{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c79c5c59-9445-4bdc-9302-d97b74dbcc42",
          "code": "P02DA01",
          "comments": "ATC|ANTIPARASITIC PRODUCTS, INSECTICIDES AND REPELLENTS|ANTHELMINTICS|ANTICESTODALS|Salicylic acid derivatives|niclosamide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=P02DA01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "e7750b1c-bec4-4f9c-9e4e-19194b8dc63c",
          "code": "QP52AG03",
          "comments": "VATC|ANTHELMINTICS|ANTHELMINTICS|Phenol derivatives, incl. salicylanilides|niclosamide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP52AG03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "8dcaf54b-c394-4aa9-80e7-9bac62f1f76f",
          "code": "50-65-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=50-65-7",
          "code_system": "CAS",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156",
            "f662a594-47d0-49ca-90c0-177d47c70b0b"
          ]
        },
        {
          "uuid": "81b5d3f1-63f1-484d-8248-dd05c3947fdd",
          "code": "D009534",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68009534",
          "code_system": "MESH",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "9829bddd-263c-4578-aa6f-43f07d76404c",
          "code": "6.1.1",
          "comments": "WHO ESSENTIAL MEDICINES LIST|Anti-infective medicines|Anthelminthics|Intestinal anthelminthics",
          "type": "PRIMARY",
          "url": "http://prais.paho.org/medicine/57/?section=45#type169",
          "code_system": "WHO-ESSENTIAL MEDICINES LIST",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "66bb2798-5200-4233-abbc-672696ec5f86",
          "code": "NICLOSAMIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Niclosamide",
          "code_system": "WIKIPEDIA",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "85417a89-c863-4d36-9487-cd59b5a1245c",
          "code": "SUB09230MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "bc66a8a4-ef9b-415d-8786-18fbcef81a22",
          "code": "217800",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1425",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "5fb5e3f3-2c75-4965-a17e-c26187a1a518",
          "code": "77401",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3037",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "9bd6df76-628c-42d2-be2e-852bdd973d47",
          "code": "1532",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1532",
          "code_system": "INN",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "0ab64498-aad5-4739-a801-6943e54e3bb9",
          "code": "200-056-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.052",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "c48c616b-b154-4f88-bcd6-ee857cc0a858",
          "code": "NICLOSAMIDE",
          "comments": "Description: A cream-coloured, crystalline powder; odourless. Solubility: Practically insoluble in water; soluble in 150 parts of ethanol (~750 g/L) TS; slightly soluble in ether R and acetone R. Category: Taeniacide. Storage: Niclosamide should be kept in a tightly closed container. Labelling: The designation on the container of Niclosamide should state whether the substance is the monohydrate or is in theanhydrous form. Additional information: Anhydrous Niclosamide is hygroscopic. Niclosamide monohydrate may exhibit polymorphism. Definition: Niclosamide contains not less than 98.0% and not more than 100.5% of C13H8Cl2N2O4, calculated with reference tothe dried substance.",
          "type": "PRIMARY",
          "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.284.pdf",
          "code_system": "WHO INTERNATIONAL PHARMACOPEIA",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "5ca27fb8-f98e-4959-ae4c-de52aa8f2734",
          "code": "C66240",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66240",
          "code_system": "NCI_THESAURUS",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "e270923f-30d7-4232-8704-779b4eb05972",
          "code": "7402",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/7402/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "189f6e13-45dc-468a-98e0-04c7b2325657",
