{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3a2afbb3-95ee-4a4f-9ca9-5c9a6449f62b",
          "code": "1145869-22-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1145869-22-2",
          "code_system": "CAS",
          "references": [
            "fffb583b-c3d6-4b98-ada1-97ba51affb2f",
            "ad98369a-2d32-45e6-aa4b-c4498e3928d8"
          ]
        },
        {
          "uuid": "db156c23-3619-45ae-b317-f2a7edd69421",
          "code": "44157021",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44157021",
          "code_system": "PUBCHEM",
          "references": [
            "fffb583b-c3d6-4b98-ada1-97ba51affb2f"
          ]
        },
        {
          "uuid": "460a399c-59e7-41ed-9bb6-00b15a453b1f",
          "code": "8LCG38V652",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "64a5225e-8e77-4ce4-b0d8-ea1b497597d5",
          "name": "ADAMANTANYL DIHYDROXYBENZAMIDE",
          "stdName": "ADAMANTANYL DIHYDROXYBENZAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ba0f4d2-4534-4708-9725-df3e900a2735",
            "08a18f65-1515-4f89-82f7-3f59f5b0a198",
            "75a45f30-9d41-430f-bdf4-e911285b0aaf"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "2fc3791d-75ac-401a-bb25-7cf495d8fe7c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "65cc8110-0aa6-4c9d-836e-fb4ecdbe5686",
          "name": "BENZAMIDE, 3,4-DIHYDROXY-N-TRICYCLO(3.3.1.13,7)DEC-1-YL-",
          "stdName": "BENZAMIDE, 3,4-DIHYDROXY-N-TRICYCLO(3.3.1.13,7)DEC-1-YL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61777c1f-11cd-408d-97b2-80086e724a0b",
            "75a45f30-9d41-430f-bdf4-e911285b0aaf"
          ],
          "display_name": false
        },
        {
          "uuid": "9e9aa7d3-5894-4e8f-9278-11f1bc34dcb8",
          "name": "SNOWIN",
          "stdName": "SNOWIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08a18f65-1515-4f89-82f7-3f59f5b0a198",
            "75a45f30-9d41-430f-bdf4-e911285b0aaf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "08a18f65-1515-4f89-82f7-3f59f5b0a198",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "75a45f30-9d41-430f-bdf4-e911285b0aaf",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61777c1f-11cd-408d-97b2-80086e724a0b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fffb583b-c3d6-4b98-ada1-97ba51affb2f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391414000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98eb258d-d1a0-44aa-8e84-d4a8f020a034",
          "citation": "SRS import [8LCG38V652]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8LCG38V652",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391414000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ba0f4d2-4534-4708-9725-df3e900a2735",
          "citation": "ADAMANTANYL DIHYDROXYBENZAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ad98369a-2d32-45e6-aa4b-c4498e3928d8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2a921805-26c1-4a3f-a1d7-52e63b4d206c",
          "id": "2a921805-26c1-4a3f-a1d7-52e63b4d206c",
          "molfile": "\n  Marvin  01132102192D          \n\n 21 24  0  0  0  0            999 V2000\n    6.8239   -0.8808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4182   -1.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8373   -2.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4316   -3.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6066   -3.0358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1874   -2.3253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5931   -1.6070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1739   -0.8964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2009   -3.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6201   -4.4647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3759   -3.7619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9702   -4.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5018   -5.3810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9880   -6.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9809   -5.6862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4551   -5.3905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9354   -5.6971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4084   -5.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9414   -6.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9246   -4.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4491   -4.7869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  9  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 20  1  0  0  0  0\n 21 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 19  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1C(=O)NC23CC4CC(CC(C4)C2)C3)O)O",
          "formula": "C17H21NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d82e22e3-f277-427d-bf92-59b1d27deea5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "287.3542",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "8c6d16da-b877-4184-9b34-e4ca72011f1f",
      "version": "3",
      "structure": {
        "id": "7438f068-3b75-4a30-89a3-152103c0302e",
        "molfile": "\n  Marvin  01132106022D          \n\n 21 24  0  0  0  0            999 V2000\n    5.5931   -1.6070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1874   -2.3253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6066   -3.0358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4316   -3.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8373   -2.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4182   -1.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8239   -0.8808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2009   -3.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3759   -3.7619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9702   -4.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4491   -4.7869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4551   -5.3905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9809   -5.6862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9880   -6.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5018   -5.3810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9414   -6.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4084   -5.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9246   -4.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9354   -5.6971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6201   -4.4647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1739   -0.8964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  3  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 10 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 10 18  1  0  0  0  0\n 19 17  1  0  0  0  0\n 12 19  1  0  0  0  0\n  8 20  2  0  0  0  0\n  1 21  1  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1C(=O)NC23CC4CC(CC(C4)C2)C3)O)O",
        "formula": "C17H21NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "287.3542",
        "optical_activity": "NONE",
        "references": [
          "61777c1f-11cd-408d-97b2-80086e724a0b",
          "98eb258d-d1a0-44aa-8e84-d4a8f020a034"
        ],
        "stereo_centers": 0
      },
      "unii": "8LCG38V652"
    }
  ]
}