{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cb6a8daf-46c2-4db5-992c-c0bb3d209e29",
          "code": "2244-21-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2244-21-5",
          "code_system": "CAS",
          "references": [
            "eadb750f-47d1-4877-bbc7-b9e68b132719",
            "5feba5bf-8998-4bde-8a9b-166885252137"
          ]
        },
        {
          "uuid": "7e8a3e47-01f8-4cd4-be37-f1df6b705905",
          "code": "SUB11330MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "eadb750f-47d1-4877-bbc7-b9e68b132719"
          ]
        },
        {
          "uuid": "267ea279-1093-411d-9b55-d98526449da4",
          "code": "81403",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3518",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "eadb750f-47d1-4877-bbc7-b9e68b132719"
          ]
        },
        {
          "uuid": "d241b2ef-e5a4-4c2b-af6e-9de1eb7a850e",
          "code": "1772",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1772",
          "code_system": "INN",
          "references": [
            "eadb750f-47d1-4877-bbc7-b9e68b132719"
          ]
        },
        {
          "uuid": "c8cccbb1-bbbb-4df6-94ca-eb62fc2a0bab",
          "code": "m11216",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11216?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "eadb750f-47d1-4877-bbc7-b9e68b132719"
          ]
        },
        {
          "uuid": "3f95c00f-0b77-414e-943e-3a5374f5ede7",
          "code": "CHEMBL2111065",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2111065",
          "code_system": "ChEMBL",
          "references": [
            "eadb750f-47d1-4877-bbc7-b9e68b132719"
          ]
        },
        {
          "uuid": "93c35b42-228d-4209-8195-aa1ad518f83a",
          "code": "218-828-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.118",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "eadb750f-47d1-4877-bbc7-b9e68b132719"
          ]
        },
        {
          "uuid": "715f6403-55e3-cc7e-0b32-123a58ab77ef",
          "code": "5871",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5871",
          "code_system": "HSDB",
          "references": [
            "57f97d39-9acf-b8e1-a5c0-5982b119150d"
          ]
        },
        {
          "uuid": "e08ba026-6751-7f88-7efc-dd7b152428a4",
          "code": "DTXSID5026178",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5026178",
          "code_system": "EPA CompTox",
          "references": [
            "77b294a3-314c-3b41-e70a-64c67e2e88ed"
          ]
        },
        {
          "uuid": "d962dac3-f9ad-2a75-91e5-a5d957f42c3d",
          "code": "C152756",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C152756",
          "code_system": "NCI_THESAURUS",
          "references": [
            "126ce1d4-2677-ae86-ee3b-e2308955558c"
          ]
        },
        {
          "uuid": "af8779a6-6670-3304-1c04-5d70bc0d234d",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a342f97a-9c3b-76a3-e3d6-46e7c37d6662"
          ]
        },
        {
          "uuid": "f54fe69c-4f24-40c2-a737-df1c8955f267",
          "code": "8A85D111P0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0bafebaf-c0d7-ed39-517b-d15babd247c2",
          "code": "517106",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/517106",
          "code_system": "PUBCHEM",
          "references": [
            "645c280c-5382-c572-c1f9-28631cac5a90"
          ]
        },
        {
          "uuid": "f2873db0-995f-8e47-1be7-3a6a7744c486",
          "code": "100000076973",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c44719ee-bfda-9e6f-d654-fc8c2163daed"
          ]
        },
        {
          "uuid": "baa7102b-fee2-51fd-b1cb-8f639d801fde",
          "code": "251767",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=251767",
          "code_system": "NSC",
          "references": [
            "c60516c3-6a08-e92f-378d-2c8ff60ed8cb"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "5d4a62a6-32ff-486d-a633-6679a6cfb780",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a723b5d0-95fd-4404-87ae-8960c2a70067",
            "refuuid": "a352df83-d71c-49a6-bc78-18153e8d9b80",
            "name": "TROCLOSENE",
            "unii": "PHR838Y52L",
            "linking_id": "PHR838Y52L",
            "ref_pname": "TROCLOSENE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cb9130c6-1bae-46ac-8247-b8ff62a4b6fe",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "575bd827-17d3-4099-98e2-8fc020fc5c8f",
            "refuuid": "a352df83-d71c-49a6-bc78-18153e8d9b80",
            "name": "TROCLOSENE",
            "unii": "PHR838Y52L",
            "linking_id": "PHR838Y52L",
            "ref_pname": "TROCLOSENE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "53e30d70-f542-4625-a3b7-9b33c9ae1bbc",
          "name": "1,3,5-TRIAZINE-2,4,6(1H,3H,5H)-TRIONE, 1,3-DICHLORO-, POTASSIUM SALT",
          "stdName": "1,3,5-TRIAZINE-2,4,6(1H,3H,5H)-TRIONE, 1,3-DICHLORO-, POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f79d6b7-b94e-45bb-826d-0b3b86190997"
          ],
          "display_name": false
        },
        {
          "uuid": "924bee10-8284-4c0d-8965-77fb539b4f24",
          "name": "1,3-DICHLORO-S-TRIAZINE-2,4,6(1H,3H,5H)TRIONE POTASSIUM SALT",