          "code": "m7874",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7874?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "b7437165-b20d-40fe-b6cc-94865fd5dca9",
          "code": "DB06803",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB06803",
          "code_system": "DRUG BANK",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "3c8a9fab-17aa-49c9-b1dc-de1e766f145d",
          "code": "SUB12176MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "3344744f-ab1d-468d-9184-4ec2d4e8e15f",
          "code": "CHEMBL1448",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1448",
          "code_system": "ChEMBL",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "bcbd1d62-0e10-4af8-a409-99bff2b8cd8a",
          "code": "4477",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4477",
          "code_system": "PUBCHEM",
          "references": [
            "88875669-be2b-4de2-97d2-d26b740d0156"
          ]
        },
        {
          "uuid": "14f3cc91-2546-9be5-ef1c-bdbe10ab1b05",
          "code": "1572",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1572",
          "code_system": "HSDB",
          "references": [
            "74c16876-efa7-ccc2-babe-8154d634f9e0"
          ]
        },
        {
          "uuid": "c4f6642e-0cf8-b7e8-0481-2b643591b094",
          "code": "DTXSID7040362",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7040362",
          "code_system": "EPA CompTox",
          "references": [
            "0dcc92c6-202c-f205-ec7e-460312190e22"
          ]
        },
        {
          "uuid": "4fdc7951-222c-d4b8-43f0-1782bd43778b",
          "code": "C250",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antiparasitic Agent[C276]|Antihelminthic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C250",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2ae86a28-64a4-d01c-0156-c347bbc0e1e2"
          ]
        },
        {
          "uuid": "87850b43-113c-4148-a901-56aae2f7cd53",
          "code": "8KK8CQ2K8G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a791fdb7-cfbc-ff88-22bd-15f91f4e4a6d",
          "code": "Niclosamide",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/niclosamide/",
          "code_system": "LACTMED",
          "references": [
            "2ae86a28-64a4-d01c-0156-c347bbc0e1e2"
          ]
        },
        {
          "uuid": "3e5bba1c-214a-a9ea-eaf3-33fbf24ec766",
          "code": "1912",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1912",
          "code_system": "DRUG CENTRAL",
          "references": [
            "2ae86a28-64a4-d01c-0156-c347bbc0e1e2"
          ]
        },
        {
          "uuid": "0a1c6e3f-1fe1-c422-9c00-27e00e656cb6",
          "code": "100000092044",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c4790aac-f257-92c6-d675-73631272e295"
          ]
        },
        {
          "uuid": "9d16c498-3053-4cf3-949c-d0552a4d06e2",
          "code": "niclosamide",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/niclosamide.html",
          "code_system": "ALANWOOD",
          "references": [
            "6c6dcc0d-76ba-4868-a351-831acc520781"
          ]
        },
        {
          "uuid": "25cac63c-27b2-8ccb-73f1-9b0860278183",
          "code": "178296",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=178296",
          "code_system": "NSC",
          "references": [
            "d6ccd940-849b-0787-6fb4-50faac0b5fd2"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8e1353ea-5b7b-431e-ab3e-a1ba91d9d5b8",
          "amount": {
            "uuid": "1f2ad792-020b-49af-80f1-669a3fd5ded4"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c4f868bd-9457-4658-a105-b45a1618034e",
            "refuuid": "587b5b18-a664-410d-8412-3a011fee11cb",
            "name": "NICLOSAMIDE",
            "unii": "8KK8CQ2K8G",
            "linking_id": "8KK8CQ2K8G",
            "ref_pname": "NICLOSAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5c278018-2947-49f7-ad62-4f1716930f76",
          "amount": {
            "uuid": "f2f1c332-617c-4a8a-85c9-3b5652625d1b"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "b4a22650-d951-4bbc-a849-d2c3274890f8",
            "refuuid": "43bb0598-8b5e-4bcd-959b-89900bc91e5a",
            "name": "NICLOSAMIDE MONOHYDRATE",
