{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "159820b7-0fc1-4fdb-a2d3-4c8bb31a40d3",
          "code": "112281-77-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=112281-77-3",
          "code_system": "CAS",
          "references": [
            "ae227bd4-0189-4121-976b-a5eb14a4b935",
            "6bc87297-35a3-4939-903c-9bbb053a75bd"
          ]
        },
        {
          "uuid": "2a4195c2-e942-4265-90b0-ef8e2df381df",
          "code": "m10608",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10608?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ae227bd4-0189-4121-976b-a5eb14a4b935"
          ]
        },
        {
          "uuid": "77d64821-0c99-4122-ad13-b7609dcc3122",
          "code": "80277",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/80277",
          "code_system": "PUBCHEM",
          "references": [
            "ae227bd4-0189-4121-976b-a5eb14a4b935"
          ]
        },
        {
          "uuid": "fd900d5f-388e-75fa-cbe8-88333aa7d347",
          "code": "7612",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7612",
          "code_system": "HSDB",
          "references": [
            "f0adb4ea-fb19-11c9-61c9-3ce3b9ee6e91"
          ]
        },
        {
          "uuid": "c78a3abf-6de1-744c-6293-e93884c344cc",
          "code": "DTXSID8034956",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8034956",
          "code_system": "EPA CompTox",
          "references": [
            "06a59cfe-cb8a-cceb-cf3b-d88566e7ebb5"
          ]
        },
        {
          "uuid": "937b49c1-039e-4ad0-beba-401211f407ea",
          "code": "8FGY868T0G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "69eab1b9-45e3-7a0c-8fb7-139186479c1b",
          "code": "tetraconazole",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/tetraconazole.html",
          "code_system": "ALANWOOD",
          "references": [
            "51f81a7d-ce6b-3b4b-113d-33a3cb4166c9"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "45a2bb1b-978d-4d40-9466-a6f443b96dcd",
          "name": "1H-1,2,4-TRIAZOLE, 1-(2-(2,4-DICHLOROPHENYL)-3-(1,1,2,2-TETRAFLUOROETHOXY)PROPYL)-, (±)-",
          "stdName": "1H-1,2,4-TRIAZOLE, 1-(2-(2,4-DICHLOROPHENYL)-3-(1,1,2,2-TETRAFLUOROETHOXY)PROPYL)-, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6f893e6-bec2-412b-9af5-f0e47fc98d93",
            "2d64e424-abb6-4ddf-9937-3ba4045ec0e4"
          ],
          "display_name": false
        },
        {
          "uuid": "37898559-7875-4bee-8eec-509cc15a4210",
          "name": "AG-4454",
          "stdName": "AG-4454",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6f893e6-bec2-412b-9af5-f0e47fc98d93",
            "2d64e424-abb6-4ddf-9937-3ba4045ec0e4"
          ],
          "display_name": false
        },
        {
          "uuid": "0a232b7c-7a1a-48cc-a066-35d73363ca36",
          "name": "DOMARK",
          "stdName": "DOMARK",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6f893e6-bec2-412b-9af5-f0e47fc98d93",
            "2d64e424-abb6-4ddf-9937-3ba4045ec0e4"
          ],
          "display_name": false
        },
        {
          "uuid": "dc2b15f1-0ad3-4aae-99d4-ad7e631ef713",
          "name": "EMINENT",
          "stdName": "EMINENT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6f893e6-bec2-412b-9af5-f0e47fc98d93",
            "2d64e424-abb6-4ddf-9937-3ba4045ec0e4"
          ],
          "display_name": false
        },
        {
          "uuid": "f86a00ce-1dad-4e9a-8e22-b2d2974d49d3",
          "name": "LOSPEL",
          "stdName": "LOSPEL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "875f3196-c0c2-499a-b2a2-f6b2a88fd607",
            "2d64e424-abb6-4ddf-9937-3ba4045ec0e4"
          ],
          "display_name": false
        },
        {
          "uuid": "1a143d1a-d05d-46e5-afab-d9cd2c52ba19",
          "name": "M-14360",
          "stdName": "M-14360",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6f893e6-bec2-412b-9af5-f0e47fc98d93",
            "2d64e424-abb6-4ddf-9937-3ba4045ec0e4"
          ],
          "display_name": false
        },
        {
          "uuid": "01f08ef3-692e-4c9a-81b7-ec36264f0277",
          "name": "TETRACONAZOLE",
          "stdName": "TETRACONAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "274cf5cb-74a6-4a41-86d8-9e1f32cac4d5",
            "4a9403c2-ea42-4cf8-aa31-766135904f63",
            "875f3196-c0c2-499a-b2a2-f6b2a88fd607",
            "34a556db-a16a-44ac-afb8-e84675b81ee7",
            "2d64e424-abb6-4ddf-9937-3ba4045ec0e4"
          ],
          "display_name": true
        },
        {
          "uuid": "e2a367bc-b44f-459e-8c82-895a0988e088",
          "name": "TETRACONAZOLE [ISO]",
          "stdName": "TETRACONAZOLE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a9403c2-ea42-4cf8-aa31-766135904f63",
            "2d64e424-abb6-4ddf-9937-3ba4045ec0e4"
          ],
          "display_name": false
        },
        {
          "uuid": "8341b65f-91c4-41a8-a1fe-2f7209fc0eb5",
          "name": "TETRACONAZOLE [MI]",
          "stdName": "TETRACONAZOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "875f3196-c0c2-499a-b2a2-f6b2a88fd607",
            "2d64e424-abb6-4ddf-9937-3ba4045ec0e4"
          ],
          "display_name": false
        },
        {
          "uuid": "8338273b-dc0c-4474-81e0-be994f76ba7f",
          "name": "TETRACONAZOLE, (±)-",
          "stdName": "TETRACONAZOLE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf9bbd1c-7493-4c82-86c0-0fdf9d1273cb",
            "2d64e424-abb6-4ddf-9937-3ba4045ec0e4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4a9403c2-ea42-4cf8-aa31-766135904f63",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2d64e424-abb6-4ddf-9937-3ba4045ec0e4",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6f893e6-bec2-412b-9af5-f0e47fc98d93",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf9bbd1c-7493-4c82-86c0-0fdf9d1273cb",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "875f3196-c0c2-499a-b2a2-f6b2a88fd607",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae227bd4-0189-4121-976b-a5eb14a4b935",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391974000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d81f3b6-8bd8-4058-bced-08b20b83e8e5",
