{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "74dbe36e-e419-48a7-859b-f37fdba0affd",
          "code": "ALLYL ALPHA-IONONE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4680",
          "code_system": "JECFA EVALUATION",
          "references": [
            "d261c8ff-2793-47d7-b56e-cb3009c26898"
          ]
        },
        {
          "uuid": "e05db372-e4b2-472b-863c-25a3d576fdba",
          "code": "79-78-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=79-78-7",
          "code_system": "CAS",
          "references": [
            "d261c8ff-2793-47d7-b56e-cb3009c26898",
            "51cb2f62-4c54-44ca-a423-6c1095635228"
          ]
        },
        {
          "uuid": "46ca4c7b-af74-4f27-a726-ede7665f6554",
          "code": "C526345",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67526345",
          "code_system": "MESH",
          "references": [
            "d261c8ff-2793-47d7-b56e-cb3009c26898"
          ]
        },
        {
          "uuid": "6f4eeea2-f200-47bf-9e66-6a3616adf44b",
          "code": "21 CFR 172.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "d261c8ff-2793-47d7-b56e-cb3009c26898"
          ]
        },
        {
          "uuid": "655c079a-50d8-4790-8671-2dccf8268315",
          "code": "201-225-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.115",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d261c8ff-2793-47d7-b56e-cb3009c26898"
          ]
        },
        {
          "uuid": "d6d0e905-6d57-49c4-8aba-305e0b78b1b9",
          "code": "SUB176895",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d261c8ff-2793-47d7-b56e-cb3009c26898"
          ]
        },
        {
          "uuid": "32dc9d80-0d3a-4212-9a51-66b4896ccfe5",
          "code": "5365976",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5365976",
          "code_system": "PUBCHEM",
          "references": [
            "d261c8ff-2793-47d7-b56e-cb3009c26898"
          ]
        },
        {
          "uuid": "43c466cb-d6c0-22cc-e720-f742a7bfe498",
          "code": "DTXSID4047591",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4047591",
          "code_system": "EPA CompTox",
          "references": [
            "e7884f8f-b764-28af-c046-9b23cc6ce0a5"
          ]
        },
        {
          "uuid": "36703791-7a96-c7b2-ebbf-76cc6518fb0f",
          "code": "2396431",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2396431/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ab7160d6-155b-09c8-a036-34550b434107"
          ]
        },
        {
          "uuid": "1c841079-f30b-46ec-8b16-890db391ab27",
          "code": "8IP66F9ODG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1e7b55da-ec59-d827-04dd-1b6df883596a",
          "code": "100000162878",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9cefcd6e-e0b4-0fb9-dff8-931779942d8a"
          ]
        },
        {
          "uuid": "f40e3382-56bb-b097-2633-3f408492c2cd",
          "code": "8IP66F9ODG",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8IP66F9ODG",
          "code_system": "DAILYMED",
          "references": [
            "9441dd15-d5d7-3d61-7332-a552fcc15248"
          ]
        },
        {
          "uuid": "75c2b961-9f92-a20e-c5a4-60bcf287f47c",
          "code": "668",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/668/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "c649b08d-0d9e-96ae-10be-8647ed791e3e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d11b00f0-8d74-491d-bc16-3f79a8e7254f",
          "name": "(±)-ALLYL .ALPHA.-IONONE",
          "stdName": "(+/-)-ALLYL .ALPHA.-IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57e70308-33b8-4560-87ae-a830abd119cf",
            "989edb00-75f0-4e8a-9efe-db5a2ca7d8cc"
          ],
          "display_name": false
        },
        {
          "uuid": "c9c7a34c-f446-40ea-96f9-ee2f2969904f",
          "name": "1,6-HEPTADIEN-3-ONE, 1-(2,6,6-TRIMETHYL-2-CYCLOHEXEN-1-YL)-",
          "stdName": "1,6-HEPTADIEN-3-ONE, 1-(2,6,6-TRIMETHYL-2-CYCLOHEXEN-1-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57e70308-33b8-4560-87ae-a830abd119cf",
            "da14ded2-1346-4c25-8060-636cef409f3e"
          ],
          "display_name": false
        },
        {
          "uuid": "f47e0924-6140-4d10-84a4-9d7000c1db09",
          "name": "1-(2,6,6-TRIMETHYL-2-CYCLOHEXEN-1-YL)HEPTA-1,6-DIEN-3-ONE",
          "stdName": "1-(2,6,6-TRIMETHYL-2-CYCLOHEXEN-1-YL)HEPTA-1,6-DIEN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57e70308-33b8-4560-87ae-a830abd119cf",
            "da14ded2-1346-4c25-8060-636cef409f3e"
          ],
          "display_name": false
        },
        {
          "uuid": "4aa0a9fb-b66f-48e4-ac74-b9c949012366",
          "name": "ALLYL .ALPHA.-IONONE",
