{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "55bcbd3e-e987-4144-9c84-99b2a9aa2403",
          "code": "74563-64-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=74563-64-7",
          "code_system": "CAS",
          "references": [
            "7bb97a08-195c-4e34-b5b5-99130b98939e",
            "aef96998-a993-4214-9ab7-0eda1fa569e9"
          ]
        },
        {
          "uuid": "69f789fc-82f7-4c44-af84-025e46aa1032",
          "code": "C508873",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67508873",
          "code_system": "MESH",
          "references": [
            "7bb97a08-195c-4e34-b5b5-99130b98939e"
          ]
        },
        {
          "uuid": "1fcc9ca3-9444-45f3-a922-9cbf69798101",
          "code": "277-923-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.070.818",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7bb97a08-195c-4e34-b5b5-99130b98939e"
          ]
        },
        {
          "uuid": "c4a1f5cf-21dd-4e69-a899-b1f9c9d8ceee",
          "code": "1368211",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368211/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7bb97a08-195c-4e34-b5b5-99130b98939e"
          ]
        },
        {
          "uuid": "9c12d941-6cb9-4249-a19e-523bfcdf9d95",
          "code": "m8768",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8768?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7bb97a08-195c-4e34-b5b5-99130b98939e"
          ]
        },
        {
          "uuid": "ae0c1fc1-5f02-4c4f-9349-523338b5c529",
          "code": "3018525",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3018525",
          "code_system": "PUBCHEM",
          "references": [
            "7bb97a08-195c-4e34-b5b5-99130b98939e"
          ]
        },
        {
          "uuid": "aff30056-7b53-4618-9fb3-737e3b9e658c",
          "code": "8LVI07A72W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "118d91aa-5f11-089c-ce57-6dea8e00e239",
          "code": "47770",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:47770",
          "code_system": "CHEBI",
          "references": [
            "64b2599b-a00e-d74c-d20f-1b71093c0b7f"
          ]
        },
        {
          "uuid": "25c73ee0-1850-af62-c6e4-928623e76d31",
          "code": "Phytantriol",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Phytantriol",
          "code_system": "WIKIPEDIA",
          "references": [
            "7e26577e-790c-c8bc-b38a-66eab936f186"
          ]
        },
        {
          "uuid": "9d950ced-4464-fb8a-9cba-b57acbea3d20",
          "code": "8LVI07A72W",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8LVI07A72W",
          "code_system": "DAILYMED",
          "references": [
            "456c864f-7437-6e3a-5639-bc2261e49ede"
          ]
        },
        {
          "uuid": "75f164db-27dc-5759-0565-025de1ff8997",
          "code": "DTXSID10868315",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10868315",
          "code_system": "EPA CompTox",
          "references": [
            "64b2599b-a00e-d74c-d20f-1b71093c0b7f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c12ab5b4-fdd4-4923-9cce-6add3fe687d3",
          "name": "3,7,11,15-TETRAMETHYL-1,2,3-HEXADECANETRIOL",
          "stdName": "3,7,11,15-TETRAMETHYL-1,2,3-HEXADECANETRIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a401b8c-de02-4e96-be21-82374a518145",
            "9f731908-f12d-453b-87dd-983756650d4f"
          ],
          "display_name": false
        },
        {
          "uuid": "1756081a-d2b7-4d38-a4fe-918d7cf2933f",
          "name": "ORISTAR PTT",
          "stdName": "ORISTAR PTT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5a2b40b-bf86-412f-91b3-a659c68b5708",
            "9f731908-f12d-453b-87dd-983756650d4f"
          ],
          "display_name": false
        },
        {
          "uuid": "23e22abc-8d29-4b02-929b-1ee763d458e3",
          "name": "PHYTANTRIOL",
          "stdName": "PHYTANTRIOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04f908d4-8b49-4798-9f05-0fd7f06b4790",
            "a5a2b40b-bf86-412f-91b3-a659c68b5708",
            "34fcab80-34ec-4779-8d8b-74f18ec3e180",
            "9f731908-f12d-453b-87dd-983756650d4f",
            "ba0e69c4-9909-4858-a5fe-8e84c19ef759",
            "4688cf22-b720-47b3-9365-e864454c7044",
            "ebfdc03f-6c67-4d86-b769-9d5ddf960e4a"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5f36cc1d-f651-44e4-803b-a4c46499e879",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "8d86090d-01df-4332-bcb5-fcefaadfe5d2",
          "name": "PHYTANTRIOL [MI]",
          "stdName": "PHYTANTRIOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04f908d4-8b49-4798-9f05-0fd7f06b4790",
            "9f731908-f12d-453b-87dd-983756650d4f"
          ],
          "display_name": false
        },
        {
          "uuid": "e7796495-2b49-44d7-92ea-bcd6b30b2540",
          "name": "TETRAMETHYL TRIHYDROXYHEXADECANE",
          "stdName": "TETRAMETHYL TRIHYDROXYHEXADECANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5a2b40b-bf86-412f-91b3-a659c68b5708",
            "9f731908-f12d-453b-87dd-983756650d4f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a5a2b40b-bf86-412f-91b3-a659c68b5708",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4688cf22-b720-47b3-9365-e864454c7044",
