{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "24220e6d-8027-45d4-adf6-520d00c3a18e",
          "code": "1217-08-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1217-08-9",
          "code_system": "CAS",
          "references": [
            "c838698a-ecc9-4435-a367-09eb04b2e35b",
            "302895aa-033a-4463-8208-55c945ea8e60"
          ]
        },
        {
          "uuid": "50103a92-32a7-419d-b39a-34a1ee5ef5f8",
          "code": "214-934-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.013.577",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c838698a-ecc9-4435-a367-09eb04b2e35b"
          ]
        },
        {
          "uuid": "0c04c224-aa5e-4dc0-a32f-9c8d8a173c84",
          "code": "102580",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/102580",
          "code_system": "PUBCHEM",
          "references": [
            "c838698a-ecc9-4435-a367-09eb04b2e35b"
          ]
        },
        {
          "uuid": "748c2963-bb91-4f31-fae2-70476d05d597",
          "code": "DTXSID3027372",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3027372",
          "code_system": "EPA CompTox",
          "references": [
            "6eb04c41-02f1-a085-8305-c5cb05954d2f"
          ]
        },
        {
          "uuid": "db7478f2-3865-4693-b276-14d7641054e3",
          "code": "8Q5V177O23",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "66f9b483-9cba-489c-bf06-c01e3a163e3e",
          "name": ".BETA.,1,1,2,3,3-HEXAMETHYLINDAN-5-ETHANOL",
          "stdName": ".BETA.,1,1,2,3,3-HEXAMETHYLINDAN-5-ETHANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cd98f09-2a06-481d-9331-d5b151a0d5b6"
          ],
          "display_name": false
        },
        {
          "uuid": "924b7d8e-b6c6-4c42-82d6-41c4ebdfd6ec",
          "name": "1,1,2,3,3-PENTAMETHYL-5-(1-METHYL-2-HYDROXYETHYL)-INDAN",
          "stdName": "1,1,2,3,3-PENTAMETHYL-5-(1-METHYL-2-HYDROXYETHYL)-INDAN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "498aeca5-08ae-453a-b18b-72754c118492"
          ],
          "display_name": false
        },
        {
          "uuid": "04bd463b-5d82-47c8-825c-7f0c5b926f9f",
          "name": "1H-INDENE-5-ETHANOL, 2,3-DIHYDRO-.BETA.,1,1,2,3,3-HEXAMETHYL-",
          "stdName": "1H-INDENE-5-ETHANOL, 2,3-DIHYDRO-.BETA.,1,1,2,3,3-HEXAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fef056c-cca0-498f-8719-d45c2d04ce6a"
          ],
          "display_name": false
        },
        {
          "uuid": "72fe0c47-c58f-4a0d-afec-217379bf39e1",
          "name": "1H-INDENE-5-ETHANOL, 2,3-DIHYDRO-BETA,1,1,2,3,3-HEXAMETHYL-",
          "stdName": "1H-INDENE-5-ETHANOL, 2,3-DIHYDRO-BETA,1,1,2,3,3-HEXAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4be04d1-ba31-4964-bcf0-765f7d9df564"
          ],
          "display_name": true
        },
        {
          "uuid": "cdcdf7fc-fdfb-411a-952e-2cbf045f058d",
          "name": "2-(1',1',2',3',3'-PENTAMETHYLINDAN-5'-YL)PROPANOL",
          "stdName": "2-(1',1',2',3',3'-PENTAMETHYLINDAN-5'-YL)PROPANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fef056c-cca0-498f-8719-d45c2d04ce6a"
          ],
          "display_name": false
        },
        {
          "uuid": "e2d58566-7a9a-4b99-aba0-943027a43b1a",
          "name": "2-(1,1,2,3,3-PENTAMETHYL-2,3-DIHYDRO-1H-INDEN-5-YL)-1-PROPANOL",
          "stdName": "2-(1,1,2,3,3-PENTAMETHYL-2,3-DIHYDRO-1H-INDEN-5-YL)-1-PROPANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "498aeca5-08ae-453a-b18b-72754c118492"
          ],
          "display_name": false
        },
        {
          "uuid": "f1727c0e-5692-4fcd-9fc8-5c409f13bd55",
          "name": "2-(1,1,2,3,3-PENTAMETHYL-2H-INDEN-5-YL)PROPAN-1-OL",
          "stdName": "2-(1,1,2,3,3-PENTAMETHYL-2H-INDEN-5-YL)PROPAN-1-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30e3b21d-67e4-4224-b2e6-617abc7ced33"
          ],
          "display_name": false
        },
        {
          "uuid": "85dcfcfb-0af6-4aa5-ad72-9f83076f0d94",
          "name": "2-(1,1,2,3,3-PENTAMETHYLINDAN-5-YL)-1-PROPANOL",
          "stdName": "2-(1,1,2,3,3-PENTAMETHYLINDAN-5-YL)-1-PROPANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fef056c-cca0-498f-8719-d45c2d04ce6a"
          ],
          "display_name": false
        },
        {
          "uuid": "78b653f8-5c86-4afa-a1af-286628dbc581",
          "name": "2-(1,1,2,3,3-PENTAMETHYLINDAN-5-YL)PROPAN-1-OL",
          "stdName": "2-(1,1,2,3,3-PENTAMETHYLINDAN-5-YL)PROPAN-1-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30e3b21d-67e4-4224-b2e6-617abc7ced33"
          ],
          "display_name": false
        },
        {
          "uuid": "9c0ab3db-c87d-4416-a799-435652bd1502",
          "name": "5-(1-(HYDROXYMETHYL)ETHYL)-1,1,2,3,3-PENTAMETHYLINDANE",
          "stdName": "5-(1-(HYDROXYMETHYL)ETHYL)-1,1,2,3,3-PENTAMETHYLINDANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5cb1a55a-3b9e-4bfb-9c15-cf714d94a6c4"
          ],
          "display_name": false
        },
        {
          "uuid": "49c42241-f2bd-40c7-bd46-de572b3bacf1",
          "name": "5-INDANETHANOL, .BETA.,1,1,2,3,3-HEXAMETHYL-",
          "stdName": "5-INDANETHANOL, .BETA.,1,1,2,3,3-HEXAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fef056c-cca0-498f-8719-d45c2d04ce6a"
          ],
          "display_name": false
        },
        {
          "uuid": "268cd026-1711-4f2e-8bd2-1979b4195a57",
          "name": "J120.449A",