            "unii": "20Z25R1145",
            "linking_id": "20Z25R1145",
            "ref_pname": "NICLOSAMIDE MONOHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "63f295b6-9ddb-47e1-bf3a-b6973f60e3a8",
          "amount": {
            "uuid": "5e877ce2-0762-4ad6-8a5e-533b369166d5"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "fabdb2d9-fe1e-4bd2-a031-c8ed1ccbcc4b",
            "refuuid": "246baaad-a7c0-4b1f-be3a-3435ab39090b",
            "name": "NICLOSAMIDE-OLAMINE",
            "unii": "QT8YUD1Z0W",
            "linking_id": "QT8YUD1Z0W",
            "ref_pname": "NICLOSAMIDE-OLAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6e956626-154a-437f-b4e2-7274798924fd",
          "amount": {
            "uuid": "1409ad2b-3db9-4ddc-abb3-972783d9b7f1"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "d1f040fc-8dda-46bb-8d7e-35c6e3d009f0"
          ],
          "related_substance": {
            "uuid": "50515c3b-ad0f-4963-9335-72b4b7646c8d",
            "refuuid": "76927fb9-02d6-48e0-8e29-7edd2734cff8",
            "name": "2-CHLORO-4-NITROANILINE",
            "unii": "XSA3ZX337B",
            "linking_id": "XSA3ZX337B",
            "ref_pname": "2-CHLORO-4-NITROANILINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "68276342-21cc-4c13-85ee-bbcb68194e41",
          "amount": {
            "uuid": "a898e19c-17d9-48cf-a61a-5ca9d6732e25"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "d1f040fc-8dda-46bb-8d7e-35c6e3d009f0"
          ],
          "related_substance": {
            "uuid": "4725da83-f47f-4613-af86-92a0b34a2f61",
            "refuuid": "65024143-4c21-4238-8a83-d5a9a888ef92",
            "name": "5-CHLOROSALICYLIC ACID",
            "unii": "J2YFG68VCZ",
            "linking_id": "J2YFG68VCZ",
            "ref_pname": "5-CHLOROSALICYLIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b43fca77-e52e-fd7a-0a1c-1424c5c857d8",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "f662a594-47d0-49ca-90c0-177d47c70b0b"
          ],
          "related_substance": {
            "uuid": "ab6008db-5c8f-455d-8734-b5306cac9e01",
            "refuuid": "43bb0598-8b5e-4bcd-959b-89900bc91e5a",
            "name": "NICLOSAMIDE MONOHYDRATE",
            "unii": "20Z25R1145",
            "linking_id": "20Z25R1145",
            "ref_pname": "NICLOSAMIDE MONOHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "83eee2d3-fbff-4424-9b90-f84e6b10bf5d",
          "name": "2',5-DICHLORO-4'-NITROSALICYLANILIDE",
          "stdName": "2',5-DICHLORO-4'-NITROSALICYLANILIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afea506d-ba6f-4cf9-a37d-2bb178939375"
          ],
          "display_name": false
        },
        {
          "uuid": "c485b068-43e8-4e43-9fb9-3f24d7c4a6c1",
          "name": "5-CHLORO-N-(2-CHLORO-4-NITROPHENYL)-2-HYDROXYBENZAMIDE",
          "stdName": "5-CHLORO-N-(2-CHLORO-4-NITROPHENYL)-2-HYDROXYBENZAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c70f32f8-3575-4757-8955-fb8be8d4c01f",
            "a98f0435-d48a-4f33-ad8c-f962672e6904"
          ],
          "display_name": false
        },
        {
          "uuid": "3089e3db-a71a-4586-94a5-4abba42d5557",
          "name": "BAY 2353",
          "stdName": "BAY 2353",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afea506d-ba6f-4cf9-a37d-2bb178939375"
          ],
          "display_name": false
        },
        {
          "uuid": "619a788a-98eb-4ef6-9a86-465b46fe6827",
          "name": "BAY-2353",
          "stdName": "BAY-2353",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "05659f66-7765-4248-a0e9-25e474c9dd34"
          ],
          "display_name": false
        },
        {
          "uuid": "5138f36b-9bb3-4c78-9c5c-36ac2cadd8a2",
          "name": "BENZAMIDE, 5-CHLORO-N-(2-CHLORO-4-NITROPHENYL)-2-HYDROXY-",
          "stdName": "BENZAMIDE, 5-CHLORO-N-(2-CHLORO-4-NITROPHENYL)-2-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afea506d-ba6f-4cf9-a37d-2bb178939375"
          ],
          "display_name": false
        },
        {
          "uuid": "338cef53-46a6-4589-adff-c6cc81fea917",
          "name": "NICLOCIDE",
          "stdName": "NICLOCIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afea506d-ba6f-4cf9-a37d-2bb178939375"
