{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3d7e1d0e-d935-4ca8-93df-327ebf7e51fd",
          "code": "54-28-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=54-28-4",
          "code_system": "CAS",
          "references": [
            "f8fbb9f2-179d-4da3-9950-3e12da456be0",
            "a4a1d5ee-a71e-4301-b970-310d5b344cb3"
          ]
        },
        {
          "uuid": "3a823509-6b8b-471e-9618-663e7919dd51",
          "code": "C68317",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68317",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f8fbb9f2-179d-4da3-9950-3e12da456be0"
          ]
        },
        {
          "uuid": "3e5b3799-f5a1-4ec6-b28f-d4c2bb7942ce",
          "code": "D024504",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68024504",
          "code_system": "MESH",
          "references": [
            "f8fbb9f2-179d-4da3-9950-3e12da456be0"
          ]
        },
        {
          "uuid": "82298727-4c35-438a-a366-db11a06046c2",
          "code": "GAMMA-TOCOPHEROL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Gamma-Tocopherol",
          "code_system": "WIKIPEDIA",
          "references": [
            "f8fbb9f2-179d-4da3-9950-3e12da456be0"
          ]
        },
        {
          "uuid": "6355938b-cad2-4dfe-938b-483db0392e5c",
          "code": "m10925",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10925?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f8fbb9f2-179d-4da3-9950-3e12da456be0"
          ]
        },
        {
          "uuid": "b54e0bda-30c4-4254-a7ed-844d85c08665",
          "code": "200-201-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.183",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f8fbb9f2-179d-4da3-9950-3e12da456be0"
          ]
        },
        {
          "uuid": "9b11e9a3-0422-463d-8575-b1a27c368a5f",
          "code": "92729",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92729",
          "code_system": "PUBCHEM",
          "references": [
            "f8fbb9f2-179d-4da3-9950-3e12da456be0"
          ]
        },
        {
          "uuid": "50dd8ca9-9f32-0e6f-05d4-21999e3c76df",
          "code": "DTXSID9049031",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9049031",
          "code_system": "EPA CompTox",
          "references": [
            "9d5fbae0-2ffc-a767-f62f-88926d0ff5cb"
          ]
        },
        {
          "uuid": "5732d0a5-b71c-5236-fc70-6f14b4583f21",
          "code": "C68313",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Tocopherol",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68313",
          "code_system": "NCI_THESAURUS",
          "references": [
            "79993050-d606-cdfe-5857-09671a2a1619"
          ]
        },
        {
          "uuid": "834a22b0-538f-2033-76c5-024d0d4dab9e",
          "code": "2419 (Number of products:200)",
          "comments": "Dietary Supplement Label Database|vitamin|Vitamin E (gamma tocopherol)",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2419&item=Vitamin E (gamma tocopherol)",
          "code_system": "DSLD",
          "references": [
            "79993050-d606-cdfe-5857-09671a2a1619"
          ]
        },
        {
          "uuid": "7ec0548c-dcbd-d2b9-07ea-10d60f9d1c37",
          "code": "2368126",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2368126/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "589cf525-a6df-79b0-1a28-0df5f9b55b43"
          ]
        },
        {
          "uuid": "c258ecad-dc60-c966-a949-6408a9f545ab",
          "code": "DB15394",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB15394",
          "code_system": "DRUG BANK",
          "references": [
            "79993050-d606-cdfe-5857-09671a2a1619"
          ]
        },
        {
          "uuid": "539ccde4-299d-4afc-bafa-8db2cbc71d6c",
          "code": "8EF1Z1238F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fe1cdbfb-5691-17b9-6014-d42ddc1d0d46",
          "code": "18185",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18185",
          "code_system": "CHEBI",
          "references": [
            "79993050-d606-cdfe-5857-09671a2a1619"
          ]
        },
        {
          "uuid": "62a58f21-dc0f-6934-332c-3487954a445d",
          "code": "300000013802",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ab8ae5fb-2177-93c5-7900-9ea249969721"
          ]
        },
        {
          "uuid": "23a99e84-6cfe-c973-a056-c4a3f61a7bdd",
          "code": "8EF1Z1238F",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8EF1Z1238F",
          "code_system": "DAILYMED",
          "references": [
