{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ce2d2495-4f31-44b7-b96b-361d7f9c8f9a", "code": "1814-64-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1814-64-8", "code_system": "CAS", "references": [ "e811a22b-692b-4970-8dd9-dd6c1bc0955b", "e4ec3560-e203-4472-aadc-fd76e79fd2d1" ] }, { "uuid": "a2b63316-49ae-4e7c-b4dd-42e521667d38", "code": "121930", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/121930", "code_system": "PUBCHEM", "references": [ "e811a22b-692b-4970-8dd9-dd6c1bc0955b" ] }, { "uuid": "ffe70a0a-c615-1224-5151-a23e8ae98229", "code": "DTXSID30171136", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30171136", "code_system": "EPA CompTox", "references": [ "4752bac6-2db6-5a84-c67b-34c602017373" ] }, { "uuid": "b47d80b3-a736-438a-83d6-a51ed8a032dd", "code": "8HAJ699EWG", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "6819bbb3-e080-409f-a8d8-61992744abd3", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "8d710df0-f7c9-4489-b470-90abe25cf3f8", "refuuid": "2a7b9451-3796-4682-8ed3-40de93a26a24", "name": "LY-165163", "unii": "8HAJ699EWG", "linking_id": "8HAJ699EWG", "ref_pname": "LY-165163", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "385140e8-89dc-475c-b4e2-76982121b275", "name": "BENZENAMINE, 4-(2-(4-(3-(TRIFLUOROMETHYL)PHENYL)-1-PIPERAZINYL)ETHYL)-", "stdName": "BENZENAMINE, 4-(2-(4-(3-(TRIFLUOROMETHYL)PHENYL)-1-PIPERAZINYL)ETHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4911b3c7-fd7b-4cea-9614-1f40a7cfed6c", "099e651e-1be4-4956-b7fe-29daec829c48" ], "display_name": false }, { "uuid": "46c3b188-8e6e-4326-a208-75d697d18fdc", "name": "LY-165163", "stdName": "LY-165163", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7d7c9c2b-c75d-4c90-a764-5fe886b0420e", "9157f963-e511-41e0-adf1-bb158c3e3ff3" ], "display_name": true }, { "uuid": "bf46d694-6422-4b6d-abea-dc39edf1e895", "name": "P-NH2-PE-TFMPP", "stdName": "P-NH2-PE-TFMPP", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "56377cb7-be8a-4e69-97fb-9d736543977e", "099e651e-1be4-4956-b7fe-29daec829c48" ], "display_name": false } ], "references": [ { "uuid": "7d7c9c2b-c75d-4c90-a764-5fe886b0420e", "citation": "CHEMID 2011 Drugportal", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "9157f963-e511-41e0-adf1-bb158c3e3ff3", "citation": "DRUGPORTAL 2011", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4911b3c7-fd7b-4cea-9614-1f40a7cfed6c", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "099e651e-1be4-4956-b7fe-29daec829c48", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "56377cb7-be8a-4e69-97fb-9d736543977e", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e811a22b-692b-4970-8dd9-dd6c1bc0955b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391216000, "tags": [ "NOMEN" ] }, { "uuid": "6ffbff10-d9ab-4ed8-a094-e961f0510e4f", "citation": "SRS import [8HAJ699EWG]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8HAJ699EWG", "doc_type": "SRS", "public_domain": true, "document_date": 1493391216000, "tags": [ "NOMEN" ] }, { "uuid": "ed8e5555-cf9a-4953-b1b7-4c10dda08c97", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4752bac6-2db6-5a84-c67b-34c602017373", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1814-64-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e4ec3560-e203-4472-aadc-fd76e79fd2d1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a130d5cc-52db-4bd7-b3f9-979fb45460b4", "id": "a130d5cc-52db-4bd7-b3f9-979fb45460b4", "molfile": "\n Marvin 01132108222D \n\n 25 27 0 0 0 0 999 V2000\n 7.3668 -5.8078 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5437 -5.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1321 -5.0928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3048 -5.0928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8933 -5.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0701 -5.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6585 -5.0969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8312 -5.0969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4196 -5.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5922 -5.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1807 -5.0969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5922 -4.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4196 -4.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3534 -5.0969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0582 -4.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8855 -4.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2971 -5.0969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8855 -5.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0582 -5.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3096 -6.5271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7336 -7.2463 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0288 -6.1031 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5904 -6.9512 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3048 -6.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1321 -6.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 25 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 24 5 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 13 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 14 1 0 0 0 0\n 13 12 1 0 0 0 0\n 15 14 1 0 0 0 0\n 14 19 2 0 0 0 0\n 16 15 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 19 18 1 0 0 0 0\n 18 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 20 1 0 0 0 0\n 23 20 1 0 0 0 0\n 25 24 1 0 0 0 0\nM END", "smiles": "c1cc(cc(c1)N2CCN(CCc3ccc(cc3)N)CC2)C(F)(F)F", "formula": "C19H22F3N3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "88878ebc-2d0d-4b67-98f5-c27286dedba9" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "349.394", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "2a7b9451-3796-4682-8ed3-40de93a26a24", "version": "5", "structure": { "id": "4a2b38f0-8ee4-443c-ba3a-bee7bd89d985", "molfile": "\n Marvin 01132103532D \n\n 25 27 0 0 0 0 999 V2000\n -1.3096 -6.5271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1807 -5.0969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8855 -5.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3534 -5.0969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8312 -5.0969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0582 -5.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5922 -4.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5922 -5.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7336 -7.2463 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0288 -6.1031 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5904 -6.9512 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4196 -5.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4196 -4.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6585 -5.0969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5437 -5.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8933 -5.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3668 -5.8078 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0701 -5.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1321 -5.0928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1321 -6.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3048 -6.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3048 -5.0928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2971 -5.0969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0582 -4.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8855 -4.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 4 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 6 1 0 0 0 0\n 5 12 1 0 0 0 0\n 6 3 2 0 0 0 0\n 7 2 1 0 0 0 0\n 8 2 1 0 0 0 0\n 9 1 1 0 0 0 0\n 10 1 1 0 0 0 0\n 11 1 1 0 0 0 0\n 12 8 1 0 0 0 0\n 13 7 1 0 0 0 0\n 14 5 1 0 0 0 0\n 15 20 1 0 0 0 0\n 16 18 1 0 0 0 0\n 17 15 1 0 0 0 0\n 18 14 1 0 0 0 0\n 19 22 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 16 1 0 0 0 0\n 22 16 2 0 0 0 0\n 23 3 1 0 0 0 0\n 24 4 2 0 0 0 0\n 25 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 13 5 1 0 0 0 0\n 19 15 2 0 0 0 0\nM END", "smiles": "c1cc(cc(c1)N2CCN(CCc3ccc(cc3)N)CC2)C(F)(F)F", "formula": "C19H22F3N3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "349.394", "optical_activity": "NONE", "references": [ "ed8e5555-cf9a-4953-b1b7-4c10dda08c97", "6ffbff10-d9ab-4ed8-a094-e961f0510e4f" ], "stereo_centers": 0 }, "unii": "8HAJ699EWG" } ] }