{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e4a312c7-4d3f-4837-a3e2-58706b0dcf26",
          "code": "C63810",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C63810",
          "code_system": "NCI_THESAURUS",
          "references": [
            "93eb2363-b47d-4e9f-9a23-f011ac09d822"
          ]
        },
        {
          "uuid": "be975a6a-8a5c-447a-95e0-18fc40eea50c",
          "code": "GLUCURONIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Glucuronic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "93eb2363-b47d-4e9f-9a23-f011ac09d822"
          ]
        },
        {
          "uuid": "a1ea7593-8168-4829-ba74-66631531b1e8",
          "code": "6556-12-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6556-12-3",
          "code_system": "CAS",
          "references": [
            "93eb2363-b47d-4e9f-9a23-f011ac09d822",
            "9c6a8e79-8361-4fc1-b510-afc8f8de6e0c"
          ]
        },
        {
          "uuid": "a0c4f61d-0a6e-42c9-9ec4-981dd069e440",
          "code": "229-486-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.807",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "93eb2363-b47d-4e9f-9a23-f011ac09d822"
          ]
        },
        {
          "uuid": "373ab12c-5e94-4897-8543-4e11dabf282b",
          "code": "m5771",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5771?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "93eb2363-b47d-4e9f-9a23-f011ac09d822"
          ]
        },
        {
          "uuid": "b6c804fd-3f80-49c9-8725-162bd7f229d2",
          "code": "314584",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/314584/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "93eb2363-b47d-4e9f-9a23-f011ac09d822"
          ]
        },
        {
          "uuid": "ec62a587-0cd7-435a-a516-80780c9c9a45",
          "code": "1426906",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426906/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "93eb2363-b47d-4e9f-9a23-f011ac09d822"
          ]
        },
        {
          "uuid": "96ee7ea1-2f58-49f3-8945-4ad0b6145370",
          "code": "SUB13988MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "93eb2363-b47d-4e9f-9a23-f011ac09d822"
          ]
        },
        {
          "uuid": "16a54212-ecea-4e16-a717-c60b0488a278",
          "code": "65041",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/65041",
          "code_system": "PUBCHEM",
          "references": [
            "93eb2363-b47d-4e9f-9a23-f011ac09d822"
          ]
        },
        {
          "uuid": "54fc1764-7c74-008b-63e3-1439ef7c6332",
          "code": "DTXSID40273973",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40273973",
          "code_system": "EPA CompTox",
          "references": [
            "01e0c4ec-1b98-7d57-8aad-e5a6a35fa83d"
          ]
        },
        {
          "uuid": "8d918465-f333-8f86-05f4-3ed0fe06ffa5",
          "code": "C345",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Organic Oxoacids[C1947]|Carboxylic Acids",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C345",
          "code_system": "NCI_THESAURUS",
          "references": [
            "83e6fb10-cfa7-0c6e-abf1-eff01ddeb0d1"
          ]
        },
        {
          "uuid": "d545f2e3-efd3-aa20-87cc-23d2a9aabba5",
          "code": "3838 (Number of products:14)",
          "comments": "Dietary Supplement Label Database|chemical|Glucuronic acid",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3838&item=Glucuronic acid",
          "code_system": "DSLD",
          "references": [
            "83e6fb10-cfa7-0c6e-abf1-eff01ddeb0d1"
          ]
        },
        {
          "uuid": "8cc6a4d4-e69c-4044-a893-2dd37a2b06f9",
          "code": "8A5D83Q4RW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "efb6807e-9cdb-dd71-6161-2e2a20e78508",
          "code": "47953",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:47953",
          "code_system": "CHEBI",
          "references": [
            "83e6fb10-cfa7-0c6e-abf1-eff01ddeb0d1"
          ]
        },
        {
          "uuid": "3a17d05d-1823-6f4d-2bb5-ee170f40e37e",
          "code": "24298",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:24298",
          "code_system": "CHEBI",
          "references": [
            "83e6fb10-cfa7-0c6e-abf1-eff01ddeb0d1"
          ]
        },
        {
