{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "78e208b8-d61e-4081-941b-21217248b302",
          "code": "19529-40-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=19529-40-9",
          "code_system": "CAS",
          "references": [
            "792fd2fd-f408-46e8-8155-ef1440af9835",
            "8b408734-4193-4717-ab5f-2fece5f55a7e"
          ]
        },
        {
          "uuid": "58daf556-1c31-6c0b-a473-7cec4b83735e",
          "code": "91865093",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91865093",
          "code_system": "PUBCHEM",
          "references": [
            "6b1d6889-baef-8990-cd1d-00225407f931"
          ]
        },
        {
          "uuid": "4f4c3cb6-37fa-4fb5-9b3f-7994a24a86e3",
          "code": "8B94462PYV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6fd3447a-7f7f-4902-936c-86e62df2c59a",
          "name": "ALAIRON",
          "stdName": "ALAIRON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e83eeb8a-eb62-4d3a-816e-7567cd2aa5f7",
            "f442661a-a136-4270-81ac-26eab1da3887"
          ],
          "display_name": false
        },
        {
          "uuid": "9d989194-ec94-459f-8191-b24a0411ee5b",
          "name": "AMMONIUM FERRIC PENTETATE",
          "stdName": "AMMONIUM FERRIC PENTETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e83eeb8a-eb62-4d3a-816e-7567cd2aa5f7",
            "2b524b9b-ed27-4be7-9416-ed80f78f797d",
            "f442661a-a136-4270-81ac-26eab1da3887"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "78b9309e-3c09-4511-b944-adac987d83fc",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "eeb10da3-468b-4a44-b7c8-6415d968815e",
          "name": "FERRATE(2-), (N,N-BIS(2-(BIS(CARBOXYMETHYL)AMINO)ETHYL)GLYCINATO(5-))-, AMMONIUM HYDROGEN",
          "stdName": "FERRATE(2-), (N,N-BIS(2-(BIS(CARBOXYMETHYL)AMINO)ETHYL)GLYCINATO(5-))-, AMMONIUM HYDROGEN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f442661a-a136-4270-81ac-26eab1da3887",
            "513a4e05-f0cb-4504-90cf-19fd54960ff3"
          ],
          "display_name": false
        },
        {
          "uuid": "c371c837-21cf-41af-8b6f-2e1788d63337",
          "name": "FERRATE(2-), (REL-(N(R))-N-(2-(BIS((CARBOXY-.KAPPA.O)METHYL)AMINO-.KAPPA.N)ETHYL)-N-((S)-2-(((CARBOXY-.KAPPA.O)METHYL)(CARBOXYMETHYL)AMINO-.KAPPA.N)ETHYL)GLYCINATO(5-)-.KAPPA.N,.KAPPA.O)-, AMMONIUM HYDROGEN (1:1:1), (PB-7-13-12564)-",
          "stdName": "FERRATE(2-), (REL-(N(R))-N-(2-(BIS((CARBOXY-.KAPPA.O)METHYL)AMINO-.KAPPA.N)ETHYL)-N-((S)-2-(((CARBOXY-.KAPPA.O)METHYL)(CARBOXYMETHYL)AMINO-.KAPPA.N)ETHYL)GLYCINATO(5-)-.KAPPA.N,.KAPPA.O)-, AMMONIUM HYDROGEN (1:1:1), (PB-7-13-12564)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f442661a-a136-4270-81ac-26eab1da3887",
            "513a4e05-f0cb-4504-90cf-19fd54960ff3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e83eeb8a-eb62-4d3a-816e-7567cd2aa5f7",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f442661a-a136-4270-81ac-26eab1da3887",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "513a4e05-f0cb-4504-90cf-19fd54960ff3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "792fd2fd-f408-46e8-8155-ef1440af9835",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393062000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aae6d733-c489-4dd0-9f2a-72f90ddd7d69",
          "citation": "SRS import [8B94462PYV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8B94462PYV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393062000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b524b9b-ed27-4be7-9416-ed80f78f797d",
          "citation": "AMMONIUM FERRIC PENTETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6b1d6889-baef-8990-cd1d-00225407f931",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "8b408734-4193-4717-ab5f-2fece5f55a7e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "80a3a53d-f5fa-41db-b163-970dd283cf83",
          "id": "80a3a53d-f5fa-41db-b163-970dd283cf83",
          "molfile": "\n  Marvin  01132106412D          \n\n 27 26  0  0  0  0            999 V2000\n    7.1549   -5.5720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4405   -5.9845    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4405   -6.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1549   -7.2219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1549   -8.0470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8694   -6.8095    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.7260   -5.5720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0115   -5.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2970   -5.5720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2970   -4.7470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5825   -4.3345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5825   -3.5095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8682   -4.7470    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.5825   -5.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7258   -6.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0939   -7.3272    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2371   -8.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0123   -8.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1556   -9.2343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6444   -7.8915    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.3186   -7.0451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6867   -7.5754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9114   -7.2933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8300   -8.3879    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.1549   -4.7470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4405   -4.3345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8694   -4.3345    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 25  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 18  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 22  1  0  0  0  0\n 25 26  2  0  0  0  0\n 25 27  1  0  0  0  0\nM  CHG  5   6  -1  13  -1  20  -1  24  -1  27  -1\nM  END",
