{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "111eefbe-d931-4cc7-b40c-56f2c3d36847",
          "code": "76968358",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76968358",
          "code_system": "PUBCHEM",
          "references": [
            "309f78a6-015a-413d-98dd-56a8dd66cac4"
          ]
        },
        {
          "uuid": "6d34cd88-32ae-45ec-8321-5fe5a0c5cd4e",
          "code": "8CVG31K45S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ab2b12bb-5d47-49c0-aa3d-6a2e9d3d4887",
          "name": "ZINC PYRIDOXAL 5-PHOSPHATE",
          "stdName": "ZINC PYRIDOXAL 5-PHOSPHATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09fe3059-49e9-44ef-beec-a9c9a4af23b2",
            "50f549e1-0b62-4f76-aab4-09aae3a957e0",
            "81c261b9-ae97-48e4-8f64-b7662088143a"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4b41aaba-1cf5-4d76-b354-4996a68b1506",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "597ab820-5d6a-490c-98ba-23062ebee1e2",
          "name": "ZINC PYRIDOXINE",
          "stdName": "ZINC PYRIDOXINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09fe3059-49e9-44ef-beec-a9c9a4af23b2",
            "50f549e1-0b62-4f76-aab4-09aae3a957e0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "09fe3059-49e9-44ef-beec-a9c9a4af23b2",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "50f549e1-0b62-4f76-aab4-09aae3a957e0",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "309f78a6-015a-413d-98dd-56a8dd66cac4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391630000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "762e2713-492f-425e-a9df-b1a8ba18923b",
          "citation": "SRS import [8CVG31K45S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8CVG31K45S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391630000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81c261b9-ae97-48e4-8f64-b7662088143a",
          "citation": "ZINC PYRIDOXAL 5-PHOSPHATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1e891315-14eb-494f-b070-d5793caa3095",
          "id": "1e891315-14eb-494f-b070-d5793caa3095",
          "molfile": "\n  Marvin  01132101452D          \n\n  1  0  0  0  0  0            999 V2000\n    0.8911   -4.8961    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "24820676-a36f-4a82-95c0-3a011679cbe6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "3f886259-5679-4403-9e6c-40a1b77db4ab",
          "id": "3f886259-5679-4403-9e6c-40a1b77db4ab",
          "molfile": "\n  Marvin  01132103222D          \n\n 16 16  0  0  0  0            999 V2000\n    7.1053   -6.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3847   -6.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6692   -6.6478    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9562   -6.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9562   -5.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2459   -4.9921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5408   -5.4028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8149   -4.9921    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2390   -5.5733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2928   -4.3257    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.1899   -4.4704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6692   -4.9921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6692   -4.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9562   -3.7574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3847   -5.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1053   -4.9921    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n 15  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 12  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  8  2  0  0  0  0\n 13 12  1  0  0  0  0\n 15 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 16 15  1  0  0  0  0\nM  CHG  2  10  -1  16  -1\nM  END",
          "smiles": "Cc1c(c(C=O)c(cn1)COP(=O)(O)[O-])[O-]",
          "formula": "C8H8NO6P",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ae921021-3586-4f7c-b288-570fac09e532"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "245.1263",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "98e8556e-052b-4a81-b411-4e5ed5424005",
      "version": "3",
      "structure": {
        "id": "13e71028-94b7-4ed6-95d1-efc6744aee59",
        "molfile": "\n  Marvin  01132101142D          \n\n 17 16  0  0  0  0            999 V2000\n    0.8911   -4.8961    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    2.8149   -4.9921    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5408   -5.4028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2459   -4.9921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9562   -5.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6692   -4.9921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3847   -5.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1053   -4.9921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3847   -6.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6692   -6.6478    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9562   -6.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1053   -6.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6692   -4.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9562   -3.7574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1899   -4.4704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2928   -4.3257    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.2390   -5.5733    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11  5  2  0  0  0  0\n 12  9  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15  2  2  0  0  0  0\n 16  2  1  0  0  0  0\n 17  2  1  0  0  0  0\nM  CHG  3   1   2  16  -1  17  -1\nM  END",
        "smiles": "Cc1c(c(C=O)c(cn1)COP(=O)([O-])[O-])O.[Zn+2]",
        "formula": "C8H8NO6P.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "310.5219",
        "optical_activity": "NONE",
        "references": [
          "09fe3059-49e9-44ef-beec-a9c9a4af23b2",
          "762e2713-492f-425e-a9df-b1a8ba18923b"
        ],
        "stereo_centers": 0
      },
      "unii": "8CVG31K45S"
    }
  ]
}