{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c0cc6473-de36-413d-947a-9a0a6cdbff74", "code": "2870-32-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2870-32-8", "code_system": "CAS", "references": [ "9e62fe76-16de-424c-9688-0842ac8f313a", "2f024804-d36b-4aed-a39b-ec645be54f7e" ] }, { "uuid": "89adff31-8b88-475e-a844-c6b69f18873d", "code": "220-698-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.817", "code_system": "ECHA (EC/EINECS)", "references": [ "9e62fe76-16de-424c-9688-0842ac8f313a" ] }, { "uuid": "38533cbb-043a-c1b9-62d5-a469c3db84c6", "code": "DTXSID5041728", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5041728", "code_system": "EPA CompTox", "references": [ "ad18cf5c-90e6-d7e3-d1d7-fd44dc80c9dc" ] }, { "uuid": "17c4bddb-e9d5-4819-a902-3efa77a9a740", "code": "8Q5531T139", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "4dffadbd-b4f4-9ac3-8a8e-e0d3358035ed", "code": "47745", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=47745", "code_system": "NSC", "references": [ "98e2d9c6-9b0b-865b-a4ac-4a04d6e22454" ] } ], "substance_class": "chemical", "names": [ { "uuid": "929e02c1-ab3e-491a-b53d-815e8b8f9c42", "name": "2,2'-(1,2-ETHENEDIYL)BIS(5-((4-ETHOXYPHENYL)AZO)BENZENESULFONIC ACID), DISODIUM SALT", "stdName": "2,2'-(1,2-ETHENEDIYL)BIS(5-((4-ETHOXYPHENYL)AZO)BENZENESULFONIC ACID), DISODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9620510f-fbef-4e31-98a3-3c48fff9438e", "7117a219-59c1-4e76-a0b4-73b7f5d057d5" ], "display_name": false }, { "uuid": "09301f3f-a9a8-4547-82dd-941a106e82e7", "name": "AIREDALE YELLOW CHD", "stdName": "AIREDALE YELLOW CHD", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "425aa5b0-7267-48ac-ae01-84fd2d4cb89e", "9620510f-fbef-4e31-98a3-3c48fff9438e" ], "display_name": false }, { "uuid": "2f1a1f78-7808-4f76-883d-812867869c9a", "name": "AUROPHENINE O", "stdName": "AUROPHENINE O", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "425aa5b0-7267-48ac-ae01-84fd2d4cb89e", "9620510f-fbef-4e31-98a3-3c48fff9438e" ], "display_name": false }, { "uuid": "3d92b35b-20a9-4dc0-8cf5-749306636406", "name": "BENZENESULFONIC ACID, 2,2'-(1,2-ETHENEDIYL)BIS(5-((4-ETHOXYPHENYL)AZO)-, DISODIUM SALT", "stdName": "BENZENESULFONIC ACID, 2,2'-(1,2-ETHENEDIYL)BIS(5-((4-ETHOXYPHENYL)AZO)-, DISODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9620510f-fbef-4e31-98a3-3c48fff9438e", "7117a219-59c1-4e76-a0b4-73b7f5d057d5" ], "display_name": false }, { "uuid": "83e299c8-7851-4d35-98ca-c1c5a1fa7ff1", "name": "C.I. DIRECT YELLOW 12", "stdName": "C.I. DIRECT YELLOW 12", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "425aa5b0-7267-48ac-ae01-84fd2d4cb89e", "9620510f-fbef-4e31-98a3-3c48fff9438e" ], "display_name": false }, { "uuid": "bd7ffaad-68c3-4bd1-b3fa-21cb81622d80", "name": "CHROME LEATHER YELLOW CH", "stdName": "CHROME LEATHER YELLOW CH", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "425aa5b0-7267-48ac-ae01-84fd2d4cb89e", "9620510f-fbef-4e31-98a3-3c48fff9438e" ], "display_name": false }, { "uuid": "baa85a38-9a59-4810-b0a8-ce74e6aaefcb", "name": "DIRECT YELLOW 12", "stdName": "DIRECT YELLOW 12", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "9620510f-fbef-4e31-98a3-3c48fff9438e", "4e9773d0-2981-40b0-9fcb-84b666ad831f", "7117a219-59c1-4e76-a0b4-73b7f5d057d5" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "fdbed768-7a1f-4054-8cc9-b920aa8d1454", "name_org": "INCI" } ] }, { "uuid": "3043fbd7-11ae-4120-9e81-6a1982ad59f4", "name": "NSC-47745", "stdName": "NSC-47745", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "425aa5b0-7267-48ac-ae01-84fd2d4cb89e", "9620510f-fbef-4e31-98a3-3c48fff9438e" ], "display_name": false } ], "references": [ { "uuid": "7117a219-59c1-4e76-a0b4-73b7f5d057d5", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "9620510f-fbef-4e31-98a3-3c48fff9438e", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "425aa5b0-7267-48ac-ae01-84fd2d4cb89e", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9e62fe76-16de-424c-9688-0842ac8f313a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391525000, "tags": [ "NOMEN" ] }, { "uuid": "4beb8922-2ba3-4ff3-810f-584f6d90378e", "citation": "SRS import [8Q5531T139]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8Q5531T139", "doc_type": "SRS", "public_domain": true, "document_date": 1493391525000, "tags": [ "NOMEN" ] }, { "uuid": "4e9773d0-2981-40b0-9fcb-84b666ad831f", "citation": "DIRECT YELLOW 12 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ad18cf5c-90e6-d7e3-d1d7-fd44dc80c9dc", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2870-32-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2f024804-d36b-4aed-a39b-ec645be54f7e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "98e2d9c6-9b0b-865b-a4ac-4a04d6e22454", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "09a9d0c4-416b-4392-a278-749e89cb4491", "id": "09a9d0c4-416b-4392-a278-749e89cb4491", "molfile": "\n Marvin 01132100462D \n\n 1 0 0 0 0 0 999 V2000\n 11.7663 -26.7498 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "86268746-759f-4bc7-a3cd-f3de1f094682" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "e72c4f6e-8925-4bb7-8641-1f452fba1128", "id": "e72c4f6e-8925-4bb7-8641-1f452fba1128", "molfile": "\n Marvin 01132111582D \n\n 44 47 0 0 0 0 999 V2000\n 24.1342 -22.5074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.3026 -22.4599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8497 -23.1228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0247 -23.1228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6461 -22.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.8211 -22.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3679 -23.0416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7399 -23.7312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5850 -23.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5566 -22.9941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0834 -23.6298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2719 -23.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8999 -22.9131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0548 -22.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6152 -23.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7904 -23.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4387 -22.7844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6139 -22.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1742 -23.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3291 -23.3661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9572 -22.6560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4103 -21.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2352 -22.