{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cbff08e2-0137-4354-b437-ecc760103e27",
          "code": "19210-12-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=19210-12-9",
          "code_system": "CAS",
          "references": [
            "dd4b4e6e-42b0-4ab5-bad4-935607471f05",
            "69491035-75af-4b67-8db2-32058267a4ba"
          ]
        },
        {
          "uuid": "951b1397-21f0-4ec1-b8b3-8b7b0001ba88",
          "code": "SUB124742",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "dd4b4e6e-42b0-4ab5-bad4-935607471f05"
          ]
        },
        {
          "uuid": "cf6527a4-020f-40e2-b7c7-d436cff0912c",
          "code": "242-881-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.038.967",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "dd4b4e6e-42b0-4ab5-bad4-935607471f05"
          ]
        },
        {
          "uuid": "b0c79020-2eb1-48d9-9ab8-d70a126736ca",
          "code": "5281542",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281542",
          "code_system": "PUBCHEM",
          "references": [
            "dd4b4e6e-42b0-4ab5-bad4-935607471f05"
          ]
        },
        {
          "uuid": "0e7572c1-e69b-1836-77c4-a58dc246372e",
          "code": "Harpagoside",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Harpagoside",
          "code_system": "WIKIPEDIA",
          "references": [
            "7d26bed3-66bc-b419-b4c6-36df5d7c69d4"
          ]
        },
        {
          "uuid": "10ef7d76-d0f7-ae14-84f3-794770faa8cc",
          "code": "2048124",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2048124/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a6cdba56-2973-46a1-fb93-4eaacac5c831"
          ]
        },
        {
          "uuid": "d926e51d-aee8-4f27-8890-9f0e22d3d6c2",
          "code": "8KGS1DC5ZU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3ce21b2a-e8c0-5b9b-68bb-e33c7e7d1341",
          "code": "100000145924",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "393afdc4-75a3-0656-686c-689d14f702d6"
          ]
        },
        {
          "uuid": "b702550a-8a1a-8825-4058-0fba355c7e94",
          "code": "DTXSID101032528",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID101032528",
          "code_system": "EPA CompTox",
          "references": [
            "8278682b-9a4d-67a4-b2d9-8587b5bc2a69"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2e13bb0c-fa8f-4071-bd21-affb8c63bf22",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6ca32898-17e5-4bca-98e3-35d684854d81",
            "refuuid": "14b7e78e-e589-4024-9b9a-11f167981840",
            "name": "HARPAGOSIDE",
            "unii": "8KGS1DC5ZU",
            "linking_id": "8KGS1DC5ZU",
            "ref_pname": "HARPAGOSIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "db43fdee-e92f-4a14-b686-91d5325abcc4",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "1cd3defe-cdf1-471a-a63b-645d5f7045e0",
            "refuuid": "5e494203-2ea9-4a36-8094-04a0ba669a9b",
            "name": "HARPAGOPHYTUM ZEYHERI ROOT",
            "unii": "1CTB7R80VI",
            "linking_id": "1CTB7R80VI",
            "ref_pname": "HARPAGOPHYTUM ZEYHERI ROOT"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c1a392d9-a6e9-4b43-b12d-cbc7a8a0ea36",
          "name": ".BETA.-D-GLUCOPYRANOSIDE, (1S,4AS,5R,7S,7AS)-1,4A,5,6,7,7A-HEXAHYDRO-4A,5-DIHYDROXY-7-METHYL-7-(((2E)-1-OXO-3-PHENYL-2-PROPENYL)OXY)CYCLOPENTA(C)PYRAN-1-YL",
          "stdName": ".BETA.-D-GLUCOPYRANOSIDE, (1S,4AS,5R,7S,7AS)-1,4A,5,6,7,7A-HEXAHYDRO-4A,5-DIHYDROXY-7-METHYL-7-(((2E)-1-OXO-3-PHENYL-2-PROPENYL)OXY)CYCLOPENTA(C)PYRAN-1-YL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78991455-b33e-4135-a9b8-299c19e34acb",
            "e57874ed-2d17-4e9e-ae69-a98267a2293a"
          ],
          "display_name": false
        },
        {
          "uuid": "2a396f0b-660b-4ed3-aaa2-3e92dcbfc397",
          "name": "E-HARPAGOSIDE",
          "stdName": "E-HARPAGOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e57874ed-2d17-4e9e-ae69-a98267a2293a",
            "86b05e8b-8a4b-4389-ba18-bf4db1bbb382"
          ],
          "display_name": false
        },
        {
          "uuid": "0b61d1f8-224d-4fdd-a8c8-78cc3150631a",
          "name": "HARPAGOSIDE",
          "stdName": "HARPAGOSIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46ad94a3-6b13-4a80-a7e7-f8c14346eea1",
            "e7531714-4c0f-454a-97af-d86b6f2dc15a",
            "e57874ed-2d17-4e9e-ae69-a98267a2293a",
            "d635fe86-5e58-4af9-ad63-98e534a8a3f8",
            "68040e05-69c7-4155-8135-3279e0ee5574",
            "57810683-3142-4725-84bf-1cc5ab6aba8d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8beb48c1-0c56-4784-96de-a5a76aa17dd9",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f42e7311-9e33-47b1-5b41-5b0da550ae87",
          "name": "Harpagoside [WHO-DD]",
          "stdName": "HARPAGOSIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b028834b-a972-cc4e-103f-4e2f43ca5004"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "46ad94a3-6b13-4a80-a7e7-f8c14346eea1",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "68040e05-69c7-4155-8135-3279e0ee5574",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e57874ed-2d17-4e9e-ae69-a98267a2293a",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78991455-b33e-4135-a9b8-299c19e34acb",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d635fe86-5e58-4af9-ad63-98e534a8a3f8",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86b05e8b-8a4b-4389-ba18-bf4db1bbb382",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd4b4e6e-42b0-4ab5-bad4-935607471f05",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391117000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce258c1c-e626-4a7b-a56a-05e9195fec0e",
          "citation": "SRS import [8KGS1DC5ZU]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8KGS1DC5ZU",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391117000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a9fa2e8-0eca-45fa-b068-399b3a6c1614",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57810683-3142-4725-84bf-1cc5ab6aba8d",
          "citation": "HARPAGOSIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e7531714-4c0f-454a-97af-d86b6f2dc15a",
          "citation": "HARPAGOSIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7d26bed3-66bc-b419-b4c6-36df5d7c69d4",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Harpagoside",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8278682b-9a4d-67a4-b2d9-8587b5bc2a69",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "69491035-75af-4b67-8db2-32058267a4ba",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a6cdba56-2973-46a1-fb93-4eaacac5c831",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "3f547f04-e3c3-7b10-626d-408660ec524f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "b028834b-a972-cc4e-103f-4e2f43ca5004",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "393afdc4-75a3-0656-686c-689d14f702d6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c1a3176d-6d57-487f-8ade-9cee7ed3b335",
          "id": "c1a3176d-6d57-487f-8ade-9cee7ed3b335",