          "uuid": "d3584cfc-9996-6262-1d69-9868889a7823",
          "code": "42717",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:42717",
          "code_system": "CHEBI",
          "references": [
            "83e6fb10-cfa7-0c6e-abf1-eff01ddeb0d1"
          ]
        },
        {
          "uuid": "a2927e6b-45c2-b9d9-6854-1ed9b97eaa1e",
          "code": "4178",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4178",
          "code_system": "CHEBI",
          "references": [
            "83e6fb10-cfa7-0c6e-abf1-eff01ddeb0d1"
          ]
        },
        {
          "uuid": "367d2b46-a940-ccfc-a11e-af0d4755efd0",
          "code": "15748",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:15748",
          "code_system": "CHEBI",
          "references": [
            "83e6fb10-cfa7-0c6e-abf1-eff01ddeb0d1"
          ]
        },
        {
          "uuid": "dec58c19-d9e6-bda6-28ab-69173b03156e",
          "code": "47952",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:47952",
          "code_system": "CHEBI",
          "references": [
            "83e6fb10-cfa7-0c6e-abf1-eff01ddeb0d1"
          ]
        },
        {
          "uuid": "e0b7b88c-5409-e2db-013d-f8587eab2a74",
          "code": "24297",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:24297",
          "code_system": "CHEBI",
          "references": [
            "83e6fb10-cfa7-0c6e-abf1-eff01ddeb0d1"
          ]
        },
        {
          "uuid": "4cc1171b-1b31-735c-e1f3-f4d23c7029b8",
          "code": "1294319",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1294319",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "83e6fb10-cfa7-0c6e-abf1-eff01ddeb0d1"
          ]
        },
        {
          "uuid": "eddd4ec2-9392-5fc3-07e7-6f56fdcde7b5",
          "code": "100000078213",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7d21b16f-a75b-4a94-71ec-308c6ecfdeee"
          ]
        },
        {
          "uuid": "47e8ca39-b1e1-f7fa-c5c8-4129fc77bd50",
          "code": "8A5D83Q4RW",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8A5D83Q4RW",
          "code_system": "DAILYMED",
          "references": [
            "a2e40742-aa7e-1883-a86c-a107068005d0"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "62f998fb-1682-40ad-b5b6-d0a17cf9b722",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "e9b03f0b-7c77-4fd2-aaf6-65a80a79601d",
            "refuuid": "81215e36-8dc0-4aa1-8be0-ae610b2d3bc2",
            "name": "SODIUM GLUCURONATE",
            "unii": "631391W27S",
            "linking_id": "631391W27S",
            "ref_pname": "SODIUM GLUCURONATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7af8cf1c-623d-40d1-809b-093498026a3e",
          "amount": {
            "uuid": "f0218f83-8534-4d70-b7df-6b3c964f3965"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "5c0ca9c5-4842-46c3-8baa-f8c5b2e2b30a",
            "refuuid": "c1fbeb9d-ea93-42d1-bbf9-2c6f60c3c49c",
            "name": "DIOLAMINE GLUCURONATE",
            "unii": "QV7V2WC3TT",
            "linking_id": "QV7V2WC3TT",
            "ref_pname": "DIOLAMINE GLUCURONATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f9be7d36-0a53-4226-a8c3-9abc1cc6f6e5",
          "name": "D-(+)-GLUCURONIC ACID",
          "stdName": "D-(+)-GLUCURONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8bf51448-5c83-4853-8d47-8fe2837c78b2"
          ],
          "display_name": false
        },
        {
          "uuid": "89144a31-32d3-455a-b5fd-30cf1717126e",
          "name": "D-GLUCURONIC ACID",
          "stdName": "D-GLUCURONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48c60d2e-1e45-4bf8-b7fd-96f5cf08a833",
            "5ee6864c-4dbd-4520-b66e-c372713750c9",
            "af21514e-3a8e-400d-bed5-9e98fd8f70cf",
            "bae03294-aaba-4960-9b72-4542ea5b5a86",
            "8bf51448-5c83-4853-8d47-8fe2837c78b2",
            "b8cb422f-1ae8-44d5-949e-dd8f642f4692",
            "4166629d-970b-48df-86fa-7d4825665874"
          ],
          "display_name": false
        },
        {
          "uuid": "781c93eb-8d57-46d0-a1d9-06f457b0f468",
          "name": "D-GLUCURONIC ACID [MI]",
          "stdName": "D-GLUCURONIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4166629d-970b-48df-86fa-7d4825665874"
          ],
          "display_name": false
        },
        {
          "uuid": "f94f483c-9bf8-4dc4-9cb6-f5bff87d0dca",
