{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4007aaa2-0505-47c0-bedb-46a7d81d4651",
          "code": "14368-24-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14368-24-2",
          "code_system": "CAS",
          "references": [
            "c3c46c43-0a58-44d6-8621-440781f3af79",
            "0f326f76-5519-465d-a2a3-6253ab38a037"
          ]
        },
        {
          "uuid": "30192d71-69e6-41b7-9eaa-807325ad2853",
          "code": "SUB11329MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c3c46c43-0a58-44d6-8621-440781f3af79"
          ]
        },
        {
          "uuid": "c4ee1ea6-571b-42c4-995d-990171a7efb1",
          "code": "3644",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3644",
          "code_system": "INN",
          "references": [
            "c3c46c43-0a58-44d6-8621-440781f3af79"
          ]
        },
        {
          "uuid": "56fde3b4-09ec-4992-8547-5cb44186cc1b",
          "code": "CHEMBL1974057",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1974057",
          "code_system": "ChEMBL",
          "references": [
            "c3c46c43-0a58-44d6-8621-440781f3af79"
          ]
        },
        {
          "uuid": "3285046c-5e02-4607-9f50-1617bc35db9d",
          "code": "26650",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/26650",
          "code_system": "PUBCHEM",
          "references": [
            "c3c46c43-0a58-44d6-8621-440781f3af79"
          ]
        },
        {
          "uuid": "3d34c38c-6243-ca97-262c-f295ce31ddd2",
          "code": "DTXSID1046475",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1046475",
          "code_system": "EPA CompTox",
          "references": [
            "175ad262-1027-79d7-fc4c-89031360a022"
          ]
        },
        {
          "uuid": "98a5695b-04ff-a01a-e1e1-d9a47f25f5a2",
          "code": "C152755",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C152755",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7c19e472-c800-f54a-0307-985a059a1f2b"
          ]
        },
        {
          "uuid": "94c3ca39-715e-211a-8bbd-a804f7cf6ce9",
          "code": "C265",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antidepressant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C265",
          "code_system": "NCI_THESAURUS",
          "references": [
            "35ed0b8b-9e2d-6edf-a549-07f7db3d70a7"
          ]
        },
        {
          "uuid": "e72da663-18e6-4734-a18e-ab374f62c676",
          "code": "8EE22OKO88",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "29e1fde8-36a4-d4a5-2d3c-ac847b145332",
          "code": "100000076954",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "56464e6c-109a-b25b-4ac0-c2087854bba6"
          ]
        },
        {
          "uuid": "487db155-96ca-20c9-0a8e-8739630ae5f3",
          "code": "233082",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=233082",
          "code_system": "NSC",
          "references": [
            "a57c1816-335f-4675-07fa-cf265614e253"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f494c7c0-e889-4048-bdc9-927884f47a4a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "823497fa-9c66-439d-af14-9604d0323958",
            "refuuid": "0c0653a5-3a8e-4104-9f44-2a01998d4b4e",
            "name": "TROCIMINE",
            "unii": "8EE22OKO88",
            "linking_id": "8EE22OKO88",
            "ref_pname": "TROCIMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e260b865-1fdc-4ef3-ad5f-c9eabdc2a5f2",
          "name": "NSC-233082",
          "stdName": "NSC-233082",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b8250df-eaf3-420b-8b7f-950b591d4eea"
          ],
          "display_name": false
        },
        {
          "uuid": "78d8664a-3a6e-4c55-b981-12d955295390",
          "name": "OCTAHYDRO-1-(3,4,5-TRIMETHOXYBENZOYL)AZOCINE",
          "stdName": "OCTAHYDRO-1-(3,4,5-TRIMETHOXYBENZOYL)AZOCINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25713303-5f0e-4f76-84bb-8cdb5ebd3de5"
          ],
          "display_name": false
        },
        {
          "uuid": "6093a79c-f11a-4544-85b0-5c08382d30a6",
          "name": "TROCIMINE",
          "stdName": "TROCIMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24344dec-465e-41d9-a4fa-8cc8e8919e9b",
            "e7b6cf58-43ac-48d2-a809-e626373adca9",
            "25713303-5f0e-4f76-84bb-8cdb5ebd3de5"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "c6a57cef-21a9-4c22-8a9e-f5578a2c0134",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "e01f5a1a-4575-429f-9d9d-32d74bbd1813",
          "name": "trocimine [INN]",
          "stdName": "TROCIMINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7b6cf58-43ac-48d2-a809-e626373adca9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "25713303-5f0e-4f76-84bb-8cdb5ebd3de5",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e7b6cf58-43ac-48d2-a809-e626373adca9",
          "citation": "INN Proposed List 32",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL32.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4b8250df-eaf3-420b-8b7f-950b591d4eea",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3c46c43-0a58-44d6-8621-440781f3af79",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390470000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "030aa51d-4770-4c36-a416-f37322149308",
          "citation": "SRS import [8EE22OKO88]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8EE22OKO88",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390470000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24344dec-465e-41d9-a4fa-8cc8e8919e9b",
