{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "76380840-e921-41c3-8994-ccb8cb8ef14d",
          "code": "DIISOBUTYL ADIPATE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=5971",
          "code_system": "JECFA EVALUATION",
          "references": [
            "b4d63b8b-c9f3-4df4-b5dc-cef87220dabe"
          ]
        },
        {
          "uuid": "5153c6ca-701b-4d67-8099-d941ee1c4a1b",
          "code": "141-04-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=141-04-8",
          "code_system": "CAS",
          "references": [
            "b4d63b8b-c9f3-4df4-b5dc-cef87220dabe",
            "b1a6d026-d645-46c4-a447-222090baf4fd"
          ]
        },
        {
          "uuid": "ed76ae64-445d-49e9-b929-a540f9faf580",
          "code": "205-450-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.956",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b4d63b8b-c9f3-4df4-b5dc-cef87220dabe"
          ]
        },
        {
          "uuid": "b10b1660-5de8-40eb-b4ac-66c660c44d0e",
          "code": "1363599",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1363599/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b4d63b8b-c9f3-4df4-b5dc-cef87220dabe"
          ]
        },
        {
          "uuid": "59be58f7-056a-43f6-b1f7-a60512a1a0e7",
          "code": "8831",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8831",
          "code_system": "PUBCHEM",
          "references": [
            "b4d63b8b-c9f3-4df4-b5dc-cef87220dabe"
          ]
        },
        {
          "uuid": "195cbacd-fa11-4cd2-c0da-919b8ff7a1b6",
          "code": "345",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/345",
          "code_system": "HSDB",
          "references": [
            "bff31bb4-1fda-5b8f-c34f-65bb5db3b4a4"
          ]
        },
        {
          "uuid": "466237bf-43fb-0205-b2a4-8418738f1790",
          "code": "DTXSID9036690",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9036690",
          "code_system": "EPA CompTox",
          "references": [
            "e96f6c56-6d99-1115-3a63-c7fd4f7b2283"
          ]
        },
        {
          "uuid": "03519a15-da70-4436-8daa-8f2dfcd70425",
          "code": "8OPY05ZY7S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "dcf590a7-ad5d-1903-8768-5d0fadca4829",
          "code": "100000175413",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ce8f17d6-7dd3-703b-55c1-a40a9d9df028"
          ]
        },
        {
          "uuid": "c4f25a5b-ec86-c133-f87b-1d0921139bb9",
          "code": "6343",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=6343",
          "code_system": "NSC",
          "references": [
            "d16fb004-fba5-6f89-7120-f136cdaf9b86"
          ]
        },
        {
          "uuid": "da49f923-77af-3c9d-488f-6110b9185d5d",
          "code": "8OPY05ZY7S",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8OPY05ZY7S",
          "code_system": "DAILYMED",
          "references": [
            "715409b2-c450-670c-803d-de4e45645fac"
          ]
        },
        {
          "uuid": "94f547cb-097e-44a3-182f-d06997d25b0b",
          "code": "1945",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1945/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "ccd5adec-fd01-f2a7-5126-4b9c69d36291"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "799c8ecd-72eb-4773-9cfe-02f86d6ad4df",
          "name": "ADIPIC ACID BIS(2-METHYLPROPYL) ESTER",
          "stdName": "ADIPIC ACID BIS(2-METHYLPROPYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "7fe454eb-2c54-4573-a7d9-d88b6a9a7e67"
          ],
          "display_name": false
        },
        {
          "uuid": "4730a2aa-5b32-4fa6-90f6-e96153125e68",
          "name": "ADIPIC ACID DI-ISO-BUTYL ESTER",
          "stdName": "ADIPIC ACID DI-ISO-BUTYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "7fe454eb-2c54-4573-a7d9-d88b6a9a7e67"
          ],
          "display_name": false
        },
        {
          "uuid": "52a822d2-218a-4876-aaac-bb742fb07856",
          "name": "ADIPIC ACID, DIISOBUTYL ESTER",
          "stdName": "ADIPIC ACID, DIISOBUTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "7fe454eb-2c54-4573-a7d9-d88b6a9a7e67"
          ],
          "display_name": false
        },
        {
          "uuid": "d61f267b-406a-43d7-9170-0f48b6acf310",
          "name": "AEC DIISOBUTYL ADIPATE",
          "stdName": "AEC DIISOBUTYL ADIPATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "2f24cc78-4465-4a77-a836-116daf349969"
          ],
          "display_name": false
        },
        {
          "uuid": "871fdb55-0826-4696-9162-1cd231450a3b",