          "name": "D-GLUCURONIC ACID [USP-RS]",
          "stdName": "D-GLUCURONIC ACID [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8cb422f-1ae8-44d5-949e-dd8f642f4692"
          ],
          "display_name": false
        },
        {
          "uuid": "801f002c-1b9d-4e93-b647-61c678c0b573",
          "name": "D-GLUCURONIC ACID [VANDF]",
          "stdName": "D-GLUCURONIC ACID [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af21514e-3a8e-400d-bed5-9e98fd8f70cf"
          ],
          "display_name": false
        },
        {
          "uuid": "8e6218b8-de01-44f9-95d2-085e79e20c43",
          "name": "GLUCOSIDURONIC ACID",
          "stdName": "GLUCOSIDURONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6078a84d-f295-4342-bf90-96e5667464c4"
          ],
          "display_name": false
        },
        {
          "uuid": "7fb0d493-38b5-4d93-926c-0e0de57e14ac",
          "name": "GLUCURONIC ACID",
          "stdName": "GLUCURONIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0799e1c0-0874-4e59-882e-53fc00a3b0a3",
            "214ced8a-85d1-4c78-a627-a2dd68a6ab21",
            "4ab7871a-6ea3-4b9d-99af-061da16dbf07",
            "eb160170-ef59-4613-be2a-5170710d4560",
            "0c34af15-63d5-4a0b-ad78-e3f6f0f614a5",
            "143aae95-1cce-4d0e-8aec-eb735397e0ab",
            "3449cec0-6e3b-47b3-95c0-14b53383aef7",
            "b1cbecf0-62e1-4cc8-99b1-dd05ed64b4d2"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6eeecc93-bcee-40f1-b4f0-d1b2b58eedbe",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "31ca85bd-8403-4687-9bef-3104b8e3a39e",
          "name": "GLUCURONIC ACID [II]",
          "stdName": "GLUCURONIC ACID [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0799e1c0-0874-4e59-882e-53fc00a3b0a3"
          ],
          "display_name": false
        },
        {
          "uuid": "d702c702-caf2-464d-b29e-c5f4c799ce30",
          "name": "GLUCURONIC ACID [MART.]",
          "stdName": "GLUCURONIC ACID [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb160170-ef59-4613-be2a-5170710d4560"
          ],
          "display_name": false
        },
        {
          "uuid": "76d39d33-eac8-4c01-a426-3bcf8b0aa69c",
          "name": "GLUCURONIC ACID, D-",
          "stdName": "GLUCURONIC ACID, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3556e031-990c-4455-8d6c-3406de86a443"
          ],
          "display_name": false
        },
        {
          "uuid": "7c62a4bb-4c4b-25bc-c01c-fa2843747f48",
          "name": "Glucuronic acid [WHO-DD]",
          "stdName": "GLUCURONIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fea21d95-67d5-6277-259e-f1744f672b9f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0799e1c0-0874-4e59-882e-53fc00a3b0a3",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8bf51448-5c83-4853-8d47-8fe2837c78b2",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6078a84d-f295-4342-bf90-96e5667464c4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb160170-ef59-4613-be2a-5170710d4560",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4166629d-970b-48df-86fa-7d4825665874",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "214ced8a-85d1-4c78-a627-a2dd68a6ab21",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8cb422f-1ae8-44d5-949e-dd8f642f4692",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3556e031-990c-4455-8d6c-3406de86a443",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c34af15-63d5-4a0b-ad78-e3f6f0f614a5",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af21514e-3a8e-400d-bed5-9e98fd8f70cf",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93eb2363-b47d-4e9f-9a23-f011ac09d822",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390909000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ee88fe5-da8c-4099-b9bf-28dc6af6fd39",
          "citation": "SRS import [8A5D83Q4RW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8A5D83Q4RW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390909000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1cbecf0-62e1-4cc8-99b1-dd05ed64b4d2",
          "citation": "GLUCURONIC ACID [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5ee6864c-4dbd-4520-b66e-c372713750c9",
          "citation": "D-GLUCURONIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4ab7871a-6ea3-4b9d-99af-061da16dbf07",