          ],
          "display_name": false
        },
        {
          "uuid": "80daa649-3f64-459e-9409-c1f017958797",
          "name": "NICLOSAMIDE",
          "stdName": "NICLOSAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce102ee7-4ea2-45c6-9954-b404b182e398",
            "922cd487-c83e-41ae-aa32-60a47050b1f1",
            "fe8f25a5-3386-42fd-bae1-c8505cf4740e",
            "6de23028-c20e-4880-b3ef-34897445b852",
            "a76e8b2c-803a-4065-b2d1-f33b69b97c34",
            "351c8fb2-ee53-48e2-b098-9fd0a436a93a",
            "9035eb78-79cc-4384-aa91-c018c8e78b0d",
            "bec685bf-c491-48e8-8dc9-662fa8748411",
            "b0a54e66-b389-4348-9759-559bf638f021",
            "46450172-c438-4f0e-9ce0-6cd80eef1ae5",
            "7e8cc7d5-eedd-493e-a9a8-9614e11fff0b",
            "50b96478-6047-4b25-a8e3-0e3e26ad7b1a",
            "b5f4c894-7c91-486c-ae6a-929ac2e9b369",
            "280b48c9-6ff3-413c-951b-036c018c11a4",
            "6472fcce-29b9-416d-a8db-54106570641f",
            "032081ae-da5a-41bf-b30c-d68c0874e865",
            "b034aaaf-9363-49f8-9049-5b601bfc37c6",
            "2818f9e2-2358-48d7-ba73-a3ad6e5c8490",
            "3e502baf-7ccb-4275-8754-96e5c0bf558e",
            "1002a16a-5602-4eed-b8df-e365f90287b5",
            "90a0fb40-c257-4ae9-beb5-4d6fa73655da"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "a8791968-07e6-4b12-a2d3-5b6906f81197",
              "name_org": "INN"
            },
            {
              "uuid": "bffcd2f7-795e-4125-8c6a-1bf86c06bf18",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "f9dae43c-ec97-4f7d-aa1d-4b4e8d5d84e5",
          "name": "NICLOSAMIDE (ANHYDROUS)",
          "stdName": "NICLOSAMIDE (ANHYDROUS)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1eca49a-1c54-44ca-81fe-46f43dd1f511"
          ],
          "display_name": false
        },
        {
          "uuid": "9f42992a-9feb-4bb3-bfad-09276e2258cf",
          "name": "NICLOSAMIDE ANHYDROUS [WHO-IP]",
          "stdName": "NICLOSAMIDE ANHYDROUS [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "782fd42d-a040-4146-96dc-9d0ee0d63e29"
          ],
          "display_name": false
        },
        {
          "uuid": "2724b45a-b6a5-f376-b17a-4ef72635c4ec",
          "name": "NICLOSAMIDE [EP MONOGRAPH]",
          "stdName": "NICLOSAMIDE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5892b468-742e-1375-7137-c5383a0f7d16"
          ],
          "display_name": false
        },
        {
          "uuid": "eb7505b7-b205-4de7-bd01-337bd9b52a27",
          "name": "NICLOSAMIDE [GREEN BOOK]",
          "stdName": "NICLOSAMIDE [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5f4c894-7c91-486c-ae6a-929ac2e9b369"
          ],
          "display_name": false
        },
        {
          "uuid": "21a2a3cb-988b-409b-8cba-e5e6c98d3f69",
          "name": "NICLOSAMIDE [HSDB]",
          "stdName": "NICLOSAMIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50b96478-6047-4b25-a8e3-0e3e26ad7b1a"
          ],
          "display_name": false
        },
        {
          "uuid": "122daed8-b76d-41a2-90e1-7c0352744e2c",
          "name": "NICLOSAMIDE [ISO]",
          "stdName": "NICLOSAMIDE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce102ee7-4ea2-45c6-9954-b404b182e398"
          ],
          "display_name": false
        },
        {
          "uuid": "825cc9f5-fe1d-42ce-a51e-ec8a6e2d8b27",
          "name": "NICLOSAMIDE [MART.]",
          "stdName": "NICLOSAMIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2818f9e2-2358-48d7-ba73-a3ad6e5c8490"
          ],
          "display_name": false
        },
        {
          "uuid": "9fc2236b-7259-4a06-b77a-4dc791d1b4b3",
          "name": "NICLOSAMIDE [MI]",
          "stdName": "NICLOSAMIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1002a16a-5602-4eed-b8df-e365f90287b5"
          ],
          "display_name": false
        },
        {
          "uuid": "69118f8b-eda6-443f-874e-75bd5c6978e0",
          "name": "NICLOSAMIDE [ORANGE BOOK]",
          "stdName": "NICLOSAMIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e8cc7d5-eedd-493e-a9a8-9614e11fff0b"
          ],
          "display_name": false
