{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "98ca0295-dda5-4b47-abe7-0213c7b9ef82", "code": "19900-69-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=19900-69-7", "code_system": "CAS", "references": [ "a7f61e09-a491-49ee-9ea4-b6e13256f8b1", "e2805d87-9584-432f-868b-785374d025d8" ] }, { "uuid": "316254f4-33ed-4a78-b9a8-35e8a0031531", "code": "C043627", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67043627", "code_system": "MESH", "references": [ "a7f61e09-a491-49ee-9ea4-b6e13256f8b1" ] }, { "uuid": "2b972ed4-f204-4281-a1b1-09a11697589f", "code": "243-421-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.039.459", "code_system": "ECHA (EC/EINECS)", "references": [ "a7f61e09-a491-49ee-9ea4-b6e13256f8b1" ] }, { "uuid": "7a52eaaa-665f-4757-a3a1-b67a54122920", "code": "88307", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/88307", "code_system": "PUBCHEM", "references": [ "a7f61e09-a491-49ee-9ea4-b6e13256f8b1" ] }, { "uuid": "b0335d50-3609-a42b-317b-7a6a35333517", "code": "DTXSID9066544", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9066544", "code_system": "EPA CompTox", "references": [ "d50f82c4-0427-e8a9-cc41-d1937e1d6883" ] }, { "uuid": "acba5f7d-8f6a-4d3a-a156-46874ca05319", "code": "8SEG5U60DC", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "3650ec7e-0f71-4d3d-98d8-defab35e96c7", "name": "3,3',5,5'-TETRAISOPROPYL-4,4'-DIAMINODIPHENYLMETHANE", "stdName": "3,3',5,5'-TETRAISOPROPYL-4,4'-DIAMINODIPHENYLMETHANE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5281669b-667d-4fbe-9268-4ae0343772f3", "85fb0d10-e41e-4873-98fe-e19864f92d46" ], "display_name": false }, { "uuid": "59861939-3bae-44f8-b9ba-26bcd067131a", "name": "4,4'-METHYLENEBIS(2,6-DIISOPROPYLANILINE)", "stdName": "4,4'-METHYLENEBIS(2,6-DIISOPROPYLANILINE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "85fb0d10-e41e-4873-98fe-e19864f92d46" ], "display_name": true }, { "uuid": "87533b3b-0004-4d3d-9068-c99bd3a6ec6a", "name": "ANILINE, 4,4'-METHYLENEBIS(2,6-DIISOPROPYL-", "stdName": "ANILINE, 4,4'-METHYLENEBIS(2,6-DIISOPROPYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5281669b-667d-4fbe-9268-4ae0343772f3", "85fb0d10-e41e-4873-98fe-e19864f92d46" ], "display_name": false }, { "uuid": "fbd00149-aefc-4db0-b433-72f30ab0ced6", "name": "BENZENAMINE, 4,4'-METHYLENEBIS(2,6-BIS(1-METHYLETHYL)-", "stdName": "BENZENAMINE, 4,4'-METHYLENEBIS(2,6-BIS(1-METHYLETHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5281669b-667d-4fbe-9268-4ae0343772f3", "85fb0d10-e41e-4873-98fe-e19864f92d46" ], "display_name": false }, { "uuid": "7390d952-dd1b-4c64-8e49-3516217a1795", "name": "BIS(3,5-DIISOPROPYL-4-AMINOPHENYL)METHANE", "stdName": "BIS(3,5-DIISOPROPYL-4-AMINOPHENYL)METHANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5281669b-667d-4fbe-9268-4ae0343772f3", "85fb0d10-e41e-4873-98fe-e19864f92d46" ], "display_name": false }, { "uuid": "de153904-5253-4fd0-8eed-ad4387c12084", "name": "LONZACURE M-DIPA", "stdName": "LONZACURE M-DIPA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5281669b-667d-4fbe-9268-4ae0343772f3", "85fb0d10-e41e-4873-98fe-e19864f92d46" ], "display_name": false } ], "references": [ { "uuid": "85fb0d10-e41e-4873-98fe-e19864f92d46", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "5281669b-667d-4fbe-9268-4ae0343772f3", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a7f61e09-a491-49ee-9ea4-b6e13256f8b1", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391017000, "tags": [ "NOMEN" ] }, { "uuid": "068e39d1-5418-48a7-a8dc-3b294f497c4d", "citation": "SRS import [8SEG5U60DC]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8SEG5U60DC", "doc_type": "SRS", "public_domain": true, "document_date": 1493391017000, "tags": [ "NOMEN" ] }, { "uuid": "7e9b3fb8-fd7f-44b3-89d9-c364f45ec489", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d50f82c4-0427-e8a9-cc41-d1937e1d6883", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=19900-69-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e2805d87-9584-432f-868b-785374d025d8", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4dbbebee-bb40-4be7-ab47-8d0912c58abd", "id": "4dbbebee-bb40-4be7-ab47-8d0912c58abd", "molfile": "\n Marvin 01132104032D \n\n 27 28 0 0 0 0 999 V2000\n 9.1676 -5.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1676 -4.9695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8777 -4.5612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4537 -4.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7350 -4.9685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0272 -4.