          "name": "CRODAMOL DIBA",
          "stdName": "CRODAMOL DIBA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "2f24cc78-4465-4a77-a836-116daf349969"
          ],
          "display_name": false
        },
        {
          "uuid": "89fc42b1-379e-46d4-add8-dc04cc468754",
          "name": "DIISOBUTYL ADIPATE",
          "stdName": "DIISOBUTYL ADIPATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "234cc7a9-6f09-4f84-b0ea-6dd35f8f853f",
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "1f1390ac-8050-4f4e-b1dd-086984481317",
            "80eb8b86-0122-4efc-ab6e-7bba8d944833",
            "2f24cc78-4465-4a77-a836-116daf349969",
            "525eb641-2260-46e3-bf85-46005d032efe"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "def1d0d0-a226-4f9f-b678-52aec314e8a1",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "34d74b57-92d5-4cfa-9402-b85f5831e24e",
          "name": "DIISOBUTYL ADIPATE [HSDB]",
          "stdName": "DIISOBUTYL ADIPATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "80eb8b86-0122-4efc-ab6e-7bba8d944833"
          ],
          "display_name": false
        },
        {
          "uuid": "76211b4e-c39f-4107-acde-e78be687bb53",
          "name": "DUB DIBA",
          "stdName": "DUB DIBA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "2f24cc78-4465-4a77-a836-116daf349969"
          ],
          "display_name": false
        },
        {
          "uuid": "e683e5a3-0632-4e72-b517-255d0dae1b3e",
          "name": "FEMA NO. 4475",
          "stdName": "FEMA NO. 4475",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "d020d1b0-b64e-4ce0-8d97-14e009670d19"
          ],
          "display_name": false
        },
        {
          "uuid": "dc52e3e1-4ebb-4079-b9d1-c79aa1e128b7",
          "name": "HALLTRESS DIBA SPECIAL",
          "stdName": "HALLTRESS DIBA SPECIAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "2f24cc78-4465-4a77-a836-116daf349969"
          ],
          "display_name": false
        },
        {
          "uuid": "f3a4ca69-7ed8-4df6-a032-717d65ca80b7",
          "name": "HEXANEDIOIC ACID, 1,6-BIS(2-METHYLPROPYL) ESTER",
          "stdName": "HEXANEDIOIC ACID, 1,6-BIS(2-METHYLPROPYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "7fe454eb-2c54-4573-a7d9-d88b6a9a7e67"
          ],
          "display_name": false
        },
        {
          "uuid": "5cd0d651-98d3-4bd4-b508-cce4e76abab8",
          "name": "HEXANEDIOIC ACID, BIS(2-METHYLPROPYL) ESTER",
          "stdName": "HEXANEDIOIC ACID, BIS(2-METHYLPROPYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "7fe454eb-2c54-4573-a7d9-d88b6a9a7e67"
          ],
          "display_name": false
        },
        {
          "uuid": "e49b80d9-2af9-4250-a582-79f309480e43",
          "name": "KAK DIBA",
          "stdName": "KAK DIBA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "2f24cc78-4465-4a77-a836-116daf349969"
          ],
          "display_name": false
        },
        {
          "uuid": "caf9598a-6d4f-46dc-afdd-30c966c23f7b",
          "name": "MATLUBE DIBA",
          "stdName": "MATLUBE DIBA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "2f24cc78-4465-4a77-a836-116daf349969"
          ],
          "display_name": false
        },
        {
          "uuid": "87a4ec9f-1201-4898-8e03-5d8e4ce40b37",
          "name": "NSC-6343",
          "stdName": "NSC-6343",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
            "d599aa7b-8138-49ba-85c2-2a9bc77406ca"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "234cc7a9-6f09-4f84-b0ea-6dd35f8f853f",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2f24cc78-4465-4a77-a836-116daf349969",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9f581e9-ef1b-41fa-862e-eb4e1bc9dfef",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7fe454eb-2c54-4573-a7d9-d88b6a9a7e67",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d020d1b0-b64e-4ce0-8d97-14e009670d19",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80eb8b86-0122-4efc-ab6e-7bba8d944833",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d599aa7b-8138-49ba-85c2-2a9bc77406ca",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4d63b8b-c9f3-4df4-b5dc-cef87220dabe",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390934000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc488b49-7192-447f-a4fa-a2388c9d2f1a",
          "citation": "SRS import [8OPY05ZY7S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8OPY05ZY7S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390934000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c78bb65-3e8b-4f09-b65c-ac05ebd74261",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f1390ac-8050-4f4e-b1dd-086984481317",