        },
        {
          "uuid": "7a432968-ec72-414c-a8d6-7ebe89b56fbb",
          "name": "NICLOSAMIDE [USAN]",
          "stdName": "NICLOSAMIDE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe8f25a5-3386-42fd-bae1-c8505cf4740e"
          ],
          "display_name": false
        },
        {
          "uuid": "9e42e4ca-5ce1-4beb-bbca-53858c3f6fa5",
          "name": "NICLOSAMIDE [VANDF]",
          "stdName": "NICLOSAMIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46450172-c438-4f0e-9ce0-6cd80eef1ae5"
          ],
          "display_name": false
        },
        {
          "uuid": "ddbe8023-960d-4561-a6f1-ba2396612014",
          "name": "NICLOSAMIDE, ANHYDROUS",
          "stdName": "NICLOSAMIDE, ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a207b2ae-86de-4cc7-a351-d3fa300a9d3c",
            "a6b586fe-7777-49f7-84be-9ef1b21896b1",
            "afea506d-ba6f-4cf9-a37d-2bb178939375"
          ],
          "display_name": false
        },
        {
          "uuid": "7a2948aa-a609-53e7-9726-0fad39d5f624",
          "name": "NICLOSAMIDE, ANHYDROUS [EP IMPURITY]",
          "stdName": "NICLOSAMIDE, ANHYDROUS [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a207b2ae-86de-4cc7-a351-d3fa300a9d3c"
          ],
          "display_name": false
        },
        {
          "uuid": "c517b9fc-487f-47ab-a2f2-e1c9b69a47ae",
          "name": "NICLOSAMIDUM ANHYDROUS [WHO-IP LATIN]",
          "stdName": "NICLOSAMIDUM ANHYDROUS [WHO-IP LATIN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "782fd42d-a040-4146-96dc-9d0ee0d63e29"
          ],
          "display_name": false
        },
        {
          "uuid": "efd1cd2b-0f96-4839-81c0-13179fc927d3",
          "name": "NSC-178296",
          "stdName": "NSC-178296",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e9e058f-a15a-4940-91dc-285dcd6f063e"
          ],
          "display_name": false
        },
        {
          "uuid": "3d998602-cdfa-4809-51a6-05263e3e95d8",
          "name": "Niclosamide [WHO-DD]",
          "stdName": "NICLOSAMIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9ebfe03-94a8-3518-b1a7-1cb96e0c6cc8"
          ],
          "display_name": false
        },
        {
          "uuid": "e1bf1748-88e7-4efc-9ae6-078cafee128a",
          "name": "WR 46234",
          "stdName": "WR 46234",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e9e058f-a15a-4940-91dc-285dcd6f063e"
          ],
          "display_name": false
        },
        {
          "uuid": "5ae61a0e-7456-49a6-adf5-a16bb02f42a6",
          "name": "niclosamide [INN]",
          "stdName": "NICLOSAMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bec685bf-c491-48e8-8dc9-662fa8748411"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a76e8b2c-803a-4065-b2d1-f33b69b97c34",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "afea506d-ba6f-4cf9-a37d-2bb178939375",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c70f32f8-3575-4757-8955-fb8be8d4c01f",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a98f0435-d48a-4f33-ad8c-f962672e6904",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bec685bf-c491-48e8-8dc9-662fa8748411",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fe8f25a5-3386-42fd-bae1-c8505cf4740e",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a207b2ae-86de-4cc7-a351-d3fa300a9d3c",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e8cc7d5-eedd-493e-a9a8-9614e11fff0b",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2818f9e2-2358-48d7-ba73-a3ad6e5c8490",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1002a16a-5602-4eed-b8df-e365f90287b5",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5f4c894-7c91-486c-ae6a-929ac2e9b369",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50b96478-6047-4b25-a8e3-0e3e26ad7b1a",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e502baf-7ccb-4275-8754-96e5c0bf558e",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46450172-c438-4f0e-9ce0-6cd80eef1ae5",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce102ee7-4ea2-45c6-9954-b404b182e398",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1eca49a-1c54-44ca-81fe-46f43dd1f511",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "782fd42d-a040-4146-96dc-9d0ee0d63e29",