          "smiles": "C(CN(CC(=O)[O-])CC(=O)[O-])N(CCN(CC(=O)[O-])CC(=O)[O-])CC(=O)[O-]",
          "formula": "C14H18N3O10",
          "atropisomerism": "No",
          "charge": -5,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "96834b14-dbc6-4579-912d-79477fcadfa9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "388.3074",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "03e5095a-163d-4803-a081-067ff6f3e893",
          "id": "03e5095a-163d-4803-a081-067ff6f3e893",
          "molfile": "\n  Marvin  01132100302D          \n\n  1  0  0  0  0  0            999 V2000\n   10.6728   -6.4201    0.0000 Fe  0  1  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   3\nM  END",
          "smiles": "[Fe+3]",
          "formula": "Fe",
          "atropisomerism": "No",
          "charge": 3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "149c6c94-8e76-4702-87b8-20093e396ed4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "55.8451",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "78a58d5d-8310-4ec1-9091-a796778bc3e4",
          "id": "78a58d5d-8310-4ec1-9091-a796778bc3e4",
          "molfile": "\n  Marvin  01132106162D          \n\n  1  0  0  0  0  0            999 V2000\n   13.8898   -6.2650    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[NH4+]",
          "formula": "H4N",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2e16b376-2291-4bae-95e9-b7b5ef8a1cc9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "18.0385",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "50a05b12-1d56-42c9-a146-aa455614f52f",
          "id": "50a05b12-1d56-42c9-a146-aa455614f52f",
          "molfile": "\n  Marvin  01132104122D          \n\n  1  0  0  0  0  0            999 V2000\n   16.4546   -6.3246    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "formula": "H",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8b126186-d3b0-4893-8444-4f4ee4caa968"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "1.0079",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "05112317-4d0c-4a96-821b-8b8e54050716",
      "version": "5",
      "structure": {
        "id": "5dc59d12-1697-4420-96e1-051af6481390",
        "molfile": "\n  Marvin  01132104512D          \n\n 30 26  0  0  0  0            999 V2000\n    7.1549   -5.5720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4405   -5.9845    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4405   -6.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1549   -7.2219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1549   -8.0470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8694   -6.8095    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.7260   -5.5720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0115   -5.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2970   -5.5720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2970   -4.7470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5825   -4.3345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5825   -3.5095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8682   -4.7470    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.5825   -5.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7258   -6.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0939   -7.3272    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2371   -8.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0123   -8.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1556   -9.2343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6444   -7.8915    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.3186   -7.0451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6867   -7.5754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9114   -7.2933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8300   -8.3879    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.1549   -4.7470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4405   -4.3345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8694   -4.3345    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.6728   -6.4201    0.0000 Fe  0  1  0  0  0  0  0  0  0  0  0  0\n   13.8898   -6.2650    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   16.4546   -6.3246    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n  9 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 18  1  0  0  0  0\n 16 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 22  1  0  0  0  0\n  1 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 25 27  1  0  0  0  0\nM  CHG  8   6  -1  13  -1  20  -1  24  -1  27  -1  28   3  29   1  30   1\nM  END",
        "smiles": "C(CN(CC(=O)[O-])CC(=O)[O-])N(CCN(CC(=O)[O-])CC(=O)[O-])CC(=O)[O-].[Fe+3].[NH4+].[H+]",
        "formula": "C14H18N3O10.Fe.H.H4N",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "463.1989",
        "optical_activity": "NONE",
        "references": [
          "e83eeb8a-eb62-4d3a-816e-7567cd2aa5f7",
          "aae6d733-c489-4dd0-9f2a-72f90ddd7d69"
        ],
        "stereo_centers": 0
      },
      "unii": "8B94462PYV"
    }
  ]
}