{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d4483c2d-583f-4965-a2c8-0a22bdfc693f",
          "code": "3549-23-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3549-23-3",
          "code_system": "CAS",
          "references": [
            "d6681c90-1036-488d-a81b-edf233c0e3ce",
            "8281e5ef-1beb-43b4-9f89-c3d940ce1805"
          ]
        },
        {
          "uuid": "9e0ede1e-e792-49c4-9ae1-55e3c9f6a72e",
          "code": "21 CFR 172.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "d6681c90-1036-488d-a81b-edf233c0e3ce"
          ]
        },
        {
          "uuid": "20d784ac-1dee-41ae-a644-ddee9928930b",
          "code": "222-602-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.548",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d6681c90-1036-488d-a81b-edf233c0e3ce"
          ]
        },
        {
          "uuid": "42d20cce-f1e7-4b6d-aa1b-d812daec0d71",
          "code": "605629",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/605629",
          "code_system": "PUBCHEM",
          "references": [
            "d6681c90-1036-488d-a81b-edf233c0e3ce"
          ]
        },
        {
          "uuid": "f451033d-59f9-c3a6-6904-a3219671f8f1",
          "code": "DTXSID0063070",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0063070",
          "code_system": "EPA CompTox",
          "references": [
            "2226b7fb-032b-7ac4-14eb-aab5c3dc42f5"
          ]
        },
        {
          "uuid": "3f45ebce-9ec8-4378-803c-53aa4e1b552c",
          "code": "8A4H5QO9OJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "137fd0da-3d57-8f0a-3fcf-4bbf8657b5c1",
          "code": "100000174533",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "317af868-37b8-094e-1c5b-cf89126ba964"
          ]
        },
        {
          "uuid": "38502365-fd8a-8a5a-0ca6-4d18773681bc",
          "code": "958",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/958/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "46b78c8d-3eba-921d-c17f-4a95cd57f1fb"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3113d9a7-6411-4e8e-b965-bbc38a267274",
          "name": "(4-TERT-BUTYLPHENYL)ACETIC ACID METHYL ESTER",
          "stdName": "(4-TERT-BUTYLPHENYL)ACETIC ACID METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c1d898e-37ff-474f-a824-78886e9b04ad",
            "b873080e-e0f3-4ae1-b845-9c251b31bb67"
          ],
          "display_name": false
        },
        {
          "uuid": "842a8a06-cf2a-4648-af92-2896ea5e7b56",
          "name": "ACETIC ACID, (P-TERT-BUTYLPHENYL)-, METHYL ESTER",
          "stdName": "ACETIC ACID, (P-TERT-BUTYLPHENYL)-, METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c1d898e-37ff-474f-a824-78886e9b04ad",
            "b873080e-e0f3-4ae1-b845-9c251b31bb67"
          ],
          "display_name": false
        },
        {
          "uuid": "1f6daeec-9c52-4d80-ac91-573b5118e65a",
          "name": "BENZENEACETIC ACID, 4-(1,1-DIMETHYLETHYL)-, METHYL ESTER",
          "stdName": "BENZENEACETIC ACID, 4-(1,1-DIMETHYLETHYL)-, METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c1d898e-37ff-474f-a824-78886e9b04ad",
            "b873080e-e0f3-4ae1-b845-9c251b31bb67"
          ],
          "display_name": false
        },
        {
          "uuid": "6ac32f15-5fb9-4f16-9f34-65ec7c15e623",
          "name": "FEMA NO. 2690",
          "stdName": "FEMA NO. 2690",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e889c57d-d184-4ed1-a3a8-a96733f4b6de",
            "b873080e-e0f3-4ae1-b845-9c251b31bb67"
          ],
          "display_name": false
        },
        {
          "uuid": "430f1bc8-2d80-41fc-8c0b-b71f284f35c8",
          "name": "METHYL 4-TERT-BUTYLBENZENEACETATE",
          "stdName": "METHYL 4-TERT-BUTYLBENZENEACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c1d898e-37ff-474f-a824-78886e9b04ad",
            "b873080e-e0f3-4ae1-b845-9c251b31bb67"
          ],
          "display_name": false
        },
        {
          "uuid": "89049ba9-c33c-43f8-afa6-d5d88cad11f8",
          "name": "METHYL 4-TERT-BUTYLPHENYLACETATE",
          "stdName": "METHYL 4-TERT-BUTYLPHENYLACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c1d898e-37ff-474f-a824-78886e9b04ad",
            "b873080e-e0f3-4ae1-b845-9c251b31bb67"
          ],
          "display_name": false
        },
        {
          "uuid": "580e66ae-c089-46ec-9b64-6da5e13cf0e1",
          "name": "METHYL P-TERT-BUTYLPHENYLACETATE",
          "stdName": "METHYL P-TERT-BUTYLPHENYLACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83175307-675d-42e7-84f8-f4fbb401efae",
            "e889c57d-d184-4ed1-a3a8-a96733f4b6de",
            "b873080e-e0f3-4ae1-b845-9c251b31bb67",
            "56710043-3fca-471a-bdab-bee8b4ee94ec"
          ],
          "display_name": true
        },
        {
          "uuid": "466bea40-25d3-4379-81db-2b295469232f",
          "name": "METHYL P-TERT-BUTYLPHENYLACETATE [FHFI]",