          "citation": "SRS import [8FGY868T0G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8FGY868T0G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391974000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "274cf5cb-74a6-4a41-86d8-9e1f32cac4d5",
          "citation": "TETRACONAZOLE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "34a556db-a16a-44ac-afb8-e84675b81ee7",
          "citation": "TETRACONAZOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f0adb4ea-fb19-11c9-61c9-3ce3b9ee6e91",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+112281-77-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "06a59cfe-cb8a-cceb-cf3b-d88566e7ebb5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=112281-77-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "51f81a7d-ce6b-3b4b-113d-33a3cb4166c9",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "6bc87297-35a3-4939-903c-9bbb053a75bd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "10e166ee-e782-452e-a903-92a8266954fd",
          "id": "10e166ee-e782-452e-a903-92a8266954fd",
          "molfile": "\n  Marvin  01132101062D          \n\n 23 24  0  0  0  0            999 V2000\n    2.6667   -3.8958    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6667   -3.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3811   -2.6583    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9522   -2.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3919   -3.3250    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1553   -2.4448    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9522   -1.8333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6667   -1.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6667   -0.5958    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.9522   -0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2377   -0.5958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1552   -1.4168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3479   -1.5912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0663   -0.8764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4865   -0.2627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3811   -0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3781    0.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0891    1.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8086    0.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5225    1.0507    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.8081   -0.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0942   -0.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0916   -1.4255    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 16  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 15  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 17 16  1  0  0  0  0\n 16 22  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 19  2  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "c1cc(C(Cn2cncn2)COC(C(F)F)(F)F)c(cc1Cl)Cl",
          "formula": "C13H11Cl2F4N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a2842e3f-9ed6-46c6-90cf-19632ffceac0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "372.1459",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "585f1fb4-ffc1-4f58-b34e-84d8ce83ca4d",
      "version": "5",
      "structure": {
        "id": "38fe1203-5d4b-4786-8d61-cdf54efe3385",
        "molfile": "\n  Marvin  01132103022D          \n\n 23 24  0  0  0  0            999 V2000\n    2.6667   -0.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3811   -0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6667   -1.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9522   -1.8333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9522   -2.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0942   -0.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8081   -0.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8086    0.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0891    1.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3781    0.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9522   -0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2377   -0.5958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4865   -0.2627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0663   -0.8764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3479   -1.5912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1552   -1.4168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0916   -1.4255    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.5225    1.0507    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.3919   -3.3250    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6667   -3.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1553   -2.4448    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6667   -3.8958    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3811   -2.6583    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  6  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n  1  2  1  0  0  0  0\n  6  7  1  0  0  0  0\n  3  4  1  0  0  0  0\n  7  8  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 12  1  0  0  0  0\n  6 17  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 18  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5 19  1  0  0  0  0\n  9 10  2  0  0  0  0\n  5 20  1  0  0  0  0\n 10  2  1  0  0  0  0\n  5 21  1  0  0  0  0\n  1  3  1  0  0  0  0\n 20 22  1  0  0  0  0\n  1 11  1  0  0  0  0\n 20 23  1  0  0  0  0\nM  END",
        "smiles": "c1cc(C(Cn2cncn2)COC(C(F)F)(F)F)c(cc1Cl)Cl",
        "formula": "C13H11Cl2F4N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "372.1459",
        "optical_activity": "( + / - )",
        "references": [
          "4a9403c2-ea42-4cf8-aa31-766135904f63",
          "5d81f3b6-8bd8-4058-bced-08b20b83e8e5"
        ],
        "stereo_centers": 1
      },
      "unii": "8FGY868T0G"
    }
  ]
}