{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9c590e08-69e4-40eb-bcac-454aaeb40028", "code": "93803-89-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=93803-89-5", "code_system": "CAS", "references": [ "3e2308ed-ee78-4b14-8116-0d7e881c7174", "b53b5e8a-0731-4695-a1af-cd4f10d318a4" ] }, { "uuid": "ec75366c-f4a2-4cfd-9ff1-25288e5d02c4", "code": "298-364-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.089.379", "code_system": "ECHA (EC/EINECS)", "references": [ "3e2308ed-ee78-4b14-8116-0d7e881c7174" ] }, { "uuid": "3fe3936f-2ed7-4803-9d02-afcd1be36fb1", "code": "17907846", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17907846", "code_system": "PUBCHEM", "references": [ "3e2308ed-ee78-4b14-8116-0d7e881c7174" ] }, { "uuid": "be83ad11-8847-4f45-816b-a05fd3d627d4", "code": "8NR9444E9U", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "eae3f0a4-504d-fb87-b556-dc6315bd5871", "code": "DTXSID40917865", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40917865", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "13ee6c50-9652-4603-b559-309b065bbeb0", "name": "2,2-BIS(((1-OXOISONONYL)OXY)METHYL)-1,3-PROPANEDIYL DIISONONANOATE", "stdName": "2,2-BIS(((1-OXOISONONYL)OXY)METHYL)-1,3-PROPANEDIYL DIISONONANOATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "63422c89-04c0-434e-97c1-12cbfdae2008", "4d73652a-fd1b-42b2-ad84-d3b72aa4fc78" ], "display_name": false }, { "uuid": "a59bc110-8675-4ec7-82b9-e8b4df72cc05", "name": "ISONONANOIC ACID, 2,2-BIS(((1-OXOISONONYL)OXY)METHYL)-1,3-PROPANEDIYL ESTER", "stdName": "ISONONANOIC ACID, 2,2-BIS(((1-OXOISONONYL)OXY)METHYL)-1,3-PROPANEDIYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "63422c89-04c0-434e-97c1-12cbfdae2008", "5aee7c1d-cfb0-4ce7-a4f9-d2331fa9b55e" ], "display_name": false }, { "uuid": "6ddb35ad-5228-4f32-8531-4c773e0744d8", "name": "PELEMOL P 49", "stdName": "PELEMOL P 49", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "63422c89-04c0-434e-97c1-12cbfdae2008", "5aee7c1d-cfb0-4ce7-a4f9-d2331fa9b55e" ], "display_name": false }, { "uuid": "d1da0661-4c0b-4984-b850-e00b77547c32", "name": "PENTAERYTHRITOL TETRAISONANOATE", "stdName": "PENTAERYTHRITOL TETRAISONANOATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "63422c89-04c0-434e-97c1-12cbfdae2008", "5aee7c1d-cfb0-4ce7-a4f9-d2331fa9b55e" ], "display_name": false }, { "uuid": "8f2a24b6-cde9-45f1-9610-a8fd950745af", "name": "PENTAERYTHRITYL TETRAISONONANOATE", "stdName": "PENTAERYTHRITYL TETRAISONONANOATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "63422c89-04c0-434e-97c1-12cbfdae2008", "5aee7c1d-cfb0-4ce7-a4f9-d2331fa9b55e", "db10c81c-664f-4fea-b9ac-2c8be345fbc6", "ba2a9a7f-a48a-453a-817c-edb935e9a1ca" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "b9e806c4-a8f3-42a6-974c-6f8ad4c3bad1", "name_org": "INCI" } ] } ], "references": [ { "uuid": "ba2a9a7f-a48a-453a-817c-edb935e9a1ca", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "63422c89-04c0-434e-97c1-12cbfdae2008", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4d73652a-fd1b-42b2-ad84-d3b72aa4fc78", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5aee7c1d-cfb0-4ce7-a4f9-d2331fa9b55e", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3e2308ed-ee78-4b14-8116-0d7e881c7174", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392729000, "tags": [ "NOMEN" ] }, { "uuid": "5eb18cb8-1782-4e15-aa58-cb011a857e6a", "citation": "SRS import [8NR9444E9U]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8NR9444E9U", "doc_type": "SRS", "public_domain": true, "document_date": 1493392729000, "tags": [ "NOMEN" ] }, { "uuid": "db10c81c-664f-4fea-b9ac-2c8be345fbc6", "citation": "PENTAERYTHRITYL TETRAISONONANOATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "b53b5e8a-0731-4695-a1af-cd4f10d318a4", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e3aacc41-096e-412d-ade1-176a28f41668", "id": "e3aacc41-096e-412d-ade1-176a28f41668", "molfile": "\n Marvin 01132111472D \n\n 49 48 0 0 0 0 999 V2000\n 14.2725 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5589 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5589 -1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8453 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1316 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4180 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7044 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9907 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2772 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2772 -1.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5635 -2.4834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8499 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1362 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1362 -3.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8499 -3.7251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8499 -4.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1220 -4.9668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5635 -4.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2772 -4.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9907 -4.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7044 -4.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4180 -4.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1316 -4.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8453 -4.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1174 -3.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1362 -1.6556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8499 -1.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8499 -0.4282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1220 -0.0143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5635 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2772 -0.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9907 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7044 -0.