{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f686f1e9-d6fc-45f2-9d55-a652a03b702e",
          "code": "1088-79-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1088-79-5",
          "code_system": "CAS",
          "references": [
            "2890a1d1-97f9-48c9-a09e-2cc55c79122c",
            "56cf4804-77b6-419e-8c6a-bdbaa28564e3"
          ]
        },
        {
          "uuid": "1c485b83-cf68-4117-857b-e071785e33f6",
          "code": "14152",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14152",
          "code_system": "PUBCHEM",
          "references": [
            "2890a1d1-97f9-48c9-a09e-2cc55c79122c"
          ]
        },
        {
          "uuid": "40686033-de79-4305-a57d-d2d19cacbfda",
          "code": "8BA40E8GDC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a14f2944-1fd5-c2db-74d8-29ab7caeca88",
          "code": "27381",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=27381",
          "code_system": "NSC",
          "references": [
            "ac5bdebd-c8fc-0457-0e1a-3e80a8f4e059"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3953fbe3-bc00-4432-8833-dd7e0b2c8e2f",
          "name": "3-(BIS(2-CHLOROETHYL)AMINO)PHENYLALANINE",
          "stdName": "3-(BIS(2-CHLOROETHYL)AMINO)PHENYLALANINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7462169-5c2d-41ab-965b-dd56e9869e73",
            "9bb7da4a-64d9-483e-992a-6cde7f974f18"
          ],
          "display_name": false
        },
        {
          "uuid": "aa6451b5-2a48-4abe-beb4-090bad10562b",
          "name": "ALANINE, 3-(M-(BIS(2-CHLOROETHYL)AMINO)PHENYL)-, DL-",
          "stdName": "ALANINE, 3-(M-(BIS(2-CHLOROETHYL)AMINO)PHENYL)-, DL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7462169-5c2d-41ab-965b-dd56e9869e73",
            "9bb7da4a-64d9-483e-992a-6cde7f974f18"
          ],
          "display_name": false
        },
        {
          "uuid": "e11538ea-59bc-407f-9d37-557bad486002",
          "name": "DL-PHENYLALANINE, 3-(BIS(2-CHLOROETHYL)AMINO)-",
          "stdName": "DL-PHENYLALANINE, 3-(BIS(2-CHLOROETHYL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7462169-5c2d-41ab-965b-dd56e9869e73",
            "9bb7da4a-64d9-483e-992a-6cde7f974f18"
          ],
          "display_name": false
        },
        {
          "uuid": "a4316d93-0352-4c96-bfd8-44922ceb5317",
          "name": "METAMELFALAN, (±)-",
          "stdName": "METAMELFALAN, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "becb7657-5b10-4384-87e2-7c2bf08a7469",
            "e7462169-5c2d-41ab-965b-dd56e9869e73"
          ],
          "display_name": true
        },
        {
          "uuid": "c3d8e6a5-d8bf-4f81-8b88-2e583ded5acd",
          "name": "NSC-27381",
          "stdName": "NSC-27381",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7462169-5c2d-41ab-965b-dd56e9869e73",
            "9bb7da4a-64d9-483e-992a-6cde7f974f18"
          ],
          "display_name": false
        },
        {
          "uuid": "5a1a69ca-4137-49f6-b1dc-4a393e56c15c",
          "name": "PHENYLALANINE, 3-(BIS(2-CHLOROETHYL)AMINO)-",
          "stdName": "PHENYLALANINE, 3-(BIS(2-CHLOROETHYL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7462169-5c2d-41ab-965b-dd56e9869e73",
            "9bb7da4a-64d9-483e-992a-6cde7f974f18"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "becb7657-5b10-4384-87e2-7c2bf08a7469",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e7462169-5c2d-41ab-965b-dd56e9869e73",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9bb7da4a-64d9-483e-992a-6cde7f974f18",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2890a1d1-97f9-48c9-a09e-2cc55c79122c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394108000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de1d02fb-555b-45d3-a8e8-f7679453cecd",
          "citation": "SRS import [8BA40E8GDC]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8BA40E8GDC",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394108000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56cf4804-77b6-419e-8c6a-bdbaa28564e3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ac5bdebd-c8fc-0457-0e1a-3e80a8f4e059",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d59a1de9-6f51-454d-a373-6e203c2cf31f",
          "id": "d59a1de9-6f51-454d-a373-6e203c2cf31f",
          "molfile": "\n  Marvin  01132111042D          \n\n 19 19  0  0  0  0            999 V2000\n   10.9622  -10.8013    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9622   -9.9763    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.2477   -9.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5333   -9.9763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5332  -10.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8188  -11.2139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1043  -10.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1043   -9.9763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8188   -9.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3899   -9.5639    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6753   -9.9763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9609   -9.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2464   -9.9764    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.3899   -8.7389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6753   -8.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9609   -8.7389    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   11.6766   -9.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3911   -9.9763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6766   -8.7389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 17  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 14  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\nM  END",
          "smiles": "c1cc(cc(c1)N(CCCl)CCCl)CC(C(=O)O)N",
          "formula": "C13H18Cl2N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "39ff3ffc-e1b2-47da-83de-13db912cb0a3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "305.2006",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9fe8a7eb-134b-472c-912b-842df7710011",
      "version": "3",
      "structure": {
        "id": "8f208497-5f68-4eab-890c-1335f924dab0",
        "molfile": "\n  Marvin  01132107252D          \n\n 19 19  0  0  0  0            999 V2000\n    7.3899   -9.5639    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6753   -9.9763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9609   -9.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2464   -9.9764    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.3899   -8.7389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6753   -8.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9609   -8.7389    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.1043   -9.9763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8188   -9.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5333   -9.9763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2477   -9.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9622   -9.9763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6766   -9.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3911   -9.9763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6766   -8.7389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9622  -10.8013    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5332  -10.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8188  -11.2139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1043  -10.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  1  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 12 16  1  0  0  0  0\n 10 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n  8 19  1  0  0  0  0\nM  END",
        "smiles": "c1cc(cc(c1)N(CCCl)CCCl)CC(C(=O)O)N",
        "formula": "C13H18Cl2N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "305.2006",
        "optical_activity": "( + / - )",
        "references": [
          "de1d02fb-555b-45d3-a8e8-f7679453cecd",
          "9bb7da4a-64d9-483e-992a-6cde7f974f18"
        ],
        "stereo_centers": 1
      },
      "unii": "8BA40E8GDC"
    }
  ]
}