            "2cdc4698-c558-a83b-bd9d-331e02ce5f79"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "61158206-fd3c-4e3d-9a3d-e3ecc765e42e",
          "name": "(+)-2,7,8-TRIMETHYL-2-(4,8,12-TRIMETHYLTRIDECYL)-6-CHROMANOL",
          "stdName": "(+)-2,7,8-TRIMETHYL-2-(4,8,12-TRIMETHYLTRIDECYL)-6-CHROMANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd54851f-9efe-44f0-925a-af6846df5ffd",
            "35f22322-5f0f-477e-8b17-e85f16bf0a33"
          ],
          "display_name": false
        },
        {
          "uuid": "abfed3f0-3170-4986-8911-0d6bbb47c1d4",
          "name": "(2R)-3,4-DIHYDRO-2,7,8-TRIMETHYL-2-((4R,8R)-4,8,12-TRIMETHYLTRIDECYL)-2H-1-BENZOPYRAN-6-OL",
          "stdName": "(2R)-3,4-DIHYDRO-2,7,8-TRIMETHYL-2-((4R,8R)-4,8,12-TRIMETHYLTRIDECYL)-2H-1-BENZOPYRAN-6-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd54851f-9efe-44f0-925a-af6846df5ffd",
            "35f22322-5f0f-477e-8b17-e85f16bf0a33"
          ],
          "display_name": false
        },
        {
          "uuid": "b7de183c-6a1d-4a2a-b38f-be12b3b50407",
          "name": "(R,R,R)-.GAMMA.-TOCOPHEROL",
          "stdName": "(R,R,R)-.GAMMA.-TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd54851f-9efe-44f0-925a-af6846df5ffd",
            "35f22322-5f0f-477e-8b17-e85f16bf0a33"
          ],
          "display_name": false
        },
        {
          "uuid": "d842aa1a-8afe-4bd7-91f6-b95e7f816834",
          "name": ".GAMMA.-TOCOPHEROL",
          "stdName": ".GAMMA.-TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5df314f4-6460-48e9-9e6c-b823d9ef648c",
            "fd54851f-9efe-44f0-925a-af6846df5ffd",
            "cdc5ec2b-fbb0-4856-941f-2be0e88bf51d",
            "35f22322-5f0f-477e-8b17-e85f16bf0a33"
          ],
          "display_name": true
        },
        {
          "uuid": "f18534dc-acbc-45b8-9591-71255f077df3",
          "name": ".GAMMA.-TOCOPHEROL [MI]",
          "stdName": ".GAMMA.-TOCOPHEROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdc5ec2b-fbb0-4856-941f-2be0e88bf51d",
            "fd54851f-9efe-44f0-925a-af6846df5ffd"
          ],
          "display_name": false
        },
        {
          "uuid": "4805e0cb-7e2f-46a6-97f7-4677956de676",
          "name": "7,8-DIMETHYLTOCOL",
          "stdName": "7,8-DIMETHYLTOCOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd54851f-9efe-44f0-925a-af6846df5ffd",
            "35f22322-5f0f-477e-8b17-e85f16bf0a33"
          ],
          "display_name": false
        },
        {
          "uuid": "fd20d9ab-7e74-9217-98f3-46fcb9495009",
          "name": "GAMMA TOCOPHEROL",
          "stdName": "GAMMA TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c91f2997-b255-3f51-041d-9345f1192dad"
          ],
          "display_name": false
        },
        {
          "uuid": "db2c316b-9dcf-44f6-bd75-0c8fd37d3254",
          "name": "GAMMA-TOCOPHEROL",
          "stdName": "GAMMA-TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2fefac19-e127-4500-afc2-1dfb36c309c3",
            "fd54851f-9efe-44f0-925a-af6846df5ffd",
            "35f22322-5f0f-477e-8b17-e85f16bf0a33",
            "3700e3e4-1460-4603-9477-5ba8cd934c3e"
          ],
          "display_name": false
        },
        {
          "uuid": "1070a5c8-81be-4209-86f6-042a5fb4321b",
          "name": "GAMMA-TOCOPHEROL (CONSTITUENT OF LYCOPENE AND TOMATO EXTRACT CONTAINING LYCOPENE) [DSC]",
          "stdName": "GAMMA-TOCOPHEROL (CONSTITUENT OF LYCOPENE AND TOMATO EXTRACT CONTAINING LYCOPENE) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd54851f-9efe-44f0-925a-af6846df5ffd",
            "cb2a95d6-c93f-4ca9-baf5-40bc0a1c2449"
          ],
          "display_name": false
        },
        {
          "uuid": "b1e26d99-ec8d-683b-922f-d266cc8ab51d",
          "name": "Gamma-tocopherol [WHO-DD]",
          "stdName": "GAMMA-TOCOPHEROL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec6ab4e4-b9a8-9701-05c7-788e1b5d6188"
          ],
          "display_name": false
        },
        {
          "uuid": "68598d2d-d323-4f7e-89ca-9fd368d3d1bc",
          "name": "J213.540J",
          "stdName": "J213.540J",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83c2e891-6838-4012-8f0c-516ca482f394",
            "fd54851f-9efe-44f0-925a-af6846df5ffd"
          ],
          "display_name": false
        },
        {
          "uuid": "dd30f036-7e5b-49d0-a2c9-a9136c261cbe",
          "name": "O-XYLOTOCOPHEROL",
          "stdName": "O-XYLOTOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd54851f-9efe-44f0-925a-af6846df5ffd",
            "35f22322-5f0f-477e-8b17-e85f16bf0a33"