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4180 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1316 -0.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8453 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1174 -1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4226 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7090 -2.4834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9954 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9954 -1.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2818 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5681 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8545 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1409 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4273 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7136 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7279 -1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 26 1 0 0 0 0\n 13 38 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 28 29 2 0 0 0 0\n 28 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 35 36 1 0 0 0 0\n 35 37 1 0 0 0 0\n 39 38 1 0 0 0 0\n 40 39 1 0 0 0 0\n 40 41 2 0 0 0 0\n 40 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 45 44 1 0 0 0 0\n 46 45 1 0 0 0 0\n 47 46 1 0 0 0 0\n 47 48 1 0 0 0 0\n 47 49 1 0 0 0 0\nM END", "smiles": "CC(C)CCCCCC(=O)OCC(COC(=O)CCCCCC(C)C)(COC(=O)CCCCCC(C)C)COC(=O)CCCCCC(C)C", "formula": "C41H76O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "54e21cdf-63d7-44f3-8426-de26c192c90a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "697.0389", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "REPRESENTATIVE", "uuid": "26599684-cc75-43a7-9704-534c07f5e332", "version": "4", "structure": { "id": "a1515696-c2b1-4154-8690-cdfe6b96d6e2", "molfile": "\n Marvin 01132108232D \n\n 49 48 0 0 0 0 999 V2000\n 7.1362 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9954 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2772 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8499 -4.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8499 -0.4282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9954 -1.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1220 -4.9668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2772 -1.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1220 -0.0143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7090 -2.4834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8499 -1.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8499 -3.7251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5635 -2.4834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1362 -1.6556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4226 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8499 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1362 -3.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5635 -4.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2818 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9907 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5635 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7136 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1316 -4.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5589 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1316 -0.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2772 -4.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7044 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5681 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2772 -0.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4273 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8453 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4180 -4.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4180 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1316 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7044 -4.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1409 -2.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7044 -0.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8545 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9907 -4.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9907 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4180 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2725 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8453 -4.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1174 -3.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5589 -1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8453 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7279 -1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1174 -1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 14 1 0 0 0 0\n 1 15 1 0 0 0 0\n 1 16 1 0 0 0 0\n 1 17 1 0 0 0 0\n 2 10 1 0 0 0 0\n 2 6 2 0 0 0 0\n 2 19 1 0 0 0 0\n 3 13 1 0 0 0 0\n 3 8 2 0 0 0 0\n 3 20 1 0 0 0 0\n 4 12 1 0 0 0 0\n 4 7 2 0 0 0 0\n 4 18 1 0 0 0 0\n 5 11 1 0 0 0 0\n 5 9 2 0 0 0 0\n 5 21 1 0 0 0 0\n 10 15 1 0 0 0 0\n 11 14 1 0 0 0 0\n 12 17 1 0 0 0 0\n 13 16 1 0 0 0 0\n 18 26 1 0 0 0 0\n 19 28 1 0 0 0 0\n 20 27 1 0 0 0 0\n 21 29 1 0 0 0 0\n 22 30 1 0 0 0 0\n 22 47 1 0 0 0 0\n 22 48 1 0 0 0 0\n 23 32 1 0 0 0 0\n 23 43 1 0 0 0 0\n 23 44 1 0 0 0 0\n 24 31 1 0 0 0 0\n 24 42 1 0 0 0 0\n 24 45 1 0 0 0 0\n 25 33 1 0 0 0 0\n 25 46 1 0 0 0 0\n 25 49 1 0 0 0 0\n 26 39 1 0 0 0 0\n 27 41 1 0 0 0 0\n 28 38 1 0 0 0 0\n 29 40 1 0 0 0 0\n 30 36 1 0 0 0 0\n 31 34 1 0 0 0 0\n 32 35 1 0 0 0 0\n 33 37 1 0 0 0 0\n 34 41 1 0 0 0 0\n 35 39 1 0 0 0 0\n 36 38 1 0 0 0 0\n 37 40 1 0 0 0 0\nM END", "smiles": "CC(C)CCCCCC(=O)OCC(COC(=O)CCCCCC(C)C)(COC(=O)CCCCCC(C)C)COC(=O)CCCCCC(C)C", "formula": "C41H76O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "697.0389", "optical_activity": "NONE", "references": [ "5eb18cb8-1782-4e15-aa58-cb011a857e6a", "4d73652a-fd1b-42b2-ad84-d3b72aa4fc78" ], "stereo_centers": 0 }, "unii": "8NR9444E9U" } ] }