{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bb8db50b-c291-492d-bd91-05001fd31a0e",
          "code": "10196-04-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10196-04-0",
          "code_system": "CAS",
          "references": [
            "150801cd-2897-4006-a127-df12a0748ce7",
            "03083a64-4250-46ee-ae6c-2082595de232"
          ]
        },
        {
          "uuid": "1d5352cc-f314-4bc7-89a0-7fd81da6119e",
          "code": "C048169",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67048169",
          "code_system": "MESH",
          "references": [
            "150801cd-2897-4006-a127-df12a0748ce7"
          ]
        },
        {
          "uuid": "fa87fb59-55eb-47dd-9d30-078ea288d522",
          "code": "AMMONIUM SULFITE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ammonium_sulfite",
          "code_system": "WIKIPEDIA",
          "references": [
            "150801cd-2897-4006-a127-df12a0748ce7"
          ]
        },
        {
          "uuid": "f27a4eed-9e85-4971-9d42-14e79579941c",
          "code": "233-484-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.428",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "150801cd-2897-4006-a127-df12a0748ce7"
          ]
        },
        {
          "uuid": "6954194a-c68d-47aa-b12c-7941c17ffa68",
          "code": "m1824",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1824?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "150801cd-2897-4006-a127-df12a0748ce7"
          ]
        },
        {
          "uuid": "99e19c5f-9b58-6c55-f18a-8198df4ed026",
          "code": "1426",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1426",
          "code_system": "HSDB",
          "references": [
            "0ba0fd37-5625-b859-d3b8-a1733b851c49"
          ]
        },
        {
          "uuid": "3eee482c-38b1-2a4b-3872-899270e90584",
          "code": "DTXSID2064991",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2064991",
          "code_system": "EPA CompTox",
          "references": [
            "9a2afc0b-2677-2566-c120-d7f1b69e4557"
          ]
        },
        {
          "uuid": "3a2a0f40-5063-808d-a1e1-a90cbedeae81",
          "code": "25041",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/25041",
          "code_system": "PUBCHEM",
          "references": [
            "67ff75ff-ffcb-7231-0ec6-a3da5ecab72d"
          ]
        },
        {
          "uuid": "7d5df2f4-238a-4f9f-a8fc-5643e2acaf8f",
          "code": "8LF589Y5GD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "724b3ce9-e001-4445-a1aa-b370cee2279d",
          "name": "AMMONIUM SULFITE",
          "stdName": "AMMONIUM SULFITE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "188573d4-5fc7-4537-8edc-eef699402237",
            "6e3bdea6-c0f8-4b59-816a-ebd184906fd2",
            "ec0f973d-e893-4282-ae00-fecbc165aca9",
            "5759a8cf-b78b-4465-b82e-cdaa7e85889a",
            "750f5a07-0d77-42e1-869b-576db6a77e88",
            "517356dc-cd90-4ce4-b986-c88c260ea7e4",
            "24e57d6c-cefa-4076-9e3a-1d4ebc867202",
            "49947ad7-ad5f-4c7a-b4b4-6fad0dbd456f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a9155ac9-c5b9-410a-88a3-a5893e961d8d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "8e3cdb57-5213-4655-b117-f410a6f4b362",
          "name": "AMMONIUM SULFITE [HSDB]",
          "stdName": "AMMONIUM SULFITE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "188573d4-5fc7-4537-8edc-eef699402237",
            "5759a8cf-b78b-4465-b82e-cdaa7e85889a"
          ],
          "display_name": false
        },
        {
          "uuid": "e79de084-afbb-4dd6-8ccd-89cabbdc1bb5",
          "name": "AMMONIUM SULFITE [MI]",
          "stdName": "AMMONIUM SULFITE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5759a8cf-b78b-4465-b82e-cdaa7e85889a",
            "750f5a07-0d77-42e1-869b-576db6a77e88"
          ],
          "display_name": false
        },
        {
          "uuid": "3eec0342-14de-4fac-b00f-841721cca30a",
          "name": "SULFUROUS ACID AMMONIUM SALT (1:2)",
          "stdName": "SULFUROUS ACID AMMONIUM SALT (1:2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5759a8cf-b78b-4465-b82e-cdaa7e85889a",
            "7c684859-9356-4c1a-afcf-c29b2baf9ef8"
          ],
          "display_name": false
        },
        {
          "uuid": "68f7dd6b-efd4-49dd-adeb-ff86e132f662",
          "name": "SULFUROUS ACID, DIAMMONIUM SALT",
          "stdName": "SULFUROUS ACID, DIAMMONIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5759a8cf-b78b-4465-b82e-cdaa7e85889a",
