{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "da7ef580-f809-4b20-a10a-cb487ef6c418",
          "code": "4075-81-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4075-81-4",
          "code_system": "CAS",
          "references": [
            "aa0226d2-71b2-43ac-afe5-bc40dd0b08b7",
            "af8570e2-d6e1-4043-bc25-f80958ae201d"
          ]
        },
        {
          "uuid": "8b2b8283-1cab-421f-aa63-79d54c855145",
          "code": "CALCIUM PROPANOATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Calcium_propanoate",
          "code_system": "WIKIPEDIA",
          "references": [
            "aa0226d2-71b2-43ac-afe5-bc40dd0b08b7"
          ]
        },
        {
          "uuid": "b58df19a-e3af-4bee-b626-1cfc993432cc",
          "code": "21 CFR 184.1221",
          "comments": "PART 184 -- DIRECT FOOD SUBSTANCES AFFIRMED AS GENERALLY RECOGNIZED AS SAFE|Subpart B--Listing of Specific Substances Affirmed as GRAS|Sec. 184.1221 Calcium propionate",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=184.1221",
          "code_system": "CFR",
          "references": [
            "aa0226d2-71b2-43ac-afe5-bc40dd0b08b7"
          ]
        },
        {
          "uuid": "16967dbf-d077-41b7-b6b7-fbce0ed39652",
          "code": "77701",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1683",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "aa0226d2-71b2-43ac-afe5-bc40dd0b08b7"
          ]
        },
        {
          "uuid": "4e3e4469-05f2-4ef0-b0dc-8fcc7185802b",
          "code": "INS-282",
          "comments": "Codex Alimentarius|Functional Classification|PRESERVATIVE",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=306",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "aa0226d2-71b2-43ac-afe5-bc40dd0b08b7"
          ]
        },
        {
          "uuid": "94a13571-3044-49f5-a478-a9005e36c064",
          "code": "INS-282",
          "comments": "JECFA|Functional Classification|PRESERVATIVE",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=282",
          "code_system": "JECFA EVALUATION",
          "references": [
            "aa0226d2-71b2-43ac-afe5-bc40dd0b08b7"
          ]
        },
        {
          "uuid": "277138bf-c1bf-4e0f-9872-bc6e4058323b",
          "code": "1426453",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426453/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "aa0226d2-71b2-43ac-afe5-bc40dd0b08b7"
          ]
        },
        {
          "uuid": "ff147f48-41be-4f5d-8a1a-a0b72f344bfa",
          "code": "m2970",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2970?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "aa0226d2-71b2-43ac-afe5-bc40dd0b08b7"
          ]
        },
        {
          "uuid": "b4c639d6-aaff-4fc7-a86c-3eae99d99f05",
          "code": "SUB13196MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "aa0226d2-71b2-43ac-afe5-bc40dd0b08b7"
          ]
        },
        {
          "uuid": "5820a27c-a401-4e89-958b-143070c7334b",
          "code": "223-795-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.633",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "aa0226d2-71b2-43ac-afe5-bc40dd0b08b7"
          ]
        },
        {
          "uuid": "c48862d5-5923-c822-df33-9202feddf9a5",
          "code": "907",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/907",
          "code_system": "HSDB",
          "references": [
            "b7e76a51-28d5-111e-0dd3-6462398305f6"
          ]
        },
        {
          "uuid": "78e4bb56-9607-f64d-f6c0-84f7d109521a",
          "code": "DTXSID1027556",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1027556",
          "code_system": "EPA CompTox",
          "references": [
            "11fb42c5-f117-edbf-f911-fec807939fe1"
          ]
        },
        {
          "uuid": "c622fcb8-d908-3084-9f4b-f6175ea938c2",
          "code": "19999",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19999",
          "code_system": "PUBCHEM",
          "references": [
            "dc0b12c7-7412-aa61-3d4d-903938ec37fe"
          ]
        },
        {
          "uuid": "c902b030-b7cb-4888-8d17-cef628513b37",
          "code": "8AI80040KW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a2815b2c-8c42-8f72-4748-b93f2479a45b",
          "code": "100000076594",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "42e9b7da-a474-b1c2-6342-04f5e140a71f"
          ]
        },
        {
          "uuid": "7269f808-8e9e-d27d-fc66-f6cd88e7e5f5",
          "code": "8AI80040KW",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8AI80040KW",