          "stdName": "J120.449A",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5cb1a55a-3b9e-4bfb-9c15-cf714d94a6c4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b4be04d1-ba31-4964-bcf0-765f7d9df564",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4fef056c-cca0-498f-8719-d45c2d04ce6a",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5cb1a55a-3b9e-4bfb-9c15-cf714d94a6c4",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J120.449A",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J120.449A",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8cd98f09-2a06-481d-9331-d5b151a0d5b6",
          "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/1217-08-9",
          "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/1217-08-9",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30e3b21d-67e4-4224-b2e6-617abc7ced33",
          "citation": "http://pubchem.ncbi.nlm.nih.gov/compound/102580#section=Top",
          "url": "http://pubchem.ncbi.nlm.nih.gov/compound/102580#section=Top",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "498aeca5-08ae-453a-b18b-72754c118492",
          "citation": "http://www.chemspider.com/Chemical-Structure.92652.html?rid=3bcf9f3b-5b44-432c-a84a-49673ce34c51",
          "url": "http://www.chemspider.com/Chemical-Structure.92652.html?rid=3bcf9f3b-5b44-432c-a84a-49673ce34c51",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c838698a-ecc9-4435-a367-09eb04b2e35b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392095000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "005d195d-9fe1-499e-9a30-53fd21dda255",
          "citation": "SRS import [8Q5V177O23]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8Q5V177O23",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392095000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6eb04c41-02f1-a085-8305-c5cb05954d2f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1217-08-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "302895aa-033a-4463-8208-55c945ea8e60",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "015ab615-9139-4cc0-9469-f06479eaa401",
          "id": "015ab615-9139-4cc0-9469-f06479eaa401",
          "molfile": "\n  Marvin  01132100232D          \n\n 18 19  0  0  0  0            999 V2000\n    1.4350    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4350   -0.8282    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.7146   -1.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1496   -1.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1496   -2.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8587   -2.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733   -2.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733   -1.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8587   -0.8282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3560   -0.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1916   -0.1815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9742   -0.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8438   -1.6562    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.6720   -1.6562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3560   -2.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1916   -3.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9742   -2.8757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 10  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 16  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 11  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  END",
          "smiles": "CC(CO)c1ccc2c(c1)C(C)(C)C(C)C2(C)C",
          "formula": "C17H26O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "aa549b86-075e-45d8-93bb-e4e5e8e2d093"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "246.3884",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ec75d380-c9ed-4402-a9d3-36723a1a99f0",
      "version": "4",
      "structure": {
        "id": "03adbe1b-01a9-422f-bc98-6da0950e68fa",
        "molfile": "\n  Marvin  01132100302D          \n\n 18 19  0  0  0  0            999 V2000\n    4.8438   -1.6562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733   -1.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3560   -0.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733   -2.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3560   -2.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8587   -0.8282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8587   -2.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1496   -2.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1496   -1.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7146   -1.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4350   -0.8282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4350    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1916   -3.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9742   -2.8757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6720   -1.6562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1916   -0.1815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9742   -0.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  1 16  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3 17  1  0  0  0  0\n  3 18  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  7  1  0  0  0  0\n  5 14  1  0  0  0  0\n  5 15  1  0  0  0  0\n  6  9  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 11  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  1  0  0  0  0\nM  END",
        "smiles": "CC(CO)c1ccc2c(c1)C(C)(C)C(C)C2(C)C",
        "formula": "C17H26O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "246.3884",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "005d195d-9fe1-499e-9a30-53fd21dda255",
          "b4be04d1-ba31-4964-bcf0-765f7d9df564"
        ],
        "stereo_centers": 2
      },
      "unii": "8Q5V177O23"
    }
  ]
}