{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "57def1ac-d7c8-e80b-464b-819717ad11aa", "code": "1239578-31-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1239578-31-4", "code_system": "CAS", "references": [ "705f8d99-e345-4b13-9770-b137cde077ad" ] }, { "uuid": "05dc237d-3e68-e26e-48fc-c38c6a1773d5", "code": "137331912", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/137331912", "code_system": "PUBCHEM", "references": [ "19de5e30-f058-cd31-167d-22a7eb26d2de" ] }, { "uuid": "dae0030c-eff1-4f63-aa0b-75af30dd67c3", "code": "8A7BE0M39C", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "2be19c2c-cdfd-4eec-8e13-eb7ac2c93d86", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "43596832-eca1-4662-9a53-7dcb6c2aec63", "refuuid": "1ce85938-6e8e-42f8-9e4b-121ed77da14b", "name": "N-SUCCINYL-S-FARNESYL-L-CYSTEINE", "unii": "YG6MG94T7Z", "linking_id": "YG6MG94T7Z", "ref_pname": "N-SUCCINYL-S-FARNESYL-L-CYSTEINE" } } ], "substance_class": "chemical", "names": [ { "uuid": "646f393a-ee9b-d0a8-faed-6d3aabed2a70", "name": "BUTANOIC ACID, 4-(((1R)-1-CARBOXY-2-(((2E,6E)-3,7,11-TRIMETHYL-2,6,10-DODECATRIEN-1-YL)THIO)ETHYL)AMINO)-4-OXO-, SODIUM SALT (1:2)", "stdName": "BUTANOIC ACID, 4-(((1R)-1-CARBOXY-2-(((2E,6E)-3,7,11-TRIMETHYL-2,6,10-DODECATRIEN-1-YL)THIO)ETHYL)AMINO)-4-OXO-, SODIUM SALT (1:2)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2be0950f-e79c-68f9-0515-6d28b60f5d73" ], "display_name": false }, { "uuid": "7c317b42-ff02-ed28-aca4-ee30f2581c39", "name": "N-SUCCINYL-S-FARNESYL-L-CYSTEINE DISODIUM", "stdName": "N-SUCCINYL-S-FARNESYL-L-CYSTEINE DISODIUM", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c3a41faa-cec7-05cf-6b16-613e1084d8d1" ], "display_name": true } ], "references": [ { "uuid": "2be0950f-e79c-68f9-0515-6d28b60f5d73", "citation": "stn", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "c3a41faa-cec7-05cf-6b16-613e1084d8d1", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "19de5e30-f058-cd31-167d-22a7eb26d2de", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "705f8d99-e345-4b13-9770-b137cde077ad", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "23712ced-17e2-9f3a-f406-f6baea9a88ad", "id": "23712ced-17e2-9f3a-f406-f6baea9a88ad", "molfile": "\n Marvin 01132101592D \n\n 1 0 0 0 1 0 999 V2000\n 18.4507 -2.1810 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "7e9d35ce-a425-4538-9832-46972e83586f" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "b9f571ce-5ba0-ede9-92f9-83a9fcf22f13", "id": "b9f571ce-5ba0-ede9-92f9-83a9fcf22f13", "molfile": "\n Marvin 01132109372D \n\n 29 28 0 0 1 0 999 V2000\n 18.1333 -4.6210 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 17.4189 -5.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7044 -4.6210 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9899 -5.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2495 -4.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5351 -5.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5351 -5.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8206 -4.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1061 -5.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3918 -4.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6772 -5.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6772 -5.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9627 -4.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2482 -5.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5338 -4.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8194 -5.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8194 -5.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1049 -4.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8478 -5.0335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5623 -4.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5623 -3.7960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2768 -5.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9912 -4.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7056 -5.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7056 -5.8585 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 22.4201 -4.6210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1333 -3.7960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4189 -3.3835 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 18.8478 -3.3835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 19 1 1 0 0 0\n 1 27 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 24 2 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 2 0 0 0 0\nM CHG 2 25 -1 28 -1\nM END", "smiles": "CC(=CCC/C(=C/CC/C(=C/CSC[C@@H](C(=O)[O-])NC(=O)CCC(=O)[O-])/C)/C)C", "formula": "C22H33NO5S", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "cb27aa20-2d9b-4671-b5dc-6f8d5f12dada" }, "defined_stereo": 1, "ez_centers": 2, "molecular_weight": "423.568", "optical_activity": "UNSPECIFIED", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "f2a195d3-8e54-d039-0c2e-19d51d6ff442", "version": "8", "structure": { "id": "78c07caa-7a83-006c-331f-a33c1333f5e7", "molfile": "untitled.mol\n Marvin 01132106162D \n\n 31 28 0 0 1 0 999 V2000\n 18.1333 -3.7960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1333 -4.6210 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 18.8478 -5.0335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5623 -4.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5623 -3.7960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2768 -5.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9912 -4.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7056 -5.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7056 -5.8585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4201 -4.6210 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 17.4189 -5.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7044 -4.6210 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9899 -5.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2495 -4.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5351 -5.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5351 -5.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8206 -4.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1061 -5.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3918 -4.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6772 -5.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6772 -5.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9627 -4.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2482 -5.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5338 -4.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8194 -5.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8194 -5.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1049 -4.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4189 -3.3835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8478 -3.3835 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 18.4507 -2.1810 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 21.4519 -3.2784 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 8 1 0 0 0 0\n 2 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 1 0 0 0 0\n 1 28 2 0 0 0 0\n 1 29 1 0 0 0 0\nM CHG 4 10 -1 29 -1 30 1 31 1\nM END", "smiles": "CC(=CCC/C(=C/CC/C(=C/CSC[C@@H](C(=O)[O-])NC(=O)CCC(=O)[O-])/C)/C)C.[Na+].[Na+]", "formula": "C22H33NO5S.2Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 1, "ez_centers": 2, "molecular_weight": "469.5476", "optical_activity": "UNSPECIFIED", "references": [ "c3a41faa-cec7-05cf-6b16-613e1084d8d1" ], "stereo_centers": 1 }, "unii": "8A7BE0M39C" } ] }