          "stdName": "METHYL P-TERT-BUTYLPHENYLACETATE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b873080e-e0f3-4ae1-b845-9c251b31bb67",
            "56710043-3fca-471a-bdab-bee8b4ee94ec"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e889c57d-d184-4ed1-a3a8-a96733f4b6de",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b873080e-e0f3-4ae1-b845-9c251b31bb67",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c1d898e-37ff-474f-a824-78886e9b04ad",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56710043-3fca-471a-bdab-bee8b4ee94ec",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6681c90-1036-488d-a81b-edf233c0e3ce",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391044000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e2e7175-ab7d-46dc-947d-8a7915633649",
          "citation": "SRS import [8A4H5QO9OJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8A4H5QO9OJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391044000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83175307-675d-42e7-84f8-f4fbb401efae",
          "citation": "METHYL P-TERT-BUTYLPHENYLACETATE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2226b7fb-032b-7ac4-14eb-aab5c3dc42f5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3549-23-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "317af868-37b8-094e-1c5b-cf89126ba964",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "8281e5ef-1beb-43b4-9f89-c3d940ce1805",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "46b78c8d-3eba-921d-c17f-4a95cd57f1fb",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "867f4b02-a108-47b9-a546-fe1f615f1dae",
          "id": "867f4b02-a108-47b9-a546-fe1f615f1dae",
          "molfile": "\n  Marvin  01132106592D          \n\n 15 15  0  0  0  0            999 V2000\n    9.6803   -1.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8531   -1.2789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4428   -1.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6178   -1.9844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8531   -2.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6803   -2.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0905   -3.3955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9176   -3.3955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3236   -2.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9176   -1.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0905   -1.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1530   -2.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1530   -3.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1530   -1.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9822   -2.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 11  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 12  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1ccc(cc1)CC(=O)OC",
          "formula": "C13H18O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9eb64343-bb96-4e68-a535-45dcdbfaf20f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "206.2813",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "044dcd6e-5e80-4270-a6f4-c50fabe0f70b",
      "version": "6",
      "structure": {
        "id": "a4951015-b444-47cd-b338-30998bd351f5",
        "molfile": "\n  Marvin  01132108332D          \n\n 15 15  0  0  0  0            999 V2000\n    9.6803   -1.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6178   -1.9844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8531   -1.2789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4428   -1.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8531   -2.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6803   -2.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0905   -3.3955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0905   -1.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1530   -3.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1530   -1.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9822   -2.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9176   -3.3955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9176   -1.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1530   -2.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3236   -2.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  7  6  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  8  6  1  0  0  0  0\n 12  7  1  0  0  0  0\n 13  8  2  0  0  0  0\n 14  9  1  0  0  0  0\n 14 10  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 12  2  0  0  0  0\n 15 13  1  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1ccc(cc1)CC(=O)OC",
        "formula": "C13H18O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "206.2813",
        "optical_activity": "NONE",
        "references": [
          "3e2e7175-ab7d-46dc-947d-8a7915633649",
          "0c1d898e-37ff-474f-a824-78886e9b04ad"
        ],
        "stereo_centers": 0
      },
      "unii": "8A4H5QO9OJ"
    }
  ]
}