{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3a8d0c26-5726-47f1-8a31-6f659c828ace",
          "code": "5696-06-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5696-06-0",
          "code_system": "CAS",
          "references": [
            "f761d870-3f57-46c5-a685-30868472045f",
            "c75b4f5d-bc04-4c5a-8403-5accc3e8f2b9"
          ]
        },
        {
          "uuid": "c10d1710-d33c-4ceb-b311-cb0b996999df",
          "code": "SUB08830MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f761d870-3f57-46c5-a685-30868472045f"
          ]
        },
        {
          "uuid": "d0d4b36c-5d07-499b-97c0-3ede5580b7eb",
          "code": "1299",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1299",
          "code_system": "INN",
          "references": [
            "f761d870-3f57-46c5-a685-30868472045f"
          ]
        },
        {
          "uuid": "77dc3dae-68d7-4cff-bf62-8aede660e227",
          "code": "m823",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m823?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f761d870-3f57-46c5-a685-30868472045f"
          ]
        },
        {
          "uuid": "6be03d40-1b16-4e5e-b28f-146317769c56",
          "code": "CHEMBL94127",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL94127",
          "code_system": "ChEMBL",
          "references": [
            "f761d870-3f57-46c5-a685-30868472045f"
          ]
        },
        {
          "uuid": "aeb180c5-baa9-4fcc-8591-8094c163bfa6",
          "code": "21908",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21908",
          "code_system": "PUBCHEM",
          "references": [
            "f761d870-3f57-46c5-a685-30868472045f"
          ]
        },
        {
          "uuid": "2d257768-cbe5-4ef5-8243-849ffb08b624",
          "code": "8G09Z6AF2T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e82f3aca-597f-ad3a-f80f-130f935ae8ac",
          "code": "C175131",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C175131",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d335a181-5c10-eaa3-7f04-f198e1d6248b"
          ]
        },
        {
          "uuid": "38d47c48-d301-1700-8d72-e725b1da819e",
          "code": "100000081205",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "39ae8b7a-c3aa-77a6-9810-33a7bf60d3c2"
          ]
        },
        {
          "uuid": "41952d60-e23f-1eef-0902-f18d9ccd39d0",
          "code": "DTXSID60863597",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60863597",
          "code_system": "EPA CompTox",
          "references": [
            "c6cb4733-1229-dce4-5d6b-a6d2926b1a3d"
          ]
        },
        {
          "uuid": "b7d839ff-8a73-de91-3e57-571b46563dd8",
          "code": "524411",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=524411",
          "code_system": "NSC",
          "references": [
            "9ec2b0b7-c148-7a58-7919-b60df016d6d2"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "58767be7-227d-43b2-be96-b766813dcdd0",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "57f4c053-87f1-4387-8238-b102b7c5728a",
            "refuuid": "0c323e2a-1640-4afc-8c88-46639696922e",
            "name": "METHETOIN",
            "unii": "8G09Z6AF2T",
            "linking_id": "8G09Z6AF2T",
            "ref_pname": "METHETOIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d8808347-ea07-441f-bd69-097ed7bcd066",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "f438c353-04e3-439f-a627-a4e867f21a72",
            "refuuid": "c98e1e44-af25-461f-a837-785efe4ac04b",
            "name": "METHETOIN, (R)-",
            "unii": "BSH5HY4ACU",
            "linking_id": "BSH5HY4ACU",
            "ref_pname": "METHETOIN, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "762ce427-ce19-4e59-b424-a9faf6f17452",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "03d9093c-69c7-4d1e-8813-46b081920258",
            "refuuid": "1651b9d3-81cb-4b0e-9a8d-47f3928aa52c",
            "name": "METHETOIN, (S)-",
            "unii": "4UEU343GHD",
            "linking_id": "4UEU343GHD",
            "ref_pname": "METHETOIN, (S)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "15188fbb-b579-4fdd-bd0a-738c28b2b5af",
          "name": "2,4-IMIDAZOLIDINEDIONE, 5-ETHYL-1-METHYL-5-PHENYL-",
          "stdName": "2,4-IMIDAZOLIDINEDIONE, 5-ETHYL-1-METHYL-5-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f100eca-cd53-47c5-96fa-0f947049aebe"
          ],
          "display_name": false
        },
        {
          "uuid": "7479aa04-aca3-46ba-9878-d4529858413e",
          "name": "5-Ethyl-1-methyl-5-phenylhydantoin",