          "citation": "CTFA",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f731908-f12d-453b-87dd-983756650d4f",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04f908d4-8b49-4798-9f05-0fd7f06b4790",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ebfdc03f-6c67-4d86-b769-9d5ddf960e4a",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a401b8c-de02-4e96-be21-82374a518145",
          "citation": "RXNORM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7bb97a08-195c-4e34-b5b5-99130b98939e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391045000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe0934c2-d930-4372-a266-7990b808ad06",
          "citation": "SRS import [8LVI07A72W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8LVI07A72W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391045000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34fcab80-34ec-4779-8d8b-74f18ec3e180",
          "citation": "PHYTANTRIOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ba0e69c4-9909-4858-a5fe-8e84c19ef759",
          "citation": "PHYTANTRIOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7e26577e-790c-c8bc-b38a-66eab936f186",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "aef96998-a993-4214-9ab7-0eda1fa569e9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "64b2599b-a00e-d74c-d20f-1b71093c0b7f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "456c864f-7437-6e3a-5639-bc2261e49ede",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fe9895a3-da4e-4959-8f3a-2354ddaca753",
          "id": "fe9895a3-da4e-4959-8f3a-2354ddaca753",
          "molfile": "\n  Marvin  01132113112D          \n\n 23 22  0  0  0  0            999 V2000\n    6.0227    1.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4352    0.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2602    0.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0227   -0.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1977   -0.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7852   -0.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9602   -0.7890    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.5477   -0.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5477   -1.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7227   -1.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3102   -2.2179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4852   -2.2179    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.0727   -1.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0727   -2.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2477   -2.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1647   -3.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9897   -3.6468    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -0.9897   -2.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9897   -4.4718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8147   -3.6468    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -2.2272   -4.3613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2272   -2.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0522   -2.9324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 17  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCCC(C)CCCC(C)CCCC(C)(C(CO)O)O",
          "formula": "C20H42O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "30e0bccc-f433-4d54-bce8-3306857c9948"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "330.5464",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a00ed017-74e9-42d4-8c3d-12f00e2c2645",
      "version": "8",
      "structure": {
        "id": "a636ff9f-376d-4728-b3d0-6ab9a6192cf3",
        "molfile": "\n  Marvin  01132108382D          \n\n 23 22  0  0  0  0            999 V2000\n    6.0227    1.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4352    0.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2602    0.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0227   -0.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1977   -0.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7852   -0.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9602   -0.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5477   -0.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5477   -1.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7227   -1.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3102   -2.2179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4852   -2.2179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0727   -1.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0727   -2.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2477   -2.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1647   -3.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9897   -3.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9897   -4.4718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9897   -2.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8147   -3.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2272   -4.3613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2272   -2.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0522   -2.9324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 17  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCCC(C)CCCC(C)CCCC(C)(C(CO)O)O",
        "formula": "C20H42O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "330.5464",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "fe0934c2-d930-4372-a266-7990b808ad06",
          "a5a2b40b-bf86-412f-91b3-a659c68b5708"
        ],
        "stereo_centers": 4
      },
      "unii": "8LVI07A72W"
    }
  ]
}