{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "94244270-c151-4794-8e49-7a260e1a3ee9",
          "code": "55-97-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=55-97-0",
          "code_system": "CAS",
          "references": [
            "2256fc29-2881-4df6-8cce-f6242af29cc6",
            "f1ccb503-69cb-4640-8935-9dfd8ba7aa05"
          ]
        },
        {
          "uuid": "70c6c1a2-2db7-46b9-a06c-eec0c475bf2b",
          "code": "C80001",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80001",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2256fc29-2881-4df6-8cce-f6242af29cc6"
          ]
        },
        {
          "uuid": "447c27f5-d74e-4eba-8d08-a1dc54a43930",
          "code": "SUB08028MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "2256fc29-2881-4df6-8cce-f6242af29cc6"
          ]
        },
        {
          "uuid": "30996c88-6fa6-456d-879f-6452966f0aaa",
          "code": "2047",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2047",
          "code_system": "INN",
          "references": [
            "2256fc29-2881-4df6-8cce-f6242af29cc6"
          ]
        },
        {
          "uuid": "67deb168-8a7f-4b5a-97ff-2fc59ceaf7c7",
          "code": "200-249-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.227",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2256fc29-2881-4df6-8cce-f6242af29cc6"
          ]
        },
        {
          "uuid": "a723598c-0d0f-487a-a279-c3ae55a71f51",
          "code": "m5994",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5994?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "2256fc29-2881-4df6-8cce-f6242af29cc6"
          ]
        },
        {
          "uuid": "3a082705-7a9b-4639-ac45-6738ed6b06e1",
          "code": "CHEMBL100622",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL100622",
          "code_system": "ChEMBL",
          "references": [
            "2256fc29-2881-4df6-8cce-f6242af29cc6"
          ]
        },
        {
          "uuid": "ff96dc42-261c-47ab-83d4-ed226a699b84",
          "code": "5938",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5938",
          "code_system": "PUBCHEM",
          "references": [
            "2256fc29-2881-4df6-8cce-f6242af29cc6"
          ]
        },
        {
          "uuid": "ab0cdcb3-33d2-2894-dd78-9f49c11bf69a",
          "code": "C66886",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticholinergic Agent[C66880]|Nicotinic Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66886",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b71bcdd3-6a90-2087-8a95-8a29aa59a48e"
          ]
        },
        {
          "uuid": "f2c138d6-3124-49bf-88e3-5947e6a2d91c",
          "code": "8J77X3S603",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "914f84be-e4ec-8fdf-324a-47320c72b5d5",
          "code": "DBSALT001082",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT001082",
          "code_system": "DRUG BANK",
          "references": [
            "b71bcdd3-6a90-2087-8a95-8a29aa59a48e"
          ]
        },
        {
          "uuid": "1fc63efd-13ae-55f1-cbed-f7402449adb0",
          "code": "DTXSID50883229",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50883229",
          "code_system": "EPA CompTox",
          "references": [
            "b71bcdd3-6a90-2087-8a95-8a29aa59a48e"
          ]
        },
        {
          "uuid": "15b138d5-0069-d54c-123e-0a1607dbd435",
          "code": "163965",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=163965",
          "code_system": "NSC",
          "references": [
            "f5b2e9f5-c97a-2ad2-1c8e-c8b477684a09"
          ]
        },
        {
          "uuid": "0986402b-7fa9-f7ce-4552-f7e463cd5410",
          "code": "100000083955",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b738fbb3-a969-6fe4-e495-6fc8fefa455a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "0800b542-eb1a-4717-899f-230b0ef4b594",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "344ac070-6923-4080-8497-75ff284dedf1",
            "refuuid": "431d76f6-8965-4d69-be01-b72cac737254",
            "name": "HEXAMETHONIUM",
            "unii": "3C9PSP36Z2",
            "linking_id": "3C9PSP36Z2",
            "ref_pname": "HEXAMETHONIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8ab71077-5258-46f9-8c12-f4bcab589b66",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "90799223-eba9-47ec-b78a-932eab8314f1",
            "refuuid": "431d76f6-8965-4d69-be01-b72cac737254",
            "name": "HEXAMETHONIUM",
            "unii": "3C9PSP36Z2",
            "linking_id": "3C9PSP36Z2",
            "ref_pname": "HEXAMETHONIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f134051d-618c-3249-563c-f332e02e1769",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "f1ccb503-69cb-4640-8935-9dfd8ba7aa05"
          ],
          "related_substance": {
            "uuid": "e801975c-9092-45d3-b11f-b2f768572fce",
            "refuuid": "d813304b-6a13-4df2-b078-c441de7e47eb",