          ],
          "display_name": false
        },
        {
          "uuid": "267c9e00-72e4-f4f0-121d-d947b92bf594",
          "name": "RRR-.ALPHA.-TOCOPHEROL IMPURITY C [EP IMPURITY]",
          "stdName": "RRR-.ALPHA.-TOCOPHEROL IMPURITY C [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd54851f-9efe-44f0-925a-af6846df5ffd",
            "c5c5e28f-1ddb-4ee5-8511-ef269d104fb2"
          ],
          "display_name": false
        },
        {
          "uuid": "ff20d724-4974-44c6-bf61-1714092f9a29",
          "name": "RRR-.GAMMA.-TOCOPHEROL",
          "stdName": "RRR-.GAMMA.-TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd54851f-9efe-44f0-925a-af6846df5ffd",
            "c5c5e28f-1ddb-4ee5-8511-ef269d104fb2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c91f2997-b255-3f51-041d-9345f1192dad",
          "citation": "11038-7",
          "doc_type": "LOINC",
          "public_domain": true
        },
        {
          "uuid": "35f22322-5f0f-477e-8b17-e85f16bf0a33",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fd54851f-9efe-44f0-925a-af6846df5ffd",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cdc5ec2b-fbb0-4856-941f-2be0e88bf51d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3700e3e4-1460-4603-9477-5ba8cd934c3e",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5c5e28f-1ddb-4ee5-8511-ef269d104fb2",
          "citation": "EP 7.8",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb2a95d6-c93f-4ca9-baf5-40bc0a1c2449",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83c2e891-6838-4012-8f0c-516ca482f394",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J213.540J",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J213.540J",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8fbb9f2-179d-4da3-9950-3e12da456be0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72db49ac-006e-419f-a7ef-d32996914ad6",
          "citation": "USP-DSC",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39fb1fd1-4bff-4fdf-b006-8591cbdf8473",
          "citation": "SRS import [8EF1Z1238F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8EF1Z1238F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5df314f4-6460-48e9-9e6c-b823d9ef648c",
          "citation": ".GAMMA.-TOCOPHEROL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2fefac19-e127-4500-afc2-1dfb36c309c3",
          "citation": "GAMMA-TOCOPHEROL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9d5fbae0-2ffc-a767-f62f-88926d0ff5cb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=54-28-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "79993050-d606-cdfe-5857-09671a2a1619",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a4a1d5ee-a71e-4301-b970-310d5b344cb3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "589cf525-a6df-79b0-1a28-0df5f9b55b43",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "2cdc4698-c558-a83b-bd9d-331e02ce5f79",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ec6ab4e4-b9a8-9701-05c7-788e1b5d6188",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ab8ae5fb-2177-93c5-7900-9ea249969721",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9d15c29e-4107-4dbd-8c25-01cb92b4f4a8",
          "id": "9d15c29e-4107-4dbd-8c25-01cb92b4f4a8",
          "molfile": "\n  Marvin  01132108102D          \n\n 30 31  0  0  1  0            999 V2000\n    7.0973   -0.0292    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.1118   -0.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8309    0.3467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5563   -0.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2783    0.3467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0067   -0.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0067   -0.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7316    0.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3747    0.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6586   -0.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9273    0.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1995   -0.0495    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.1879   -0.8735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4799    0.3554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7666   -0.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0592    0.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3280   -0.0145    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.3280    0.8094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3280   -0.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6235   -1.2581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0729   -0.