          "citation": "TROCIMINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "175ad262-1027-79d7-fc4c-89031360a022",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=14368-24-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "56464e6c-109a-b25b-4ac0-c2087854bba6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "7c19e472-c800-f54a-0307-985a059a1f2b",
          "citation": "NCIT",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "35ed0b8b-9e2d-6edf-a549-07f7db3d70a7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0f326f76-5519-465d-a2a3-6253ab38a037",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a57c1816-335f-4675-07fa-cf265614e253",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b2812785-2b28-4280-81bd-306153994abe",
          "id": "b2812785-2b28-4280-81bd-306153994abe",
          "molfile": "\n  Marvin  01132109152D          \n\n 22 23  0  0  0  0            999 V2000\n    6.4263   -4.1716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4263   -3.3498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7002   -2.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9817   -3.3498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2767   -2.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2767   -2.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9817   -1.6983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9817   -0.8764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7002   -0.4549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7002   -2.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4263   -1.6887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1389   -2.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5505   -3.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5505   -4.1832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8282   -2.9398    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2497   -3.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4392   -3.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8549   -2.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8549   -2.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4392   -1.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2497   -1.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8282   -2.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 10  2  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5 13  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7 10  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 22  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "COc1cc(cc(c1OC)OC)C(=O)N2CCCCCCC2",
          "formula": "C17H25NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "60ec1926-eb06-46ee-b9a6-30afec8a8035"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "307.3854",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0c0653a5-3a8e-4104-9f44-2a01998d4b4e",
      "version": "8",
      "structure": {
        "id": "9ef2fa01-7345-4393-9bed-254799807b07",
        "molfile": "\n  Marvin  01132108152D          \n\n 22 23  0  0  0  0            999 V2000\n    4.2767   -2.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5505   -3.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9817   -3.3498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2767   -2.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8282   -2.9398    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5505   -4.1832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7002   -2.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9817   -1.6983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2497   -3.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8282   -2.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7002   -2.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4263   -3.3498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9817   -0.8764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4392   -3.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2497   -1.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4263   -1.6887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4263   -4.1716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7002   -0.4549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8549   -2.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4392   -1.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1389   -2.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8549   -2.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  2  0  0  0  0\n  3  7  1  0  0  0  0\n  4  8  2  0  0  0  0\n  5  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n  7 11  2  0  0  0  0\n  7 12  1  0  0  0  0\n  8 13  1  0  0  0  0\n  9 14  1  0  0  0  0\n 10 15  1  0  0  0  0\n 11 16  1  0  0  0  0\n 12 17  1  0  0  0  0\n 13 18  1  0  0  0  0\n 14 19  1  0  0  0  0\n 15 20  1  0  0  0  0\n 16 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n  8 11  1  0  0  0  0\n 20 22  1  0  0  0  0\nM  END",
        "smiles": "COc1cc(cc(c1OC)OC)C(=O)N2CCCCCCC2",
        "formula": "C17H25NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "307.3854",
        "optical_activity": "NONE",
        "references": [
          "030aa51d-4770-4c36-a416-f37322149308",
          "25713303-5f0e-4f76-84bb-8cdb5ebd3de5",
          "e7b6cf58-43ac-48d2-a809-e626373adca9"
        ],
        "stereo_centers": 0
      },
      "unii": "8EE22OKO88"
    }
  ]
}