{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0fb4d9fa-4119-44c0-8138-5b6e985f2316",
          "code": "121-79-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=121-79-9",
          "code_system": "CAS",
          "references": [
            "4af956eb-a191-4d38-a969-70621a412a52",
            "6c331a77-1066-4231-bcfd-48bb91d94f60"
          ]
        },
        {
          "uuid": "4a456af7-3e9e-4e3b-800d-6039dcc9514e",
          "code": "C76728",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76728",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4af956eb-a191-4d38-a969-70621a412a52"
          ]
        },
        {
          "uuid": "a6380d86-ccd0-4c92-aa32-94483aed20aa",
          "code": "D011435",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68011435",
          "code_system": "MESH",
          "references": [
            "4af956eb-a191-4d38-a969-70621a412a52"
          ]
        },
        {
          "uuid": "3eff0e34-cfb5-45cc-a039-d28136b9e8cf",
          "code": "PROPYL GALLATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Propyl_gallate",
          "code_system": "WIKIPEDIA",
          "references": [
            "4af956eb-a191-4d38-a969-70621a412a52"
          ]
        },
        {
          "uuid": "99040bcd-aa00-4a88-8fbb-39c9fda27e04",
          "code": "21 CFR 184.1660",
          "comments": "PART 184 -- DIRECT FOOD SUBSTANCES AFFIRMED AS GENERALLY RECOGNIZED AS SAFE|Subpart B--Listing of Specific Substances Affirmed as GRAS|Sec. 184.1660 Propyl gallate",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=184.166",
          "code_system": "CFR",
          "references": [
            "4af956eb-a191-4d38-a969-70621a412a52"
          ]
        },
        {
          "uuid": "67619e1b-19a0-42d6-ab4c-b493ff83a5bb",
          "code": "INS-310",
          "comments": "Codex Alimentarius|Functional Classification|Antioxidant",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=204",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "4af956eb-a191-4d38-a969-70621a412a52"
          ]
        },
        {
          "uuid": "61edd5b7-8c3d-49b2-ad36-50ae4e8dcb00",
          "code": "INS-310",
          "comments": "JECFA|Functional Classification|Antioxidant",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=310",
          "code_system": "JECFA EVALUATION",
          "references": [
            "4af956eb-a191-4d38-a969-70621a412a52"
          ]
        },
        {
          "uuid": "a8ee2a3c-9d3e-4dbc-8e96-50770bd3d488",
          "code": "1311134",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1311134/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4af956eb-a191-4d38-a969-70621a412a52"
          ]
        },
        {
          "uuid": "89a2a893-1d69-4084-be42-0c9503d83b83",
          "code": "m9241",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9241?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4af956eb-a191-4d38-a969-70621a412a52"
          ]
        },
        {
          "uuid": "f0b300eb-ffb3-4844-9916-81c9950c3c43",
          "code": "SUB69737",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4af956eb-a191-4d38-a969-70621a412a52"
          ]
        },
        {
          "uuid": "aadcf110-0d9e-414d-bdfa-169565155097",
          "code": "SUB15028MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4af956eb-a191-4d38-a969-70621a412a52"
          ]
        },
        {
          "uuid": "3bd94ec5-f453-4e02-8ae2-09729915bdab",
          "code": "CHEMBL7983",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL7983",
          "code_system": "ChEMBL",
          "references": [
            "4af956eb-a191-4d38-a969-70621a412a52"
          ]
        },
        {
          "uuid": "304866db-a816-463c-994a-eeb04d6f6b8b",
          "code": "204-498-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.090",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4af956eb-a191-4d38-a969-70621a412a52"
          ]
        },
        {
          "uuid": "0170bf18-dd27-44e7-9559-dd81939dfe77",
          "code": "4947",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4947",
          "code_system": "PUBCHEM",
          "references": [
            "4af956eb-a191-4d38-a969-70621a412a52"
          ]
        },
        {
          "uuid": "1e37aa1f-8c68-41df-732b-e7342f165e9b",
          "code": "591",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/591",
          "code_system": "HSDB",
          "references": [
            "5aff564d-f505-b43e-5451-14aff168c3bd"
          ]