          "stdName": "5-ETHYL-1-METHYL-5-PHENYLHYDANTOIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f100eca-cd53-47c5-96fa-0f947049aebe"
          ],
          "display_name": false
        },
        {
          "uuid": "44393266-35d9-4896-b991-808c5fa7c9fa",
          "name": "METETOIN",
          "stdName": "METETOIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0b4fcd2-77d2-4217-b82b-c1d5967df18d",
            "0fbe2bb3-8aaf-4745-bf72-efca18b6f953",
            "99b55025-47bc-487c-abbe-8216e279ad6d",
            "b9872533-a512-4ef0-894f-9dd1490305de",
            "5434e482-7696-462e-83c7-f7676a0cb531"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "c56243c7-5697-407c-84ec-38f10666f19c",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "a34ef095-d9a9-4173-9cb2-a69212581704",
          "name": "METHETOIN",
          "stdName": "METHETOIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1518b54-5b8d-4d54-a6c7-da94533bab17",
            "8ff53a0d-0e8f-4c48-aac2-ec580488ed19",
            "2f100eca-cd53-47c5-96fa-0f947049aebe",
            "5b3b1b5c-e2bf-4061-907c-8f23cd522165",
            "6e4d2acb-0f9f-4b9c-ae0b-18ff8639d808"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "047da477-12b8-4f4f-9e38-5f25fcd239b0",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "e0c79995-5ea0-4aa3-969c-a0326220d5ab",
          "name": "METHETOIN [MI]",
          "stdName": "METHETOIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1518b54-5b8d-4d54-a6c7-da94533bab17"
          ],
          "display_name": false
        },
        {
          "uuid": "ceab58d9-cd08-40a9-b929-3e7a7c0ad864",
          "name": "METHETOIN [USAN]",
          "stdName": "METHETOIN [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ff53a0d-0e8f-4c48-aac2-ec580488ed19"
          ],
          "display_name": false
        },
        {
          "uuid": "86c9550d-309b-6e38-6782-72c0f66549cf",
          "name": "Metetoin [WHO-DD]",
          "stdName": "METETOIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42e35176-bb21-c40b-cba9-f9c80081179e"
          ],
          "display_name": false
        },
        {
          "uuid": "2f27fdbd-0495-4e44-bad1-b3af8d061bc9",
          "name": "N 3",
          "stdName": "N 3",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fecbcc4d-5d4c-4251-8a5d-a5100db24799"
          ],
          "display_name": false
        },
        {
          "uuid": "2e8f37c7-3fb4-4633-9a38-11be9148a93a",
          "name": "N-3",
          "stdName": "N-3",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f100eca-cd53-47c5-96fa-0f947049aebe"
          ],
          "display_name": false
        },
        {
          "uuid": "62342343-0487-412a-9bdd-7dacb087dcdf",
          "name": "NSC-524411",
          "stdName": "NSC-524411",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f100eca-cd53-47c5-96fa-0f947049aebe"
          ],
          "display_name": false
        },
        {
          "uuid": "4f6c4499-5839-491c-87a2-7beaae70ff66",
          "name": "metetoin [INN]",
          "stdName": "METETOIN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0b4fcd2-77d2-4217-b82b-c1d5967df18d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2f100eca-cd53-47c5-96fa-0f947049aebe",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fecbcc4d-5d4c-4251-8a5d-a5100db24799",
          "citation": "FDA_SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9872533-a512-4ef0-894f-9dd1490305de",
          "citation": "EMEA 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0b4fcd2-77d2-4217-b82b-c1d5967df18d",
          "citation": "INN Proposed List 12",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL12.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8ff53a0d-0e8f-4c48-aac2-ec580488ed19",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0fbe2bb3-8aaf-4745-bf72-efca18b6f953",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1518b54-5b8d-4d54-a6c7-da94533bab17",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f761d870-3f57-46c5-a685-30868472045f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390864000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f109ec61-d44a-4a66-b89c-de5cc5b68ec2",
          "citation": "SRS import [8G09Z6AF2T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8G09Z6AF2T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390864000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43b13479-700d-4861-adc0-1210b5f0adc5",
          "citation": "USP DICTIONARY 2010; INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5434e482-7696-462e-83c7-f7676a0cb531",
          "citation": "METETOIN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5b3b1b5c-e2bf-4061-907c-8f23cd522165",
