{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1ef168e4-2f7d-450f-8d8b-d721642f6125",
          "code": "18836-52-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=18836-52-7",
          "code_system": "CAS",
          "references": [
            "8cf46c4d-51fb-4881-b291-77695fa7e967",
            "5a683658-a53b-44e6-9339-7c3b0fff4936"
          ]
        },
        {
          "uuid": "65693be0-e4bf-4827-973d-11f384a3fead",
          "code": "C008778",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67008778",
          "code_system": "MESH",
          "references": [
            "8cf46c4d-51fb-4881-b291-77695fa7e967"
          ]
        },
        {
          "uuid": "f4aee5de-d5ed-4d24-b9ce-17dd27651416",
          "code": "m8452",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8452?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8cf46c4d-51fb-4881-b291-77695fa7e967"
          ]
        },
        {
          "uuid": "be4d090e-58e7-44f1-989c-98295c4f5471",
          "code": "5318516",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5318516",
          "code_system": "PUBCHEM",
          "references": [
            "8cf46c4d-51fb-4881-b291-77695fa7e967"
          ]
        },
        {
          "uuid": "94ace09d-15e4-44f0-bc2a-7494ff51fbef",
          "code": "8IS5231171",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "45dc7901-f1ab-5554-1c2c-f3469014b274",
          "code": "DTXSID301019978",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301019978",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "09048847-20e5-3f68-6a89-50fea1cbd948",
          "code": "1587",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1587/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "b898a339-b2a6-9077-68a6-ca9be6e7b2fa"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "90ae9e64-26ba-49aa-953d-309893cb33f6",
          "name": "(2E,4E)-N-(2-METHYLPROPYL)-2,4-DECADIENAMIDE",
          "stdName": "(2E,4E)-N-(2-METHYLPROPYL)-2,4-DECADIENAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c32de343-1ed5-4858-86b0-ed81c8b270ce",
            "76355b48-1c49-44a6-8bd1-23325c75216d"
          ],
          "display_name": false
        },
        {
          "uuid": "2dbfc4a0-389f-46c0-8f34-5988986b8afd",
          "name": "(E,E)-N-ISOBUTYL-2,4-DECADIENAMIDE",
          "stdName": "(E,E)-N-ISOBUTYL-2,4-DECADIENAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c32de343-1ed5-4858-86b0-ed81c8b270ce",
            "76355b48-1c49-44a6-8bd1-23325c75216d"
          ],
          "display_name": false
        },
        {
          "uuid": "8a54b8bf-6e75-42a9-8f4a-25b8ddf2e4fe",
          "name": "FEMA NO. 4148",
          "stdName": "FEMA NO. 4148",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "226165d5-ea87-49e5-8798-4b20d45b4238",
            "76355b48-1c49-44a6-8bd1-23325c75216d"
          ],
          "display_name": false
        },
        {
          "uuid": "381fdcfc-f7e1-4ad7-8239-0f81e2cbf9ee",
          "name": "METHYLPROPYL)-2,4-DECADIENAMIDE, (E,E)-N-(2-",
          "stdName": "METHYLPROPYL)-2,4-DECADIENAMIDE, (E,E)-N-(2-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82fe4269-015e-42c4-be6e-1dc2982b0323"
          ],
          "display_name": false
        },
        {
          "uuid": "b5aef735-bff4-40c8-bac5-4416f156256a",
          "name": "N-ISOBUTYL (E,E)-2,4-DECADIENAMIDE",
          "stdName": "N-ISOBUTYL (E,E)-2,4-DECADIENAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "226165d5-ea87-49e5-8798-4b20d45b4238",
            "76355b48-1c49-44a6-8bd1-23325c75216d"
          ],
          "display_name": false
        },
        {
          "uuid": "843f93ad-f348-4a5a-91f2-31951c494339",
          "name": "N-ISOBUTYL-2,4-DECADIENAMIDE, TRANS,TRANS-",
          "stdName": "N-ISOBUTYL-2,4-DECADIENAMIDE, TRANS,TRANS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "882a2310-6cec-4975-83d3-c98a1c31e48e",
            "76355b48-1c49-44a6-8bd1-23325c75216d"
          ],
          "display_name": false
        },
        {
          "uuid": "286dc390-4d8d-4825-b22f-20ba4a27d73e",
          "name": "PELLITORINE",
          "stdName": "PELLITORINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c32de343-1ed5-4858-86b0-ed81c8b270ce",
            "2f92fca6-f0a0-456a-9829-41bfe97d0fa3",
            "f67e1a9a-16f9-4f0d-a21c-148bbbe2e939",
            "76355b48-1c49-44a6-8bd1-23325c75216d"
          ],
          "display_name": true
        },
        {
          "uuid": "fb4b2388-e31d-4655-92f9-cb130063734f",
          "name": "PELLITORINE [MI]",
          "stdName": "PELLITORINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f92fca6-f0a0-456a-9829-41bfe97d0fa3",