        },
        {
          "uuid": "27e175cf-fa6b-2a44-eda1-ea6fbec6078e",
          "code": "DTXSID5021201",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5021201",
          "code_system": "EPA CompTox",
          "references": [
            "b1a0c2af-afc9-1565-7f26-0c9ef029652b"
          ]
        },
        {
          "uuid": "e7875f26-bcec-4f74-8c5f-c360faaa8f6d",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e73d3f2b-793b-2a3c-d0d4-a9fa38cabfda"
          ]
        },
        {
          "uuid": "2e5b8319-7d4e-8757-76df-99fac76a28b4",
          "code": "1576800",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1576800",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "e73d3f2b-793b-2a3c-d0d4-a9fa38cabfda"
          ]
        },
        {
          "uuid": "ff4904a1-61b1-81a5-4cb2-0bb1fe9dde7c",
          "code": "DB12450",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12450",
          "code_system": "DRUG BANK",
          "references": [
            "e73d3f2b-793b-2a3c-d0d4-a9fa38cabfda"
          ]
        },
        {
          "uuid": "2eb96029-07d4-4cbd-b355-b46464cbf848",
          "code": "8D4SNN7V92",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5c028768-e8a1-e6be-ad61-38b5f809af1a",
          "code": "3267 (Number of products:1)",
          "comments": "Dietary Supplement Label Database|other|Propyl Gallate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3267&item=Propyl Gallate",
          "code_system": "DSLD",
          "references": [
            "e73d3f2b-793b-2a3c-d0d4-a9fa38cabfda"
          ]
        },
        {
          "uuid": "3cb4ea75-8346-0c4d-b9d9-d96e818ad00d",
          "code": "8D4SNN7V92",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8D4SNN7V92",
          "code_system": "DAILYMED",
          "references": [
            "1fc034c7-cfe8-06a9-70ec-f43503a6834b"
          ]
        },
        {
          "uuid": "30f09359-7440-0549-f399-12c062e9921d",
          "code": "100000078879",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c9ea4649-e1eb-b8ec-9fca-52ebf78eda7f"
          ]
        },
        {
          "uuid": "cc5cbcb2-6627-1893-5a7e-97d5c38825b5",
          "code": "2626",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2626",
          "code_system": "NSC",
          "references": [
            "5b7a6b5d-44ae-21a7-88cf-5f44e9a1355c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "20b6c873-9082-47b4-b72a-0933c0e68ed3",
          "name": "ANHYDROUS PROPYL GALLATE (E 310)",
          "stdName": "ANHYDROUS PROPYL GALLATE (E 310)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c2dbec0-65f8-4d33-998b-edfa7020e841"
          ],
          "display_name": false
        },
        {
          "uuid": "cb5c7e42-3045-4ccb-a9b7-2c2fe6131f10",
          "name": "BENZOIC ACID, 3,4,5-TRIHYDROXY-, PROPYL ESTER",
          "stdName": "BENZOIC ACID, 3,4,5-TRIHYDROXY-, PROPYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "088f4c6f-358a-4915-a0a1-05c16b173eff"
          ],
          "display_name": false
        },
        {
          "uuid": "f375faea-2d6e-4c97-b4c0-7c0b3fd1b4a1",
          "name": "E-310",
          "stdName": "E-310",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f33e2306-5afc-4ee9-8fc6-1c05c2435ebc"
          ],
          "display_name": false
        },
        {
          "uuid": "689c1d9c-9fc5-439f-9302-ed0c55cd7de3",
          "name": "FEMA NO. 2947",
          "stdName": "FEMA NO. 2947",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac1a05ba-9f33-4134-a7f4-39735dd2895a"
          ],
          "display_name": false
        },
        {
          "uuid": "40bc1736-bed7-43e1-b308-b399cf4bab98",
          "name": "GALLIC ACID, PROPYL ESTER",
          "stdName": "GALLIC ACID, PROPYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9b7184f-0684-4e81-ab33-60df07b88c9f",
            "12abc7cc-d198-4cf4-89b3-7c9812c95065"
          ],
          "display_name": false
        },
        {
          "uuid": "254e04c9-8b6e-42e0-a7f4-a0c9499871d5",
          "name": "INS NO.310",
          "stdName": "INS NO.310",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f33e2306-5afc-4ee9-8fc6-1c05c2435ebc"
          ],
          "display_name": false
        },
        {
          "uuid": "5c72d569-e7e4-49a3-9fcb-7f813a98a4a0",
          "name": "INS-310",
          "stdName": "INS-310",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f33e2306-5afc-4ee9-8fc6-1c05c2435ebc"
          ],
          "display_name": false
        },