          "citation": "DIISOBUTYL ADIPATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "525eb641-2260-46e3-bf85-46005d032efe",
          "citation": "DIISOBUTYL ADIPATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bff31bb4-1fda-5b8f-c34f-65bb5db3b4a4",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+141-04-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e96f6c56-6d99-1115-3a63-c7fd4f7b2283",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=141-04-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b1a6d026-d645-46c4-a447-222090baf4fd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d16fb004-fba5-6f89-7120-f136cdaf9b86",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "715409b2-c450-670c-803d-de4e45645fac",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ce8f17d6-7dd3-703b-55c1-a40a9d9df028",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ccd5adec-fd01-f2a7-5126-4b9c69d36291",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fa73cee6-2b2b-4d47-a5ae-df6daf2d64cf",
          "id": "fa73cee6-2b2b-4d47-a5ae-df6daf2d64cf",
          "molfile": "\n  Marvin  01132112582D          \n\n 18 17  0  0  0  0            999 V2000\n    2.5750   -4.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2897   -4.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2897   -5.7012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0088   -4.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7409   -4.8744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4555   -4.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4555   -3.6518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1745   -4.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9067   -4.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5997   -4.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3277   -4.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0421   -4.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0421   -5.7228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7702   -4.4826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4934   -4.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2080   -4.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9230   -4.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2080   -3.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  END",
          "smiles": "CC(C)COC(=O)CCCCC(=O)OCC(C)C",
          "formula": "C14H26O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "80f07fec-844b-409b-99bb-380d71f9fb96"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "258.3544",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d518d280-d6c9-4310-87bb-cd1cd5bcd161",
      "version": "9",
      "structure": {
        "id": "8b064d6a-fa9b-49cd-9e95-94cb81d0e6fe",
        "molfile": "\n  Marvin  01132107132D          \n\n 18 17  0  0  0  0            999 V2000\n    5.4555   -4.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7409   -4.8744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0088   -4.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2897   -4.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5750   -4.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2897   -5.7012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1745   -4.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9067   -4.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5997   -4.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3277   -4.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0421   -4.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7702   -4.4826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4934   -4.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2080   -4.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9230   -4.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2080   -3.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0421   -5.7228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4555   -3.6518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 11 17  2  0  0  0  0\n  1 18  2  0  0  0  0\nM  END",
        "smiles": "CC(C)COC(=O)CCCCC(=O)OCC(C)C",
        "formula": "C14H26O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "258.3544",
        "optical_activity": "NONE",
        "references": [
          "9c78bb65-3e8b-4f09-b65c-ac05ebd74261",
          "fc488b49-7192-447f-a4fa-a2388c9d2f1a"
        ],
        "stereo_centers": 0
      },
      "unii": "8OPY05ZY7S"
    }
  ]
}