          "stdName": "1,3-DICHLORO-S-TRIAZINE-2,4,6(1H,3H,5H)TRIONE POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f79d6b7-b94e-45bb-826d-0b3b86190997"
          ],
          "display_name": false
        },
        {
          "uuid": "d3a0e652-1972-4da1-9884-3656406e8c43",
          "name": "NSC-251767",
          "stdName": "NSC-251767",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f3e5a11-4745-4b59-9ae4-c0768bd61b81"
          ],
          "display_name": false
        },
        {
          "uuid": "52dce1e6-5ce4-4fdf-bda3-02002d3c60d7",
          "name": "POTASSIUM DICHLOROCYANURATE",
          "stdName": "POTASSIUM DICHLOROCYANURATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09074e62-32c8-4509-9216-c5f6630bf7f6"
          ],
          "display_name": false
        },
        {
          "uuid": "4c4d4bee-1e9a-4c6e-bc0d-72c9b75a426c",
          "name": "POTASSIUM DICHLOROISOCYANURATE",
          "stdName": "POTASSIUM DICHLOROISOCYANURATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f79d6b7-b94e-45bb-826d-0b3b86190997"
          ],
          "display_name": false
        },
        {
          "uuid": "943382ca-618d-4a0e-bb26-351657c53791",
          "name": "POTASSIUM TROCLOSENE",
          "stdName": "POTASSIUM TROCLOSENE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "db079eda-72f0-495a-a929-88635120be69",
            "94821845-df2e-43d7-b2d8-85be0e380431",
            "97566c97-63f3-46b7-9d5a-5691fd6fcc08"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "cf7280bf-ebb7-4310-bf85-7c60c917d93f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d8e0ab7b-8e34-440a-967f-f096d0985fcf",
          "name": "TROCLOSENE POTASSIUM",
          "stdName": "TROCLOSENE POTASSIUM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45c4b857-f93c-4c61-9e60-cbb0485035a9",
            "5e7c9f4d-215f-4c74-93c8-67c2e6c29ee4",
            "9905d5af-a26b-4fc0-8a29-a0def48ee425",
            "f25b05fb-94f4-4f6a-999a-dd73bf193eb6",
            "129aafac-70cd-421f-9649-1698bea6acdb",
            "5f79d6b7-b94e-45bb-826d-0b3b86190997",
            "695b977b-0139-4b2d-8ba3-5f1c38ddf306",
            "1a9558b0-dc49-4fc5-a426-b01d3edbb4f6",
            "d9331f8a-21e7-46a9-a119-b27ac1e13059",
            "4281241a-3fd1-4d69-9d17-6f6140c5ddb1",
            "2d9f6b25-1b9d-41ba-8de2-8db9fcfb857e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "fd55fc69-aad8-4457-b99c-22c5eb75f7b5",
              "name_org": "INN"
            },
            {
              "uuid": "6cbedd18-1d97-4210-8321-542843d84d22",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "fd8e6213-40a7-4a72-b967-26a66d96e97a",
          "name": "TROCLOSENE POTASSIUM [HSDB]",
          "stdName": "TROCLOSENE POTASSIUM [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45c4b857-f93c-4c61-9e60-cbb0485035a9"
          ],
          "display_name": false
        },
        {
          "uuid": "63d39ec9-e106-42b1-aa85-7e6bf6ebbd66",
          "name": "TROCLOSENE POTASSIUM [MART.]",
          "stdName": "TROCLOSENE POTASSIUM [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d9f6b25-1b9d-41ba-8de2-8db9fcfb857e"
          ],
          "display_name": false
        },
        {
          "uuid": "d5ce0334-2ab3-4b39-9844-48b25104ae1f",
          "name": "TROCLOSENE POTASSIUM [MI]",
          "stdName": "TROCLOSENE POTASSIUM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9331f8a-21e7-46a9-a119-b27ac1e13059"
          ],
          "display_name": false
        },
        {
          "uuid": "aad39b29-74e6-48be-a62e-0e8e2d2e8369",
          "name": "TROCLOSENE POTASSIUM [USAN]",
          "stdName": "TROCLOSENE POTASSIUM [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "129aafac-70cd-421f-9649-1698bea6acdb"
          ],
          "display_name": false
        },
        {
          "uuid": "7df1caac-2da9-4faf-9067-b78e9ba83faa",
          "name": "troclosene potassium [INN]",
          "stdName": "TROCLOSENE POTASSIUM [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4281241a-3fd1-4d69-9d17-6f6140c5ddb1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5f79d6b7-b94e-45bb-826d-0b3b86190997",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4281241a-3fd1-4d69-9d17-6f6140c5ddb1",
          "citation": "INN Proposed List 15",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL15.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "129aafac-70cd-421f-9649-1698bea6acdb",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d9f6b25-1b9d-41ba-8de2-8db9fcfb857e",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9331f8a-21e7-46a9-a119-b27ac1e13059",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97566c97-63f3-46b7-9d5a-5691fd6fcc08",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45c4b857-f93c-4c61-9e60-cbb0485035a9",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09074e62-32c8-4509-9216-c5f6630bf7f6",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db079eda-72f0-495a-a929-88635120be69",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f3e5a11-4745-4b59-9ae4-c0768bd61b81",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eadb750f-47d1-4877-bbc7-b9e68b132719",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390470000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ea217c3-86e5-4402-ad4e-ec3716d29e04",