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8006   -1.2581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5435   -0.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2568   -1.2610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5435   -0.0145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1723    0.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8006    0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8006    1.2085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0729   -0.0145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6235    0.3846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  9  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  1  0  0  0\n 19 17  1  0  0  0  0\n 17 30  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 29  2  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 23 25  1  0  0  0  0\n 26 25  1  0  0  0  0\n 25 27  2  0  0  0  0\n 28 27  1  0  0  0  0\n 27 29  1  0  0  0  0\n 30 29  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2cc(c(C)c(C)c2O1)O",
          "formula": "C28H48O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cda0a9a8-6f5b-41ff-a85f-11a23b51b9e0"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "416.6806",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d1f599df-c926-4fe5-9c63-c3a1629b5625",
      "version": "17",
      "structure": {
        "id": "d9e7f834-bfe7-4b41-b08e-6d631365c2bb",
        "molfile": "\n  Marvin  01132111182D          \n\n 30 31  0  0  1  0            999 V2000\n   -0.0729   -0.0145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8007    0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6235    0.3846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0729   -0.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5436   -0.0145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5436   -0.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8007   -1.2582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3281   -0.0145    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.6235   -1.2582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3281   -0.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2570   -1.2611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8007    1.2086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1725    0.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0593    0.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7668   -0.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6590   -0.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5569   -0.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3281    0.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2790    0.3467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4802    0.3554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3752    0.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8315    0.3467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9277    0.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1998   -0.0495    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.0978   -0.0292    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.0074   -0.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0074   -0.8649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7324    0.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1123   -0.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1882   -0.8736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  2  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  4  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  6  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13  5  1  0  0  0  0\n  8 14  1  6  0  0  0\n 15 14  1  0  0  0  0\n 16 23  1  0  0  0  0\n 17 22  1  0  0  0  0\n  8 18  1  1  0  0  0\n 19 17  1  0  0  0  0\n 20 15  1  0  0  0  0\n 21 16  1  0  0  0  0\n 22 25  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 20  1  0  0  0  0\n 25 21  1  0  0  0  0\n 26 19  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 26  1  0  0  0  0\n 25 29  1  1  0  0  0\n 24 30  1  1  0  0  0\n 10  8  1  0  0  0  0\n  6  5  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2cc(c(C)c(C)c2O1)O",
        "formula": "C28H48O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "416.6806",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "39fb1fd1-4bff-4fdf-b006-8591cbdf8473",
          "35f22322-5f0f-477e-8b17-e85f16bf0a33"
        ],
        "stereo_centers": 3
      },
      "unii": "8EF1Z1238F"
    }
  ]
}