{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "54f2f758-2039-471a-8883-78334bd6ef1a", "code": "107534-93-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=107534-93-0", "code_system": "CAS", "references": [ "8d1bc7bd-fd5d-432f-b87e-4b49545558d4", "30711759-6625-4eb3-936d-a1e2c2bc0946" ] }, { "uuid": "52c2df06-8e7f-4cf6-9a2e-39454a8e10c3", "code": "C92606", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C92606", "code_system": "NCI_THESAURUS", "references": [ "8d1bc7bd-fd5d-432f-b87e-4b49545558d4" ] }, { "uuid": "55dc6a22-6381-4266-a7b5-241d9deda4d4", "code": "C502026", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67502026", "code_system": "MESH", "references": [ "8d1bc7bd-fd5d-432f-b87e-4b49545558d4" ] }, { "uuid": "3ff15e9f-f950-43d5-9b76-95a5be08467d", "code": "MACELIGNAN", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Macelignan", "code_system": "WIKIPEDIA", "references": [ "8d1bc7bd-fd5d-432f-b87e-4b49545558d4" ] }, { "uuid": "f5e26cdd-c187-4ec2-9394-65e406e90545", "code": "10404245", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10404245", "code_system": "PUBCHEM", "references": [ "8d1bc7bd-fd5d-432f-b87e-4b49545558d4" ] }, { "uuid": "0d47bcf4-95e8-627b-d52c-e2bd876f0928", "code": "1872381", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1872381/allProperties.xml?prop=all", "code_system": "RXCUI" }, { "uuid": "8463ba10-bfa4-be9c-47c6-81a59655a91a", "code": "DTXSID00148077", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00148077", "code_system": "EPA CompTox", "references": [ "7d4a71e0-c19c-63ad-4277-a3e6c7e50c8e" ] }, { "uuid": "5c3016a8-b6f0-4ba8-8415-4545268b173a", "code": "C52588", "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antibacterial Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C52588", "code_system": "NCI_THESAURUS", "references": [ "64791602-721a-7e65-082d-3d5552e5e817" ] }, { "uuid": "f6dbc192-2411-c22b-8689-f884a2fcc92d", "code": "C28203", "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Polyphenol", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28203", "code_system": "NCI_THESAURUS", "references": [ "64791602-721a-7e65-082d-3d5552e5e817" ] }, { "uuid": "77256eb2-b219-57c9-0420-d80e27d5e711", "code": "DB14129", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB14129", "code_system": "DRUG BANK", "references": [ "64791602-721a-7e65-082d-3d5552e5e817" ] }, { "uuid": "a11f418b-a114-44ed-8bab-d9007d904e71", "code": "8PP3614Z43", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "3dbb5ed9-9e8b-0867-daa0-7d6ca5bf5a86", "code": "8PP3614Z43", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8PP3614Z43", "code_system": "DAILYMED", "references": [ "9358f07f-6ede-5989-6da4-808c60a3110f" ] } ], "relationships": [ { "uuid": "702bf241-0c2d-4d5b-bd4b-4f23cbaeb96b", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "a5180283-df48-425f-99ae-fcbaf37d9be3", "refuuid": "686f685f-d068-4c61-95c6-07566c004bfe", "name": "MACELIGNAN", "unii": "8PP3614Z43", "linking_id": "8PP3614Z43", "ref_pname": "MACELIGNAN", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "ffd0e49c-49d3-47e1-aed3-7e4d41a53a8c", "name": "(8R,8'S)-7-(3,4-METHYLENEDIOXYPHENYL)-7'-(4-HYDROXY-3-METHOXYPHENYL)-8,8'-DIMETHYLBUTANE", "stdName": "(8R,8'S)-7-(3,4-METHYLENEDIOXYPHENYL)-7'-(4-HYDROXY-3-METHOXYPHENYL)-8,8'-DIMETHYLBUTANE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "80b5464d-84b5-4531-88b1-4fe7f920220f" ], "display_name": false }, { "uuid": "85e44530-5a7d-4a6b-bee9-97bbc9755a17", "name": "MACELIGNAN", "stdName": "MACELIGNAN", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "6d5dab37-c718-4826-80c6-45c32c7855b0", "ae888c33-13c4-4b12-8be3-15625d79e0fc", "d35ddda6-6848-4579-82cd-83bb762c431e" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "cf488fe6-6736-4151-a741-bca150a2330b", "name_org": "INCI" } ] }, { "uuid": "49932f03-c8f3-41a3-bf15-7c292cafb706", "name": "PHENOL, 4-((2S,3R)-4-(1,3-BENZODIOXOL-5-YL)-2,3-DIMETHYLBUTYL)-2-METHOXY-", "stdName": "PHENOL, 4-((2S,3R)-4-(1,3-BENZODIOXOL-5-YL)-2,3-DIMETHYLBUTYL)-2-METHOXY-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "499ddc31-7f58-47c8-a64a-8f742d31fc3b" ], "display_name": false } ], "references": [ { "uuid": "80b5464d-84b5-4531-88b1-4fe7f920220f", "citation": "Biol. Pharm. Bull. 31(5) 986?989 (2008)", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "499ddc31-7f58-47c8-a64a-8f742d31fc3b", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d35ddda6-6848-4579-82cd-83bb762c431e", "citation": "http://ec.europa.eu/consumers/cosmetics/cosing/index.cfm?fuseaction=search.details&id=86571", "url": "http://ec.europa.eu/consumers/cosmetics/cosing/index.cfm?fuseaction=search.details&id=86571", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6d5dab37-c718-4826-80c6-45c32c7855b0", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8d1bc7bd-fd5d-432f-b87e-4b49545558d4", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390901000, "tags": [ "NOMEN" ] }, { "uuid": "c3cda840-6a9a-4352-800b-d31cee18d600", "citation": "SRS import [8PP3614Z43]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8PP3614Z43", "doc_type": "SRS", "public_domain": true, "document_date": 1493390901000, "tags": [ "NOMEN" ] }, { "uuid": "5e2ee443-fe73-424c-aab6-6205dc30645f", "citation": "http://www.jstage.jst.go.jp/article/bpb/31/5/986/_pdf", "url": "http://www.jstage.jst.go.jp/article/bpb/31/5/986/_pdf", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ae888c33-13c4-4b12-8be3-15625d79e0fc", "citation": "MACELIGNAN [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "7d4a71e0-c19c-63ad-4277-a3e6c7e50c8e", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=107534-93-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "64791602-721a-7e65-082d-3d5552e5e817", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "30711759-6625-4eb3-936d-a1e2c2bc0946", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "9358f07f-6ede-5989-6da4-808c60a3110f", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6c687ee6-8163-404b-8c55-32dc7a31c5b9", "id": "6c687ee6-8163-404b-8c55-32dc7a31c5b9", "molfile": "\n Marvin 01132105382D \n\n 24 26 0 0 1 0 999 V2000\n 1.8227 -1.0629 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 2.5371 -1.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1081 -1.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1081 -2.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3905 -2.7147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3953 -3.5392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1070 -3.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2785 -4.7553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0991 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4348 -4.0878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8216 -3.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8224 -2.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8227 -0.2378 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 2.5371 0.1747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1081 0.1749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3934 -0.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3934 -1.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3167 -1.4747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0331 -1.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6164 -1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0331 -0.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7475 0.1744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7475 0.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3185 0.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 13 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 12 4 2 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 11 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 14 1 6 0 0 0\n 13 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 24 2 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 19 2 0 0 0 0\n 21 22 1 0 0 0 0\n 24 21 1 0 0 0 0\n 22 23 1 0 0 0 0\nM END", "smiles": "C[C@@H](Cc1ccc(c(c1)OC)O)[C@H](C)Cc2ccc3c(c2)OCO3", "formula": "C20H24O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3538b280-5621-4f08-8618-014f23e2ba61" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "328.4029", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "686f685f-d068-4c61-95c6-07566c004bfe", "version": "9", "structure": { "id": "356a5bdf-c52e-4d69-a77f-a55aa0e0699f", "molfile": "\n Marvin 01132102512D \n\n 24 26 0 0 1 0 999 V2000\n -1.0331 -0.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0331 -1.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3167 -1.4747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3934 -1.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3934 -0.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3185 0.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1081 0.1749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8227 -0.2378 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 1.8227 -1.0629 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 1.1081 -1.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1081 -2.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8224 -2.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8216 -3.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1070 -3.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3953 -3.5392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3905 -2.7147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2785 -4.7553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0991 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4348 -4.0878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5371 -1.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5371 0.1747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6164 -1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7475 0.1744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7475 0.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 1 2 0 0 0 0\n 5 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 11 16 1 0 0 0 0\n 14 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 13 19 1 0 0 0 0\n 9 20 1 6 0 0 0\n 8 21 1 6 0 0 0\n 2 22 1 0 0 0 0\n 1 23 1 0 0 0 0\n 23 24 1 0 0 0 0\nM END", "smiles": "C[C@@H](Cc1ccc(c(c1)OC)O)[C@H](C)Cc2ccc3c(c2)OCO3", "formula": "C20H24O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "328.4029", "optical_activity": "UNSPECIFIED", "references": [ "c3cda840-6a9a-4352-800b-d31cee18d600", "5e2ee443-fe73-424c-aab6-6205dc30645f" ], "stereo_centers": 2 }, "unii": "8PP3614Z43" } ] }