          "citation": "GLUCURONIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "143aae95-1cce-4d0e-8aec-eb735397e0ab",
          "citation": "GLUCURONIC ACID [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bae03294-aaba-4960-9b72-4542ea5b5a86",
          "citation": "D-GLUCURONIC ACID [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3449cec0-6e3b-47b3-95c0-14b53383aef7",
          "citation": "GLUCURONIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "48c60d2e-1e45-4bf8-b7fd-96f5cf08a833",
          "citation": "D-GLUCURONIC ACID [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "01e0c4ec-1b98-7d57-8aad-e5a6a35fa83d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6556-12-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7d21b16f-a75b-4a94-71ec-308c6ecfdeee",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "83e6fb10-cfa7-0c6e-abf1-eff01ddeb0d1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "902a1ac9-7361-be88-29b9-801c24ab367d",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "9c6a8e79-8361-4fc1-b510-afc8f8de6e0c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fea21d95-67d5-6277-259e-f1744f672b9f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a2e40742-aa7e-1883-a86c-a107068005d0",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "090429b3-165a-4605-b690-0f904534aca0",
          "id": "090429b3-165a-4605-b690-0f904534aca0",
          "molfile": "\n  Marvin  01132100442D          \n\n 13 12  0  0  1  0            999 V2000\n    5.5414   -3.2505    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.5414   -2.4255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2558   -3.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9703   -3.2505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8269   -3.6630    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.8269   -4.4880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1125   -3.2505    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.1125   -2.4255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3980   -3.6630    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.3980   -4.4880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6835   -3.2505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9691   -3.6630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6835   -2.4255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  1  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  END",
          "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O)O)O)O",
          "formula": "C6H10O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8bba42f5-ccbf-4aa6-96e7-7cb43dac0dfc"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "194.1397",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e0e303e5-bcda-4865-999c-ec4004f1ce80",
      "version": "25",
      "structure": {
        "id": "59fdd65e-1e78-40fb-8998-2dbbf41c9b4b",
        "molfile": "\n  Marvin  01132104402D          \n\n 13 12  0  0  1  0            999 V2000\n    1.9691   -3.6630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6835   -3.2505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3980   -3.6630    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.3980   -4.4880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1125   -3.2505    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.1125   -2.4255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8269   -3.6630    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.8269   -4.4880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5414   -3.2505    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.5414   -2.4255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2558   -3.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9703   -3.2505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6835   -2.4255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  6  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n  2 13  2  0  0  0  0\nM  END",
        "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O)O)O)O",
        "formula": "C6H10O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "194.1397",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "6ee88fe5-da8c-4099-b9bf-28dc6af6fd39",
          "6078a84d-f295-4342-bf90-96e5667464c4"
        ],
        "stereo_centers": 4
      },
      "unii": "8A5D83Q4RW"
    }
  ]
}