{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "91eeff62-2ebd-2dd4-09f4-7504060ce29a", "code": "321553-20-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=321553-20-2", "code_system": "CAS", "references": [ "ca71cba0-8b6f-4cba-8690-227fcbe2c8e3" ] }, { "uuid": "53c2eacb-89ab-229c-c813-4280ccadf17f", "code": "1473242", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1473242", "code_system": "PUBCHEM", "references": [ "62997edf-c7fd-41e1-1e84-7a8c5b266d8f" ] }, { "uuid": "9e869f81-b07d-48dc-a1ce-43c5fa151eed", "code": "8C9VEZ8JB3", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "366fce25-16d3-a928-6fde-0847388fcd56", "code": "DB06877", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB06877", "code_system": "DRUG BANK", "references": [ "d184dc01-cf06-e021-61aa-0a1ad7901c5f" ] } ], "substance_class": "chemical", "names": [ { "uuid": "14942f88-2f3d-4ac3-b5ea-77f1473ffbd3", "name": "1H-PYRROLE-2-CARBOXAMIDE, N,N-DIMETHYL-4-(4-PHENYL-1H-PYRAZOL-3-YL)-", "stdName": "1H-PYRROLE-2-CARBOXAMIDE, N,N-DIMETHYL-4-(4-PHENYL-1H-PYRAZOL-3-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ca71cba0-8b6f-4cba-8690-227fcbe2c8e3" ], "display_name": false }, { "uuid": "7b763e70-f476-2c53-1ac4-6f14dd2db3cd", "name": "N,N-DIMETHYL-4-(4-PHENYL-1H-PYRAZOL-3-YL)-1H-PYRROLE-2-CARBOXAMIDE", "stdName": "N,N-DIMETHYL-4-(4-PHENYL-1H-PYRAZOL-3-YL)-1H-PYRROLE-2-CARBOXAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7c8fcd2a-697c-ce1c-b4f1-71eea73de164" ], "display_name": true } ], "references": [ { "uuid": "62997edf-c7fd-41e1-1e84-7a8c5b266d8f", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "7c8fcd2a-697c-ce1c-b4f1-71eea73de164", "citation": "ZINC", "url": "http://zinc.docking.org/substances/subsets/in-vivo/", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "ca71cba0-8b6f-4cba-8690-227fcbe2c8e3", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d184dc01-cf06-e021-61aa-0a1ad7901c5f", "doc_type": "SYSTEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "78a26ad5-f02c-4535-9bfa-84166306f729", "id": "78a26ad5-f02c-4535-9bfa-84166306f729", "molfile": "\n Marvin 01132106162D \n\n 21 23 0 0 0 0 999 V2000\n 3.6667 2.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5804 1.4735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2478 0.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8267 1.1379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1593 1.6228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7404 0.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0260 -0.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1975 -0.9021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6455 -1.5152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8170 -2.3222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1025 -2.7347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4894 -2.1826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 -1.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0180 -0.9883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3536 -0.2346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 21 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 20 2 0 0 0 0\n 9 10 2 0 0 0 0\n 13 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 19 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 20 21 1 0 0 0 0\nM END", "smiles": "CN(C)C(=O)c1cc(c[nH]1)-c2c(c[nH]n2)-c3ccccc3", "formula": "C16H16N4O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f5076ce7-02f8-4642-aee9-5ed65106d579" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "280.325", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "952a13e9-b37d-4c4a-a40c-e4c3bcfe975f", "version": "7", "structure": { "id": "c8ea860d-9682-4b7c-abd5-8a55ae9b4b07", "molfile": "ZINC000020149026\n Marvin 01132110232D \n\n 21 23 0 0 0 0 999 V2000\n 3.6667 2.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5804 1.4735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2478 0.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8267 1.1379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1593 1.6228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7404 0.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0260 -0.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1975 -0.9021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6455 -1.5152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8170 -2.3222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1025 -2.7347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4894 -2.1826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 -1.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0180 -0.9883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3536 -0.2346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 8 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 6 1 0 0 0 0\n 13 9 1 0 0 0 0\n 19 14 1 0 0 0 0\nM END", "smiles": "CN(C)C(=O)c1cc(c[nH]1)-c2c(c[nH]n2)-c3ccccc3", "formula": "C16H16N4O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "280.325", "optical_activity": "NONE", "references": [ "7c8fcd2a-697c-ce1c-b4f1-71eea73de164" ], "stereo_centers": 0 }, "unii": "8C9VEZ8JB3" } ] }