{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7a410330-55e9-492d-b23e-68bdf13e7d05", "code": "54686-97-4", "type": "GENERIC (FAMILY)", "url": "https://commonchemistry.cas.org/detail?cas_rn=54686-97-4", "code_system": "CAS", "references": [ "13e6b0ec-9d5a-4cf6-a63e-85cf2b51efba", "964908f6-dfe0-4c9e-a38a-fba4e828da51" ] }, { "uuid": "ed222d1a-22fa-4d54-9ec2-be314c746a12", "code": "FCN NO. 1091", "comments": "FCN|NUCLEATING AGENT|FOOD CONTACT ARTICLES", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=1091", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "13e6b0ec-9d5a-4cf6-a63e-85cf2b51efba" ] }, { "uuid": "aceb4683-10ad-4f88-a4eb-102f628c3a90", "code": "FCN NO. 189", "comments": "FCN|CLARIFIER|POLYPROPYLENE POLYMERS", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=189", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "13e6b0ec-9d5a-4cf6-a63e-85cf2b51efba" ] }, { "uuid": "4b53b426-c2b1-4ebc-8538-75b3b1d1b312", "code": "FCN NO. 808", "comments": "FCN|NUCLEATING AGENT|FOOD CONTACT ARTICLES", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=808", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "13e6b0ec-9d5a-4cf6-a63e-85cf2b51efba" ] }, { "uuid": "bbb5de0d-cf69-486f-b68c-ffc61e21d386", "code": "11069095", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11069095", "code_system": "PUBCHEM", "references": [ "13e6b0ec-9d5a-4cf6-a63e-85cf2b51efba" ] }, { "uuid": "0b50044d-5658-c955-a18a-2355ad0c3fc5", "code": "DTXSID401009875", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401009875", "code_system": "EPA CompTox", "references": [ "d4e5b524-5e58-c959-5e63-1681e5e0b932" ] }, { "uuid": "7d2f783d-e2a1-4266-8552-35a2f0300d28", "code": "8BW8T2H5TX", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "a1b67a3b-d6de-46ee-8c88-b3e42a883040", "name": "BIS(P-METHYLBENZYLIDENE)SORBITOL", "stdName": "BIS(P-METHYLBENZYLIDENE)SORBITOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "16cb0428-fa80-4cbe-aee5-9d476e57958f" ], "display_name": false }, { "uuid": "25d361bd-c2d9-4cf1-9178-e1a0ba88f344", "name": "D-GLUCITOL, BIS-O-((4-METHYLPHENYL)METHYLENE)-", "stdName": "D-GLUCITOL, BIS-O-((4-METHYLPHENYL)METHYLENE)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "16cb0428-fa80-4cbe-aee5-9d476e57958f" ], "display_name": false }, { "uuid": "2eaf1d62-15e6-4896-bb72-31abac24dc3d", "name": "DI(P-TOLYLIDENE)SORBITOL", "stdName": "DI(P-TOLYLIDENE)SORBITOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dca83c16-3529-4558-8fe6-b655e49c0231" ], "display_name": true }, { "uuid": "d5c29a65-a907-4467-a9d2-7016f3f90c6f", "name": "DI-P-TOLYLIDENE SORBITOL", "stdName": "DI-P-TOLYLIDENE SORBITOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "180b1e21-4637-4670-815d-a9789446f2f9" ], "display_name": false }, { "uuid": "781efb57-1278-4c6e-9bb7-ecbda83c0974", "name": "HB-2002", "stdName": "HB-2002", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "3464a42c-3879-4db8-b755-f43e6136f228" ], "display_name": false } ], "references": [ { "uuid": "180b1e21-4637-4670-815d-a9789446f2f9", "citation": "CEDI", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "16cb0428-fa80-4cbe-aee5-9d476e57958f", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3464a42c-3879-4db8-b755-f43e6136f228", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dca83c16-3529-4558-8fe6-b655e49c0231", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "13e6b0ec-9d5a-4cf6-a63e-85cf2b51efba", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391930000, "tags": [ "NOMEN" ] }, { "uuid": "35773757-3496-45b9-94e5-cbc99f8e2062", "citation": "SRS import [8BW8T2H5TX]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8BW8T2H5TX", "doc_type": "SRS", "public_domain": true, "document_date": 1493391930000, "tags": [ "NOMEN" ] }, { "uuid": "d4e5b524-5e58-c959-5e63-1681e5e0b932", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=54686-97-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "964908f6-dfe0-4c9e-a38a-fba4e828da51", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c0cd57c3-f7b6-4019-8971-19503eeeb0e1", "id": "c0cd57c3-f7b6-4019-8971-19503eeeb0e1", "molfile": "\n Marvin 01132109582D \n\n 28 31 0 0 1 0 999 V2000\n 6.7534 -4.0533 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.8396 -4.8738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9997 -3.7177 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.9134 -2.8972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3322 -4.2027 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 4.5476 -3.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0627 -4.6151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5476 -5.2826 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 5.3322 -5.0277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2926 -6.