        {
          "uuid": "babcc0e5-c074-4238-a768-781b1836693e",
          "name": "N-PROPYL ESTER OF 3,4,5- TRIHYDROXYBENZOIC ACID",
          "stdName": "N-PROPYL ESTER OF 3,4,5- TRIHYDROXYBENZOIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d79f815a-04cf-4e66-a5b6-b2faaa53b6d6"
          ],
          "display_name": false
        },
        {
          "uuid": "38ceaefc-ef11-42b9-be2f-219c73b5ceba",
          "name": "NSC-2626",
          "stdName": "NSC-2626",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9b7184f-0684-4e81-ab33-60df07b88c9f",
            "12abc7cc-d198-4cf4-89b3-7c9812c95065"
          ],
          "display_name": false
        },
        {
          "uuid": "d1659673-ce06-4a12-ae45-3bda1aead9db",
          "name": "PROPYL 3,4,5-TRIHYDROXYBENZOATE",
          "stdName": "PROPYL 3,4,5-TRIHYDROXYBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d79f815a-04cf-4e66-a5b6-b2faaa53b6d6"
          ],
          "display_name": false
        },
        {
          "uuid": "3de32347-530a-4e8b-b919-4bdb566c8025",
          "name": "PROPYL GALLATE (E 310)",
          "stdName": "PROPYL GALLATE (E 310)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e34eaf9-59b4-4df9-b9bb-0fa0867cbcba"
          ],
          "display_name": false
        },
        {
          "uuid": "b6aa78e5-11c4-6f5b-884d-131bdb28bb87",
          "name": "PROPYL GALLATE [EP MONOGRAPH]",
          "stdName": "PROPYL GALLATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce433575-2605-825b-341a-aae8c9501bf6"
          ],
          "display_name": false
        },
        {
          "uuid": "b006261a-f2b8-4a7c-b397-e5d734bf8d22",
          "name": "PROPYL GALLATE [FCC]",
          "stdName": "PROPYL GALLATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2408ebda-e70a-4a0f-8160-530fb0b013e1"
          ],
          "display_name": false
        },
        {
          "uuid": "ce4090cf-03e4-41db-a060-781390f1fac3",
          "name": "PROPYL GALLATE [FHFI]",
          "stdName": "PROPYL GALLATE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0dce257d-f7b8-48f0-94ee-ab4c489d57c2"
          ],
          "display_name": false
        },
        {
          "uuid": "d8213f07-c726-4d33-9bed-82812f7d0832",
          "name": "PROPYL GALLATE [HSDB]",
          "stdName": "PROPYL GALLATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0005db35-b8ed-4e78-9152-7e1d6a04367f"
          ],
          "display_name": false
        },
        {
          "uuid": "a2fc56c1-23f5-4214-b453-fc3fd553d19c",
          "name": "PROPYL GALLATE [II]",
          "stdName": "PROPYL GALLATE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8d6f8ed-f04d-4dfd-9991-cd9f9ecb0ed5"
          ],
          "display_name": false
        },
        {
          "uuid": "dd63d0dd-4883-4d17-9d4a-ede64c1bd9d7",
          "name": "PROPYL GALLATE [MART.]",
          "stdName": "PROPYL GALLATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1173b373-c42f-4592-a3f7-acaadf0aca02"
          ],
          "display_name": false
        },
        {
          "uuid": "b28ad835-38c8-43cd-a1d3-8c69c52a5f38",
          "name": "PROPYL GALLATE [MI]",
          "stdName": "PROPYL GALLATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07c7a817-58c2-45db-b31a-ee196551d1fe"
          ],
          "display_name": false
        },
        {
          "uuid": "689ea4b1-04b0-40ec-8cd8-8dc1b3ee37c2",
          "name": "PROPYL GALLATE [USP-RS]",
          "stdName": "PROPYL GALLATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a695fc08-794e-4c97-9889-4e385b54b969"
          ],
          "display_name": false
        },
        {
          "uuid": "fabb2dbf-ab39-448c-aeb7-889571402d97",
          "name": "PROPYL GALLATE [VANDF]",
          "stdName": "PROPYL GALLATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "731db761-af99-4757-8fde-a9fa89f3a7cc"
          ],
          "display_name": false
        },
        {
          "uuid": "2652b252-b502-4f4a-9482-7f3d5118679b",
          "name": "Propyl gallate",
          "stdName": "PROPYL GALLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e6e2daf-14fe-4c2a-b9f1-6535dd949fb6",
            "1173b373-c42f-4592-a3f7-acaadf0aca02",
            "54c0b7d8-4db2-4187-b532-b40c97eddf72",
            "e4b059b2-0a85-4ba7-aa02-5a90ad156aab",
            "57435633-a3b4-48af-8526-fd6f3f8c20a4",
            "07c7a817-58c2-45db-b31a-ee196551d1fe",
            "aad6e5f7-f3cf-40c1-a616-5ee10062404a",
            "0dce257d-f7b8-48f0-94ee-ab4c489d57c2",
