{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ab18cb99-372f-4025-be0c-d4498f5d88c1", "code": "476332-65-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=476332-65-7", "code_system": "CAS", "references": [ "51142c91-8737-4a2e-9d74-f0f8cad105ff", "5421421e-de54-45d0-a4c9-9340f941f882" ] }, { "uuid": "85b2a2a4-b77d-4e62-aee0-62affbfd79aa", "code": "92030006", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92030006", "code_system": "PUBCHEM", "references": [ "51142c91-8737-4a2e-9d74-f0f8cad105ff" ] }, { "uuid": "0347500b-0c95-6c45-b4bd-78a1a21af23a", "code": "DTXSID9051379", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9051379", "code_system": "EPA CompTox", "references": [ "c9c700a6-3f0b-e232-0a59-2f597d42e68b" ] }, { "uuid": "f79120f2-4380-4ad1-a361-071e20006b8b", "code": "89ZYZ7YI66", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "bf5aefe1-ea0f-ed63-b610-1ddd5cdc694e", "code": "2557364", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2557364/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "bbfb5cbf-52c8-e48a-7e22-340b4a51b3ff" ] }, { "uuid": "fa2db8e6-5a25-d506-08e9-8b89f7d5bbe9", "code": "89ZYZ7YI66", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=89ZYZ7YI66", "code_system": "DAILYMED", "references": [ "109fc4a9-4378-dc43-1207-18f68ab7b4be" ] } ], "substance_class": "chemical", "names": [ { "uuid": "52461fc9-e581-47a5-afbe-46d23d7fc96f", "name": "2H-INDENO(4,5-B)FURAN, DECAHYDRO-2,2,6,6,7,8,8-HEPTAMETHYL-", "stdName": "2H-INDENO(4,5-B)FURAN, DECAHYDRO-2,2,6,6,7,8,8-HEPTAMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "da9997c0-4b6b-4e48-96f4-58f612dfad85" ], "display_name": false }, { "uuid": "f4ee3c77-c01f-4e41-8365-6e04cefb52f9", "name": "DECAHYDRO-2,2,6,6,7,8,8-HEPTAMETHYL-2H-INDENO(4,5-B)FURAN", "stdName": "DECAHYDRO-2,2,6,6,7,8,8-HEPTAMETHYL-2H-INDENO(4,5-B)FURAN", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6d84b024-cd52-4ccf-b2fb-a418d5702bf3" ], "display_name": true } ], "references": [ { "uuid": "da9997c0-4b6b-4e48-96f4-58f612dfad85", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "6d84b024-cd52-4ccf-b2fb-a418d5702bf3", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "51142c91-8737-4a2e-9d74-f0f8cad105ff", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392263000, "tags": [ "NOMEN" ] }, { "uuid": "ff1136b1-c862-40ac-8192-f45336ade9f4", "citation": "SRS import [89ZYZ7YI66]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=89ZYZ7YI66", "doc_type": "SRS", "public_domain": true, "document_date": 1493392263000, "tags": [ "NOMEN" ] }, { "uuid": "c9c700a6-3f0b-e232-0a59-2f597d42e68b", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=476332-65-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bbfb5cbf-52c8-e48a-7e22-340b4a51b3ff", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "109fc4a9-4378-dc43-1207-18f68ab7b4be", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "5421421e-de54-45d0-a4c9-9340f941f882", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "901491cd-d7ea-42df-aba7-ef902e494bce", "id": "901491cd-d7ea-42df-aba7-ef902e494bce", "molfile": "\n Marvin 01132107282D \n\n 19 21 0 0 0 0 999 V2000\n 0.0000 -2.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8266 -2.5302 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 1.3062 -3.2107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6393 -3.6903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5575 -3.9871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0963 -2.9413 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.8043 -3.3568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5212 -2.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5212 -2.1237 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.1379 -1.5757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8090 -0.8175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5671 -0.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7177 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9824 -0.9043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8134 -1.7127 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.0963 -2.1237 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 1.3153 -1.8634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6485 -1.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5666 -1.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 17 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 3 1 0 0 0 0\n 6 3 1 0 0 0 0\n 6 7 1 0 0 0 0\n 16 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 15 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 11 1 0 0 0 0\n 14 11 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 17 1 0 0 0 0\nM END", "smiles": "CC1C(C)(C)C2CCC3CC(C)(C)OC3C2C1(C)C", "formula": "C18H32O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "41a1a047-ff6a-45e8-b569-b6745ee18510" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "264.4468", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "COMPLETE", "uuid": "d020728a-9208-4ff0-a2c6-d336f6f2846a", "version": "6", "structure": { "id": "8a404418-8ffc-4451-bb64-97b712b9d3e1", "molfile": "\n Marvin 01132107112D \n\n 19 21 0 0 0 0 999 V2000\n 0.6393 -3.6903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5575 -3.9871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6485 -1.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5666 -1.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5671 -0.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7177 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9824 -0.9043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8134 -1.7127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8090 -0.8175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5212 -2.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1379 -1.5757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0963 -2.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0963 -2.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5212 -2.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8043 -3.3568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3153 -1.8634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8266 -2.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3062 -3.2107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 19 1 0 0 0 0\n 2 19 1 0 0 0 0\n 3 18 1 0 0 0 0\n 4 17 1 0 0 0 0\n 5 17 1 0 0 0 0\n 6 10 1 0 0 0 0\n 7 10 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 9 13 1 0 0 0 0\n 10 12 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 15 1 0 0 0 0\n 13 17 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 16 1 0 0 0 0\n 14 19 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\nM END", "smiles": "CC1C(C)(C)C2CCC3CC(C)(C)OC3C2C1(C)C", "formula": "C18H32O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "264.4468", "optical_activity": "UNSPECIFIED", "references": [ "da9997c0-4b6b-4e48-96f4-58f612dfad85", "ff1136b1-c862-40ac-8192-f45336ade9f4" ], "stereo_centers": 5 }, "unii": "89ZYZ7YI66" } ] }