          "stdName": "ALLYL .ALPHA.-IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07fe5783-e2c4-4cac-aaf2-5a7ef3a7a6a1",
            "d8bd6593-7dba-4cb5-9de7-e1c10cf5a46f",
            "07eb5a06-16fe-4996-86ea-d13e556497fe",
            "57e70308-33b8-4560-87ae-a830abd119cf",
            "907c90c2-10e2-40b2-be0b-b2f4cd5ccbe7"
          ],
          "display_name": true
        },
        {
          "uuid": "4fa07163-d751-4da6-96bd-7c01f95b94fa",
          "name": "ALLYL .ALPHA.-IONONE [FHFI]",
          "stdName": "ALLYL .ALPHA.-IONONE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57e70308-33b8-4560-87ae-a830abd119cf",
            "907c90c2-10e2-40b2-be0b-b2f4cd5ccbe7"
          ],
          "display_name": false
        },
        {
          "uuid": "bb562e7a-3a49-43cf-92e6-ce51d88a74d4",
          "name": "ALLYL .ALPHA.-IONONE [II]",
          "stdName": "ALLYL .ALPHA.-IONONE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07eb5a06-16fe-4996-86ea-d13e556497fe",
            "57e70308-33b8-4560-87ae-a830abd119cf"
          ],
          "display_name": false
        },
        {
          "uuid": "f63efa16-e11e-410b-87ff-0d9a193913cc",
          "name": "ALLYL .ALPHA.-IONONE, (±)-",
          "stdName": "ALLYL .ALPHA.-IONONE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57e70308-33b8-4560-87ae-a830abd119cf",
            "989edb00-75f0-4e8a-9efe-db5a2ca7d8cc"
          ],
          "display_name": false
        },
        {
          "uuid": "bdfabb3e-0975-4b70-80d0-39839e5070cd",
          "name": "ALLYL ALPHA-IONONE",
          "stdName": "ALLYL ALPHA-IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07eb5a06-16fe-4996-86ea-d13e556497fe",
            "57e70308-33b8-4560-87ae-a830abd119cf",
            "8e9f885b-9d31-4f8a-bbd6-2980485d8ec6"
          ],
          "display_name": false
        },
        {
          "uuid": "1df139f6-5ca2-44f6-a4fc-be4bfa3f7a95",
          "name": "ALLYL ALPHA-IONONE [FCC]",
          "stdName": "ALLYL ALPHA-IONONE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07eb5a06-16fe-4996-86ea-d13e556497fe",
            "57e70308-33b8-4560-87ae-a830abd119cf"
          ],
          "display_name": false
        },
        {
          "uuid": "05e33de7-c190-42ab-98fb-4dcee482dc1c",
          "name": "ALLYL IONONE",
          "stdName": "ALLYL IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07eb5a06-16fe-4996-86ea-d13e556497fe",
            "57e70308-33b8-4560-87ae-a830abd119cf"
          ],
          "display_name": false
        },
        {
          "uuid": "913a84e9-0a4e-4966-afd6-88195ee4750d",
          "name": "FEMA NO. 2033",
          "stdName": "FEMA NO. 2033",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07eb5a06-16fe-4996-86ea-d13e556497fe",
            "57e70308-33b8-4560-87ae-a830abd119cf"
          ],
          "display_name": false
        },
        {
          "uuid": "57225864-8dad-4b94-bce8-60d49b72124e",
          "name": "IONONE, ALLYL .ALPHA.-",
          "stdName": "IONONE, ALLYL .ALPHA.-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93756850-0228-4125-a4b3-d14510e08583",
            "57e70308-33b8-4560-87ae-a830abd119cf"
          ],
          "display_name": false
        },
        {
          "uuid": "77f1ce92-93a3-4e9a-85f2-84b6c608ccf2",
          "name": "TROPICAL IONONE",
          "stdName": "TROPICAL IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57e70308-33b8-4560-87ae-a830abd119cf",
            "71bfe633-9836-49ad-9cd5-4fde8765e476"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "07eb5a06-16fe-4996-86ea-d13e556497fe",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "57e70308-33b8-4560-87ae-a830abd119cf",
          "citation": "USP FOOD CHEMICALS CODEX",
          "doc_type": "USP FOOD CHEMICALS CODEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da14ded2-1346-4c25-8060-636cef409f3e",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71bfe633-9836-49ad-9cd5-4fde8765e476",
          "citation": "http://www.thegoodscentscompany.com/data/rw1019831.html",
          "url": "http://www.thegoodscentscompany.com/data/rw1019831.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93756850-0228-4125-a4b3-d14510e08583",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "907c90c2-10e2-40b2-be0b-b2f4cd5ccbe7",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "989edb00-75f0-4e8a-9efe-db5a2ca7d8cc",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d261c8ff-2793-47d7-b56e-cb3009c26898",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390746000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73723164-2cea-4e3e-b855-b56cb43d5ac2",
          "citation": "SRS import [8IP66F9ODG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8IP66F9ODG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390746000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8bd6593-7dba-4cb5-9de7-e1c10cf5a46f",
