{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "41e93042-43a4-d8fd-999b-602370efd8d4", "code": "17002-50-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=17002-50-5", "code_system": "CAS", "references": [ "1d49b2e2-7406-45e5-9525-cfbf2e6f7616" ] }, { "uuid": "083732a6-acfc-61fe-4eb4-a4f0acfcfd5b", "code": "135398698", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135398698", "code_system": "PUBCHEM", "references": [ "ae59d044-e3d7-86c1-03fd-5fd6d37a55c3" ] }, { "uuid": "385832d4-6ca3-8f13-ca56-2bfb0b7acfd2", "code": "DTXSID70735852", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70735852", "code_system": "EPA CompTox" }, { "uuid": "a27a3552-dbcb-43a5-bb49-5b8d73225792", "code": "8T3Z7X2Y9G", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "abbfb16b-e118-4e9b-beb5-17278f77366c", "name": "2-(4-Oxo-1,3-thiazolidin-2-ylidene)-1,3-benzothiazol-6-one", "stdName": "2-(4-OXO-1,3-THIAZOLIDIN-2-YLIDENE)-1,3-BENZOTHIAZOL-6-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1d49b2e2-7406-45e5-9525-cfbf2e6f7616" ], "display_name": false }, { "uuid": "ab4a3315-11ad-4d48-aab9-4c839139aa6e", "name": "2-(6-Hydroxy-2-benzothiazolyl)-4(5H)-thiazolone", "stdName": "2-(6-HYDROXY-2-BENZOTHIAZOLYL)-4(5H)-THIAZOLONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1d49b2e2-7406-45e5-9525-cfbf2e6f7616" ], "display_name": true }, { "uuid": "e72807f5-dca3-9c6e-af7f-f31e00938b63", "name": "2-(6-OXIDANYL-1,3-BENZOTHIAZOL-2-YL)-1,3-THIAZOL-4-ONE", "stdName": "2-(6-OXIDANYL-1,3-BENZOTHIAZOL-2-YL)-1,3-THIAZOL-4-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "270fb315-3535-835d-ea96-7b3d836d8701" ], "display_name": false }, { "uuid": "fc0b4ead-1e7c-4327-8d16-d7d19c9dcd64", "name": "2-Thiazolin-4-one, 2-(6-hydroxy-2-benzothiazolyl)-", "stdName": "2-THIAZOLIN-4-ONE, 2-(6-HYDROXY-2-BENZOTHIAZOLYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1d49b2e2-7406-45e5-9525-cfbf2e6f7616" ], "display_name": false }, { "uuid": "5d7a1132-07d8-40fd-bc89-65cfc92afeec", "name": "4(5H)-Thiazolone, 2-(6-hydroxy-2-benzothiazolyl)-", "stdName": "4(5H)-THIAZOLONE, 2-(6-HYDROXY-2-BENZOTHIAZOLYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1d49b2e2-7406-45e5-9525-cfbf2e6f7616" ], "display_name": false }, { "uuid": "c10444d5-6c1b-435e-bc36-a8ba9629e28e", "name": "Oxyluciferin", "stdName": "OXYLUCIFERIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1d49b2e2-7406-45e5-9525-cfbf2e6f7616" ], "display_name": false } ], "references": [ { "uuid": "270fb315-3535-835d-ea96-7b3d836d8701", "citation": "ZINC", "url": "http://zinc.docking.org/substances/subsets/in-vivo/", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "1d49b2e2-7406-45e5-9525-cfbf2e6f7616", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ae59d044-e3d7-86c1-03fd-5fd6d37a55c3", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "68691b2d-acc1-4910-a3b5-8d8522d20ac6", "id": "68691b2d-acc1-4910-a3b5-8d8522d20ac6", "molfile": "\n Marvin 01132105262D \n\n 16 18 0 0 0 0 999 V2000\n -0.8974 -4.7460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -4.0786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 -4.0786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6674 -3.2940 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.9840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6674 -1.4991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 1.4290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6674 -1.4991 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6674 -3.2940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 16 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 16 2 0 0 0 0\n 6 7 2 0 0 0 0\n 15 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 14 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\nM END", "smiles": "c1cc2c(cc1O)sc(C3=NC(=O)CS3)n2", "formula": "C10H6N2O2S2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "920afd0e-4a84-4efa-ac83-9ce2004392f6" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "250.2994", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "f60d1e06-769f-455d-ba4b-3a75670ff883", "version": "6", "structure": { "id": "b8c6e88e-35d5-4334-a6da-f28ab54d408d", "molfile": "ZINC000015216221\n Marvin 01132109332D \n\n 16 18 0 0 0 0 999 V2000\n -0.8974 -4.7460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -4.0786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 -4.0786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6674 -3.2940 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.9840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6674 -1.4991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 1.4290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6674 -1.4991 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6674 -3.2940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 5 16 2 0 0 0 0\n 16 2 1 0 0 0 0\n 15 6 1 0 0 0 0\n 14 8 1 0 0 0 0\nM END", "smiles": "c1cc2c(cc1O)sc(C3=NC(=O)CS3)n2", "formula": "C10H6N2O2S2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "250.2994", "optical_activity": "NONE", "references": [ "270fb315-3535-835d-ea96-7b3d836d8701", "1d49b2e2-7406-45e5-9525-cfbf2e6f7616" ], "stereo_centers": 0 }, "unii": "8T3Z7X2Y9G" } ] }