          "molfile": "\n  Marvin  01132110012D          \n\n 35 38  0  0  1  0            999 V2000\n    7.6476   -6.8852    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.8965   -7.6767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1458   -6.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6959   -5.5465    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.6959   -4.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4244   -5.1408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1833   -4.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1833   -3.9564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8627   -5.1306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5772   -4.7119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2171   -5.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9505   -4.7018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6402   -5.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6402   -5.9497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9161   -6.3556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2171   -5.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8749   -5.7778    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.1948   -5.3739    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.1513   -4.6832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4402   -4.2647    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.4402   -3.4278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7292   -3.0093    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.7292   -2.0513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5151   -1.4551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0183   -3.4278    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.9804   -2.8946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0183   -4.2647    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.0721   -4.7462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7292   -4.6832    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.7292   -5.5201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4365   -5.7741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4365   -6.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1463   -7.0215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8749   -6.6156    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.8749   -7.6317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 34  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n 17  4  1  6  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 16  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 34  1  0  0  0  0\n 18 19  1  1  0  0  0\n 18 31  1  0  0  0  0\n 20 19  1  1  0  0  0\n 20 21  1  0  0  0  0\n 29 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  1  0  0  0\n 25 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 26  1  6  0  0  0\n 25 27  1  0  0  0  0\n 27 28  1  1  0  0  0\n 27 29  1  0  0  0  0\n 29 30  1  6  0  0  0\n 32 31  1  0  0  0  0\n 32 33  2  0  0  0  0\n 34 33  1  0  0  0  0\n 34 35  1  1  0  0  0\nM  END",
          "smiles": "CC1(C[C@H]([C@@]2(C=CO[C@H]([C@H]12)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O)OC(=O)/C=C/c4ccccc4",
          "formula": "C24H30O11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "03f776e7-4b66-45ea-98e2-f5edf9fc9bcd"
          },
          "defined_stereo": 9,
          "ez_centers": 1,
          "molecular_weight": "494.4893",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 10
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "14b7e78e-e589-4024-9b9a-11f167981840",
      "version": "16",
      "structure": {
        "id": "9f835432-57af-4a2c-ac30-1ec0a1b59d77",
        "molfile": "\n  Marvin  01132108172D          \n\n 37 40  0  0  1  0            999 V2000\n   11.9505   -4.7018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6402   -5.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6402   -5.9497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9161   -6.3556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2171   -5.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2171   -5.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5772   -4.7119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8627   -5.1306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1833   -4.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4244   -5.1408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6959   -5.5465    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.6959   -4.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8749   -5.7778    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.8749   -6.6156    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.1463   -7.0215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4365   -6.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4365   -5.7741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1948   -5.3739    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.1513   -4.6832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4402   -4.2647    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.7292   -4.6832    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.0183   -4.2647    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.0721   -4.7462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0183   -3.4278    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.7292   -3.0093    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.4402   -3.4278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7292   -2.0513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5151   -1.4551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9804   -2.8946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7292   -5.5201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4402   -5.1822    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8749   -7.6317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6476   -6.8852    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.8965   -7.6767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1458   -6.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8749   -4.7748    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1833   -3.9564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  1  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 13  1  0  0  0  0\n 18 19  1  1  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  1  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 20  1  0  0  0  0\n 25 27  1  1  0  0  0\n 28 27  1  0  0  0  0\n 24 29  1  6  0  0  0\n 21 30  1  6  0  0  0\n 20 31  1  6  0  0  0\n 14 32  1  1  0  0  0\n 33 14  1  0  0  0  0\n 33 34  1  1  0  0  0\n 33 35  1  0  0  0  0\n 35 11  1  0  0  0  0\n 13 36  1  1  0  0  0\n 37  9  2  0  0  0  0\nM  END",
        "smiles": "C[C@@]1(C[C@H]([C@@]2(C=CO[C@H]([C@]12[H])O[C@@]3([H])[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O)OC(=O)/C=C/c4ccccc4",
        "formula": "C24H30O11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 10,
        "ez_centers": 1,
        "molecular_weight": "494.4893",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ce258c1c-e626-4a7b-a56a-05e9195fec0e",
          "0a9fa2e8-0eca-45fa-b068-399b3a6c1614"
        ],
        "stereo_centers": 10
      },
      "unii": "8KGS1DC5ZU"
    }
  ]
}