{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fbc64a13-0bb9-4a09-80af-14645902b3ce",
          "code": "1104874-94-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1104874-94-3",
          "code_system": "CAS",
          "references": [
            "d0ce8a62-7785-4267-8f2a-3d21769beb28",
            "79e4be10-7c46-4373-8c78-9d91f905d801"
          ]
        },
        {
          "uuid": "68d3a02b-a13c-49a0-a486-8a9b8a90f1b8",
          "code": "56652925",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/56652925",
          "code_system": "PUBCHEM",
          "references": [
            "d0ce8a62-7785-4267-8f2a-3d21769beb28"
          ]
        },
        {
          "uuid": "6e3df96c-c3f0-cb24-6230-c961af44f8ab",
          "code": "DTXSID40149265",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40149265",
          "code_system": "EPA CompTox",
          "references": [
            "89c60e41-490c-41af-de84-e4c1429e77c3"
          ]
        },
        {
          "uuid": "b2993b85-86ea-4d5c-9a26-45cde5bdf15e",
          "code": "8GJP2KSJ0T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "12a155b6-6fa7-c406-8828-a372f12e99c0",
          "code": "100000175193",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6cdff69d-2d82-252f-f3e6-50c3bdbd5e51"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6b396c0b-b407-466c-b667-48e895a8d480",
          "name": "(S)-METHYL 2-(HEXANAMIDO)-3-(4-HYDROXYPHENYL)PROPANOATE",
          "stdName": "(S)-METHYL 2-(HEXANAMIDO)-3-(4-HYDROXYPHENYL)PROPANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e6bf3a7-7f10-46f1-a495-daf13648ba49"
          ],
          "display_name": false
        },
        {
          "uuid": "feeeb0d2-89ba-4c04-adfb-3a843cb608ba",
          "name": "DEFENSAMIDE",
          "stdName": "DEFENSAMIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f68e6725-e0bc-4142-b5e7-631c6709e8bc"
          ],
          "display_name": false
        },
        {
          "uuid": "9d27d425-b862-44af-b6e2-76914602f24e",
          "name": "L-TYROSINE, N-(1-OXOHEXYL)-, METHYL ESTER",
          "stdName": "L-TYROSINE, N-(1-OXOHEXYL)-, METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f68e6725-e0bc-4142-b5e7-631c6709e8bc",
            "1a73077f-a0a4-4711-93fc-64fa42006a6e"
          ],
          "display_name": false
        },
        {
          "uuid": "639218b7-f914-4aaf-ab23-28cf9a3b6de0",
          "name": "METHYL CAPROOYL TYROSINATE",
          "stdName": "METHYL CAPROOYL TYROSINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "f68e6725-e0bc-4142-b5e7-631c6709e8bc",
            "7a147a33-81c3-483b-953d-15df05b96a34",
            "156dadd4-8b6e-4ddb-81a5-61a0e13cbe67"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3beff4e6-aeba-4f1e-94fe-69288ebf4d7b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "764aac22-14af-c475-b8f5-8db1fbb17b8a",
          "name": "Methyl caprooyl tyrosinate [WHO-DD]",
          "stdName": "METHYL CAPROOYL TYROSINATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56abb08f-5229-7176-7dce-367a2ba63d2c"
          ],
          "display_name": false
        },
        {
          "uuid": "f17a24b8-4989-4830-b5e5-d0598edfbb0c",
          "name": "N-HEXANOYLTYROSINE METHYL ESTER",
          "stdName": "N-HEXANOYLTYROSINE METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e1c1e5c-2a22-43de-9e2f-7190ff6767f2",
            "f68e6725-e0bc-4142-b5e7-631c6709e8bc"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "1a73077f-a0a4-4711-93fc-64fa42006a6e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f68e6725-e0bc-4142-b5e7-631c6709e8bc",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e1c1e5c-2a22-43de-9e2f-7190ff6767f2",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e6bf3a7-7f10-46f1-a495-daf13648ba49",
          "citation": "MSDS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a147a33-81c3-483b-953d-15df05b96a34",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0ce8a62-7785-4267-8f2a-3d21769beb28",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390980000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2f746f0-2149-474c-a143-fd6375768195",
          "citation": "SRS import [8GJP2KSJ0T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8GJP2KSJ0T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390980000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "156dadd4-8b6e-4ddb-81a5-61a0e13cbe67",
          "citation": "METHYL CAPROOYL TYROSINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "89c60e41-490c-41af-de84-e4c1429e77c3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1104874-94-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "61726cc4-1c12-80d7-b516-9be64a940e7f",
          "citation": "WHO DRUG DICTIONARY 2019",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "79e4be10-7c46-4373-8c78-9d91f905d801",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "56abb08f-5229-7176-7dce-367a2ba63d2c",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6cdff69d-2d82-252f-f3e6-50c3bdbd5e51",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "62443c73-8fc4-4bfe-8278-5ba718de1d00",
          "id": "62443c73-8fc4-4bfe-8278-5ba718de1d00",
          "molfile": "\n  Marvin  01132105062D          \n\n 21 21  0  0  1  0            999 V2000\n   13.5637   -6.8706    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   14.2763   -7.2820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9889   -6.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7034   -7.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4179   -6.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4179   -6.0456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1305   -5.6341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7034   -5.6331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9889   -6.0456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8492   -7.2831    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1366   -6.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1366   -6.0488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4240   -7.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7114   -6.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9969   -7.2841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2824   -6.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5680   -7.2841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5637   -6.0477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8511   -5.6363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2763   -5.6363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2763   -4.8113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 10  1  6  0  0  0\n  1 18  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  9  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "CCCCCC(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)OC",
          "formula": "C16H23NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ab01b407-f059-4779-994e-f67b8ff8ca8f"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "293.3587",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ce388e88-697a-4993-9001-780125f2c3c0",
      "version": "10",
      "structure": {
        "id": "7828f14b-b191-4dca-bb65-5488358336b6",
        "molfile": "\n  Marvin  01132106142D          \n\n 21 21  0  0  1  0            999 V2000\n   17.4022   -4.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4022   -4.8929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1166   -5.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.8312   -4.8929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.8312   -4.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1166   -3.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6895   -5.3043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9770   -4.8929    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   19.5438   -3.6564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9770   -4.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2644   -3.6586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6895   -3.6586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2624   -5.3054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5498   -4.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8373   -5.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1246   -4.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5498   -4.0711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4102   -5.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6956   -4.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9812   -5.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6895   -2.8336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  5  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n  8 13  1  6  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 14 17  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 12 21  1  0  0  0  0\nM  END",
        "smiles": "CCCCCC(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)OC",
        "formula": "C16H23NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "293.3587",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b2f746f0-2149-474c-a143-fd6375768195",
          "7e6bf3a7-7f10-46f1-a495-daf13648ba49"
        ],
        "stereo_centers": 1
      },
      "unii": "8GJP2KSJ0T"
    }
  ]
}