{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "25fb3e2d-29ad-48bf-983b-6f71b45c002b",
          "code": "153259-65-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=153259-65-5",
          "code_system": "CAS",
          "references": [
            "d15b400d-cd29-4167-932c-1cf9eb49048c",
            "3e32f804-024e-47bf-8f52-7b27953139c6"
          ]
        },
        {
          "uuid": "758b6629-8bb2-477e-bb11-1b3bf9ef94b7",
          "code": "C95232",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C95232",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d15b400d-cd29-4167-932c-1cf9eb49048c"
          ]
        },
        {
          "uuid": "0ca32de2-7a2a-4f82-bd87-d63539c5a8f5",
          "code": "C433247",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67433247",
          "code_system": "MESH",
          "references": [
            "d15b400d-cd29-4167-932c-1cf9eb49048c"
          ]
        },
        {
          "uuid": "5da2e836-f21a-440d-b8e3-26929195c2b7",
          "code": "CILOMILAST",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cilomilast",
          "code_system": "WIKIPEDIA",
          "references": [
            "d15b400d-cd29-4167-932c-1cf9eb49048c"
          ]
        },
        {
          "uuid": "88689565-843d-426d-a036-d2a5a8bc48af",
          "code": "SUB01296MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d15b400d-cd29-4167-932c-1cf9eb49048c"
          ]
        },
        {
          "uuid": "284ffe9f-0272-4cda-9312-e55852700ebd",
          "code": "7960",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=7960",
          "code_system": "INN",
          "references": [
            "d15b400d-cd29-4167-932c-1cf9eb49048c"
          ]
        },
        {
          "uuid": "f1e6caa4-0df8-4db4-aafb-c213b2ef7fa8",
          "code": "m3549",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3549?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d15b400d-cd29-4167-932c-1cf9eb49048c"
          ]
        },
        {
          "uuid": "dcea3a34-104f-4a15-b54a-b0b2951854a8",
          "code": "CHEMBL511115",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL511115",
          "code_system": "ChEMBL",
          "references": [
            "d15b400d-cd29-4167-932c-1cf9eb49048c"
          ]
        },
        {
          "uuid": "bdaddee0-b5d8-4a68-b2fe-a8686ad7527e",
          "code": "151170",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/151170",
          "code_system": "PUBCHEM",
          "references": [
            "d15b400d-cd29-4167-932c-1cf9eb49048c"
          ]
        },
        {
          "uuid": "3efcb6fe-7ffb-5c7d-c5e5-ac023f83b20b",
          "code": "DTXSID6046686",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6046686",
          "code_system": "EPA CompTox",
          "references": [
            "e35bb7bf-bd91-429e-b7db-f6fed0eb89e5"
          ]
        },
        {
          "uuid": "6199e872-52f6-35d0-c733-a299912cfc12",
          "code": "C744",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Phosphodiesterase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C744",
          "code_system": "NCI_THESAURUS",
          "references": [
            "61d2a18e-ce78-557a-b732-58506ed718c1"
          ]
        },
        {
          "uuid": "502cec2c-7960-4ed4-b740-fba0254631be",
          "code": "8ATB1C1R6X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "01054ccd-53ab-46fb-1660-b7eb3077d007",
          "code": "DB03849",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB03849",
          "code_system": "DRUG BANK",
          "references": [
            "61d2a18e-ce78-557a-b732-58506ed718c1"
          ]
        },
        {
          "uuid": "9dc7bac9-e71b-5013-e06a-26843f22f162",
          "code": "JJ-16",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/JJ-16/relevant/1/",
          "code_system": "USAN",
          "references": [
            "d04a1ceb-810b-7f0c-0f61-923114e7d054"
          ]
        },
        {
          "uuid": "02f16bc5-e289-1f4a-06c0-c800e87500a6",
          "code": "100000092735",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8a75343d-9b9b-0a8b-9db2-2cd6222cffb4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "02e822fc-96ad-4d96-a021-9871733872e4",
          "amount": {
            "uuid": "b97087c3-0011-45a9-9b69-0cd1fe4f0d95"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "edfd9fad-74a9-402e-b7e1-dd946e7807d2",
            "refuuid": "f3b68549-bdd7-49f0-9de7-f14d6b3b875b",
            "name": "CILOMILAST",
            "unii": "8ATB1C1R6X",
            "linking_id": "8ATB1C1R6X",
            "ref_pname": "CILOMILAST",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c5c70bf5-00be-4edb-a438-44102ac74587",
          "name": "ARIFLO",
          "stdName": "ARIFLO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d823b53b-7fce-49ef-b0f1-af783b506853",
            "4d5275fd-d545-494a-b947-3c58d1fc0e26"
          ],
          "display_name": false
        },
        {
          "uuid": "7811bdb3-6bf9-43bf-ad8c-a89fb179946a",
          "name": "CILOMILAST",
          "stdName": "CILOMILAST",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dcf4c3ba-b761-4e9c-b07b-2b4d9253768e",
            "15f53917-4dfe-4e60-b2d3-5144f934142f",
            "bc8f36c6-58ea-4ded-9b02-1ae702e32d6f",
            "e7452503-b189-4abc-b72a-fb9a642c6bc8",
            "d69f5112-1d2d-4995-8497-058cd9a85b77",
            "5c644a1c-e397-43f4-8967-4c1136d68f1a",
            "97f1eebf-423f-409e-bc4e-7a5918fe1f2c",
            "df28aa52-ec43-4bd5-b557-4daa82da75f1",
            "512baabc-98b5-4e98-922e-a37038b94d59",
            "d823b53b-7fce-49ef-b0f1-af783b506853",
            "c964d605-18a9-47b5-9965-6bf2632a0f9c",
            "9f6ee63f-d377-47a4-a101-937973e2364c",
            "77504fc9-1eea-4386-b69d-3411a37f08a5",
            "dd4693d4-63f1-40ce-abd7-0a66f380cab9",
