{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "babd91a4-874b-4525-900b-b652e6e99fc1", "code": "76960529", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76960529", "code_system": "PUBCHEM", "references": [ "38c72b51-cb6c-4d7f-92e7-c6fda21422b8" ] }, { "uuid": "a6c3d2c8-61c9-4f9d-9eb6-464eaa97f638", "code": "8KXP8KM811", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "90ab97b8-d0ca-4153-af95-2750039d8756", "name": "BENZENESULFONYLTROMETHAMIDE", "stdName": "BENZENESULFONYLTROMETHAMIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "785ce89b-79c4-4d7e-91e0-6573dad6945e", "27b9552f-a649-42f3-91ec-8bef87ed57b7", "56dc833c-9917-4093-98fc-375fbbb36f6a" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "e384d578-3369-455a-90e2-0be03c91d6e8", "name_org": "INCI" } ] }, { "uuid": "00fcc90a-c7bf-4e4a-8304-36578689aad2", "name": "N-(3-HYDROXY-2,2-DIHYDROXYMETHYLPROPYL)BENZENESULFONAMIDE", "stdName": "N-(3-HYDROXY-2,2-DIHYDROXYMETHYLPROPYL)BENZENESULFONAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1f70e471-40fa-4887-ade3-e7fc4ce7ffd9", "785ce89b-79c4-4d7e-91e0-6573dad6945e" ], "display_name": false }, { "uuid": "0a953239-4e91-48a7-95d8-fd9e7dd7a7fc", "name": "UNIGLYN", "stdName": "UNIGLYN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "785ce89b-79c4-4d7e-91e0-6573dad6945e", "56dc833c-9917-4093-98fc-375fbbb36f6a" ], "display_name": false } ], "references": [ { "uuid": "38c72b51-cb6c-4d7f-92e7-c6fda21422b8", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391922000, "tags": [ "NOMEN" ] }, { "uuid": "c1d8c4ca-0129-46a4-838f-e34eea3abdc1", "citation": "SRS import [8KXP8KM811]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8KXP8KM811", "doc_type": "SRS", "public_domain": true, "document_date": 1493391922000, "tags": [ "NOMEN" ] }, { "uuid": "e5e89ff0-140d-4053-96e9-1c90a5f9020f", "citation": "http://www.saael.com/en/saa/?type=detail&id=3991", "url": "http://www.saael.com/en/saa/?type=detail&id=3991", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "27b9552f-a649-42f3-91ec-8bef87ed57b7", "citation": "BENZENESULFONYLTROMETHAMIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "56dc833c-9917-4093-98fc-375fbbb36f6a", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "785ce89b-79c4-4d7e-91e0-6573dad6945e", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1f70e471-40fa-4887-ade3-e7fc4ce7ffd9", "citation": "N-(3-Hydroxy-2,2-dihydroxymethylpropyl)benzenesulfonamide", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a2f4d4cc-0971-44d7-911c-25b4ddef59d2", "id": "a2f4d4cc-0971-44d7-911c-25b4ddef59d2", "molfile": "\n Marvin 01132108282D \n\n 18 18 0 0 0 0 999 V2000\n 4.0297 -7.9552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4422 -7.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2672 -7.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0922 -7.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5047 -7.9552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2672 -8.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9816 -8.4783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2672 -6.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9817 -6.0032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9816 -5.1782 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1566 -5.1782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8066 -5.1782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9816 -4.3532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2671 -3.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2671 -3.1157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9816 -2.7032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6960 -3.1157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6960 -3.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 6 1 0 0 0 0\n 3 8 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 2 0 0 0 0\n 13 10 1 0 0 0 0\n 14 13 1 0 0 0 0\n 13 18 2 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)S(=O)(=O)NCC(CO)(CO)CO", "formula": "C11H17NO5S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3b6455ad-b592-4088-a4dd-ad0f119fe822" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "275.3229", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "391560d1-4570-4b6b-a682-d9a16f0bd8af", "version": "3", "structure": { "id": "893f5f1e-6fbb-4d8a-8989-58bf3f94cce9", "molfile": "\n Marvin 01132107082D \n\n 18 18 0 0 0 0 999 V2000\n 5.2672 -7.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2672 -6.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9817 -6.0032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9816 -5.1782 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9816 -4.3532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2671 -3.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2671 -3.1157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9816 -2.7032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6960 -3.1157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6960 -3.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1566 -5.1782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8066 -5.1782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4422 -7.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0297 -7.9552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0922 -7.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5047 -7.9552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2672 -8.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9816 -8.4783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 5 10 1 0 0 0 0\n 10 9 2 0 0 0 0\n 4 11 2 0 0 0 0\n 4 12 2 0 0 0 0\n 1 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 1 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 1 17 1 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)S(=O)(=O)NCC(CO)(CO)CO", "formula": "C11H17NO5S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "275.3229", "optical_activity": "NONE", "references": [ "c1d8c4ca-0129-46a4-838f-e34eea3abdc1", "e5e89ff0-140d-4053-96e9-1c90a5f9020f" ], "stereo_centers": 0 }, "unii": "8KXP8KM811" } ] }