{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3f513a84-c95d-4177-a950-07da98504540",
          "code": "86753-15-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=86753-15-3",
          "code_system": "CAS",
          "references": [
            "2aac64ed-c5a1-4761-ba31-8184ebb642a0",
            "25994b9d-acf0-45db-b0f1-d7f0a98022d0"
          ]
        },
        {
          "uuid": "7fb7ad28-e828-db43-2125-9ef8251e7fdc",
          "code": "90908346",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/90908346",
          "code_system": "PUBCHEM",
          "references": [
            "726d44e5-6812-874e-688e-89bec7cab6d5"
          ]
        },
        {
          "uuid": "693d83f1-47a8-468f-9d97-74c6325acbf7",
          "code": "8L821V6V99",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ed0b0e4f-0a95-4113-2088-3a21ef059fe6",
          "code": "8L821V6V99",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8L821V6V99",
          "code_system": "DAILYMED",
          "references": [
            "5b6f0064-b0e5-33df-33b1-36e7a586097d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "18a1957d-4658-4745-ba4a-a9eab79e82b0",
          "name": "KEFIRAN",
          "stdName": "KEFIRAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d41fafeb-d880-4ef6-a47d-cda2c0d63137",
            "9b74e943-bae5-4403-9f8a-eef0efcd9648",
            "89b896d6-118b-4a4f-9981-117df6313100"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b3f89a89-93b3-4ecb-adc8-739cd39ff374",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "9b74e943-bae5-4403-9f8a-eef0efcd9648",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "89b896d6-118b-4a4f-9981-117df6313100",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2aac64ed-c5a1-4761-ba31-8184ebb642a0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393335000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90f6eac5-98fa-4d81-9a37-a170afdb59d4",
          "citation": "SRS import [8L821V6V99]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8L821V6V99",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393335000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da16df7d-b2d6-423d-aefd-5f7252f135ae",
          "citation": "http://online.personalcarecouncil.org/ctfa-static/online/lists/cir-pdfs/FR657.pdf",
          "url": "http://online.personalcarecouncil.org/ctfa-static/online/lists/cir-pdfs/FR657.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d41fafeb-d880-4ef6-a47d-cda2c0d63137",
          "citation": "KEFIRAN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "726d44e5-6812-874e-688e-89bec7cab6d5",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "25994b9d-acf0-45db-b0f1-d7f0a98022d0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5b6f0064-b0e5-33df-33b1-36e7a586097d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "519c35da-dc98-4ba1-8973-7afb5adff330",
          "id": "519c35da-dc98-4ba1-8973-7afb5adff330",
          "molfile": "\n  Marvin  01132104152D          \n\n 23 23  0  0  1  0            999 V2000\n   17.7080   -4.9703    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   17.7080   -5.7952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4223   -4.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1368   -4.9702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9935   -4.5578    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   16.9935   -3.7328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2791   -4.9703    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   16.2791   -5.7952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5646   -4.5578    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   15.5646   -3.7328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8501   -4.9703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1357   -4.5578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4212   -4.9703    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   12.7068   -4.5578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9923   -4.9703    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.2779   -4.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5634   -4.9703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9923   -5.7952    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   11.2779   -6.2078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7068   -6.2078    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   12.7068   -7.0327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4212   -5.7952    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   14.1357   -6.2078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  6  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 22  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  1  0  0  0\n 18 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  6  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  1  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  6  0  0  0\nM  END",
          "smiles": "C([C@H]([C@@H]([C@@H]([C@H](COC1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O)O)O",
          "formula": "C12H24O11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6d2fef6f-747c-4159-8c05-5c34f920f9f9"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "344.3129",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "410a2eb3-c4b0-4d28-a372-bfb48bbcdc47",
      "version": "6",
      "structure": {
        "id": "0a0f0ab6-4f5b-4924-812a-d435e4bfa70d",
        "molfile": "\n  Marvin  01132100472D          \n\n 23 23  0  0  1  0            999 V2000\n   13.4212   -5.7952    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.5646   -4.5578    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.2791   -4.9703    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.9935   -4.5578    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   17.7080   -4.9703    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.9923   -4.9703    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.9923   -5.7952    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.7068   -6.2078    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.1357   -6.2078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4212   -4.9703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1357   -4.5578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8501   -4.9703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5646   -3.7328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2791   -5.7952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9935   -3.7328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7080   -5.7952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4223   -4.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1368   -4.9702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7068   -4.5578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2779   -4.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5634   -4.9703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2779   -6.2078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7068   -7.0327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  1  1  0  0  0  0\n  1  9  1  6  0  0  0\n 10  1  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12  2  1  0  0  0  0\n 11 12  1  0  0  0  0\n  2 13  1  6  0  0  0\n  3 14  1  6  0  0  0\n  4 15  1  1  0  0  0\n  5 16  1  1  0  0  0\n  5 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 10  1  0  0  0  0\n 19  6  1  0  0  0  0\n  6 20  1  1  0  0  0\n 20 21  1  0  0  0  0\n  7 22  1  6  0  0  0\n  8 23  1  1  0  0  0\nM  END",
        "smiles": "C([C@H]([C@@H]([C@@H]([C@H](COC1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O)O)O",
        "formula": "C12H24O11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "344.3129",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "90f6eac5-98fa-4d81-9a37-a170afdb59d4",
          "da16df7d-b2d6-423d-aefd-5f7252f135ae"
        ],
        "stereo_centers": 9
      },
      "unii": "8L821V6V99"
    }
  ]
}