          "code_system": "DAILYMED",
          "references": [
            "243dfc53-f44a-aaee-5da3-2203dc5e1377"
          ]
        },
        {
          "uuid": "81f81b5d-bdb7-8fe1-8451-c94d5f4b1d93",
          "code": "786",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=786",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "c981a8cc-2098-dbcf-3b69-55df889e347b"
          ]
        },
        {
          "uuid": "ba831eca-8d27-0609-994a-9479c7bdbbc0",
          "code": "157",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=157",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "c981a8cc-2098-dbcf-3b69-55df889e347b"
          ]
        },
        {
          "uuid": "e939eac6-c182-7c52-7c9f-d60a8fb4f37f",
          "code": "1087053",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1087053",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "e38167a9-fe29-453e-b56f-248b1a6c09e8"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d372b9b4-a3ac-4075-91e3-cc5272a2c0b4",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "88ff33e4-4052-4a4f-9b23-e3ec6915a426",
            "refuuid": "bae1091a-e5ae-4539-9a5d-88eec57d73aa",
            "name": "Propionic acid",
            "unii": "JHU490RVYR",
            "linking_id": "JHU490RVYR",
            "ref_pname": "Propionic acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "02f10551-412c-47b2-ae0c-f850fbb5b736",
          "name": "CALCIUM PROPANOATE",
          "stdName": "CALCIUM PROPANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b01f1575-b465-4eff-b093-41359c791a21",
            "73bb50c7-9909-4cff-b619-ed69913825a0"
          ],
          "display_name": false
        },
        {
          "uuid": "27287ef7-5500-4fb0-a411-e12ed1d6d1fe",
          "name": "CALCIUM PROPIONATE",
          "stdName": "CALCIUM PROPIONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "915efc29-516e-4129-b591-050291272c40",
            "4e651af2-6bec-4318-b551-39399bcc0cc7",
            "5360af77-1708-4aa9-8d0c-82280818ccbd",
            "24337e57-401c-4f51-b4c8-a001ae36df06",
            "aa413fa3-59f1-4802-a3c0-ddedda1613ad",
            "b01f1575-b465-4eff-b093-41359c791a21",
            "efbc4181-cf4d-4df7-8cd9-88c0c13de287",
            "3be7ef1c-9232-43e3-a3de-aabef1b0d6b5",
            "9081801b-275f-4a1e-8cd9-b64d4ec57c1d",
            "cca4aa05-fadf-4f50-8209-8b56b093072b",
            "699aca01-75f3-41f5-b6d3-3068c44b1690",
            "516b6afa-12a5-4b49-ac32-b30cbbdcab1a",
            "e5b25d58-8727-4227-9051-07ebac94c9fb",
            "73bb50c7-9909-4cff-b619-ed69913825a0"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4545609d-26be-429c-b656-5bb00ef3e4b3",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1e8f0794-4df3-446b-a58b-29f8ff015d92",
          "name": "CALCIUM PROPIONATE (E 282)",
          "stdName": "CALCIUM PROPIONATE (E 282)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc802aec-da9a-4031-93f9-a9c93b6c879f",
            "73bb50c7-9909-4cff-b619-ed69913825a0"
          ],
          "display_name": false
        },
        {
          "uuid": "f36903ea-97c6-4692-b3ea-9e79b5babcc0",
          "name": "CALCIUM PROPIONATE [FCC]",
          "stdName": "CALCIUM PROPIONATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b01f1575-b465-4eff-b093-41359c791a21",
            "73bb50c7-9909-4cff-b619-ed69913825a0"
          ],
          "display_name": false
        },
        {
          "uuid": "8d0f0852-84dc-4569-a15c-9411d02a1be9",
          "name": "CALCIUM PROPIONATE [HSDB]",
          "stdName": "CALCIUM PROPIONATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cca4aa05-fadf-4f50-8209-8b56b093072b",
            "73bb50c7-9909-4cff-b619-ed69913825a0"
          ],
          "display_name": false
        },
        {
          "uuid": "25a65d8c-22ff-4a50-b58c-4adde45285ef",
          "name": "CALCIUM PROPIONATE [MART.]",
          "stdName": "CALCIUM PROPIONATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "915efc29-516e-4129-b591-050291272c40"
          ],
          "display_name": false
        },
        {
          "uuid": "d866c1b5-4030-4373-978f-a2d7a3631824",
          "name": "CALCIUM PROPIONATE [MI]",
          "stdName": "CALCIUM PROPIONATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24337e57-401c-4f51-b4c8-a001ae36df06",
            "73bb50c7-9909-4cff-b619-ed69913825a0"
          ],
          "display_name": false
        },
        {
          "uuid": "1a197940-430f-576f-eee0-093da32e19ef",
          "name": "Ca-PROPIONATE",