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3104 -4.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3104 -5.7967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0184 -6.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0184 -7.0359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7346 -7.4532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7346 -8.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4471 -7.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3061 -7.4450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3061 -8.2700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5931 -7.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5931 -6.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8781 -7.4416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1608 -7.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8781 -8.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0272 -3.7309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7350 -3.3184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7350 -2.4934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4482 -2.0760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0217 -2.0856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4537 -3.7309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1676 -3.3175 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 26 2 0 0 0 0\n 6 5 2 0 0 0 0\n 6 7 1 0 0 0 0\n 21 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 17 2 0 0 0 0\n 10 9 2 0 0 0 0\n 10 11 1 0 0 0 0\n 14 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 14 2 0 0 0 0\n 17 16 1 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 22 21 2 0 0 0 0\n 22 23 1 0 0 0 0\n 26 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 27 26 1 0 0 0 0\nM END", "smiles": "CC(C)c1cc(Cc2cc(C(C)C)c(c(c2)C(C)C)N)cc(C(C)C)c1N", "formula": "C25H38N2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f541d321-c390-4e90-bb34-56ed2d2b23d6" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "366.5836", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "180c6030-7790-4c7d-8713-ca4b41ac286d", "version": "3", "structure": { "id": "066dd175-010a-45d7-aef2-93a704d35b2a", "molfile": "\n Marvin 01132100372D \n\n 27 28 0 0 0 0 999 V2000\n 9.1676 -3.3175 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4537 -3.7309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7350 -3.3184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0272 -3.7309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0272 -4.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7350 -4.9685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4537 -4.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1676 -4.9695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1676 -5.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8777 -4.5612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3104 -4.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3104 -5.7967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5931 -6.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5931 -7.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3061 -7.4450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3061 -8.2700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0184 -7.0359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7346 -7.4532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7346 -8.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4471 -7.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0184 -6.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8781 -7.4416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1608 -7.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8781 -8.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7350 -2.4934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4482 -2.0760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0217 -2.0856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 2 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 5 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 17 21 1 0 0 0 0\n 21 12 2 0 0 0 0\n 14 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 3 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 1 0 0 0 0\nM END", "smiles": "CC(C)c1cc(Cc2cc(C(C)C)c(c(c2)C(C)C)N)cc(C(C)C)c1N", "formula": "C25H38N2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "366.5836", "optical_activity": "NONE", "references": [ "068e39d1-5418-48a7-a8dc-3b294f497c4d", "7e9b3fb8-fd7f-44b3-89d9-c364f45ec489" ], "stereo_centers": 0 }, "unii": "8SEG5U60DC" } ] }