          "citation": "WHO-IP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e9e058f-a15a-4940-91dc-285dcd6f063e",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05659f66-7765-4248-a0e9-25e474c9dd34",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88875669-be2b-4de2-97d2-d26b740d0156",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389713000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1f040fc-8dda-46bb-8d7e-35c6e3d009f0",
          "citation": "J.J ESPINOSA-AGUIRRE\\\\nMUTAGENIC ACTIVITY OF 2-CHLORO-4-NITROANILINE AND 5-CHLOROSALICYLIC ACID IN SALMONELLA TYPHIMURIUM: TWO POSSIBLE METABOLITES OF NICLOSAMIDE\\\\nMUTATION RESEARCH LETTERS \\\\nVOLUME 264, ISSUE 3, NOVEMBER 1991, PAGES 139?145",
          "url": "http://www.sciencedirect.com/science/article/pii/016579929190131M",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c82ed68a-ea09-48d2-afec-9e9a7da43cee",
          "citation": "SRS import [8KK8CQ2K8G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8KK8CQ2K8G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389713000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0a54e66-b389-4348-9759-559bf638f021",
          "citation": "NICLOSAMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "922cd487-c83e-41ae-aa32-60a47050b1f1",
          "citation": "NICLOSAMIDE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a6b586fe-7777-49f7-84be-9ef1b21896b1",
          "citation": "NICLOSAMIDE, ANHYDROUS [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "032081ae-da5a-41bf-b30c-d68c0874e865",
          "citation": "NICLOSAMIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "351c8fb2-ee53-48e2-b098-9fd0a436a93a",
          "citation": "NICLOSAMIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6472fcce-29b9-416d-a8db-54106570641f",
          "citation": "NICLOSAMIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6de23028-c20e-4880-b3ef-34897445b852",
          "citation": "NICLOSAMIDE [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "280b48c9-6ff3-413c-951b-036c018c11a4",
          "citation": "NICLOSAMIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "90a0fb40-c257-4ae9-beb5-4d6fa73655da",
          "citation": "NICLOSAMIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9035eb78-79cc-4384-aa91-c018c8e78b0d",
          "citation": "NICLOSAMIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b034aaaf-9363-49f8-9049-5b601bfc37c6",
          "citation": "NICLOSAMIDE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "74c16876-efa7-ccc2-babe-8154d634f9e0",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+50-65-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0dcc92c6-202c-f205-ec7e-460312190e22",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=50-65-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c4790aac-f257-92c6-d675-73631272e295",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "2ae86a28-64a4-d01c-0156-c347bbc0e1e2",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f662a594-47d0-49ca-90c0-177d47c70b0b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6c6dcc0d-76ba-4868-a351-831acc520781",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "5892b468-742e-1375-7137-c5383a0f7d16",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "d6ccd940-849b-0787-6fb4-50faac0b5fd2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0e885ae3-c59d-643f-e067-425f07c29fd2",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e9ebfe03-94a8-3518-b1a7-1cb96e0c6cc8",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "667a47e2-30e8-4940-9b3a-16df88cd2baf",
          "id": "667a47e2-30e8-4940-9b3a-16df88cd2baf",