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6949 -21.3038 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2629 -20.6885 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 15.3441 -21.8244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1405 -20.6885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1458 -22.6019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6726 -23.2849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8611 -23.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4891 -22.5210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6440 -22.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2044 -23.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3795 -23.1700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9265 -23.7989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0948 -23.7989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5831 -23.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4080 -23.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9939 -24.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8187 -24.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5342 -24.9685 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9661 -25.5703 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 15.8850 -24.4479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0885 -25.5838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 9 4 2 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 10 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 40 12 2 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 15 39 2 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 23 2 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 2 0 0 0 0\n 21 28 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 2 0 0 0 0\n 24 27 2 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 38 2 0 0 0 0\n 31 32 2 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 37 33 2 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 38 37 1 0 0 0 0\n 39 40 1 0 0 0 0\n 39 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 41 43 2 0 0 0 0\n 41 44 2 0 0 0 0\nM CHG 2 25 -1 42 -1\nM END", "smiles": "CCOc1ccc(cc1)/N=N/c2ccc(/C=C/c3ccc(cc3S(=O)(=O)[O-])/N=N/c4ccc(cc4)OCC)c(c2)S(=O)(=O)[O-]", "formula": "C30H26N4O8S2", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "21b191da-acc0-41ac-ad15-0e2b3eda5645" }, "defined_stereo": 0, "ez_centers": 3, "molecular_weight": "634.6828", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "4a073c25-2279-4c14-8147-c07459a90140", "version": "5", "structure": { "id": "7ee1ec06-1fb0-47e1-9568-e7473f0fad5c", "molfile": "\n Marvin 01132106352D \n\n 46 47 0 0 0 0 999 V2000\n 24.1342 -22.5074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.3026 -22.4599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8497 -23.1228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0247 -23.1228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5850 -23.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7399 -23.7312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3679 -23.0416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.8211 -22.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6461 -22.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5566 -22.9941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0834 -23.6298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2719 -23.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8999 -22.9131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0548 -22.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6152 -23.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9939 -24.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5342 -24.9685 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9661 -25.5703 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 15.8850 -24.4479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0885 -25.5838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8187 -24.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7904 -23.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4387 -22.7844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6139 -22.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1742 -23.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3291 -23.3661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9572 -22.6560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1458 -22.6019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6726 -23.2849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8611 -23.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4080 -23.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5831 -23.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2044 -23.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3795 -23.1700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9265 -23.7989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0948 -23.7989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6440 -22.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4891 -22.5210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4103 -21.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2352 -22.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6949 -21.3038 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2629 -20.6885 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 15.3441 -21.8244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1405 -20.6885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7663 -26.7498 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 11.7663 -26.7498 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 4 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 7 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 2 0 0 0 0\n 17 20 2 0 0 0 0\n 21 12 1 0 0 0 0\n 16 21 2 0 0 0 0\n 22 15 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 2 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 37 33 2 0 0 0 0\n 38 37 1 0 0 0 0\n 30 38 2 0 0 0 0\n 39 27 2 0 0 0 0\n 40 39 1 0 0 0 0\n 24 40 2 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 41 43 2 0 0 0 0\n 41 44 2 0 0 0 0\nM CHG 4 18 -1 42 -1 45 1 46 1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 2 45 46\nM SPA 1 1 45\nM SDI 1 4 11.3463 -27.1698 11.3463 -26.3298\nM SDI 1 4 12.1863 -26.3298 12.1863 -27.1698\nM SMT 1 2\nM END", "smiles": "CCOc1ccc(cc1)/N=N/c2ccc(/C=C/c3ccc(cc3S(=O)(=O)[O-])/N=N/c4ccc(cc4)OCC)c(c2)S(=O)(=O)[O-].[Na+].[Na+]", "formula": "C30H26N4O8S2.2Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 3, "molecular_weight": "680.6623", "optical_activity": "NONE", "references": [ "425aa5b0-7267-48ac-ae01-84fd2d4cb89e", "4beb8922-2ba3-4ff3-810f-584f6d90378e" ], "stereo_centers": 0 }, "unii": "8Q5531T139" } ] }