            "d74f2440-fb8e-4794-939b-708ee86a0f3b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "517356dc-cd90-4ce4-b986-c88c260ea7e4",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "750f5a07-0d77-42e1-869b-576db6a77e88",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5759a8cf-b78b-4465-b82e-cdaa7e85889a",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c684859-9356-4c1a-afcf-c29b2baf9ef8",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d74f2440-fb8e-4794-939b-708ee86a0f3b",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49947ad7-ad5f-4c7a-b4b4-6fad0dbd456f",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "188573d4-5fc7-4537-8edc-eef699402237",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "150801cd-2897-4006-a127-df12a0748ce7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390992000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f4eea61-5cb1-412f-8fec-9d81ea3d0532",
          "citation": "SRS import [8LF589Y5GD]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8LF589Y5GD",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390992000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64a49fe5-e6ae-44df-b33b-f9b48d6ae02d",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e3bdea6-c0f8-4b59-816a-ebd184906fd2",
          "citation": "AMMONIUM SULFITE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ec0f973d-e893-4282-ae00-fecbc165aca9",
          "citation": "AMMONIUM SULFITE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "24e57d6c-cefa-4076-9e3a-1d4ebc867202",
          "citation": "AMMONIUM SULFITE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0ba0fd37-5625-b859-d3b8-a1733b851c49",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+10196-04-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9a2afc0b-2677-2566-c120-d7f1b69e4557",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10196-04-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "67ff75ff-ffcb-7231-0ec6-a3da5ecab72d",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "03083a64-4250-46ee-ae6c-2082595de232",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "51dbede6-030d-4358-9f5b-2f7fbaf807cc",
          "id": "51dbede6-030d-4358-9f5b-2f7fbaf807cc",
          "molfile": "\n  Marvin  01132104162D          \n\n  1  0  0  0  0  0            999 V2000\n    4.1899   -3.5339    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "N",
          "formula": "H3N",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "f07fcd11-c9d5-4b5b-ae71-1c2c2f6ce568"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "17.0305",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "c973900c-5ee3-461d-9519-bb0c6ca02e19",
          "id": "c973900c-5ee3-461d-9519-bb0c6ca02e19",
          "molfile": "\n  Marvin  01132110242D          \n\n  4  3  0  0  0  0            999 V2000\n    6.5771   -4.2860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2615   -3.7930    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9463   -4.2532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2615   -3.0019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\nM  END",
          "smiles": "OS(=O)O",
          "formula": "H2O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0805d8d0-1fab-4124-9495-5d33fa675327"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "82.0802",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e2e1d383-a1b6-4a34-8458-8d2379e2f797",
      "version": "6",
      "structure": {
        "id": "acea7853-e3dc-40d8-913d-e0962bc7dcb0",
        "molfile": "\n  Marvin  01132108582D          \n\n  6  3  0  0  0  0            999 V2000\n    7.2621   -3.7933    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2621   -3.0021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5776   -4.2863    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.9469   -4.2535    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.1887   -3.5327    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.1887   -3.5327    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  2  2  0  0  0  0\nM  CHG  4   3  -1   4  -1   5   1   6   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2   5   6\nM  SPA   1  1   5\nM  SDI   1  4    3.7687   -3.9527    3.7687   -3.1127\nM  SDI   1  4    4.6087   -3.1127    4.6087   -3.9527\nM  SMT   1 2\nM  END",
        "smiles": "[NH4+].[NH4+].O=S([O-])[O-]",
        "formula": "O3S.2H4N",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "116.1412",
        "optical_activity": "NONE",
        "references": [
          "8f4eea61-5cb1-412f-8fec-9d81ea3d0532",
          "64a49fe5-e6ae-44df-b33b-f9b48d6ae02d"
        ],
        "stereo_centers": 0
      },
      "unii": "8LF589Y5GD"
    }
  ]
}