            "name": "HEXAMETHONIUM BROMIDE DIHYDRATE",
            "unii": "E010109G6B",
            "linking_id": "E010109G6B",
            "ref_pname": "HEXAMETHONIUM BROMIDE DIHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "91e0a7ee-8f51-4713-a321-a5ad71cfd536",
          "name": "HEXAMETHONE BROMIDE",
          "stdName": "HEXAMETHONE BROMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30515011-537d-45a4-8941-7fe94c61cbb5"
          ],
          "display_name": false
        },
        {
          "uuid": "b879c694-8789-4565-ba47-6fb9622f50fb",
          "name": "HEXAMETHONIUM BROMIDE",
          "stdName": "HEXAMETHONIUM BROMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a23788de-23be-4855-b8fd-f2e46f0cca06",
            "b2f6d8bc-6903-42b5-bd16-6ccfc37889dc",
            "1cf03fea-da99-4d10-b9f3-917c21393c94",
            "87c0ff84-e081-45ac-b0e5-f63b69754285",
            "82945fc3-de2a-4ec6-9822-ed95ba225c66",
            "0f58ce50-68c2-4e23-84ca-34e6da7a9143",
            "c945cadd-bdd9-4df4-bb86-39bcac5e6d11",
            "f7fe10c4-f26a-4b5a-b4c9-997d5cf93857",
            "30515011-537d-45a4-8941-7fe94c61cbb5",
            "4bd6efc4-2702-4d22-bada-5d4acda83584",
            "3144313c-6f74-456d-b1ae-666fc1c69fe6"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "9260cfbc-1796-4275-9d3e-d356dc00dc27",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "b6c0fa3a-e041-4d84-b6fc-153b76af7ffd",
          "name": "HEXAMETHONIUM BROMIDE [JAN]",
          "stdName": "HEXAMETHONIUM BROMIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a23788de-23be-4855-b8fd-f2e46f0cca06"
          ],
          "display_name": false
        },
        {
          "uuid": "3daf23d2-56c8-4ad0-b69d-0fd452b54ebe",
          "name": "HEXAMETHONIUM BROMIDE [MART.]",
          "stdName": "HEXAMETHONIUM BROMIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2f6d8bc-6903-42b5-bd16-6ccfc37889dc"
          ],
          "display_name": false
        },
        {
          "uuid": "d236b0f0-8431-4b5b-a0b9-96e9070d33a3",
          "name": "HEXAMETHONIUM BROMIDE [MI]",
          "stdName": "HEXAMETHONIUM BROMIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82945fc3-de2a-4ec6-9822-ed95ba225c66"
          ],
          "display_name": false
        },
        {
          "uuid": "ef5d4669-dfc2-4ab5-b7f5-f1da2fa04420",
          "name": "HEXAMETHYLENEBIS(TRIMETHYLAMMONIUM BROMIDE)",
          "stdName": "HEXAMETHYLENEBIS(TRIMETHYLAMMONIUM BROMIDE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30515011-537d-45a4-8941-7fe94c61cbb5"
          ],
          "display_name": false
        },
        {
          "uuid": "7e8f3086-3a93-3cdf-9323-ac7c58317dfe",
          "name": "Hexamethonium bromide [WHO-DD]",
          "stdName": "HEXAMETHONIUM BROMIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a149d7b-e613-19a6-e1ee-2b13be305552"
          ],
          "display_name": false
        },
        {
          "uuid": "4557ae64-fdd4-4dd3-a9b6-aa8db65a6a33",
          "name": "NSC-163965",
          "stdName": "NSC-163965",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ee56384-b749-46e0-b990-5f8aeec76c19"
          ],
          "display_name": false
        },
        {
          "uuid": "77589560-3a25-4e64-bfc6-1b138496cecf",
          "name": "hexamethonium bromide [INN]",
          "stdName": "HEXAMETHONIUM BROMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7fe10c4-f26a-4b5a-b4c9-997d5cf93857"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "30515011-537d-45a4-8941-7fe94c61cbb5",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f7fe10c4-f26a-4b5a-b4c9-997d5cf93857",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a23788de-23be-4855-b8fd-f2e46f0cca06",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2f6d8bc-6903-42b5-bd16-6ccfc37889dc",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4bd6efc4-2702-4d22-bada-5d4acda83584",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ee56384-b749-46e0-b990-5f8aeec76c19",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2256fc29-2881-4df6-8cce-f6242af29cc6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "974fde24-393b-497a-8c13-48f912b8f693",
          "citation": "SRS import [8J77X3S603]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8J77X3S603",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2926639-b329-45a2-92d3-77a0f700b162",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c945cadd-bdd9-4df4-bb86-39bcac5e6d11",
          "citation": "HEXAMETHONIUM BROMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1cf03fea-da99-4d10-b9f3-917c21393c94",
          "citation": "HEXAMETHONIUM BROMIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "87c0ff84-e081-45ac-b0e5-f63b69754285",
          "citation": "HEXAMETHONIUM BROMIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3144313c-6f74-456d-b1ae-666fc1c69fe6",
