{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8848f894-f188-4c4e-b980-b2cada47de1d",
          "code": "2602-34-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2602-34-8",
          "code_system": "CAS",
          "references": [
            "99fd9720-5728-4948-a1ec-271374eccd1f",
            "994e0d5f-003f-4576-b675-bcdadba69821"
          ]
        },
        {
          "uuid": "a9462383-29bc-426c-bf5a-1a7dd29049b9",
          "code": "220-011-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.193",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "99fd9720-5728-4948-a1ec-271374eccd1f"
          ]
        },
        {
          "uuid": "e92664dd-df4c-4662-b845-195070bf0b06",
          "code": "102856",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/102856",
          "code_system": "PUBCHEM",
          "references": [
            "99fd9720-5728-4948-a1ec-271374eccd1f"
          ]
        },
        {
          "uuid": "2651b8c3-7842-47e3-b059-0201461a0dbb",
          "code": "8IVM34DGV2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3b3f5fcb-f208-1cbb-c894-72a3b4990738",
          "code": "DTXSID90862997",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90862997",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e30bf7ae-0bfc-4c3f-95a6-0e44c75734c1",
          "name": "(3-GLYCIDYLOXYPROPYL)TRIETHOXYSILANE",
          "stdName": "(3-GLYCIDYLOXYPROPYL)TRIETHOXYSILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b5f3b52-ec01-442d-a587-74caf9649555"
          ],
          "display_name": true
        },
        {
          "uuid": "b29d795f-e40b-41fd-b48f-d2f35883945d",
          "name": "3-(TRIETHOXYSILYL)PROPYL GLYCIDYL ETHER",
          "stdName": "3-(TRIETHOXYSILYL)PROPYL GLYCIDYL ETHER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c38092ff-deed-4615-b337-ea5968d88e9b"
          ],
          "display_name": false
        },
        {
          "uuid": "fea673ea-c6ad-4607-a583-ec36d1497c28",
          "name": "3-GPTES",
          "stdName": "3-GPTES",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c38092ff-deed-4615-b337-ea5968d88e9b"
          ],
          "display_name": false
        },
        {
          "uuid": "0bc7bc75-5ca8-4ce3-9115-97a5e555c0fc",
          "name": "OXIRANE, 2-((3-(TRIETHOXYSILYL)PROPOXY)METHYL)-",
          "stdName": "OXIRANE, 2-((3-(TRIETHOXYSILYL)PROPOXY)METHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c38092ff-deed-4615-b337-ea5968d88e9b"
          ],
          "display_name": false
        },
        {
          "uuid": "03dd6cd7-6fc9-4556-9f15-c4be3dcec507",
          "name": "SILANE, (3-(2,3-EPOXYPROPOXY)PROPYL)TRIETHOXY-",
          "stdName": "SILANE, (3-(2,3-EPOXYPROPOXY)PROPYL)TRIETHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c38092ff-deed-4615-b337-ea5968d88e9b"
          ],
          "display_name": false
        },
        {
          "uuid": "8284d8fc-a810-4a89-9115-b3780bcccdd1",
          "name": "TRIETHOXY(3-GLYCIDOXYPROPYL)SILANE",
          "stdName": "TRIETHOXY(3-GLYCIDOXYPROPYL)SILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c38092ff-deed-4615-b337-ea5968d88e9b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4b5f3b52-ec01-442d-a587-74caf9649555",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c38092ff-deed-4615-b337-ea5968d88e9b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99fd9720-5728-4948-a1ec-271374eccd1f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392545000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d19bfbb2-9a8c-48b9-aec3-1b9a4eb17f49",
          "citation": "SRS import [8IVM34DGV2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8IVM34DGV2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392545000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "891ec4cc-00ec-b871-b976-6d80b72e9955",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        },
        {
          "uuid": "994e0d5f-003f-4576-b675-bcdadba69821",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "94ed9c4d-5162-435b-8223-c1698bd25348",
          "id": "94ed9c4d-5162-435b-8223-c1698bd25348",
          "molfile": "\n  Marvin  01132107442D          \n\n 18 18  0  0  0  0            999 V2000\n    0.0000   -1.7080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7055   -2.1303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4182   -1.7080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1303   -2.1303    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    2.8358   -2.5460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8358   -3.3835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5485   -3.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5485   -4.6368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2606   -5.0519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2606   -5.8899    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.6763   -6.5955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8388   -6.5955    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5460   -1.4182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1303   -0.7055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5460    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7080   -2.8358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8771   -2.8358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4553   -3.5485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 13  1  0  0  0  0\n  4 16  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "CCO[Si](CCCOCC1CO1)(OCC)OCC",
          "formula": "C12H26O5Si",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4bcaf531-cb3b-4b98-a74e-1339a6eb90cf"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "278.4177",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d303b289-f736-411d-93a9-82aecaada70a",
      "version": "5",
      "structure": {
        "id": "128df430-4f95-46b7-829b-d7144dfbf4ba",
        "molfile": "\n  Marvin  01132101112D          \n\n 18 18  0  0  0  0            999 V2000\n    3.8391   -6.5961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1305   -2.1305    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2610   -5.8904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6767   -6.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4183   -1.7082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5462   -1.4183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7082   -2.8361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8361   -2.5462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8361   -3.3838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2610   -5.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5488   -4.6372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5488   -3.7995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8772   -2.8361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1305   -0.7056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7056   -2.1305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.7082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5462    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4553   -3.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  8  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  3 10  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5 15  1  0  0  0  0\n  6 14  1  0  0  0  0\n  7 13  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 12  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 18  1  0  0  0  0\n 14 17  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
        "smiles": "CCO[Si](CCCOCC1CO1)(OCC)OCC",
        "formula": "C12H26O5Si",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "278.4177",
        "optical_activity": "( + / - )",
        "references": [
          "d19bfbb2-9a8c-48b9-aec3-1b9a4eb17f49",
          "4b5f3b52-ec01-442d-a587-74caf9649555"
        ],
        "stereo_centers": 1
      },
      "unii": "8IVM34DGV2"
    }
  ]
}