            "f39cd3bd-9ce7-4d16-976e-8beea7ad7a23",
            "fae53038-7bb8-4a18-b8de-4dbca9068f9a",
            "c8d6f8ed-f04d-4dfd-9991-cd9f9ecb0ed5",
            "a6f52714-ab68-42f5-90ab-39e85e77883c",
            "1e12a32e-f2ec-4146-9d71-d8fed0b45c70",
            "731db761-af99-4757-8fde-a9fa89f3a7cc",
            "057bb79b-34c3-4143-a4cb-0fba76b56d1a",
            "a79a6c31-7104-4fa8-adc8-a93a209c0cee",
            "2408ebda-e70a-4a0f-8160-530fb0b013e1",
            "0005db35-b8ed-4e78-9152-7e1d6a04367f",
            "43dcb1b7-0b61-40e1-ada1-bbe5c9ea9fe2",
            "a695fc08-794e-4c97-9889-4e385b54b969",
            "0fd24740-f7cf-4d71-8628-3bb84c058040",
            "66fec94d-1976-4e92-a111-6e82d4f49752"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "739101c8-224a-4746-8c28-d6962d809b0e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "eabe7324-45c6-6be4-75f1-0f32a3821de3",
          "name": "Propyl gallate [WHO-DD]",
          "stdName": "PROPYL GALLATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5b88af8-c8c4-8143-56ae-dbc6d2146663"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "43dcb1b7-0b61-40e1-ada1-bbe5c9ea9fe2",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1173b373-c42f-4592-a3f7-acaadf0aca02",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07c7a817-58c2-45db-b31a-ee196551d1fe",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57435633-a3b4-48af-8526-fd6f3f8c20a4",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2408ebda-e70a-4a0f-8160-530fb0b013e1",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0dce257d-f7b8-48f0-94ee-ab4c489d57c2",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0005db35-b8ed-4e78-9152-7e1d6a04367f",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a695fc08-794e-4c97-9889-4e385b54b969",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e6e2daf-14fe-4c2a-b9f1-6535dd949fb6",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "731db761-af99-4757-8fde-a9fa89f3a7cc",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e34eaf9-59b4-4df9-b9bb-0fa0867cbcba",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d79f815a-04cf-4e66-a5b6-b2faaa53b6d6",
          "citation": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=310",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=310",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c2dbec0-65f8-4d33-998b-edfa7020e841",
          "citation": "EVMPD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f33e2306-5afc-4ee9-8fc6-1c05c2435ebc",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/results.html",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/results.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4af956eb-a191-4d38-a969-70621a412a52",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389663000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5114409f-8702-447e-ae08-4f47b9b59d8b",
          "citation": "SRS import [8D4SNN7V92]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8D4SNN7V92",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389663000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fae53038-7bb8-4a18-b8de-4dbca9068f9a",
          "citation": "PROPYL GALLATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e4b059b2-0a85-4ba7-aa02-5a90ad156aab",
          "citation": "PROPYL GALLATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "54c0b7d8-4db2-4187-b532-b40c97eddf72",
          "citation": "PROPYL GALLATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aad6e5f7-f3cf-40c1-a616-5ee10062404a",
          "citation": "PROPYL GALLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "057bb79b-34c3-4143-a4cb-0fba76b56d1a",
          "citation": "PROPYL GALLATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a6f52714-ab68-42f5-90ab-39e85e77883c",
          "citation": "PROPYL GALLATE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "66fec94d-1976-4e92-a111-6e82d4f49752",
          "citation": "PROPYL GALLATE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a79a6c31-7104-4fa8-adc8-a93a209c0cee",
          "citation": "PROPYL GALLATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1e12a32e-f2ec-4146-9d71-d8fed0b45c70",
          "citation": "PROPYL GALLATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f39cd3bd-9ce7-4d16-976e-8beea7ad7a23",
          "citation": "PROPYL GALLATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0fd24740-f7cf-4d71-8628-3bb84c058040",
          "citation": "PROPYL GALLATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c8d6f8ed-f04d-4dfd-9991-cd9f9ecb0ed5",