          "citation": "METHETOIN [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "99b55025-47bc-487c-abbe-8216e279ad6d",
          "citation": "METETOIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6e4d2acb-0f9f-4b9c-ae0b-18ff8639d808",
          "citation": "METHETOIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c6cb4733-1229-dce4-5d6b-a6d2926b1a3d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c75b4f5d-bc04-4c5a-8403-5accc3e8f2b9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d335a181-5c10-eaa3-7f04-f198e1d6248b",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "9ec2b0b7-c148-7a58-7919-b60df016d6d2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "42e35176-bb21-c40b-cba9-f9c80081179e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "39ae8b7a-c3aa-77a6-9810-33a7bf60d3c2",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5e1edb4f-8280-4527-b9ed-2cc3d9635018",
          "id": "5e1edb4f-8280-4527-b9ed-2cc3d9635018",
          "molfile": "\n  Marvin  01132104522D          \n\n 16 17  0  0  0  0            999 V2000\n    2.0744   -4.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3092   -4.3960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1492   -5.2047    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.3608   -4.9487    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1135   -4.1632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1367   -5.5975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9601   -5.5975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3608   -6.2724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1492   -6.0164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8125   -6.5081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9725   -5.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4235   -4.5472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2759   -4.5472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7297   -5.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3078   -5.8942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4467   -5.8942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  9  1  0  0  0  0\n 11  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 12 11  1  0  0  0  0\n 16 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "CCC1(c2ccccc2)C(=O)NC(=O)N1C",
          "formula": "C12H14N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d26b01c7-2ec5-4dec-9d20-3f934d04d47a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "218.2522",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0c323e2a-1640-4afc-8c88-46639696922e",
      "version": "13",
      "structure": {
        "id": "5eb604d7-1f70-4585-8f70-26005d7401dd",
        "molfile": "\n  Marvin  01132104542D          \n\n 16 17  0  0  0  0            999 V2000\n    0.3608   -6.2724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1367   -5.5975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1492   -6.0164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3608   -4.9487    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1492   -5.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9601   -5.5975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8125   -6.5081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9725   -5.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1135   -4.1632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3092   -4.3960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4467   -5.8942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4235   -4.5472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0744   -4.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2759   -4.5472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3078   -5.8942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7297   -5.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  2  2  0  0  0  0\n  7  3  2  0  0  0  0\n  8  5  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  8  2  0  0  0  0\n 12  8  1  0  0  0  0\n 13 10  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 11  1  0  0  0  0\n 16 14  1  0  0  0  0\n  5  4  1  0  0  0  0\n 16 15  2  0  0  0  0\nM  END",
        "smiles": "CCC1(c2ccccc2)C(=O)NC(=O)N1C",
        "formula": "C12H14N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "218.2522",
        "optical_activity": "( + / - )",
        "references": [
          "43b13479-700d-4861-adc0-1210b5f0adc5",
          "f109ec61-d44a-4a66-b89c-de5cc5b68ec2",
          "e0b4fcd2-77d2-4217-b82b-c1d5967df18d"
        ],
        "stereo_centers": 1
      },
      "unii": "8G09Z6AF2T"
    }
  ]
}