          "molfile": "\n  Marvin  01132105202D          \n\n 21 22  0  0  0  0            999 V2000\n    0.7023   -4.1983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4328   -3.7893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1403   -4.2163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8709   -3.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8786   -3.0047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6144   -2.6034    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1712   -2.5648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4226   -2.9866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7254   -2.5493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7332   -1.7056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0051   -2.9198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6920   -2.5030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6843   -1.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3891   -1.2683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1197   -1.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1223   -2.4747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4328   -2.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4277   -3.6915    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8349   -1.2116    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -3.5551   -1.6078    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.8220   -0.3962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  8  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 17 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 15 19  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  2  0  0  0  0\nM  CHG  2  19   1  20  -1\nM  END",
          "smiles": "c1cc(c(cc1Cl)C(=O)Nc2ccc(cc2Cl)[N+](=O)[O-])O",
          "formula": "C13H8Cl2N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "420733a2-f4ba-4de6-8dd0-e017c3156f9a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "327.12",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "587b5b18-a664-410d-8412-3a011fee11cb",
      "version": "22",
      "structure": {
        "id": "fe5acb5f-4227-4e1b-a5dc-7afbd9852e52",
        "molfile": "\n  Marvin  01132113102D          \n\n 21 22  0  0  0  0            999 V2000\n   -2.8349   -1.2116    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    1.4226   -2.9866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7254   -2.5493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0051   -2.9198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1197   -1.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1223   -2.4747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6920   -2.5030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4328   -2.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4328   -3.7893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5551   -1.6078    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.1712   -2.5648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8220   -0.3962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7332   -1.7056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3891   -1.2683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6843   -1.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1403   -4.2163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8786   -3.0047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4277   -3.6915    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.8709   -3.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7023   -4.1983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6144   -2.6034    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  7  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7 15  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  2  2  0  0  0  0\n 10  1  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12  1  2  0  0  0  0\n 13  3  2  0  0  0  0\n 14  5  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16  9  1  0  0  0  0\n 17 11  2  0  0  0  0\n 18  8  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20  9  1  0  0  0  0\n 21 17  1  0  0  0  0\n  8  7  2  0  0  0  0\n 19 16  2  0  0  0  0\nM  CHG  2   1   1  10  -1\nM  END",
        "smiles": "c1cc(c(cc1Cl)C(=O)Nc2ccc(cc2Cl)[N+](=O)[O-])O",
        "formula": "C13H8Cl2N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "327.12",
        "optical_activity": "NONE",
        "references": [
          "a76e8b2c-803a-4065-b2d1-f33b69b97c34",
          "c82ed68a-ea09-48d2-afec-9e9a7da43cee",
          "bec685bf-c491-48e8-8dc9-662fa8748411"
        ],
        "stereo_centers": 0
      },
      "unii": "8KK8CQ2K8G"
    }
  ]
}