          "citation": "HEXAMETHONIUM BROMIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0f58ce50-68c2-4e23-84ca-34e6da7a9143",
          "citation": "HEXAMETHONIUM BROMIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "82945fc3-de2a-4ec6-9822-ed95ba225c66",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b71bcdd3-6a90-2087-8a95-8a29aa59a48e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f1ccb503-69cb-4640-8935-9dfd8ba7aa05",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f5b2e9f5-c97a-2ad2-1c8e-c8b477684a09",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8a149d7b-e613-19a6-e1ee-2b13be305552",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3933044c-81b2-4119-a055-056bd50824d5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b738fbb3-a969-6fe4-e495-6fc8fefa455a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c50a33d2-9401-4a79-a469-665a9310ab17",
          "id": "c50a33d2-9401-4a79-a469-665a9310ab17",
          "molfile": "\n  Marvin  01132110112D          \n\n  1  0  0  0  0  0            999 V2000\n    7.5027   -6.4955    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Br",
          "formula": "BrH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "dfd52957-1454-4217-9e73-62a877658c04"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "80.9115",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "510f2eec-2f12-4e4d-ab0c-1fb595614403",
          "id": "510f2eec-2f12-4e4d-ab0c-1fb595614403",
          "molfile": "\n  Marvin  01132104132D          \n\n 14 13  0  0  0  0            999 V2000\n   10.6925   -2.5181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0441   -3.0553    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    9.5671   -2.3606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6231   -3.6296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3032   -3.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5806   -3.0229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8582   -3.3935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1541   -2.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4132   -3.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7000   -2.9534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9589   -3.3379    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    4.3893   -2.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3152   -3.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4313   -4.0280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 11  1  0  0  0  0\nM  CHG  2   2   1  11   1\nM  END",
          "smiles": "C[N+](C)(C)CCCCCC[N+](C)(C)C",
          "formula": "C12H30N2",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e65da0ae-9d2d-4e68-aaa8-4c2b5d53a34a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "202.3805",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5ee1eca5-97b2-4450-9d1b-f816dce38334",
      "version": "14",
      "structure": {
        "id": "72b16536-4971-4953-8d0f-4ff4ef77b210",
        "molfile": "\n  Marvin  01132105572D          \n\n 16 13  0  0  0  0            999 V2000\n    4.9589   -3.3379    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.7000   -2.9534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4132   -3.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1541   -2.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8582   -3.3935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5806   -3.0229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3032   -3.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0441   -3.0553    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   10.6925   -2.5181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5671   -2.3606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6231   -3.6296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3893   -2.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3152   -3.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4313   -4.0280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5027   -6.4955    0.0000 Br  0  5  0  0  0  0  0  0  0  0  0  0\n    7.5027   -6.4955    0.0000 Br  0  5  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13  1  1  0  0  0  0\n 14  1  1  0  0  0  0\n  2  1  1  0  0  0  0\nM  CHG  4   1   1   8   1  15  -1  16  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  15  16\nM  SPA   1  1  15\nM  SDI   1  4    7.0827   -6.9155    7.0827   -6.0755\nM  SDI   1  4    7.9227   -6.0755    7.9227   -6.9155\nM  SMT   1 2\nM  END",
        "smiles": "C[N+](C)(C)CCCCCC[N+](C)(C)C.[Br-].[Br-]",
        "formula": "C12H30N2.2Br",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "362.1875",
        "optical_activity": "NONE",
        "references": [
          "974fde24-393b-497a-8c13-48f912b8f693",
          "e2926639-b329-45a2-92d3-77a0f700b162",
          "f7fe10c4-f26a-4b5a-b4c9-997d5cf93857"
        ],
        "stereo_centers": 0
      },
      "unii": "8J77X3S603"
    }
  ]
}