          "citation": "ALLYL .ALPHA.-IONONE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8e9f885b-9d31-4f8a-bbd6-2980485d8ec6",
          "citation": "ALLYL ALPHA-IONONE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "07fe5783-e2c4-4cac-aaf2-5a7ef3a7a6a1",
          "citation": "ALLYL .ALPHA.-IONONE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e7884f8f-b764-28af-c046-9b23cc6ce0a5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=79-78-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ab7160d6-155b-09c8-a036-34550b434107",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "51cb2f62-4c54-44ca-a423-6c1095635228",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9441dd15-d5d7-3d61-7332-a552fcc15248",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "9cefcd6e-e0b4-0fb9-dff8-931779942d8a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "c649b08d-0d9e-96ae-10be-8647ed791e3e",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "370346e1-1451-4720-bcd3-37f61ab0ef73",
          "id": "370346e1-1451-4720-bcd3-37f61ab0ef73",
          "molfile": "\n  Marvin  01132102562D          \n\n 17 17  0  0  0  0            999 V2000\n    5.4125    0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4204   -0.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7083   -0.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7083   -1.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4204   -1.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1324   -1.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9542   -1.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3417   -2.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1324   -0.6833    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.8417   -0.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5542   -0.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2667   -0.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2625    0.5625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0458   -0.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8583   -0.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6042   -0.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4500   -0.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  9  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\nM  END",
          "smiles": "C=CCCC(=O)/C=C/C1C(=CCCC1(C)C)C",
          "formula": "C16H24O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e1c29bce-81ab-4233-9255-dd7c2bb0ebb9"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "232.3618",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d0ea0abf-0157-4ebc-8aa6-e4fe74080e36",
      "version": "9",
      "structure": {
        "id": "8379c29a-d4fa-44f8-9a93-1c2c75fd38fd",
        "molfile": "\n  Marvin  01132106492D          \n\n 17 17  0  0  0  0            999 V2000\n    4.7083   -0.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7083   -1.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4204   -1.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1324   -1.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1324   -0.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4204   -0.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4125    0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9542   -1.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3417   -2.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8417   -0.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5542   -0.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2667   -0.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0458   -0.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8583   -0.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6042   -0.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4500   -0.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2625    0.5625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  6  2  0  0  0  0\n  4  9  1  0  0  0  0\n  2  3  1  0  0  0  0\n  5 10  1  0  0  0  0\n  3  4  1  0  0  0  0\n 10 11  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  6  7  1  0  0  0  0\n 14 15  1  0  0  0  0\n  1  2  1  0  0  0  0\n 15 16  2  0  0  0  0\n  4  8  1  0  0  0  0\n 12 17  2  0  0  0  0\n 11 12  1  0  0  0  0\nM  END",
        "smiles": "C=CCCC(=O)/C=C/C1C(=CCCC1(C)C)C",
        "formula": "C16H24O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "232.3618",
        "optical_activity": "( + / - )",
        "references": [
          "07eb5a06-16fe-4996-86ea-d13e556497fe",
          "73723164-2cea-4e3e-b855-b56cb43d5ac2"
        ],
        "stereo_centers": 1
      },
      "unii": "8IP66F9ODG"
    }
  ]
}