{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "91865c93-d9ae-4622-b606-1e7a25bc313e", "code": "67801-44-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=67801-44-9", "code_system": "CAS", "references": [ "22af3e71-b361-4cda-9f8b-d10542121e6a", "8fe17500-5896-4d23-ab97-cc30cea9e101" ] }, { "uuid": "d2e9eace-c836-465c-aa71-a2a1b7bd00a7", "code": "267-165-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.061.041", "code_system": "ECHA (EC/EINECS)", "references": [ "22af3e71-b361-4cda-9f8b-d10542121e6a" ] }, { "uuid": "f3dadc4a-db90-4839-b6ea-b261279fa0c0", "code": "8A36T93BX4", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "8fe17500-5896-4d23-ab97-cc30cea9e101" ] }, { "uuid": "1127d9b4-c4dd-83b9-3e02-70625bd4d5c3", "code": "DTXSID4070619", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4070619", "code_system": "EPA CompTox", "references": [ "2e5ef435-27db-0ba0-f3f1-dd9acb43d8dd" ] }, { "uuid": "b3042ecb-fc88-9521-55ff-3f9e9d769f46", "code": "105651", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/105651", "code_system": "PUBCHEM", "references": [ "d8029a57-10d0-1de5-60ba-75292e61753f" ] } ], "substance_class": "chemical", "names": [ { "uuid": "d5955dbc-4e6b-42ba-9b5b-804633c492e1", "name": "BENZOIC ACID, 2-(OCTYLIDENEAMINO)-, METHYL ESTER", "stdName": "BENZOIC ACID, 2-(OCTYLIDENEAMINO)-, METHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ecade659-8488-40e7-80cc-171e6fb36c10" ], "display_name": false }, { "uuid": "7613f5ab-a90d-4870-af52-a01ff2b6dca0", "name": "Methyl 2-(octylideneamino)benzoate", "stdName": "METHYL 2-(OCTYLIDENEAMINO)BENZOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8fe17500-5896-4d23-ab97-cc30cea9e101" ], "display_name": true }, { "uuid": "2f9be132-e1fd-4afa-b84e-9990a3936a70", "name": "OCMEA", "stdName": "OCMEA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8fe17500-5896-4d23-ab97-cc30cea9e101" ], "display_name": false } ], "references": [ { "uuid": "ecade659-8488-40e7-80cc-171e6fb36c10", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "22af3e71-b361-4cda-9f8b-d10542121e6a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392085000, "tags": [ "NOMEN" ] }, { "uuid": "d0647dd9-b5a5-f48c-ac1c-d66818684e53", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=67801-44-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8fe17500-5896-4d23-ab97-cc30cea9e101", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d8029a57-10d0-1de5-60ba-75292e61753f", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "2e5ef435-27db-0ba0-f3f1-dd9acb43d8dd", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4e20c8f9-f181-427b-8238-90f066bb43e1", "id": "4e20c8f9-f181-427b-8238-90f066bb43e1", "molfile": "\n Marvin 03222315482D \n\n 19 19 0 0 0 0 999 V2000\n 2.1434 2.0625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7158 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4303 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1447 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8592 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 3.7126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 3 0 0 0\n 1 14 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 2 0 0 0 0\n 10 15 1 0 0 0 0\n 11 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 16 18 2 0 0 0 0\n 17 19 2 0 0 0 0\n 18 19 1 0 0 0 0\nM END", "smiles": "CCCCCCCC=Nc1ccccc1C(=O)OC", "formula": "C16H23NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "419535be-c391-4d1e-85d8-1b267d416122" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "261.3599", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "b83859a7-7657-40f5-82dc-54620c157bd1", "version": "8", "structure": { "id": "87ee13a7-3d8b-4e7a-abda-813954e61841", "molfile": "Methyl 2-(octylideneamino)benzoate\n JSDraw203222315482D\n\n 19 19 0 0 0 0 0 V2000\n 21.1664 -7.3060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5175 -6.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8685 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2195 -6.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5704 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9216 -6.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2725 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6235 -6.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9745 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4645 -8.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1135 -9.6461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8154 -9.6461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1135 -11.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8154 -6.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4645 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8154 -4.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1135 -6.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4645 -4.1859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1135 -4.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 3 0 0 0\n 1 14 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 2 0 0 0 0\n 10 15 1 0 0 0 0\n 11 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 16 18 2 0 0 0 0\n 17 19 2 0 0 0 0\n 18 19 1 0 0 0 0\nM END", "smiles": "CCCCCCCC=Nc1ccccc1C(=O)OC", "formula": "C16H23NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "261.3599", "optical_activity": "NONE", "references": [ "ecade659-8488-40e7-80cc-171e6fb36c10", "8fe17500-5896-4d23-ab97-cc30cea9e101" ], "stereo_centers": 0 }, "unii": "8A36T93BX4" } ] }