          "citation": "USP Dictionary 2007",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e9b7184f-0684-4e81-ab33-60df07b88c9f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12abc7cc-d198-4cf4-89b3-7c9812c95065",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac1a05ba-9f33-4134-a7f4-39735dd2895a",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "088f4c6f-358a-4915-a0a1-05c16b173eff",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5aff564d-f505-b43e-5451-14aff168c3bd",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+121-79-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b1a0c2af-afc9-1565-7f26-0c9ef029652b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=121-79-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c9ea4649-e1eb-b8ec-9fca-52ebf78eda7f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "e73d3f2b-793b-2a3c-d0d4-a9fa38cabfda",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6c331a77-1066-4231-bcfd-48bb91d94f60",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ce433575-2605-825b-341a-aae8c9501bf6",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "e5b88af8-c8c4-8143-56ae-dbc6d2146663",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5b7a6b5d-44ae-21a7-88cf-5f44e9a1355c",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1fc034c7-cfe8-06a9-70ec-f43503a6834b",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a11e0913-1f9a-4942-99ee-42247540675f",
          "id": "a11e0913-1f9a-4942-99ee-42247540675f",
          "molfile": "\n  Marvin  01132108222D          \n\n 15 15  0  0  0  0            999 V2000\n    5.7287   -2.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9953   -2.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2850   -2.4578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5747   -2.0382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8979   -2.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8876   -3.2221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1644   -2.0151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1772   -1.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4309   -0.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4541    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7334   -1.2302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7334   -2.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4438   -2.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 15  2  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\nM  END",
          "smiles": "CCCOC(=O)c1cc(c(c(c1)O)O)O",
          "formula": "C10H12O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "410891c2-aa0b-42fc-b413-f33ccda95e5a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "212.1997",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9a27edba-94cb-4aba-a4d4-1a7b8309e840",
      "version": "21",
      "structure": {
        "id": "43d71d04-3e5d-4fdf-a1d2-5e505ecb8e2a",
        "molfile": "\n  Marvin  01132103342D          \n\n 15 15  0  0  0  0            999 V2000\n    0.7334   -1.2302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1644   -2.0151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7334   -2.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4309   -0.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8979   -2.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4438   -2.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1772   -1.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8876   -3.2221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4541    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5747   -2.0382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2850   -2.4578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9953   -2.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7287   -2.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  4  2  0  0  0  0\n  8  5  2  0  0  0  0\n  9  1  1  0  0  0  0\n 10  4  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12  5  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n  2  6  2  0  0  0  0\nM  END",
        "smiles": "CCCOC(=O)c1cc(c(c(c1)O)O)O",
        "formula": "C10H12O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "212.1997",
        "optical_activity": "NONE",
        "references": [
          "c8d6f8ed-f04d-4dfd-9991-cd9f9ecb0ed5",
          "5114409f-8702-447e-ae08-4f47b9b59d8b"
        ],
        "stereo_centers": 0
      },
      "unii": "8D4SNN7V92"
    }
  ]
}