            "fe9069fa-7a39-42d0-af6f-ebb812dcc2d5"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "a4ee0679-bca7-4f26-bc68-8dadffa6954e",
              "name_org": "USAN"
            },
            {
              "uuid": "a67bdfa7-e92c-480a-be21-c9fec52887c5",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "d3260494-32ce-4953-991f-232aa3ad7220",
          "name": "CILOMILAST [JAN]",
          "stdName": "CILOMILAST [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d823b53b-7fce-49ef-b0f1-af783b506853"
          ],
          "display_name": false
        },
        {
          "uuid": "14fe8b24-fafc-4e22-8623-a7c755861602",
          "name": "CILOMILAST [MART.]",
          "stdName": "CILOMILAST [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd4693d4-63f1-40ce-abd7-0a66f380cab9"
          ],
          "display_name": false
        },
        {
          "uuid": "3ea7893b-e5be-4de8-a436-c2bb40d326a7",
          "name": "CILOMILAST [MI]",
          "stdName": "CILOMILAST [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7452503-b189-4abc-b72a-fb9a642c6bc8"
          ],
          "display_name": false
        },
        {
          "uuid": "89a4531a-692c-425e-9704-e151917217f8",
          "name": "CILOMILAST [USAN]",
          "stdName": "CILOMILAST [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77504fc9-1eea-4386-b69d-3411a37f08a5"
          ],
          "display_name": false
        },
        {
          "uuid": "a7be0b41-aece-4dac-a34b-b11c0845c5ea",
          "name": "CILOMILAST [VANDF]",
          "stdName": "CILOMILAST [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dcf4c3ba-b761-4e9c-b07b-2b4d9253768e"
          ],
          "display_name": false
        },
        {
          "uuid": "ba1a46d8-d4da-4589-b9af-1590caa35a65",
          "name": "CIS-4-CYANO-4-(3-(CYCLOPENTYLOXY)-4-METHOXYPHENYL)CYCLOHEXANECARBOXYLIC ACID",
          "stdName": "CIS-4-CYANO-4-(3-(CYCLOPENTYLOXY)-4-METHOXYPHENYL)CYCLOHEXANECARBOXYLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0eb998f-86c6-462a-82cb-af6a6da3511f"
          ],
          "display_name": false
        },
        {
          "uuid": "b2902df0-2e42-db26-8fc1-0e830a41e71c",
          "name": "Cilomilast [WHO-DD]",
          "stdName": "CILOMILAST [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d9cdeef-afa3-3bec-8db9-334c0c818f54"
          ],
          "display_name": false
        },
        {
          "uuid": "b8b08219-f9a9-4b07-a4e7-f27459ae911c",
          "name": "SB-207499",
          "stdName": "SB-207499",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "05a7edd3-fd82-43aa-b0fe-fd22fdaca44d"
          ],
          "display_name": false
        },
        {
          "uuid": "5854a522-4352-4859-a542-889538845032",
          "name": "SB207499",
          "stdName": "SB207499",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0eb998f-86c6-462a-82cb-af6a6da3511f"
          ],
          "display_name": false
        },
        {
          "uuid": "12e31277-535d-4e15-8997-f39aa495aa9f",
          "name": "cilomilast [INN]",
          "stdName": "CILOMILAST [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c644a1c-e397-43f4-8967-4c1136d68f1a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "05a7edd3-fd82-43aa-b0fe-fd22fdaca44d",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "15f53917-4dfe-4e60-b2d3-5144f934142f",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0eb998f-86c6-462a-82cb-af6a6da3511f",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77504fc9-1eea-4386-b69d-3411a37f08a5",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c644a1c-e397-43f4-8967-4c1136d68f1a",
          "citation": "INN Proposed List 82",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL82.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d823b53b-7fce-49ef-b0f1-af783b506853",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd4693d4-63f1-40ce-abd7-0a66f380cab9",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7452503-b189-4abc-b72a-fb9a642c6bc8",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4d5275fd-d545-494a-b947-3c58d1fc0e26",
          "citation": "D01704",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "512baabc-98b5-4e98-922e-a37038b94d59",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dcf4c3ba-b761-4e9c-b07b-2b4d9253768e",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9037249-b380-42b8-8476-44c8ff33967c",
          "citation": "http://dryeyedigest.",
          "url": "http://dryeyedigest.",
          "doc_type": "CLINICALTRIALS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d15b400d-cd29-4167-932c-1cf9eb49048c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390290000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2714f3a6-f963-488a-97b4-a39bba877341",
          "citation": "SRS import [8ATB1C1R6X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8ATB1C1R6X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390290000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97f1eebf-423f-409e-bc4e-7a5918fe1f2c",
          "citation": "CILOMILAST [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "df28aa52-ec43-4bd5-b557-4daa82da75f1",
          "citation": "CILOMILAST [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d69f5112-1d2d-4995-8497-058cd9a85b77",
          "citation": "CILOMILAST [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bc8f36c6-58ea-4ded-9b02-1ae702e32d6f",
          "citation": "CILOMILAST [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9f6ee63f-d377-47a4-a101-937973e2364c",
          "citation": "CILOMILAST [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fe9069fa-7a39-42d0-af6f-ebb812dcc2d5",
          "citation": "CILOMILAST [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c964d605-18a9-47b5-9965-6bf2632a0f9c",