          "stdName": "CA-PROPIONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e2ddaea-030a-1094-a0eb-73c963ba56cb"
          ],
          "display_name": false
        },
        {
          "uuid": "27db914d-da65-f0dc-323a-676a0b8a1608",
          "name": "Calcium propionate [WHO-DD]",
          "stdName": "CALCIUM PROPIONATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "981144a6-6873-7f86-1ba2-28a161ffcb0a"
          ],
          "display_name": false
        },
        {
          "uuid": "cb1ec3fb-b612-4be8-a4da-0f179064d6ae",
          "name": "E-282",
          "stdName": "E-282",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a739e86-6ae0-4c9f-ac21-7fda1e6f674a",
            "73bb50c7-9909-4cff-b619-ed69913825a0"
          ],
          "display_name": false
        },
        {
          "uuid": "ff7f3a5a-1e88-4db7-9b5b-8f77c63160cc",
          "name": "INS NO.282",
          "stdName": "INS NO.282",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a739e86-6ae0-4c9f-ac21-7fda1e6f674a",
            "73bb50c7-9909-4cff-b619-ed69913825a0"
          ],
          "display_name": false
        },
        {
          "uuid": "d809ac71-0812-458b-88dd-12f9fb23e7d4",
          "name": "INS-282",
          "stdName": "INS-282",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a739e86-6ae0-4c9f-ac21-7fda1e6f674a",
            "73bb50c7-9909-4cff-b619-ed69913825a0"
          ],
          "display_name": false
        },
        {
          "uuid": "92095e81-fd18-4162-91e0-ec5ed19f43a5",
          "name": "PROPANOIC ACID, CALCIUM SALT",
          "stdName": "PROPANOIC ACID, CALCIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81216e4e-fbad-467e-95cc-a4acb22aa3a9",
            "73bb50c7-9909-4cff-b619-ed69913825a0"
          ],
          "display_name": false
        },
        {
          "uuid": "078c7324-07b3-46c4-a54c-7db1bc840a55",
          "name": "PROPANOIC ACID, CALCIUM SALT (2:1)",
          "stdName": "PROPANOIC ACID, CALCIUM SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81216e4e-fbad-467e-95cc-a4acb22aa3a9",
            "73bb50c7-9909-4cff-b619-ed69913825a0"
          ],
          "display_name": false
        },
        {
          "uuid": "6b65beee-35c1-4352-b2f2-11f1cdcd7429",
          "name": "PROPIONIC ACID, CALCIUM SALT",
          "stdName": "PROPIONIC ACID, CALCIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81216e4e-fbad-467e-95cc-a4acb22aa3a9",
            "73bb50c7-9909-4cff-b619-ed69913825a0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b01f1575-b465-4eff-b093-41359c791a21",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "efbc4181-cf4d-4df7-8cd9-88c0c13de287",
          "citation": "OTC",
          "doc_type": "USP FOOD CHEMICALS CODEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73bb50c7-9909-4cff-b619-ed69913825a0",
          "citation": "USP FOOD CHEMICALS CODEX",
          "doc_type": "USP FOOD CHEMICALS CODEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81216e4e-fbad-467e-95cc-a4acb22aa3a9",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "915efc29-516e-4129-b591-050291272c40",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24337e57-401c-4f51-b4c8-a001ae36df06",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9081801b-275f-4a1e-8cd9-b64d4ec57c1d",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cca4aa05-fadf-4f50-8209-8b56b093072b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "516b6afa-12a5-4b49-ac32-b30cbbdcab1a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc802aec-da9a-4031-93f9-a9c93b6c879f",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a739e86-6ae0-4c9f-ac21-7fda1e6f674a",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=306",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=306",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa0226d2-71b2-43ac-afe5-bc40dd0b08b7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389702000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dce0acc7-8392-4d07-85a9-32785ae74fe4",
          "citation": "SRS import [8AI80040KW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8AI80040KW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389702000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3be7ef1c-9232-43e3-a3de-aabef1b0d6b5",
          "citation": "CALCIUM PROPIONATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "699aca01-75f3-41f5-b6d3-3068c44b1690",
          "citation": "CALCIUM PROPIONATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4e651af2-6bec-4318-b551-39399bcc0cc7",