          "citation": "SRS import [8A85D111P0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8A85D111P0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390470000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e7c9f4d-215f-4c74-93c8-67c2e6c29ee4",
          "citation": "TROCLOSENE POTASSIUM [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1a9558b0-dc49-4fc5-a426-b01d3edbb4f6",
          "citation": "TROCLOSENE POTASSIUM [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f25b05fb-94f4-4f6a-999a-dd73bf193eb6",
          "citation": "TROCLOSENE POTASSIUM [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "695b977b-0139-4b2d-8ba3-5f1c38ddf306",
          "citation": "TROCLOSENE POTASSIUM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "94821845-df2e-43d7-b2d8-85be0e380431",
          "citation": "POTASSIUM TROCLOSENE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9905d5af-a26b-4fc0-8a29-a0def48ee425",
          "citation": "TROCLOSENE POTASSIUM [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "645c280c-5382-c572-c1f9-28631cac5a90",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "5feba5bf-8998-4bde-8a9b-166885252137",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "57f97d39-9acf-b8e1-a5c0-5982b119150d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+2244-21-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "77b294a3-314c-3b41-e70a-64c67e2e88ed",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2244-21-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c44719ee-bfda-9e6f-d654-fc8c2163daed",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "126ce1d4-2677-ae86-ee3b-e2308955558c",
          "citation": "NCIT",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a342f97a-9c3b-76a3-e3d6-46e7c37d6662",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c60516c3-6a08-e92f-378d-2c8ff60ed8cb",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e8697fb8-21b2-4cbb-bcf4-1f77f5aa457f",
          "id": "e8697fb8-21b2-4cbb-bcf4-1f77f5aa457f",
          "molfile": "\n  Marvin  01132112022D          \n\n  1  0  0  0  0  0            999 V2000\n   10.0231   -3.9965    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "772218cb-ccb0-429f-9c2f-8cbb0f554572"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "c4e31307-1673-4a59-a6de-4ae6a702e9a6",
          "id": "c4e31307-1673-4a59-a6de-4ae6a702e9a6",
          "molfile": "\n  Marvin  01132110112D          \n\n 11 11  0  0  0  0            999 V2000\n    7.5143   -3.2508    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.7918   -3.6605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7918   -4.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5143   -4.8989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0827   -4.8989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3693   -4.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6513   -4.8989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3693   -3.6605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6513   -3.2508    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.0827   -3.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0827   -2.4177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 10  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  1  0  0  0  0\n 10 11  2  0  0  0  0\nM  END",
          "smiles": "c1(=O)[nH]c(=O)n(c(=O)n1Cl)Cl",
          "formula": "C3HCl2N3O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d618a3ce-9309-4b71-8e67-03bb811aa5de"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "197.9643",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e6b791bd-88a1-4167-8009-c1ee9c479340",
      "version": "12",
      "structure": {
        "id": "85b82b3f-7041-40bb-8111-37c26bf6c818",
        "molfile": "\n  Marvin  01132106562D          \n\n 12 11  0  0  0  0            999 V2000\n    6.0827   -3.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3693   -3.6605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3693   -4.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0827   -4.8989    0.0000 N   0  5  0  0  0  0  0  0  0  0  0  0\n    6.7918   -4.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7918   -3.6605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5143   -3.2508    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.5143   -4.8989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6513   -4.8989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6513   -3.2508    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.0827   -2.4177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0231   -3.9965    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  8  2  0  0  0  0\n  3  9  2  0  0  0  0\n  2 10  1  0  0  0  0\n  1 11  2  0  0  0  0\nM  CHG  2   4  -1  12   1\nM  END",
        "smiles": "c1(=O)[n-]c(=O)n(c(=O)n1Cl)Cl.[K+]",
        "formula": "C3Cl2N3O3.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "236.0547",
        "optical_activity": "NONE",
        "references": [
          "5ea217c3-86e5-4402-ad4e-ec3716d29e04",
          "5f79d6b7-b94e-45bb-826d-0b3b86190997",
          "4281241a-3fd1-4d69-9d17-6f6140c5ddb1"
        ],
        "stereo_centers": 0
      },
      "unii": "8A85D111P0"
    }
  ]
}