          "citation": "CILOMILAST [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e35bb7bf-bd91-429e-b7db-f6fed0eb89e5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=153259-65-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8a75343d-9b9b-0a8b-9db2-2cd6222cffb4",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "61d2a18e-ce78-557a-b732-58506ed718c1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3e32f804-024e-47bf-8f52-7b27953139c6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d04a1ceb-810b-7f0c-0f61-923114e7d054",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "5d9cdeef-afa3-3bec-8db9-334c0c818f54",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "00555026-97fb-4a1c-992a-ceee09f17ae6",
          "id": "00555026-97fb-4a1c-992a-ceee09f17ae6",
          "molfile": "\n  Marvin  01132100202D          \n\n 25 27  0  0  0  0            999 V2000\n   -4.9375   -7.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5208   -7.0083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6958   -7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2833   -7.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4583   -7.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0458   -7.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4542   -6.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2792   -6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6875   -5.5833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5125   -5.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0000   -6.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7833   -5.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7792   -5.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.9917   -4.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2208   -7.0292    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -1.2208   -6.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5125   -5.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2000   -6.2042    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.2000   -7.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5125   -7.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9167   -5.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9208   -4.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6292   -6.2083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6375   -7.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0583   -8.4542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  8  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n 15  6  1  1  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 14 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 20 15  1  0  0  0  0\n 15 24  1  6  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 21  1  6  0  0  0\n 19 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 21  2  0  0  0  0\n 25 24  3  0  0  0  0\nM  END",
          "smiles": "COc1ccc(cc1OC2CCCC2)[C@]3(CC[C@@H](CC3)C(=O)O)C#N",
          "formula": "C20H25NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "83166883-1bbd-4845-b421-a85507a50dcb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "343.4176",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f3b68549-bdd7-49f0-9de7-f14d6b3b875b",
      "version": "17",
      "structure": {
        "id": "213dae72-ddf5-46e6-bf10-500f3c644680",
        "molfile": "\n  Marvin  01132101532D          \n\n 25 27  0  0  1  0            999 V2000\n   -1.2208   -7.0292    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -3.2792   -6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0583   -8.4542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0458   -7.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6375   -7.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9167   -5.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4542   -6.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6875   -5.5833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6958   -7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2000   -6.2042    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.5125   -7.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2208   -6.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9208   -4.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4583   -7.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2833   -7.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5125   -5.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2000   -7.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6292   -6.2083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5125   -5.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5208   -7.0083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.9375   -7.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.9917   -4.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0000   -6.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7833   -5.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7792   -5.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  0  0  0  0\n  3  5  3  0  0  0  0\n  1  4  1  1  0  0  0\n  1  5  1  6  0  0  0\n 10  6  1  6  0  0  0\n  7  4  2  0  0  0  0\n  8  2  1  0  0  0  0\n  9 15  1  0  0  0  0\n 10 17  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13  6  2  0  0  0  0\n 14  4  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 12  1  0  0  0  0\n 17 11  1  0  0  0  0\n 18  6  1  0  0  0  0\n 19  8  1  0  0  0  0\n 20  9  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 19  1  0  0  0  0\n 23 19  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 22  1  0  0  0  0\n 16 10  1  0  0  0  0\n  9  2  2  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
        "smiles": "COc1ccc(cc1OC2CCCC2)[C@]3(CC[C@@H](CC3)C(=O)O)C#N",
        "formula": "C20H25NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "343.4176",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "2714f3a6-f963-488a-97b4-a39bba877341",
          "15f53917-4dfe-4e60-b2d3-5144f934142f",
          "5c644a1c-e397-43f4-8967-4c1136d68f1a"
        ],
        "stereo_centers": 0
      },
      "unii": "8ATB1C1R6X"
    }
  ]
}