            "76355b48-1c49-44a6-8bd1-23325c75216d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "82fe4269-015e-42c4-be6e-1dc2982b0323",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2f92fca6-f0a0-456a-9829-41bfe97d0fa3",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76355b48-1c49-44a6-8bd1-23325c75216d",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c32de343-1ed5-4858-86b0-ed81c8b270ce",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "226165d5-ea87-49e5-8798-4b20d45b4238",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "882a2310-6cec-4975-83d3-c98a1c31e48e",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8cf46c4d-51fb-4881-b291-77695fa7e967",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390937000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c9633d7-4402-4562-ab9f-c2974ff309a0",
          "citation": "SRS import [8IS5231171]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8IS5231171",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390937000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4bdc28ef-8d43-4873-95e7-d156e4866ad8",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f67e1a9a-16f9-4f0d-a21c-148bbbe2e939",
          "citation": "PELLITORINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5a683658-a53b-44e6-9339-7c3b0fff4936",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b898a339-b2a6-9077-68a6-ca9be6e7b2fa",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "905c3935-4396-4fba-a5cf-018cfbbd1b32",
          "id": "905c3935-4396-4fba-a5cf-018cfbbd1b32",
          "molfile": "\n  Marvin  01132107292D          \n\n 16 15  0  0  0  0            999 V2000\n    2.5843   -5.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3002   -4.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0122   -5.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7323   -4.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4446   -5.2616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1605   -4.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8723   -5.2727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5893   -4.8646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3006   -5.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0243   -4.8719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0243   -4.0479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7344   -5.2880    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4489   -4.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1560   -5.2978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1560   -6.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8669   -4.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
          "smiles": "CCCCC/C=C/C=C/C(=O)NCC(C)C",
          "formula": "C14H25NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d1647aac-d316-480e-b538-211b38331268"
          },
          "defined_stereo": 0,
          "ez_centers": 2,
          "molecular_weight": "223.3549",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ce3c37b3-7455-4897-9940-66cabb0d28f6",
      "version": "4",
      "structure": {
        "id": "db18f1f6-f40f-4e7a-ae25-2f4f2dc297d3",
        "molfile": "\n  Marvin  01132111222D          \n\n 16 15  0  0  0  0            999 V2000\n    9.7344   -5.2880    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0243   -4.8719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0243   -4.0479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3006   -5.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5893   -4.8646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8723   -5.2727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1605   -4.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4446   -5.2616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7323   -4.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0122   -5.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3002   -4.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5843   -5.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4489   -4.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1560   -5.2978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1560   -6.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8669   -4.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
        "smiles": "CCCCC/C=C/C=C/C(=O)NCC(C)C",
        "formula": "C14H25NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 2,
        "molecular_weight": "223.3549",
        "optical_activity": "NONE",
        "references": [
          "4bdc28ef-8d43-4873-95e7-d156e4866ad8",
          "5c9633d7-4402-4562-ab9f-c2974ff309a0"
        ],
        "stereo_centers": 0
      },
      "unii": "8IS5231171"
    }
  ]
}