          "citation": "CALCIUM PROPIONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e5b25d58-8727-4227-9051-07ebac94c9fb",
          "citation": "CALCIUM PROPIONATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aa413fa3-59f1-4802-a3c0-ddedda1613ad",
          "citation": "CALCIUM PROPIONATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5360af77-1708-4aa9-8d0c-82280818ccbd",
          "citation": "CALCIUM PROPIONATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "11fb42c5-f117-edbf-f911-fec807939fe1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4075-81-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b7e76a51-28d5-111e-0dd3-6462398305f6",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+4075-81-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2e2ddaea-030a-1094-a0eb-73c963ba56cb",
          "citation": "NCT04019951",
          "url": "https://clinicaltrials.gov/ct2/show/NCT04019951",
          "doc_type": "CLINICAL_TRIALS.GOV",
          "public_domain": true
        },
        {
          "uuid": "c981a8cc-2098-dbcf-3b69-55df889e347b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "af8570e2-d6e1-4043-bc25-f80958ae201d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "dc0b12c7-7412-aa61-3d4d-903938ec37fe",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "e38167a9-fe29-453e-b56f-248b1a6c09e8",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "243dfc53-f44a-aaee-5da3-2203dc5e1377",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "981144a6-6873-7f86-1ba2-28a161ffcb0a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "42e9b7da-a474-b1c2-6342-04f5e140a71f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d9cecbae-be08-4d57-9cb8-73437c591ba9",
          "id": "d9cecbae-be08-4d57-9cb8-73437c591ba9",
          "molfile": "\n  Marvin  01132111182D          \n\n  1  0  0  0  0  0            999 V2000\n    2.5752  -11.8596    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "70f7e97e-ec80-44da-a77e-8efae8c5a745"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "fca952b1-48b3-4b31-8203-a0f59229e3a8",
          "id": "fca952b1-48b3-4b31-8203-a0f59229e3a8",
          "molfile": "\n  Marvin  01132113052D          \n\n  5  4  0  0  0  0            999 V2000\n   -0.5227  -12.0729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2033  -12.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8907  -12.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6111  -12.4669    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.8925  -11.2371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "CCC(=O)[O-]",
          "formula": "C3H5O2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "acc816ca-2519-4fc5-9565-57794700fc0c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "73.0707",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0addb9d8-99b4-4bfb-be59-e69cc3840b00",
      "version": "16",
      "structure": {
        "id": "5360905d-480c-4a05-b8b3-937cf521fc00",
        "molfile": "\n  Marvin  01132104202D          \n\n 11  8  0  0  0  0            999 V2000\n    0.8907  -12.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6111  -12.4669    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.8925  -11.2371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2033  -12.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5227  -12.0729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5752  -11.8596    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n    0.8907  -12.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6111  -12.4669    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.8925  -11.2371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2033  -12.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5227  -12.0729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n 10  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 11 10  1  0  0  0  0\nM  CHG  3   2  -1   6   2   8  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 10   1   2   3   4   5   7   8   9  10  11\nM  SPA   1  5   1   2   3   4   5\nM  SDI   1  4   -0.9427  -12.9025   -0.9427  -10.8171\nM  SDI   1  4    2.0311  -10.8171    2.0311  -12.9025\nM  SMT   1 2\nM  END",
        "smiles": "CCC(=O)[O-].CCC(=O)[O-].[Ca+2]",
        "formula": "2C3H5O2.Ca",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "186.2195",
        "optical_activity": "NONE",
        "references": [
          "dce0acc7-8392-4d07-85a9-32785ae74fe4",
          "b01f1575-b465-4eff-b093-41359c791a21"
        ],
        "stereo_centers": 0
      },
      "unii": "8AI80040KW"
    }
  ]
}