          "uuid": "fa352cbb-a10e-4bbf-8a65-fd5583cbc9ae",
          "name": "LIQUIRITIGENIN 4'-O-APIOSYL-O-GLUCOSIDE",
          "stdName": "LIQUIRITIGENIN 4'-O-APIOSYL-O-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e840ac1c-1308-49f4-b2e8-64edd020eef2",
            "5113d9aa-a279-4fc7-855c-1471ffd61887"
          ],
          "display_name": false
        },
        {
          "uuid": "5b719bdb-e150-4a75-bf1b-9afe38dcfaeb",
          "name": "LIQUIRITIGENIN-4'-O-APIOSYL(1->2)GLUCOSIDE",
          "stdName": "LIQUIRITIGENIN-4'-O-APIOSYL(1->2)GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e840ac1c-1308-49f4-b2e8-64edd020eef2",
            "5113d9aa-a279-4fc7-855c-1471ffd61887"
          ],
          "display_name": false
        },
        {
          "uuid": "df45cb61-7023-4f92-8b18-be8348aec1d8",
          "name": "LIQUIRITIN APIOSIDE",
          "stdName": "LIQUIRITIN APIOSIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5113d9aa-a279-4fc7-855c-1471ffd61887",
            "206913c0-2dab-4787-8572-52c828ab1ab4",
            "7486c97e-0f1c-4737-91e7-7c9aec98af13",
            "c11dc0df-b812-4201-9b6e-57a9cea612dd"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6b777774-3f02-4078-9a18-540023a41c1c",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "206913c0-2dab-4787-8572-52c828ab1ab4",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5113d9aa-a279-4fc7-855c-1471ffd61887",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7486c97e-0f1c-4737-91e7-7c9aec98af13",
          "citation": "Xu J et al, Journal of separation science, 36(19)3295-3301,2013",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e840ac1c-1308-49f4-b2e8-64edd020eef2",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aeb3968f-df84-4ed6-affe-65e34c17cb0d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392604000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52b2630c-5da7-4a36-9e91-d0c1c2fb286b",
          "citation": "XU J ET AL, JOURNAL OF SEPARATION SCIENCE, 36(19)3295-3301,2013",
          "url": "http://onlinelibrary.wiley.com/doi/10.1002/jssc.201300410/pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "946b41a9-bf94-4295-a467-a0815fe744bc",
          "citation": "SRS import [8T57TH2CCD]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8T57TH2CCD",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392604000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c11dc0df-b812-4201-9b6e-57a9cea612dd",
          "citation": "LIQUIRITIN APIOSIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0322d2dd-33d3-44f6-bd42-06a0d1d2c390",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0b9d3cfe-fc39-4f6a-b857-a0abe10d0243",
          "id": "0b9d3cfe-fc39-4f6a-b857-a0abe10d0243",
          "molfile": "\n  Marvin  01132100512D          \n\n 39 43  0  0  1  0            999 V2000\n    9.0004   -3.4669    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.2859   -3.8794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2858   -4.7044    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.0003   -5.1169    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.7971   -4.9034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0002   -5.9420    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.7147   -6.3544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2857   -6.3544    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.2857   -7.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0002   -7.5919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5712   -5.9418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5713   -5.1168    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.8568   -4.7043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1423   -5.1168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4278   -4.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7133   -5.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7132   -5.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4277   -6.3543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1422   -5.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9988   -6.3542    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.9988   -7.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2843   -7.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2843   -8.4167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5698   -7.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8554   -7.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1409   -7.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1409   -6.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4265   -5.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8554   -5.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5698   -6.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2843   -5.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7536   -3.8023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3055   -3.1895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8932   -2.4754    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.6797   -1.6785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4766   -1.8920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1909   -2.1916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0866   -2.6468    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.4594   -2.0379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1 32  1  0  0  0  0\n 38  1  1  0  0  0  0\n  3  2  1  6  0  0  0\n  3  4  1  0  0  0  0\n  3 12  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  1  0  0  0\n  8 11  1  0  0  0  0\n  9 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 19 14  2  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 20 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 31  1  6  0  0  0\n 22 21  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 22  1  0  0  0  0\n 25 24  1  0  0  0  0\n 24 30  2  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  2  0  0  0  0\n 30 29  1  0  0  0  0\n 30 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 34 33  1  0  0  0  0\n 34 35  1  6  0  0  0\n 34 36  1  0  0  0  0\n 38 34  1  0  0  0  0\n 36 37  1  0  0  0  0\n 38 39  1  6  0  0  0\nM  END",
          "smiles": "c1cc(ccc1[C@@H]2CC(=O)c3ccc(cc3O2)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O[C@H]5[C@@H]([C@@](CO)(CO5)O)O",
          "formula": "C26H30O13",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "eda463e7-bd75-403b-89c8-9dc5c0e95706"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "550.5096",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5d7e86fa-ad60-49f5-89eb-7e1c19385ecc",
      "version": "5",
      "structure": {
        "id": "a84b28ce-9afd-4328-89cd-17c7f37f4612",
        "molfile": "\n  Marvin  01132108442D          \n\n 40 44  0  0  1  0            999 V2000\n    1.1409   -6.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8554   -5.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5698   -6.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5698   -7.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8554   -7.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1409   -7.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2843   -5.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9988   -6.3542    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.9988   -7.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2843   -7.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7132   -5.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4277   -6.3543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7133   -5.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4278   -4.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1423   -5.1168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1422   -5.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8568   -4.7043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5713   -5.1168    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.5712   -5.9418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2858   -4.7044    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.0003   -5.1169    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.0002   -5.9420    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.2857   -6.3544    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.2859   -3.8794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0004   -3.4669    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.0866   -2.6468    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.8932   -2.4754    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.3055   -3.1895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7536   -3.8023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2857   -7.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0002   -7.5919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7147   -6.3544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7971   -4.9034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2859   -3.0544    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4594   -2.0379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6797   -1.6785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4766   -1.8920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1909   -2.1916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2843   -8.4167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4265   -5.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  5  2  0  0  0  0\n  3  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  8 11  1  6  0  0  0\n 12 11  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 12 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 18 17  1  1  0  0  0\n 19 18  1  0  0  0  0\n 18 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 19 23  1  0  0  0  0\n 20 24  1  6  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 25  1  0  0  0  0\n 23 30  1  1  0  0  0\n 30 31  1  0  0  0  0\n 22 32  1  6  0  0  0\n 21 33  1  1  0  0  0\n 25 34  1  6  0  0  0\n 26 35  1  6  0  0  0\n 27 36  1  6  0  0  0\n 27 37  1  0  0  0  0\n 37 38  1  0  0  0  0\n 10 39  2  0  0  0  0\n  1 40  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1[C@@H]2CC(=O)c3ccc(cc3O2)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O[C@@]5([H])[C@@H]([C@@](CO)(CO5)O)O",
        "formula": "C26H30O13",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "550.5096",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "946b41a9-bf94-4295-a467-a0815fe744bc",
          "7486c97e-0f1c-4737-91e7-7c9aec98af13"
        ],
        "stereo_centers": 9
      },
      "unii": "8T57TH2CCD"
    }
  ]
}