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4857 -6.2388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2307 -7.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7828 -7.6365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5278 -8.4211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5898 -7.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8447 -6.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4208 -3.5684 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.2054 -3.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6903 -3.1559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2054 -2.4884 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 7.4208 -2.7434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4603 -1.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9083 -1.0907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1633 -0.3061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9702 -0.1345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2252 0.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5222 -0.7477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2673 -1.5323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 17 1 1 0 0 0 0\n 3 4 1 1 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 9 1 1 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 8 1 0 0 0 0\n 10 11 1 0 0 0 0\n 16 10 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 21 1 6 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 20 1 0 0 0 0\n 23 22 1 0 0 0 0\n 22 28 2 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 25 2 0 0 0 0\n 28 27 1 0 0 0 0\nM END", "smiles": "Cc1ccc(cc1)C2OC[C@H]([C@H]([C@@H]([C@@H]3COC(c4ccc(C)cc4)O3)O)O)O2", "formula": "C22H26O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "fd945f2c-acdf-4fce-a023-304d02b1861d" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "386.4391", "optical_activity": "UNSPECIFIED", "stereo_centers": 6 } ], "definition_level": "INCOMPLETE", "uuid": "7b3da4f4-d265-451b-b80f-c042118c5269", "version": "4", "structure": { "id": "553751d8-9868-4204-92d2-9fd4891e8531", "molfile": "\n Marvin 01132104262D \n\n 28 31 0 0 1 0 999 V2000\n 4.0627 -4.6151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5476 -3.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3322 -4.2027 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.9997 -3.7177 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.7534 -4.0533 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.4208 -3.5684 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.2054 -3.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6903 -3.1559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2054 -2.4884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4603 -1.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9083 -1.0907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1633 -0.3061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9702 -0.1345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5222 -0.7477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2673 -1.5323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2252 0.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4208 -2.7434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8396 -4.8738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9134 -2.8972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3322 -5.0277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5476 -5.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2926 -6.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4857 -6.2388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2307 -7.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7828 -7.6365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5898 -7.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8447 -6.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5278 -8.4211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 10 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 9 17 1 0 0 0 0\n 6 17 1 6 0 0 0\n 5 18 1 1 0 0 0\n 4 19 1 1 0 0 0\n 3 20 1 1 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 22 2 0 0 0 0\n 25 28 1 0 0 0 0\n 21 1 1 0 0 0 0\nM END", "smiles": "Cc1ccc(cc1)C2OC[C@H]([C@H]([C@@H]([C@@H]3COC(c4ccc(C)cc4)O3)O)O)O2", "formula": "C22H26O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "386.4391", "optical_activity": "UNSPECIFIED", "references": [ "35773757-3496-45b9-94e5-cbc99f8e2062", "16cb0428-fa80-4cbe-aee5-9d476e57958f" ], "stereo_centers": 6 }, "unii": "8BW8T2H5TX" } ] }